diff --git a/.circleci/config.yml b/.circleci/config.yml new file mode 100644 index 0000000..9054356 --- /dev/null +++ b/.circleci/config.yml @@ -0,0 +1,29 @@ +jobs: + build: + docker: + - image: hashicorp/terraform:0.11.11 + environment: + TERRAFORM_VERSION: v0.11 + steps: + - checkout + - run: + command: terraform init + test: + docker: + - image: hashicorp/terraform:0.11.11 + steps: + - checkout + - run: + command: | + terraform fmt -check=true + terraform validate + go test -v ./... +version: 2 +workflows: + build-test: + jobs: + - build + - test: + requires: + - build + version: 2 diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..a893580 --- /dev/null +++ b/.gitignore @@ -0,0 +1,26 @@ +# Local .terraform directories +**/.terraform/* + +# .tfstate files +*.tfstate +*.tfstate.* + +# Crash log files +crash.log + +# Ignore any .tfvars files that are generated automatically for each Terraform run. Most +# .tfvars files are managed as part of configuration and so should be included in +# version control. +# +# example.tfvars + +# Ignore override files as they are usually used to override resources locally and so +# are not checked in +override.tf +override.tf.json +*_override.tf +*_override.tf.json + +# Include override files you do wish to add to version control using negated pattern +# +# !example_override.tf diff --git a/Gopkg.lock b/Gopkg.lock new file mode 100644 index 0000000..53fe8ea --- /dev/null +++ b/Gopkg.lock @@ -0,0 +1,86 @@ +# This file is autogenerated, do not edit; changes may be undone by the next 'dep ensure'. + + +[[projects]] + digest = "1:ffe9824d294da03b391f44e1ae8281281b4afc1bdaa9588c9097785e3af10cec" + name = "github.com/davecgh/go-spew" + packages = ["spew"] + pruneopts = "UT" + revision = "8991bc29aa16c548c550c7ff78260e27b9ab7c73" + version = "v1.1.1" + +[[projects]] + digest = "1:a0b4db50b9b3180ecdee4a24e8cf1765533f5b3f14f1ce97f23ec472e5d490de" + name = "github.com/gruntwork-io/terratest" + packages = [ + "modules/collections", + "modules/customerrors", + "modules/files", + "modules/logger", + "modules/retry", + "modules/shell", + "modules/ssh", + "modules/terraform", + ] + pruneopts = "UT" + revision = "14a766db13787cf19cab4703d9415481930854b1" + version = "v0.14.2" + +[[projects]] + digest = "1:0028cb19b2e4c3112225cd871870f2d9cf49b9b4276531f03438a88e94be86fe" + name = "github.com/pmezard/go-difflib" + packages = ["difflib"] + pruneopts = "UT" + revision = "792786c7400a136282c1664665ae0a8db921c6c2" + version = "v1.0.0" + +[[projects]] + digest = "1:972c2427413d41a1e06ca4897e8528e5a1622894050e2f527b38ddf0f343f759" + name = "github.com/stretchr/testify" + packages = ["assert"] + pruneopts = "UT" + revision = "ffdc059bfe9ce6a4e144ba849dbedead332c6053" + version = "v1.3.0" + +[[projects]] + branch = "master" + digest = "1:fe4ea207179d7d9eeaebf545b47b750e39ba7590f01bb8d966342b4f821f26d7" + name = "golang.org/x/crypto" + packages = [ + "curve25519", + "ed25519", + "ed25519/internal/edwards25519", + "internal/chacha20", + "internal/subtle", + "poly1305", + "ssh", + "ssh/agent", + ] + pruneopts = "UT" + revision = "8dd112bcdc25174059e45e07517d9fc663123347" + +[[projects]] + branch = "master" + digest = "1:76ee51c3f468493aff39dbacc401e8831fbb765104cbf613b89bef01cf4bad70" + name = "golang.org/x/net" + packages = ["context"] + pruneopts = "UT" + revision = "16b79f2e4e95ea23b2bf9903c9809ff7b013ce85" + +[[projects]] + branch = "master" + digest = "1:f05f63172c98e8e485809dde9cd75921846e08ea8c35bb8bc63040384d9f3c6d" + name = "golang.org/x/sys" + packages = ["cpu"] + pruneopts = "UT" + revision = "3e9a981b8ddba4cb37815d4ebf2171df73c5255b" + +[solve-meta] + analyzer-name = "dep" + analyzer-version = 1 + input-imports = [ + "github.com/gruntwork-io/terratest/modules/terraform", + "github.com/stretchr/testify/assert", + ] + solver-name = "gps-cdcl" + solver-version = 1 diff --git a/Gopkg.toml b/Gopkg.toml new file mode 100644 index 0000000..188fed8 --- /dev/null +++ b/Gopkg.toml @@ -0,0 +1,38 @@ +# Gopkg.toml example +# +# Refer to https://golang.github.io/dep/docs/Gopkg.toml.html +# for detailed Gopkg.toml documentation. +# +# required = ["github.com/user/thing/cmd/thing"] +# ignored = ["github.com/user/project/pkgX", "bitbucket.org/user/project/pkgA/pkgY"] +# +# [[constraint]] +# name = "github.com/user/project" +# version = "1.0.0" +# +# [[constraint]] +# name = "github.com/user/project2" +# branch = "dev" +# source = "github.com/myfork/project2" +# +# [[override]] +# name = "github.com/x/y" +# version = "2.4.0" +# +# [prune] +# non-go = false +# go-tests = true +# unused-packages = true + + +[[constraint]] + name = "github.com/gruntwork-io/terratest" + version = "0.14.2" + +[[constraint]] + name = "github.com/stretchr/testify" + version = "1.3.0" + +[prune] + go-tests = true + unused-packages = true diff --git a/main.tf b/main.tf new file mode 100644 index 0000000..8f735c3 --- /dev/null +++ b/main.tf @@ -0,0 +1,145 @@ +locals { + command = "${jsonencode(var.command)}" + dnsSearchDomains = "${jsonencode(var.dnsSearchDomains)}" + dnsServers = "${jsonencode(var.dnsServers)}" + dockerLabels = "${jsonencode(var.dockerLabels)}" + dockerSecurityOptions = "${jsonencode(var.dockerSecurityOptions)}" + entryPoint = "${jsonencode(var.entryPoint)}" + environment = "${jsonencode(var.environment)}" + extraHosts = "${jsonencode(var.extraHosts)}" + + healthCheck = "${ + replace( + jsonencode(var.healthCheck), + local.classes["digit"], + "$1" + ) + }" + + links = "${jsonencode(var.links)}" + + linuxParameters = "${ + replace( + replace( + replace( + jsonencode(var.linuxParameters), + "/\"1\"/", + "true" + ), + "/\"0\"/", + "false" + ), + local.classes["digit"], + "$1" + ) + }" + + logConfiguration = "${jsonencode(var.logConfiguration)}" + + mountPoints = "${ + replace( + replace( + jsonencode(var.mountPoints), + "/\"1\"/", + "true" + ), + "/\"0\"/", + "false" + ) + }" + + portMappings = "${ + replace( + jsonencode(var.portMappings), + local.classes["digit"], + "$1" + ) + }" + + repositoryCredentials = "${jsonencode(var.repositoryCredentials)}" + resourceRequirements = "${jsonencode(var.resourceRequirements)}" + secrets = "${jsonencode(var.secrets)}" + systemControls = "${jsonencode(var.systemControls)}" + + ulimits = "${ + replace( + jsonencode(var.ulimits), + local.classes["digit"], + "$1" + ) + }" + + volumesFrom = "${ + replace( + replace( + jsonencode(var.volumesFrom), + "/\"1\"/", + "true" + ), + "/\"0\"/", + "false" + ) + }" + + # re2 ASCII character classes + # https://github.com/google/re2/wiki/Syntax + classes = { + digit = "/\"([[:digit:]]+)\"/" + } + + container_definitions = "${replace(data.template_file.container_definitions.rendered, "/\"(null)\"/", "$1")}" +} + +data "template_file" "container_definitions" { + template = "${file("${path.module}/templates/container-definitions.json.tmpl")}" + + vars = { + command = "${local.command == "[]" ? "null" : local.command}" + cpu = "${var.cpu == 0 ? "null" : var.cpu}" + disableNetworking = "${var.disableNetworking ? true : false}" + dnsSearchDomains = "${local.dnsSearchDomains == "[]" ? "null" : local.dnsSearchDomains}" + dnsServers = "${local.dnsServers == "[]" ? "null" : local.dnsServers}" + dockerLabels = "${local.dockerLabels == "{}" ? "null" : local.dockerLabels}" + dockerSecurityOptions = "${local.dockerSecurityOptions == "[]" ? "null" : local.dockerSecurityOptions}" + entryPoint = "${local.entryPoint == "[]" ? "null" : local.entryPoint}" + environment = "${local.environment == "[]" ? "null" : local.environment}" + essential = "${var.essential ? true : false}" + extraHosts = "${local.extraHosts == "[]" ? "null" : local.extraHosts}" + healthCheck = "${local.healthCheck == "{}" ? "null" : local.healthCheck}" + hostname = "${var.hostname == "" ? "null" : var.hostname}" + image = "${var.image == "" ? "null" : var.image}" + interactive = "${var.interactive ? true : false}" + links = "${local.links == "[]" ? "null" : local.links}" + linuxParameters = "${local.linuxParameters == "{}" ? "null" : local.linuxParameters}" + logConfiguration = "${local.logConfiguration == "{}" ? "null" : local.logConfiguration}" + memory = "${var.memory == 0 ? "null" : var.memory}" + memoryReservation = "${var.memoryReservation == 0 ? "null" : var.memoryReservation}" + mountPoints = "${local.mountPoints == "[]" ? "null" : local.mountPoints}" + name = "${var.name == "" ? "null" : var.name}" + portMappings = "${local.portMappings == "[]" ? "null" : local.portMappings}" + privileged = "${var.privileged ? true : false}" + pseudoTerminal = "${var.pseudoTerminal ? true : false}" + readonlyRootFilesystem = "${var.readonlyRootFilesystem ? true : false}" + repositoryCredentials = "${local.repositoryCredentials == "{}" ? "null" : local.repositoryCredentials}" + resourceRequirements = "${local.resourceRequirements == "[]" ? "null" : local.resourceRequirements}" + secrets = "${local.secrets == "[]" ? "null" : local.secrets}" + systemControls = "${local.systemControls == "[]" ? "null" : local.systemControls}" + ulimits = "${local.ulimits == "[]" ? "null" : local.ulimits}" + user = "${var.user == "" ? "null" : var.user}" + volumesFrom = "${local.volumesFrom == "[]" ? "null" : local.volumesFrom}" + workingDirectory = "${var.workingDirectory == "" ? "null" : var.workingDirectory}" + } +} + +resource "aws_ecs_task_definition" "ecs_task_definition" { + container_definitions = "${local.container_definitions}" + execution_role_arn = "${var.execution_role_arn}" + family = "${var.family}" + ipc_mode = "${var.ipc_mode}" + network_mode = "${var.network_mode}" + pid_mode = "${var.pid_mode}" + placement_constraints = "${var.placement_constraints}" + requires_compatibilities = "${var.requires_compatibilities}" + task_role_arn = "${var.task_role_arn}" + volume = "${var.volumes}" +} diff --git a/outputs.tf b/outputs.tf new file mode 100644 index 0000000..124811b --- /dev/null +++ b/outputs.tf @@ -0,0 +1,4 @@ +output "container_definitions" { + description = "A list of container definitions in JSON format that describe the different containers that make up your task" + value = "${local.container_definitions}" +} diff --git a/templates/container-definitions.json.tmpl b/templates/container-definitions.json.tmpl new file mode 100644 index 0000000..de6e79d --- /dev/null +++ b/templates/container-definitions.json.tmpl @@ -0,0 +1,38 @@ +[ + { + "command": ${command}, + "cpu": ${cpu}, + "disableNetworking": ${disableNetworking}, + "dnsSearchDomains": ${dnsSearchDomains}, + "dnsServers": ${dnsServers}, + "dockerLabels": ${dockerLabels}, + "dockerSecurityOptions": ${dockerSecurityOptions}, + "entryPoint": ${entryPoint}, + "environment": ${environment}, + "essential": ${essential}, + "extraHosts": ${extraHosts}, + "healthCheck": ${healthCheck}, + "hostname": "${hostname}", + "image": "${image}", + "interactive": ${interactive}, + "links": ${links}, + "linuxParameters": ${linuxParameters}, + "logConfiguration": ${logConfiguration}, + "memory": ${memory}, + "memoryReservation": ${memoryReservation}, + "mountPoints": ${mountPoints}, + "name": "${name}", + "portMappings": ${portMappings}, + "privileged": ${privileged}, + "pseudoTerminal": ${pseudoTerminal}, + "readonlyRootFilesystem": ${readonlyRootFilesystem}, + "repositoryCredentials": ${repositoryCredentials}, + "resourceRequirements": ${resourceRequirements}, + "secrets": ${secrets}, + "systemControls": ${systemControls}, + "ulimits": ${ulimits}, + "user": "${user}", + "volumesFrom": ${volumesFrom}, + "workingDirectory": "${workingDirectory}" + } +] diff --git a/test/ecs_task_definition_test.go b/test/ecs_task_definition_test.go new file mode 100644 index 0000000..a3633f5 --- /dev/null +++ b/test/ecs_task_definition_test.go @@ -0,0 +1,60 @@ +package test + +import ( + "testing" + + "github.com/gruntwork-io/terratest/modules/terraform" + "github.com/stretchr/testify/assert" +) + +func TestContainerDefinitionsOutput(t *testing.T) { + t.Parallel() + options := &terraform.Options{ + NoColor: true, + TerraformDir: "..", + VarFiles: []string{"varfile.tfvars"}, + } + defer terraform.Destroy(t, options) + terraform.InitAndApply(t, options) + expected := + `[ + { + "command": null, + "cpu": null, + "disableNetworking": false, + "dnsSearchDomains": null, + "dnsServers": null, + "dockerLabels": null, + "dockerSecurityOptions": null, + "entryPoint": null, + "environment": [{"name":"AWS_DEFAULT_REGION","value":"us-east-1"}], + "essential": true, + "extraHosts": null, + "healthCheck": {"command":["echo"],"interval":30,"retries":3,"startPeriod":0,"timeout":5}, + "hostname": null, + "image": "mongo:3.6", + "interactive": false, + "links": null, + "linuxParameters": {"capabilities":{"add":["AUDIT_CONTROL","AUDIT_WRITE"],"drop":["SYS_RAWIO","SYS_TIME"]},"devices":[{"containerPath":"/dev/disk0","hostPath":"/dev/disk0","permissions":["read"]}],"initProcessEnabled":true,"sharedMemorySize":512,"tmpfs":[{"containerPath":"/tmp","mountOptions":["defaults"],"size":512}]}, + "logConfiguration": null, + "memory": null, + "memoryReservation": 512, + "mountPoints": [{"containerPath":"/dev/disk0","readOnly":true,"sourceVolume":"data"}], + "name": "mongo", + "portMappings": [{"containerPort":8080,"hostPort":0,"protocol":"tcp"}], + "privileged": false, + "pseudoTerminal": false, + "readonlyRootFilesystem": false, + "repositoryCredentials": null, + "resourceRequirements": null, + "secrets": null, + "systemControls": null, + "ulimits": [{"hardLimit":1024,"name":"cpu","softLimit":1024}], + "user": "root", + "volumesFrom": null, + "workingDirectory": "~/project" + } +]` + actual := terraform.Output(t, options, "container_definitions") + assert.Equal(t, expected, actual) +} diff --git a/varfile.tfvars b/varfile.tfvars new file mode 100644 index 0000000..c1cee84 --- /dev/null +++ b/varfile.tfvars @@ -0,0 +1,82 @@ +environment = [ + { + name = "AWS_DEFAULT_REGION" + value = "us-east-1" + }, +] + +family = "default" + +healthCheck = { + command = ["echo"] + interval = 30 + retries = 3 + startPeriod = 0 + timeout = 5 +} + +image = "mongo:3.6" + +linuxParameters = { + capabilities = { + add = ["AUDIT_CONTROL", "AUDIT_WRITE"] + drop = ["SYS_RAWIO", "SYS_TIME"] + } + + devices = [ + { + containerPath = "/dev/disk0" + hostPath = "/dev/disk0" + permissions = ["read"] + }, + ] + + initProcessEnabled = true + sharedMemorySize = 512 + + tmpfs = [ + { + containerPath = "/tmp" + mountOptions = ["defaults"] + size = 512 + }, + ] +} + +memoryReservation = 512 + +mountPoints = [ + { + containerPath = "/dev/disk0" + readOnly = true + sourceVolume = "data" + }, +] + +name = "mongo" + +portMappings = [ + { + containerPort = 8080 + hostPort = 0 + protocol = "tcp" + }, +] + +ulimits = [ + { + hardLimit = 1024 + name = "cpu" + softLimit = 1024 + }, +] + +user = "root" + +volumes = [ + { + name = "data" + }, +] + +workingDirectory = "~/project" diff --git a/variables.tf b/variables.tf new file mode 100644 index 0000000..71d26fd --- /dev/null +++ b/variables.tf @@ -0,0 +1,245 @@ +# Container definitions are used in task definitions to describe the different containers that are launched as part of a task. +# https://docs.aws.amazon.com/AmazonECS/latest/APIReference/API_ContainerDefinition.html + +variable "command" { + default = [] + description = "The command that is passed to the container" + type = "list" +} + +variable "cpu" { + default = 0 + description = "The number of cpu units reserved for the container" +} + +variable "disableNetworking" { + default = false + description = "When this parameter is true, networking is disabled within the container" +} + +variable "dnsSearchDomains" { + default = [] + description = "A list of DNS search domains that are presented to the container" + type = "list" +} + +variable "dnsServers" { + default = [] + description = "A list of DNS servers that are presented to the container" + type = "list" +} + +variable "dockerLabels" { + default = {} + description = "A key/value map of labels to add to the container" + type = "map" +} + +variable "dockerSecurityOptions" { + default = [] + description = "A list of strings to provide custom labels for SELinux and AppArmor multi-level security systems" + type = "list" +} + +variable "entryPoint" { + default = [] + description = "The entry point that is passed to the container" + type = "list" +} + +variable "environment" { + default = [] + description = "The environment variables to pass to a container" + type = "list" +} + +variable "essential" { + default = true + description = "If the essential parameter of a container is marked as true, and that container fails or stops for any reason, all other containers that are part of the task are stopped" +} + +variable "execution_role_arn" { + default = "" + description = "The Amazon Resource Name (ARN) of the task execution role that the Amazon ECS container agent and the Docker daemon can assume" +} + +variable "extraHosts" { + default = [] + description = "A list of hostnames and IP address mappings to append to the /etc/hosts file on the container" + type = "list" +} + +variable "family" { + description = "You must specify a family for a task definition, which allows you to track multiple versions of the same task definition" +} + +variable "healthCheck" { + default = {} + description = "The health check command and associated configuration parameters for the container" + type = "map" +} + +variable "hostname" { + default = "" + description = "The hostname to use for your container" +} + +variable "image" { + default = "" + description = "The image used to start a container" +} + +variable "interactive" { + default = false + description = "When this parameter is true, this allows you to deploy containerized applications that require stdin or a tty to be allocated" +} + +variable "ipc_mode" { + default = "host" + description = "The IPC resource namespace to use for the containers in the task" +} + +variable "links" { + default = [] + description = "The link parameter allows containers to communicate with each other without the need for port mappings" + type = "list" +} + +variable "linuxParameters" { + default = {} + description = "Linux-specific modifications that are applied to the container, such as Linux KernelCapabilities" + type = "map" +} + +variable "logConfiguration" { + default = {} + description = "The log configuration specification for the container" + type = "map" +} + +variable "memory" { + default = 0 + description = "The hard limit (in MiB) of memory to present to the container" +} + +variable "memoryReservation" { + default = 0 + description = "The soft limit (in MiB) of memory to reserve for the container" +} + +variable "mountPoints" { + default = [] + description = "The mount points for data volumes in your container" + type = "list" +} + +variable "name" { + default = "" + description = "The name of a container" +} + +variable "network_mode" { + default = "bridge" + description = "The Docker networking mode to use for the containers in the task" +} + +variable "pid_mode" { + default = "host" + description = "The process namespace to use for the containers in the task" +} + +variable "placement_constraints" { + default = [] + description = "An array of placement constraint objects to use for the task" + type = "list" +} + +variable "portMappings" { + default = [] + description = "The list of port mappings for the container" + type = "list" +} + +variable "privileged" { + default = false + description = "When this parameter is true, the container is given elevated privileges on the host container instance (similar to the root user)" +} + +variable "pseudoTerminal" { + default = false + description = "When this parameter is true, a TTY is allocated" +} + +variable "readonlyRootFilesystem" { + default = false + description = "When this parameter is true, the container is given read-only access to its root file system" +} + +variable "repositoryCredentials" { + default = {} + description = "The private repository authentication credentials to use" + type = "map" +} + +variable "requires_compatibilities" { + default = [] + description = "The launch type required by the task" + type = "list" +} + +variable "resourceRequirements" { + default = [] + description = "The type and amount of a resource to assign to a container" + type = "list" +} + +variable "secrets" { + default = [] + description = "The secrets to pass to the container" + type = "list" +} + +variable "systemControls" { + default = [] + description = "A list of namespaced kernel parameters to set in the container" + type = "list" +} + +variable "tags" { + default = {} + description = "The metadata that you apply to the task definition to help you categorize and organize them" + type = "map" +} + +variable "task_role_arn" { + default = "" + description = "The short name or full Amazon Resource Name (ARN) of the IAM role that containers in this task can assume" +} + +variable "ulimits" { + default = [] + description = "A list of ulimits to set in the container" + type = "list" +} + +variable "user" { + default = "" + description = "The user name to use inside the container" +} + +variable "volumes" { + default = [] + description = "A list of volume definitions in JSON format that containers in your task may use" + type = "list" +} + +variable "volumesFrom" { + default = [] + description = "Data volumes to mount from another container" + type = "list" +} + +variable "workingDirectory" { + default = "" + description = "The working directory in which to run commands inside the container" +} diff --git a/vendor/github.com/davecgh/go-spew/LICENSE b/vendor/github.com/davecgh/go-spew/LICENSE new file mode 100644 index 0000000..bc52e96 --- /dev/null +++ b/vendor/github.com/davecgh/go-spew/LICENSE @@ -0,0 +1,15 @@ +ISC License + +Copyright (c) 2012-2016 Dave Collins + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/vendor/github.com/davecgh/go-spew/spew/bypass.go b/vendor/github.com/davecgh/go-spew/spew/bypass.go new file mode 100644 index 0000000..7929947 --- /dev/null +++ b/vendor/github.com/davecgh/go-spew/spew/bypass.go @@ -0,0 +1,145 @@ +// Copyright (c) 2015-2016 Dave Collins +// +// Permission to use, copy, modify, and distribute this software for any +// purpose with or without fee is hereby granted, provided that the above +// copyright notice and this permission notice appear in all copies. +// +// THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +// WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +// MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +// ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +// WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +// ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +// OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +// NOTE: Due to the following build constraints, this file will only be compiled +// when the code is not running on Google App Engine, compiled by GopherJS, and +// "-tags safe" is not added to the go build command line. The "disableunsafe" +// tag is deprecated and thus should not be used. +// Go versions prior to 1.4 are disabled because they use a different layout +// for interfaces which make the implementation of unsafeReflectValue more complex. +// +build !js,!appengine,!safe,!disableunsafe,go1.4 + +package spew + +import ( + "reflect" + "unsafe" +) + +const ( + // UnsafeDisabled is a build-time constant which specifies whether or + // not access to the unsafe package is available. + UnsafeDisabled = false + + // ptrSize is the size of a pointer on the current arch. + ptrSize = unsafe.Sizeof((*byte)(nil)) +) + +type flag uintptr + +var ( + // flagRO indicates whether the value field of a reflect.Value + // is read-only. + flagRO flag + + // flagAddr indicates whether the address of the reflect.Value's + // value may be taken. + flagAddr flag +) + +// flagKindMask holds the bits that make up the kind +// part of the flags field. In all the supported versions, +// it is in the lower 5 bits. +const flagKindMask = flag(0x1f) + +// Different versions of Go have used different +// bit layouts for the flags type. This table +// records the known combinations. +var okFlags = []struct { + ro, addr flag +}{{ + // From Go 1.4 to 1.5 + ro: 1 << 5, + addr: 1 << 7, +}, { + // Up to Go tip. + ro: 1<<5 | 1<<6, + addr: 1 << 8, +}} + +var flagValOffset = func() uintptr { + field, ok := reflect.TypeOf(reflect.Value{}).FieldByName("flag") + if !ok { + panic("reflect.Value has no flag field") + } + return field.Offset +}() + +// flagField returns a pointer to the flag field of a reflect.Value. +func flagField(v *reflect.Value) *flag { + return (*flag)(unsafe.Pointer(uintptr(unsafe.Pointer(v)) + flagValOffset)) +} + +// unsafeReflectValue converts the passed reflect.Value into a one that bypasses +// the typical safety restrictions preventing access to unaddressable and +// unexported data. It works by digging the raw pointer to the underlying +// value out of the protected value and generating a new unprotected (unsafe) +// reflect.Value to it. +// +// This allows us to check for implementations of the Stringer and error +// interfaces to be used for pretty printing ordinarily unaddressable and +// inaccessible values such as unexported struct fields. +func unsafeReflectValue(v reflect.Value) reflect.Value { + if !v.IsValid() || (v.CanInterface() && v.CanAddr()) { + return v + } + flagFieldPtr := flagField(&v) + *flagFieldPtr &^= flagRO + *flagFieldPtr |= flagAddr + return v +} + +// Sanity checks against future reflect package changes +// to the type or semantics of the Value.flag field. +func init() { + field, ok := reflect.TypeOf(reflect.Value{}).FieldByName("flag") + if !ok { + panic("reflect.Value has no flag field") + } + if field.Type.Kind() != reflect.TypeOf(flag(0)).Kind() { + panic("reflect.Value flag field has changed kind") + } + type t0 int + var t struct { + A t0 + // t0 will have flagEmbedRO set. + t0 + // a will have flagStickyRO set + a t0 + } + vA := reflect.ValueOf(t).FieldByName("A") + va := reflect.ValueOf(t).FieldByName("a") + vt0 := reflect.ValueOf(t).FieldByName("t0") + + // Infer flagRO from the difference between the flags + // for the (otherwise identical) fields in t. + flagPublic := *flagField(&vA) + flagWithRO := *flagField(&va) | *flagField(&vt0) + flagRO = flagPublic ^ flagWithRO + + // Infer flagAddr from the difference between a value + // taken from a pointer and not. + vPtrA := reflect.ValueOf(&t).Elem().FieldByName("A") + flagNoPtr := *flagField(&vA) + flagPtr := *flagField(&vPtrA) + flagAddr = flagNoPtr ^ flagPtr + + // Check that the inferred flags tally with one of the known versions. + for _, f := range okFlags { + if flagRO == f.ro && flagAddr == f.addr { + return + } + } + panic("reflect.Value read-only flag has changed semantics") +} diff --git a/vendor/github.com/davecgh/go-spew/spew/bypasssafe.go b/vendor/github.com/davecgh/go-spew/spew/bypasssafe.go new file mode 100644 index 0000000..205c28d --- /dev/null +++ b/vendor/github.com/davecgh/go-spew/spew/bypasssafe.go @@ -0,0 +1,38 @@ +// Copyright (c) 2015-2016 Dave Collins +// +// Permission to use, copy, modify, and distribute this software for any +// purpose with or without fee is hereby granted, provided that the above +// copyright notice and this permission notice appear in all copies. +// +// THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +// WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +// MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +// ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +// WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +// ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +// OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +// NOTE: Due to the following build constraints, this file will only be compiled +// when the code is running on Google App Engine, compiled by GopherJS, or +// "-tags safe" is added to the go build command line. The "disableunsafe" +// tag is deprecated and thus should not be used. +// +build js appengine safe disableunsafe !go1.4 + +package spew + +import "reflect" + +const ( + // UnsafeDisabled is a build-time constant which specifies whether or + // not access to the unsafe package is available. + UnsafeDisabled = true +) + +// unsafeReflectValue typically converts the passed reflect.Value into a one +// that bypasses the typical safety restrictions preventing access to +// unaddressable and unexported data. However, doing this relies on access to +// the unsafe package. This is a stub version which simply returns the passed +// reflect.Value when the unsafe package is not available. +func unsafeReflectValue(v reflect.Value) reflect.Value { + return v +} diff --git a/vendor/github.com/davecgh/go-spew/spew/common.go b/vendor/github.com/davecgh/go-spew/spew/common.go new file mode 100644 index 0000000..1be8ce9 --- /dev/null +++ b/vendor/github.com/davecgh/go-spew/spew/common.go @@ -0,0 +1,341 @@ +/* + * Copyright (c) 2013-2016 Dave Collins + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +package spew + +import ( + "bytes" + "fmt" + "io" + "reflect" + "sort" + "strconv" +) + +// Some constants in the form of bytes to avoid string overhead. This mirrors +// the technique used in the fmt package. +var ( + panicBytes = []byte("(PANIC=") + plusBytes = []byte("+") + iBytes = []byte("i") + trueBytes = []byte("true") + falseBytes = []byte("false") + interfaceBytes = []byte("(interface {})") + commaNewlineBytes = []byte(",\n") + newlineBytes = []byte("\n") + openBraceBytes = []byte("{") + openBraceNewlineBytes = []byte("{\n") + closeBraceBytes = []byte("}") + asteriskBytes = []byte("*") + colonBytes = []byte(":") + colonSpaceBytes = []byte(": ") + openParenBytes = []byte("(") + closeParenBytes = []byte(")") + spaceBytes = []byte(" ") + pointerChainBytes = []byte("->") + nilAngleBytes = []byte("") + maxNewlineBytes = []byte("\n") + maxShortBytes = []byte("") + circularBytes = []byte("") + circularShortBytes = []byte("") + invalidAngleBytes = []byte("") + openBracketBytes = []byte("[") + closeBracketBytes = []byte("]") + percentBytes = []byte("%") + precisionBytes = []byte(".") + openAngleBytes = []byte("<") + closeAngleBytes = []byte(">") + openMapBytes = []byte("map[") + closeMapBytes = []byte("]") + lenEqualsBytes = []byte("len=") + capEqualsBytes = []byte("cap=") +) + +// hexDigits is used to map a decimal value to a hex digit. +var hexDigits = "0123456789abcdef" + +// catchPanic handles any panics that might occur during the handleMethods +// calls. +func catchPanic(w io.Writer, v reflect.Value) { + if err := recover(); err != nil { + w.Write(panicBytes) + fmt.Fprintf(w, "%v", err) + w.Write(closeParenBytes) + } +} + +// handleMethods attempts to call the Error and String methods on the underlying +// type the passed reflect.Value represents and outputes the result to Writer w. +// +// It handles panics in any called methods by catching and displaying the error +// as the formatted value. +func handleMethods(cs *ConfigState, w io.Writer, v reflect.Value) (handled bool) { + // We need an interface to check if the type implements the error or + // Stringer interface. However, the reflect package won't give us an + // interface on certain things like unexported struct fields in order + // to enforce visibility rules. We use unsafe, when it's available, + // to bypass these restrictions since this package does not mutate the + // values. + if !v.CanInterface() { + if UnsafeDisabled { + return false + } + + v = unsafeReflectValue(v) + } + + // Choose whether or not to do error and Stringer interface lookups against + // the base type or a pointer to the base type depending on settings. + // Technically calling one of these methods with a pointer receiver can + // mutate the value, however, types which choose to satisify an error or + // Stringer interface with a pointer receiver should not be mutating their + // state inside these interface methods. + if !cs.DisablePointerMethods && !UnsafeDisabled && !v.CanAddr() { + v = unsafeReflectValue(v) + } + if v.CanAddr() { + v = v.Addr() + } + + // Is it an error or Stringer? + switch iface := v.Interface().(type) { + case error: + defer catchPanic(w, v) + if cs.ContinueOnMethod { + w.Write(openParenBytes) + w.Write([]byte(iface.Error())) + w.Write(closeParenBytes) + w.Write(spaceBytes) + return false + } + + w.Write([]byte(iface.Error())) + return true + + case fmt.Stringer: + defer catchPanic(w, v) + if cs.ContinueOnMethod { + w.Write(openParenBytes) + w.Write([]byte(iface.String())) + w.Write(closeParenBytes) + w.Write(spaceBytes) + return false + } + w.Write([]byte(iface.String())) + return true + } + return false +} + +// printBool outputs a boolean value as true or false to Writer w. +func printBool(w io.Writer, val bool) { + if val { + w.Write(trueBytes) + } else { + w.Write(falseBytes) + } +} + +// printInt outputs a signed integer value to Writer w. +func printInt(w io.Writer, val int64, base int) { + w.Write([]byte(strconv.FormatInt(val, base))) +} + +// printUint outputs an unsigned integer value to Writer w. +func printUint(w io.Writer, val uint64, base int) { + w.Write([]byte(strconv.FormatUint(val, base))) +} + +// printFloat outputs a floating point value using the specified precision, +// which is expected to be 32 or 64bit, to Writer w. +func printFloat(w io.Writer, val float64, precision int) { + w.Write([]byte(strconv.FormatFloat(val, 'g', -1, precision))) +} + +// printComplex outputs a complex value using the specified float precision +// for the real and imaginary parts to Writer w. +func printComplex(w io.Writer, c complex128, floatPrecision int) { + r := real(c) + w.Write(openParenBytes) + w.Write([]byte(strconv.FormatFloat(r, 'g', -1, floatPrecision))) + i := imag(c) + if i >= 0 { + w.Write(plusBytes) + } + w.Write([]byte(strconv.FormatFloat(i, 'g', -1, floatPrecision))) + w.Write(iBytes) + w.Write(closeParenBytes) +} + +// printHexPtr outputs a uintptr formatted as hexadecimal with a leading '0x' +// prefix to Writer w. +func printHexPtr(w io.Writer, p uintptr) { + // Null pointer. + num := uint64(p) + if num == 0 { + w.Write(nilAngleBytes) + return + } + + // Max uint64 is 16 bytes in hex + 2 bytes for '0x' prefix + buf := make([]byte, 18) + + // It's simpler to construct the hex string right to left. + base := uint64(16) + i := len(buf) - 1 + for num >= base { + buf[i] = hexDigits[num%base] + num /= base + i-- + } + buf[i] = hexDigits[num] + + // Add '0x' prefix. + i-- + buf[i] = 'x' + i-- + buf[i] = '0' + + // Strip unused leading bytes. + buf = buf[i:] + w.Write(buf) +} + +// valuesSorter implements sort.Interface to allow a slice of reflect.Value +// elements to be sorted. +type valuesSorter struct { + values []reflect.Value + strings []string // either nil or same len and values + cs *ConfigState +} + +// newValuesSorter initializes a valuesSorter instance, which holds a set of +// surrogate keys on which the data should be sorted. It uses flags in +// ConfigState to decide if and how to populate those surrogate keys. +func newValuesSorter(values []reflect.Value, cs *ConfigState) sort.Interface { + vs := &valuesSorter{values: values, cs: cs} + if canSortSimply(vs.values[0].Kind()) { + return vs + } + if !cs.DisableMethods { + vs.strings = make([]string, len(values)) + for i := range vs.values { + b := bytes.Buffer{} + if !handleMethods(cs, &b, vs.values[i]) { + vs.strings = nil + break + } + vs.strings[i] = b.String() + } + } + if vs.strings == nil && cs.SpewKeys { + vs.strings = make([]string, len(values)) + for i := range vs.values { + vs.strings[i] = Sprintf("%#v", vs.values[i].Interface()) + } + } + return vs +} + +// canSortSimply tests whether a reflect.Kind is a primitive that can be sorted +// directly, or whether it should be considered for sorting by surrogate keys +// (if the ConfigState allows it). +func canSortSimply(kind reflect.Kind) bool { + // This switch parallels valueSortLess, except for the default case. + switch kind { + case reflect.Bool: + return true + case reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Int: + return true + case reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uint: + return true + case reflect.Float32, reflect.Float64: + return true + case reflect.String: + return true + case reflect.Uintptr: + return true + case reflect.Array: + return true + } + return false +} + +// Len returns the number of values in the slice. It is part of the +// sort.Interface implementation. +func (s *valuesSorter) Len() int { + return len(s.values) +} + +// Swap swaps the values at the passed indices. It is part of the +// sort.Interface implementation. +func (s *valuesSorter) Swap(i, j int) { + s.values[i], s.values[j] = s.values[j], s.values[i] + if s.strings != nil { + s.strings[i], s.strings[j] = s.strings[j], s.strings[i] + } +} + +// valueSortLess returns whether the first value should sort before the second +// value. It is used by valueSorter.Less as part of the sort.Interface +// implementation. +func valueSortLess(a, b reflect.Value) bool { + switch a.Kind() { + case reflect.Bool: + return !a.Bool() && b.Bool() + case reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Int: + return a.Int() < b.Int() + case reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uint: + return a.Uint() < b.Uint() + case reflect.Float32, reflect.Float64: + return a.Float() < b.Float() + case reflect.String: + return a.String() < b.String() + case reflect.Uintptr: + return a.Uint() < b.Uint() + case reflect.Array: + // Compare the contents of both arrays. + l := a.Len() + for i := 0; i < l; i++ { + av := a.Index(i) + bv := b.Index(i) + if av.Interface() == bv.Interface() { + continue + } + return valueSortLess(av, bv) + } + } + return a.String() < b.String() +} + +// Less returns whether the value at index i should sort before the +// value at index j. It is part of the sort.Interface implementation. +func (s *valuesSorter) Less(i, j int) bool { + if s.strings == nil { + return valueSortLess(s.values[i], s.values[j]) + } + return s.strings[i] < s.strings[j] +} + +// sortValues is a sort function that handles both native types and any type that +// can be converted to error or Stringer. Other inputs are sorted according to +// their Value.String() value to ensure display stability. +func sortValues(values []reflect.Value, cs *ConfigState) { + if len(values) == 0 { + return + } + sort.Sort(newValuesSorter(values, cs)) +} diff --git a/vendor/github.com/davecgh/go-spew/spew/config.go b/vendor/github.com/davecgh/go-spew/spew/config.go new file mode 100644 index 0000000..2e3d22f --- /dev/null +++ b/vendor/github.com/davecgh/go-spew/spew/config.go @@ -0,0 +1,306 @@ +/* + * Copyright (c) 2013-2016 Dave Collins + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +package spew + +import ( + "bytes" + "fmt" + "io" + "os" +) + +// ConfigState houses the configuration options used by spew to format and +// display values. There is a global instance, Config, that is used to control +// all top-level Formatter and Dump functionality. Each ConfigState instance +// provides methods equivalent to the top-level functions. +// +// The zero value for ConfigState provides no indentation. You would typically +// want to set it to a space or a tab. +// +// Alternatively, you can use NewDefaultConfig to get a ConfigState instance +// with default settings. See the documentation of NewDefaultConfig for default +// values. +type ConfigState struct { + // Indent specifies the string to use for each indentation level. The + // global config instance that all top-level functions use set this to a + // single space by default. If you would like more indentation, you might + // set this to a tab with "\t" or perhaps two spaces with " ". + Indent string + + // MaxDepth controls the maximum number of levels to descend into nested + // data structures. The default, 0, means there is no limit. + // + // NOTE: Circular data structures are properly detected, so it is not + // necessary to set this value unless you specifically want to limit deeply + // nested data structures. + MaxDepth int + + // DisableMethods specifies whether or not error and Stringer interfaces are + // invoked for types that implement them. + DisableMethods bool + + // DisablePointerMethods specifies whether or not to check for and invoke + // error and Stringer interfaces on types which only accept a pointer + // receiver when the current type is not a pointer. + // + // NOTE: This might be an unsafe action since calling one of these methods + // with a pointer receiver could technically mutate the value, however, + // in practice, types which choose to satisify an error or Stringer + // interface with a pointer receiver should not be mutating their state + // inside these interface methods. As a result, this option relies on + // access to the unsafe package, so it will not have any effect when + // running in environments without access to the unsafe package such as + // Google App Engine or with the "safe" build tag specified. + DisablePointerMethods bool + + // DisablePointerAddresses specifies whether to disable the printing of + // pointer addresses. This is useful when diffing data structures in tests. + DisablePointerAddresses bool + + // DisableCapacities specifies whether to disable the printing of capacities + // for arrays, slices, maps and channels. This is useful when diffing + // data structures in tests. + DisableCapacities bool + + // ContinueOnMethod specifies whether or not recursion should continue once + // a custom error or Stringer interface is invoked. The default, false, + // means it will print the results of invoking the custom error or Stringer + // interface and return immediately instead of continuing to recurse into + // the internals of the data type. + // + // NOTE: This flag does not have any effect if method invocation is disabled + // via the DisableMethods or DisablePointerMethods options. + ContinueOnMethod bool + + // SortKeys specifies map keys should be sorted before being printed. Use + // this to have a more deterministic, diffable output. Note that only + // native types (bool, int, uint, floats, uintptr and string) and types + // that support the error or Stringer interfaces (if methods are + // enabled) are supported, with other types sorted according to the + // reflect.Value.String() output which guarantees display stability. + SortKeys bool + + // SpewKeys specifies that, as a last resort attempt, map keys should + // be spewed to strings and sorted by those strings. This is only + // considered if SortKeys is true. + SpewKeys bool +} + +// Config is the active configuration of the top-level functions. +// The configuration can be changed by modifying the contents of spew.Config. +var Config = ConfigState{Indent: " "} + +// Errorf is a wrapper for fmt.Errorf that treats each argument as if it were +// passed with a Formatter interface returned by c.NewFormatter. It returns +// the formatted string as a value that satisfies error. See NewFormatter +// for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Errorf(format, c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Errorf(format string, a ...interface{}) (err error) { + return fmt.Errorf(format, c.convertArgs(a)...) +} + +// Fprint is a wrapper for fmt.Fprint that treats each argument as if it were +// passed with a Formatter interface returned by c.NewFormatter. It returns +// the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Fprint(w, c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Fprint(w io.Writer, a ...interface{}) (n int, err error) { + return fmt.Fprint(w, c.convertArgs(a)...) +} + +// Fprintf is a wrapper for fmt.Fprintf that treats each argument as if it were +// passed with a Formatter interface returned by c.NewFormatter. It returns +// the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Fprintf(w, format, c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Fprintf(w io.Writer, format string, a ...interface{}) (n int, err error) { + return fmt.Fprintf(w, format, c.convertArgs(a)...) +} + +// Fprintln is a wrapper for fmt.Fprintln that treats each argument as if it +// passed with a Formatter interface returned by c.NewFormatter. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Fprintln(w, c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Fprintln(w io.Writer, a ...interface{}) (n int, err error) { + return fmt.Fprintln(w, c.convertArgs(a)...) +} + +// Print is a wrapper for fmt.Print that treats each argument as if it were +// passed with a Formatter interface returned by c.NewFormatter. It returns +// the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Print(c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Print(a ...interface{}) (n int, err error) { + return fmt.Print(c.convertArgs(a)...) +} + +// Printf is a wrapper for fmt.Printf that treats each argument as if it were +// passed with a Formatter interface returned by c.NewFormatter. It returns +// the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Printf(format, c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Printf(format string, a ...interface{}) (n int, err error) { + return fmt.Printf(format, c.convertArgs(a)...) +} + +// Println is a wrapper for fmt.Println that treats each argument as if it were +// passed with a Formatter interface returned by c.NewFormatter. It returns +// the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Println(c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Println(a ...interface{}) (n int, err error) { + return fmt.Println(c.convertArgs(a)...) +} + +// Sprint is a wrapper for fmt.Sprint that treats each argument as if it were +// passed with a Formatter interface returned by c.NewFormatter. It returns +// the resulting string. See NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Sprint(c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Sprint(a ...interface{}) string { + return fmt.Sprint(c.convertArgs(a)...) +} + +// Sprintf is a wrapper for fmt.Sprintf that treats each argument as if it were +// passed with a Formatter interface returned by c.NewFormatter. It returns +// the resulting string. See NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Sprintf(format, c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Sprintf(format string, a ...interface{}) string { + return fmt.Sprintf(format, c.convertArgs(a)...) +} + +// Sprintln is a wrapper for fmt.Sprintln that treats each argument as if it +// were passed with a Formatter interface returned by c.NewFormatter. It +// returns the resulting string. See NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Sprintln(c.NewFormatter(a), c.NewFormatter(b)) +func (c *ConfigState) Sprintln(a ...interface{}) string { + return fmt.Sprintln(c.convertArgs(a)...) +} + +/* +NewFormatter returns a custom formatter that satisfies the fmt.Formatter +interface. As a result, it integrates cleanly with standard fmt package +printing functions. The formatter is useful for inline printing of smaller data +types similar to the standard %v format specifier. + +The custom formatter only responds to the %v (most compact), %+v (adds pointer +addresses), %#v (adds types), and %#+v (adds types and pointer addresses) verb +combinations. Any other verbs such as %x and %q will be sent to the the +standard fmt package for formatting. In addition, the custom formatter ignores +the width and precision arguments (however they will still work on the format +specifiers not handled by the custom formatter). + +Typically this function shouldn't be called directly. It is much easier to make +use of the custom formatter by calling one of the convenience functions such as +c.Printf, c.Println, or c.Printf. +*/ +func (c *ConfigState) NewFormatter(v interface{}) fmt.Formatter { + return newFormatter(c, v) +} + +// Fdump formats and displays the passed arguments to io.Writer w. It formats +// exactly the same as Dump. +func (c *ConfigState) Fdump(w io.Writer, a ...interface{}) { + fdump(c, w, a...) +} + +/* +Dump displays the passed parameters to standard out with newlines, customizable +indentation, and additional debug information such as complete types and all +pointer addresses used to indirect to the final value. It provides the +following features over the built-in printing facilities provided by the fmt +package: + + * Pointers are dereferenced and followed + * Circular data structures are detected and handled properly + * Custom Stringer/error interfaces are optionally invoked, including + on unexported types + * Custom types which only implement the Stringer/error interfaces via + a pointer receiver are optionally invoked when passing non-pointer + variables + * Byte arrays and slices are dumped like the hexdump -C command which + includes offsets, byte values in hex, and ASCII output + +The configuration options are controlled by modifying the public members +of c. See ConfigState for options documentation. + +See Fdump if you would prefer dumping to an arbitrary io.Writer or Sdump to +get the formatted result as a string. +*/ +func (c *ConfigState) Dump(a ...interface{}) { + fdump(c, os.Stdout, a...) +} + +// Sdump returns a string with the passed arguments formatted exactly the same +// as Dump. +func (c *ConfigState) Sdump(a ...interface{}) string { + var buf bytes.Buffer + fdump(c, &buf, a...) + return buf.String() +} + +// convertArgs accepts a slice of arguments and returns a slice of the same +// length with each argument converted to a spew Formatter interface using +// the ConfigState associated with s. +func (c *ConfigState) convertArgs(args []interface{}) (formatters []interface{}) { + formatters = make([]interface{}, len(args)) + for index, arg := range args { + formatters[index] = newFormatter(c, arg) + } + return formatters +} + +// NewDefaultConfig returns a ConfigState with the following default settings. +// +// Indent: " " +// MaxDepth: 0 +// DisableMethods: false +// DisablePointerMethods: false +// ContinueOnMethod: false +// SortKeys: false +func NewDefaultConfig() *ConfigState { + return &ConfigState{Indent: " "} +} diff --git a/vendor/github.com/davecgh/go-spew/spew/doc.go b/vendor/github.com/davecgh/go-spew/spew/doc.go new file mode 100644 index 0000000..aacaac6 --- /dev/null +++ b/vendor/github.com/davecgh/go-spew/spew/doc.go @@ -0,0 +1,211 @@ +/* + * Copyright (c) 2013-2016 Dave Collins + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +/* +Package spew implements a deep pretty printer for Go data structures to aid in +debugging. + +A quick overview of the additional features spew provides over the built-in +printing facilities for Go data types are as follows: + + * Pointers are dereferenced and followed + * Circular data structures are detected and handled properly + * Custom Stringer/error interfaces are optionally invoked, including + on unexported types + * Custom types which only implement the Stringer/error interfaces via + a pointer receiver are optionally invoked when passing non-pointer + variables + * Byte arrays and slices are dumped like the hexdump -C command which + includes offsets, byte values in hex, and ASCII output (only when using + Dump style) + +There are two different approaches spew allows for dumping Go data structures: + + * Dump style which prints with newlines, customizable indentation, + and additional debug information such as types and all pointer addresses + used to indirect to the final value + * A custom Formatter interface that integrates cleanly with the standard fmt + package and replaces %v, %+v, %#v, and %#+v to provide inline printing + similar to the default %v while providing the additional functionality + outlined above and passing unsupported format verbs such as %x and %q + along to fmt + +Quick Start + +This section demonstrates how to quickly get started with spew. See the +sections below for further details on formatting and configuration options. + +To dump a variable with full newlines, indentation, type, and pointer +information use Dump, Fdump, or Sdump: + spew.Dump(myVar1, myVar2, ...) + spew.Fdump(someWriter, myVar1, myVar2, ...) + str := spew.Sdump(myVar1, myVar2, ...) + +Alternatively, if you would prefer to use format strings with a compacted inline +printing style, use the convenience wrappers Printf, Fprintf, etc with +%v (most compact), %+v (adds pointer addresses), %#v (adds types), or +%#+v (adds types and pointer addresses): + spew.Printf("myVar1: %v -- myVar2: %+v", myVar1, myVar2) + spew.Printf("myVar3: %#v -- myVar4: %#+v", myVar3, myVar4) + spew.Fprintf(someWriter, "myVar1: %v -- myVar2: %+v", myVar1, myVar2) + spew.Fprintf(someWriter, "myVar3: %#v -- myVar4: %#+v", myVar3, myVar4) + +Configuration Options + +Configuration of spew is handled by fields in the ConfigState type. For +convenience, all of the top-level functions use a global state available +via the spew.Config global. + +It is also possible to create a ConfigState instance that provides methods +equivalent to the top-level functions. This allows concurrent configuration +options. See the ConfigState documentation for more details. + +The following configuration options are available: + * Indent + String to use for each indentation level for Dump functions. + It is a single space by default. A popular alternative is "\t". + + * MaxDepth + Maximum number of levels to descend into nested data structures. + There is no limit by default. + + * DisableMethods + Disables invocation of error and Stringer interface methods. + Method invocation is enabled by default. + + * DisablePointerMethods + Disables invocation of error and Stringer interface methods on types + which only accept pointer receivers from non-pointer variables. + Pointer method invocation is enabled by default. + + * DisablePointerAddresses + DisablePointerAddresses specifies whether to disable the printing of + pointer addresses. This is useful when diffing data structures in tests. + + * DisableCapacities + DisableCapacities specifies whether to disable the printing of + capacities for arrays, slices, maps and channels. This is useful when + diffing data structures in tests. + + * ContinueOnMethod + Enables recursion into types after invoking error and Stringer interface + methods. Recursion after method invocation is disabled by default. + + * SortKeys + Specifies map keys should be sorted before being printed. Use + this to have a more deterministic, diffable output. Note that + only native types (bool, int, uint, floats, uintptr and string) + and types which implement error or Stringer interfaces are + supported with other types sorted according to the + reflect.Value.String() output which guarantees display + stability. Natural map order is used by default. + + * SpewKeys + Specifies that, as a last resort attempt, map keys should be + spewed to strings and sorted by those strings. This is only + considered if SortKeys is true. + +Dump Usage + +Simply call spew.Dump with a list of variables you want to dump: + + spew.Dump(myVar1, myVar2, ...) + +You may also call spew.Fdump if you would prefer to output to an arbitrary +io.Writer. For example, to dump to standard error: + + spew.Fdump(os.Stderr, myVar1, myVar2, ...) + +A third option is to call spew.Sdump to get the formatted output as a string: + + str := spew.Sdump(myVar1, myVar2, ...) + +Sample Dump Output + +See the Dump example for details on the setup of the types and variables being +shown here. + + (main.Foo) { + unexportedField: (*main.Bar)(0xf84002e210)({ + flag: (main.Flag) flagTwo, + data: (uintptr) + }), + ExportedField: (map[interface {}]interface {}) (len=1) { + (string) (len=3) "one": (bool) true + } + } + +Byte (and uint8) arrays and slices are displayed uniquely like the hexdump -C +command as shown. + ([]uint8) (len=32 cap=32) { + 00000000 11 12 13 14 15 16 17 18 19 1a 1b 1c 1d 1e 1f 20 |............... | + 00000010 21 22 23 24 25 26 27 28 29 2a 2b 2c 2d 2e 2f 30 |!"#$%&'()*+,-./0| + 00000020 31 32 |12| + } + +Custom Formatter + +Spew provides a custom formatter that implements the fmt.Formatter interface +so that it integrates cleanly with standard fmt package printing functions. The +formatter is useful for inline printing of smaller data types similar to the +standard %v format specifier. + +The custom formatter only responds to the %v (most compact), %+v (adds pointer +addresses), %#v (adds types), or %#+v (adds types and pointer addresses) verb +combinations. Any other verbs such as %x and %q will be sent to the the +standard fmt package for formatting. In addition, the custom formatter ignores +the width and precision arguments (however they will still work on the format +specifiers not handled by the custom formatter). + +Custom Formatter Usage + +The simplest way to make use of the spew custom formatter is to call one of the +convenience functions such as spew.Printf, spew.Println, or spew.Printf. The +functions have syntax you are most likely already familiar with: + + spew.Printf("myVar1: %v -- myVar2: %+v", myVar1, myVar2) + spew.Printf("myVar3: %#v -- myVar4: %#+v", myVar3, myVar4) + spew.Println(myVar, myVar2) + spew.Fprintf(os.Stderr, "myVar1: %v -- myVar2: %+v", myVar1, myVar2) + spew.Fprintf(os.Stderr, "myVar3: %#v -- myVar4: %#+v", myVar3, myVar4) + +See the Index for the full list convenience functions. + +Sample Formatter Output + +Double pointer to a uint8: + %v: <**>5 + %+v: <**>(0xf8400420d0->0xf8400420c8)5 + %#v: (**uint8)5 + %#+v: (**uint8)(0xf8400420d0->0xf8400420c8)5 + +Pointer to circular struct with a uint8 field and a pointer to itself: + %v: <*>{1 <*>} + %+v: <*>(0xf84003e260){ui8:1 c:<*>(0xf84003e260)} + %#v: (*main.circular){ui8:(uint8)1 c:(*main.circular)} + %#+v: (*main.circular)(0xf84003e260){ui8:(uint8)1 c:(*main.circular)(0xf84003e260)} + +See the Printf example for details on the setup of variables being shown +here. + +Errors + +Since it is possible for custom Stringer/error interfaces to panic, spew +detects them and handles them internally by printing the panic information +inline with the output. Since spew is intended to provide deep pretty printing +capabilities on structures, it intentionally does not return any errors. +*/ +package spew diff --git a/vendor/github.com/davecgh/go-spew/spew/dump.go b/vendor/github.com/davecgh/go-spew/spew/dump.go new file mode 100644 index 0000000..f78d89f --- /dev/null +++ b/vendor/github.com/davecgh/go-spew/spew/dump.go @@ -0,0 +1,509 @@ +/* + * Copyright (c) 2013-2016 Dave Collins + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +package spew + +import ( + "bytes" + "encoding/hex" + "fmt" + "io" + "os" + "reflect" + "regexp" + "strconv" + "strings" +) + +var ( + // uint8Type is a reflect.Type representing a uint8. It is used to + // convert cgo types to uint8 slices for hexdumping. + uint8Type = reflect.TypeOf(uint8(0)) + + // cCharRE is a regular expression that matches a cgo char. + // It is used to detect character arrays to hexdump them. + cCharRE = regexp.MustCompile(`^.*\._Ctype_char$`) + + // cUnsignedCharRE is a regular expression that matches a cgo unsigned + // char. It is used to detect unsigned character arrays to hexdump + // them. + cUnsignedCharRE = regexp.MustCompile(`^.*\._Ctype_unsignedchar$`) + + // cUint8tCharRE is a regular expression that matches a cgo uint8_t. + // It is used to detect uint8_t arrays to hexdump them. + cUint8tCharRE = regexp.MustCompile(`^.*\._Ctype_uint8_t$`) +) + +// dumpState contains information about the state of a dump operation. +type dumpState struct { + w io.Writer + depth int + pointers map[uintptr]int + ignoreNextType bool + ignoreNextIndent bool + cs *ConfigState +} + +// indent performs indentation according to the depth level and cs.Indent +// option. +func (d *dumpState) indent() { + if d.ignoreNextIndent { + d.ignoreNextIndent = false + return + } + d.w.Write(bytes.Repeat([]byte(d.cs.Indent), d.depth)) +} + +// unpackValue returns values inside of non-nil interfaces when possible. +// This is useful for data types like structs, arrays, slices, and maps which +// can contain varying types packed inside an interface. +func (d *dumpState) unpackValue(v reflect.Value) reflect.Value { + if v.Kind() == reflect.Interface && !v.IsNil() { + v = v.Elem() + } + return v +} + +// dumpPtr handles formatting of pointers by indirecting them as necessary. +func (d *dumpState) dumpPtr(v reflect.Value) { + // Remove pointers at or below the current depth from map used to detect + // circular refs. + for k, depth := range d.pointers { + if depth >= d.depth { + delete(d.pointers, k) + } + } + + // Keep list of all dereferenced pointers to show later. + pointerChain := make([]uintptr, 0) + + // Figure out how many levels of indirection there are by dereferencing + // pointers and unpacking interfaces down the chain while detecting circular + // references. + nilFound := false + cycleFound := false + indirects := 0 + ve := v + for ve.Kind() == reflect.Ptr { + if ve.IsNil() { + nilFound = true + break + } + indirects++ + addr := ve.Pointer() + pointerChain = append(pointerChain, addr) + if pd, ok := d.pointers[addr]; ok && pd < d.depth { + cycleFound = true + indirects-- + break + } + d.pointers[addr] = d.depth + + ve = ve.Elem() + if ve.Kind() == reflect.Interface { + if ve.IsNil() { + nilFound = true + break + } + ve = ve.Elem() + } + } + + // Display type information. + d.w.Write(openParenBytes) + d.w.Write(bytes.Repeat(asteriskBytes, indirects)) + d.w.Write([]byte(ve.Type().String())) + d.w.Write(closeParenBytes) + + // Display pointer information. + if !d.cs.DisablePointerAddresses && len(pointerChain) > 0 { + d.w.Write(openParenBytes) + for i, addr := range pointerChain { + if i > 0 { + d.w.Write(pointerChainBytes) + } + printHexPtr(d.w, addr) + } + d.w.Write(closeParenBytes) + } + + // Display dereferenced value. + d.w.Write(openParenBytes) + switch { + case nilFound: + d.w.Write(nilAngleBytes) + + case cycleFound: + d.w.Write(circularBytes) + + default: + d.ignoreNextType = true + d.dump(ve) + } + d.w.Write(closeParenBytes) +} + +// dumpSlice handles formatting of arrays and slices. Byte (uint8 under +// reflection) arrays and slices are dumped in hexdump -C fashion. +func (d *dumpState) dumpSlice(v reflect.Value) { + // Determine whether this type should be hex dumped or not. Also, + // for types which should be hexdumped, try to use the underlying data + // first, then fall back to trying to convert them to a uint8 slice. + var buf []uint8 + doConvert := false + doHexDump := false + numEntries := v.Len() + if numEntries > 0 { + vt := v.Index(0).Type() + vts := vt.String() + switch { + // C types that need to be converted. + case cCharRE.MatchString(vts): + fallthrough + case cUnsignedCharRE.MatchString(vts): + fallthrough + case cUint8tCharRE.MatchString(vts): + doConvert = true + + // Try to use existing uint8 slices and fall back to converting + // and copying if that fails. + case vt.Kind() == reflect.Uint8: + // We need an addressable interface to convert the type + // to a byte slice. However, the reflect package won't + // give us an interface on certain things like + // unexported struct fields in order to enforce + // visibility rules. We use unsafe, when available, to + // bypass these restrictions since this package does not + // mutate the values. + vs := v + if !vs.CanInterface() || !vs.CanAddr() { + vs = unsafeReflectValue(vs) + } + if !UnsafeDisabled { + vs = vs.Slice(0, numEntries) + + // Use the existing uint8 slice if it can be + // type asserted. + iface := vs.Interface() + if slice, ok := iface.([]uint8); ok { + buf = slice + doHexDump = true + break + } + } + + // The underlying data needs to be converted if it can't + // be type asserted to a uint8 slice. + doConvert = true + } + + // Copy and convert the underlying type if needed. + if doConvert && vt.ConvertibleTo(uint8Type) { + // Convert and copy each element into a uint8 byte + // slice. + buf = make([]uint8, numEntries) + for i := 0; i < numEntries; i++ { + vv := v.Index(i) + buf[i] = uint8(vv.Convert(uint8Type).Uint()) + } + doHexDump = true + } + } + + // Hexdump the entire slice as needed. + if doHexDump { + indent := strings.Repeat(d.cs.Indent, d.depth) + str := indent + hex.Dump(buf) + str = strings.Replace(str, "\n", "\n"+indent, -1) + str = strings.TrimRight(str, d.cs.Indent) + d.w.Write([]byte(str)) + return + } + + // Recursively call dump for each item. + for i := 0; i < numEntries; i++ { + d.dump(d.unpackValue(v.Index(i))) + if i < (numEntries - 1) { + d.w.Write(commaNewlineBytes) + } else { + d.w.Write(newlineBytes) + } + } +} + +// dump is the main workhorse for dumping a value. It uses the passed reflect +// value to figure out what kind of object we are dealing with and formats it +// appropriately. It is a recursive function, however circular data structures +// are detected and handled properly. +func (d *dumpState) dump(v reflect.Value) { + // Handle invalid reflect values immediately. + kind := v.Kind() + if kind == reflect.Invalid { + d.w.Write(invalidAngleBytes) + return + } + + // Handle pointers specially. + if kind == reflect.Ptr { + d.indent() + d.dumpPtr(v) + return + } + + // Print type information unless already handled elsewhere. + if !d.ignoreNextType { + d.indent() + d.w.Write(openParenBytes) + d.w.Write([]byte(v.Type().String())) + d.w.Write(closeParenBytes) + d.w.Write(spaceBytes) + } + d.ignoreNextType = false + + // Display length and capacity if the built-in len and cap functions + // work with the value's kind and the len/cap itself is non-zero. + valueLen, valueCap := 0, 0 + switch v.Kind() { + case reflect.Array, reflect.Slice, reflect.Chan: + valueLen, valueCap = v.Len(), v.Cap() + case reflect.Map, reflect.String: + valueLen = v.Len() + } + if valueLen != 0 || !d.cs.DisableCapacities && valueCap != 0 { + d.w.Write(openParenBytes) + if valueLen != 0 { + d.w.Write(lenEqualsBytes) + printInt(d.w, int64(valueLen), 10) + } + if !d.cs.DisableCapacities && valueCap != 0 { + if valueLen != 0 { + d.w.Write(spaceBytes) + } + d.w.Write(capEqualsBytes) + printInt(d.w, int64(valueCap), 10) + } + d.w.Write(closeParenBytes) + d.w.Write(spaceBytes) + } + + // Call Stringer/error interfaces if they exist and the handle methods flag + // is enabled + if !d.cs.DisableMethods { + if (kind != reflect.Invalid) && (kind != reflect.Interface) { + if handled := handleMethods(d.cs, d.w, v); handled { + return + } + } + } + + switch kind { + case reflect.Invalid: + // Do nothing. We should never get here since invalid has already + // been handled above. + + case reflect.Bool: + printBool(d.w, v.Bool()) + + case reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Int: + printInt(d.w, v.Int(), 10) + + case reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uint: + printUint(d.w, v.Uint(), 10) + + case reflect.Float32: + printFloat(d.w, v.Float(), 32) + + case reflect.Float64: + printFloat(d.w, v.Float(), 64) + + case reflect.Complex64: + printComplex(d.w, v.Complex(), 32) + + case reflect.Complex128: + printComplex(d.w, v.Complex(), 64) + + case reflect.Slice: + if v.IsNil() { + d.w.Write(nilAngleBytes) + break + } + fallthrough + + case reflect.Array: + d.w.Write(openBraceNewlineBytes) + d.depth++ + if (d.cs.MaxDepth != 0) && (d.depth > d.cs.MaxDepth) { + d.indent() + d.w.Write(maxNewlineBytes) + } else { + d.dumpSlice(v) + } + d.depth-- + d.indent() + d.w.Write(closeBraceBytes) + + case reflect.String: + d.w.Write([]byte(strconv.Quote(v.String()))) + + case reflect.Interface: + // The only time we should get here is for nil interfaces due to + // unpackValue calls. + if v.IsNil() { + d.w.Write(nilAngleBytes) + } + + case reflect.Ptr: + // Do nothing. We should never get here since pointers have already + // been handled above. + + case reflect.Map: + // nil maps should be indicated as different than empty maps + if v.IsNil() { + d.w.Write(nilAngleBytes) + break + } + + d.w.Write(openBraceNewlineBytes) + d.depth++ + if (d.cs.MaxDepth != 0) && (d.depth > d.cs.MaxDepth) { + d.indent() + d.w.Write(maxNewlineBytes) + } else { + numEntries := v.Len() + keys := v.MapKeys() + if d.cs.SortKeys { + sortValues(keys, d.cs) + } + for i, key := range keys { + d.dump(d.unpackValue(key)) + d.w.Write(colonSpaceBytes) + d.ignoreNextIndent = true + d.dump(d.unpackValue(v.MapIndex(key))) + if i < (numEntries - 1) { + d.w.Write(commaNewlineBytes) + } else { + d.w.Write(newlineBytes) + } + } + } + d.depth-- + d.indent() + d.w.Write(closeBraceBytes) + + case reflect.Struct: + d.w.Write(openBraceNewlineBytes) + d.depth++ + if (d.cs.MaxDepth != 0) && (d.depth > d.cs.MaxDepth) { + d.indent() + d.w.Write(maxNewlineBytes) + } else { + vt := v.Type() + numFields := v.NumField() + for i := 0; i < numFields; i++ { + d.indent() + vtf := vt.Field(i) + d.w.Write([]byte(vtf.Name)) + d.w.Write(colonSpaceBytes) + d.ignoreNextIndent = true + d.dump(d.unpackValue(v.Field(i))) + if i < (numFields - 1) { + d.w.Write(commaNewlineBytes) + } else { + d.w.Write(newlineBytes) + } + } + } + d.depth-- + d.indent() + d.w.Write(closeBraceBytes) + + case reflect.Uintptr: + printHexPtr(d.w, uintptr(v.Uint())) + + case reflect.UnsafePointer, reflect.Chan, reflect.Func: + printHexPtr(d.w, v.Pointer()) + + // There were not any other types at the time this code was written, but + // fall back to letting the default fmt package handle it in case any new + // types are added. + default: + if v.CanInterface() { + fmt.Fprintf(d.w, "%v", v.Interface()) + } else { + fmt.Fprintf(d.w, "%v", v.String()) + } + } +} + +// fdump is a helper function to consolidate the logic from the various public +// methods which take varying writers and config states. +func fdump(cs *ConfigState, w io.Writer, a ...interface{}) { + for _, arg := range a { + if arg == nil { + w.Write(interfaceBytes) + w.Write(spaceBytes) + w.Write(nilAngleBytes) + w.Write(newlineBytes) + continue + } + + d := dumpState{w: w, cs: cs} + d.pointers = make(map[uintptr]int) + d.dump(reflect.ValueOf(arg)) + d.w.Write(newlineBytes) + } +} + +// Fdump formats and displays the passed arguments to io.Writer w. It formats +// exactly the same as Dump. +func Fdump(w io.Writer, a ...interface{}) { + fdump(&Config, w, a...) +} + +// Sdump returns a string with the passed arguments formatted exactly the same +// as Dump. +func Sdump(a ...interface{}) string { + var buf bytes.Buffer + fdump(&Config, &buf, a...) + return buf.String() +} + +/* +Dump displays the passed parameters to standard out with newlines, customizable +indentation, and additional debug information such as complete types and all +pointer addresses used to indirect to the final value. It provides the +following features over the built-in printing facilities provided by the fmt +package: + + * Pointers are dereferenced and followed + * Circular data structures are detected and handled properly + * Custom Stringer/error interfaces are optionally invoked, including + on unexported types + * Custom types which only implement the Stringer/error interfaces via + a pointer receiver are optionally invoked when passing non-pointer + variables + * Byte arrays and slices are dumped like the hexdump -C command which + includes offsets, byte values in hex, and ASCII output + +The configuration options are controlled by an exported package global, +spew.Config. See ConfigState for options documentation. + +See Fdump if you would prefer dumping to an arbitrary io.Writer or Sdump to +get the formatted result as a string. +*/ +func Dump(a ...interface{}) { + fdump(&Config, os.Stdout, a...) +} diff --git a/vendor/github.com/davecgh/go-spew/spew/format.go b/vendor/github.com/davecgh/go-spew/spew/format.go new file mode 100644 index 0000000..b04edb7 --- /dev/null +++ b/vendor/github.com/davecgh/go-spew/spew/format.go @@ -0,0 +1,419 @@ +/* + * Copyright (c) 2013-2016 Dave Collins + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +package spew + +import ( + "bytes" + "fmt" + "reflect" + "strconv" + "strings" +) + +// supportedFlags is a list of all the character flags supported by fmt package. +const supportedFlags = "0-+# " + +// formatState implements the fmt.Formatter interface and contains information +// about the state of a formatting operation. The NewFormatter function can +// be used to get a new Formatter which can be used directly as arguments +// in standard fmt package printing calls. +type formatState struct { + value interface{} + fs fmt.State + depth int + pointers map[uintptr]int + ignoreNextType bool + cs *ConfigState +} + +// buildDefaultFormat recreates the original format string without precision +// and width information to pass in to fmt.Sprintf in the case of an +// unrecognized type. Unless new types are added to the language, this +// function won't ever be called. +func (f *formatState) buildDefaultFormat() (format string) { + buf := bytes.NewBuffer(percentBytes) + + for _, flag := range supportedFlags { + if f.fs.Flag(int(flag)) { + buf.WriteRune(flag) + } + } + + buf.WriteRune('v') + + format = buf.String() + return format +} + +// constructOrigFormat recreates the original format string including precision +// and width information to pass along to the standard fmt package. This allows +// automatic deferral of all format strings this package doesn't support. +func (f *formatState) constructOrigFormat(verb rune) (format string) { + buf := bytes.NewBuffer(percentBytes) + + for _, flag := range supportedFlags { + if f.fs.Flag(int(flag)) { + buf.WriteRune(flag) + } + } + + if width, ok := f.fs.Width(); ok { + buf.WriteString(strconv.Itoa(width)) + } + + if precision, ok := f.fs.Precision(); ok { + buf.Write(precisionBytes) + buf.WriteString(strconv.Itoa(precision)) + } + + buf.WriteRune(verb) + + format = buf.String() + return format +} + +// unpackValue returns values inside of non-nil interfaces when possible and +// ensures that types for values which have been unpacked from an interface +// are displayed when the show types flag is also set. +// This is useful for data types like structs, arrays, slices, and maps which +// can contain varying types packed inside an interface. +func (f *formatState) unpackValue(v reflect.Value) reflect.Value { + if v.Kind() == reflect.Interface { + f.ignoreNextType = false + if !v.IsNil() { + v = v.Elem() + } + } + return v +} + +// formatPtr handles formatting of pointers by indirecting them as necessary. +func (f *formatState) formatPtr(v reflect.Value) { + // Display nil if top level pointer is nil. + showTypes := f.fs.Flag('#') + if v.IsNil() && (!showTypes || f.ignoreNextType) { + f.fs.Write(nilAngleBytes) + return + } + + // Remove pointers at or below the current depth from map used to detect + // circular refs. + for k, depth := range f.pointers { + if depth >= f.depth { + delete(f.pointers, k) + } + } + + // Keep list of all dereferenced pointers to possibly show later. + pointerChain := make([]uintptr, 0) + + // Figure out how many levels of indirection there are by derferencing + // pointers and unpacking interfaces down the chain while detecting circular + // references. + nilFound := false + cycleFound := false + indirects := 0 + ve := v + for ve.Kind() == reflect.Ptr { + if ve.IsNil() { + nilFound = true + break + } + indirects++ + addr := ve.Pointer() + pointerChain = append(pointerChain, addr) + if pd, ok := f.pointers[addr]; ok && pd < f.depth { + cycleFound = true + indirects-- + break + } + f.pointers[addr] = f.depth + + ve = ve.Elem() + if ve.Kind() == reflect.Interface { + if ve.IsNil() { + nilFound = true + break + } + ve = ve.Elem() + } + } + + // Display type or indirection level depending on flags. + if showTypes && !f.ignoreNextType { + f.fs.Write(openParenBytes) + f.fs.Write(bytes.Repeat(asteriskBytes, indirects)) + f.fs.Write([]byte(ve.Type().String())) + f.fs.Write(closeParenBytes) + } else { + if nilFound || cycleFound { + indirects += strings.Count(ve.Type().String(), "*") + } + f.fs.Write(openAngleBytes) + f.fs.Write([]byte(strings.Repeat("*", indirects))) + f.fs.Write(closeAngleBytes) + } + + // Display pointer information depending on flags. + if f.fs.Flag('+') && (len(pointerChain) > 0) { + f.fs.Write(openParenBytes) + for i, addr := range pointerChain { + if i > 0 { + f.fs.Write(pointerChainBytes) + } + printHexPtr(f.fs, addr) + } + f.fs.Write(closeParenBytes) + } + + // Display dereferenced value. + switch { + case nilFound: + f.fs.Write(nilAngleBytes) + + case cycleFound: + f.fs.Write(circularShortBytes) + + default: + f.ignoreNextType = true + f.format(ve) + } +} + +// format is the main workhorse for providing the Formatter interface. It +// uses the passed reflect value to figure out what kind of object we are +// dealing with and formats it appropriately. It is a recursive function, +// however circular data structures are detected and handled properly. +func (f *formatState) format(v reflect.Value) { + // Handle invalid reflect values immediately. + kind := v.Kind() + if kind == reflect.Invalid { + f.fs.Write(invalidAngleBytes) + return + } + + // Handle pointers specially. + if kind == reflect.Ptr { + f.formatPtr(v) + return + } + + // Print type information unless already handled elsewhere. + if !f.ignoreNextType && f.fs.Flag('#') { + f.fs.Write(openParenBytes) + f.fs.Write([]byte(v.Type().String())) + f.fs.Write(closeParenBytes) + } + f.ignoreNextType = false + + // Call Stringer/error interfaces if they exist and the handle methods + // flag is enabled. + if !f.cs.DisableMethods { + if (kind != reflect.Invalid) && (kind != reflect.Interface) { + if handled := handleMethods(f.cs, f.fs, v); handled { + return + } + } + } + + switch kind { + case reflect.Invalid: + // Do nothing. We should never get here since invalid has already + // been handled above. + + case reflect.Bool: + printBool(f.fs, v.Bool()) + + case reflect.Int8, reflect.Int16, reflect.Int32, reflect.Int64, reflect.Int: + printInt(f.fs, v.Int(), 10) + + case reflect.Uint8, reflect.Uint16, reflect.Uint32, reflect.Uint64, reflect.Uint: + printUint(f.fs, v.Uint(), 10) + + case reflect.Float32: + printFloat(f.fs, v.Float(), 32) + + case reflect.Float64: + printFloat(f.fs, v.Float(), 64) + + case reflect.Complex64: + printComplex(f.fs, v.Complex(), 32) + + case reflect.Complex128: + printComplex(f.fs, v.Complex(), 64) + + case reflect.Slice: + if v.IsNil() { + f.fs.Write(nilAngleBytes) + break + } + fallthrough + + case reflect.Array: + f.fs.Write(openBracketBytes) + f.depth++ + if (f.cs.MaxDepth != 0) && (f.depth > f.cs.MaxDepth) { + f.fs.Write(maxShortBytes) + } else { + numEntries := v.Len() + for i := 0; i < numEntries; i++ { + if i > 0 { + f.fs.Write(spaceBytes) + } + f.ignoreNextType = true + f.format(f.unpackValue(v.Index(i))) + } + } + f.depth-- + f.fs.Write(closeBracketBytes) + + case reflect.String: + f.fs.Write([]byte(v.String())) + + case reflect.Interface: + // The only time we should get here is for nil interfaces due to + // unpackValue calls. + if v.IsNil() { + f.fs.Write(nilAngleBytes) + } + + case reflect.Ptr: + // Do nothing. We should never get here since pointers have already + // been handled above. + + case reflect.Map: + // nil maps should be indicated as different than empty maps + if v.IsNil() { + f.fs.Write(nilAngleBytes) + break + } + + f.fs.Write(openMapBytes) + f.depth++ + if (f.cs.MaxDepth != 0) && (f.depth > f.cs.MaxDepth) { + f.fs.Write(maxShortBytes) + } else { + keys := v.MapKeys() + if f.cs.SortKeys { + sortValues(keys, f.cs) + } + for i, key := range keys { + if i > 0 { + f.fs.Write(spaceBytes) + } + f.ignoreNextType = true + f.format(f.unpackValue(key)) + f.fs.Write(colonBytes) + f.ignoreNextType = true + f.format(f.unpackValue(v.MapIndex(key))) + } + } + f.depth-- + f.fs.Write(closeMapBytes) + + case reflect.Struct: + numFields := v.NumField() + f.fs.Write(openBraceBytes) + f.depth++ + if (f.cs.MaxDepth != 0) && (f.depth > f.cs.MaxDepth) { + f.fs.Write(maxShortBytes) + } else { + vt := v.Type() + for i := 0; i < numFields; i++ { + if i > 0 { + f.fs.Write(spaceBytes) + } + vtf := vt.Field(i) + if f.fs.Flag('+') || f.fs.Flag('#') { + f.fs.Write([]byte(vtf.Name)) + f.fs.Write(colonBytes) + } + f.format(f.unpackValue(v.Field(i))) + } + } + f.depth-- + f.fs.Write(closeBraceBytes) + + case reflect.Uintptr: + printHexPtr(f.fs, uintptr(v.Uint())) + + case reflect.UnsafePointer, reflect.Chan, reflect.Func: + printHexPtr(f.fs, v.Pointer()) + + // There were not any other types at the time this code was written, but + // fall back to letting the default fmt package handle it if any get added. + default: + format := f.buildDefaultFormat() + if v.CanInterface() { + fmt.Fprintf(f.fs, format, v.Interface()) + } else { + fmt.Fprintf(f.fs, format, v.String()) + } + } +} + +// Format satisfies the fmt.Formatter interface. See NewFormatter for usage +// details. +func (f *formatState) Format(fs fmt.State, verb rune) { + f.fs = fs + + // Use standard formatting for verbs that are not v. + if verb != 'v' { + format := f.constructOrigFormat(verb) + fmt.Fprintf(fs, format, f.value) + return + } + + if f.value == nil { + if fs.Flag('#') { + fs.Write(interfaceBytes) + } + fs.Write(nilAngleBytes) + return + } + + f.format(reflect.ValueOf(f.value)) +} + +// newFormatter is a helper function to consolidate the logic from the various +// public methods which take varying config states. +func newFormatter(cs *ConfigState, v interface{}) fmt.Formatter { + fs := &formatState{value: v, cs: cs} + fs.pointers = make(map[uintptr]int) + return fs +} + +/* +NewFormatter returns a custom formatter that satisfies the fmt.Formatter +interface. As a result, it integrates cleanly with standard fmt package +printing functions. The formatter is useful for inline printing of smaller data +types similar to the standard %v format specifier. + +The custom formatter only responds to the %v (most compact), %+v (adds pointer +addresses), %#v (adds types), or %#+v (adds types and pointer addresses) verb +combinations. Any other verbs such as %x and %q will be sent to the the +standard fmt package for formatting. In addition, the custom formatter ignores +the width and precision arguments (however they will still work on the format +specifiers not handled by the custom formatter). + +Typically this function shouldn't be called directly. It is much easier to make +use of the custom formatter by calling one of the convenience functions such as +Printf, Println, or Fprintf. +*/ +func NewFormatter(v interface{}) fmt.Formatter { + return newFormatter(&Config, v) +} diff --git a/vendor/github.com/davecgh/go-spew/spew/spew.go b/vendor/github.com/davecgh/go-spew/spew/spew.go new file mode 100644 index 0000000..32c0e33 --- /dev/null +++ b/vendor/github.com/davecgh/go-spew/spew/spew.go @@ -0,0 +1,148 @@ +/* + * Copyright (c) 2013-2016 Dave Collins + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +package spew + +import ( + "fmt" + "io" +) + +// Errorf is a wrapper for fmt.Errorf that treats each argument as if it were +// passed with a default Formatter interface returned by NewFormatter. It +// returns the formatted string as a value that satisfies error. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Errorf(format, spew.NewFormatter(a), spew.NewFormatter(b)) +func Errorf(format string, a ...interface{}) (err error) { + return fmt.Errorf(format, convertArgs(a)...) +} + +// Fprint is a wrapper for fmt.Fprint that treats each argument as if it were +// passed with a default Formatter interface returned by NewFormatter. It +// returns the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Fprint(w, spew.NewFormatter(a), spew.NewFormatter(b)) +func Fprint(w io.Writer, a ...interface{}) (n int, err error) { + return fmt.Fprint(w, convertArgs(a)...) +} + +// Fprintf is a wrapper for fmt.Fprintf that treats each argument as if it were +// passed with a default Formatter interface returned by NewFormatter. It +// returns the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Fprintf(w, format, spew.NewFormatter(a), spew.NewFormatter(b)) +func Fprintf(w io.Writer, format string, a ...interface{}) (n int, err error) { + return fmt.Fprintf(w, format, convertArgs(a)...) +} + +// Fprintln is a wrapper for fmt.Fprintln that treats each argument as if it +// passed with a default Formatter interface returned by NewFormatter. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Fprintln(w, spew.NewFormatter(a), spew.NewFormatter(b)) +func Fprintln(w io.Writer, a ...interface{}) (n int, err error) { + return fmt.Fprintln(w, convertArgs(a)...) +} + +// Print is a wrapper for fmt.Print that treats each argument as if it were +// passed with a default Formatter interface returned by NewFormatter. It +// returns the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Print(spew.NewFormatter(a), spew.NewFormatter(b)) +func Print(a ...interface{}) (n int, err error) { + return fmt.Print(convertArgs(a)...) +} + +// Printf is a wrapper for fmt.Printf that treats each argument as if it were +// passed with a default Formatter interface returned by NewFormatter. It +// returns the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Printf(format, spew.NewFormatter(a), spew.NewFormatter(b)) +func Printf(format string, a ...interface{}) (n int, err error) { + return fmt.Printf(format, convertArgs(a)...) +} + +// Println is a wrapper for fmt.Println that treats each argument as if it were +// passed with a default Formatter interface returned by NewFormatter. It +// returns the number of bytes written and any write error encountered. See +// NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Println(spew.NewFormatter(a), spew.NewFormatter(b)) +func Println(a ...interface{}) (n int, err error) { + return fmt.Println(convertArgs(a)...) +} + +// Sprint is a wrapper for fmt.Sprint that treats each argument as if it were +// passed with a default Formatter interface returned by NewFormatter. It +// returns the resulting string. See NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Sprint(spew.NewFormatter(a), spew.NewFormatter(b)) +func Sprint(a ...interface{}) string { + return fmt.Sprint(convertArgs(a)...) +} + +// Sprintf is a wrapper for fmt.Sprintf that treats each argument as if it were +// passed with a default Formatter interface returned by NewFormatter. It +// returns the resulting string. See NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Sprintf(format, spew.NewFormatter(a), spew.NewFormatter(b)) +func Sprintf(format string, a ...interface{}) string { + return fmt.Sprintf(format, convertArgs(a)...) +} + +// Sprintln is a wrapper for fmt.Sprintln that treats each argument as if it +// were passed with a default Formatter interface returned by NewFormatter. It +// returns the resulting string. See NewFormatter for formatting details. +// +// This function is shorthand for the following syntax: +// +// fmt.Sprintln(spew.NewFormatter(a), spew.NewFormatter(b)) +func Sprintln(a ...interface{}) string { + return fmt.Sprintln(convertArgs(a)...) +} + +// convertArgs accepts a slice of arguments and returns a slice of the same +// length with each argument converted to a default spew Formatter interface. +func convertArgs(args []interface{}) (formatters []interface{}) { + formatters = make([]interface{}, len(args)) + for index, arg := range args { + formatters[index] = NewFormatter(arg) + } + return formatters +} diff --git a/vendor/github.com/gruntwork-io/terratest/LICENSE b/vendor/github.com/gruntwork-io/terratest/LICENSE new file mode 100644 index 0000000..7a4a3ea --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. \ No newline at end of file diff --git a/vendor/github.com/gruntwork-io/terratest/NOTICE b/vendor/github.com/gruntwork-io/terratest/NOTICE new file mode 100644 index 0000000..88b1d1a --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/NOTICE @@ -0,0 +1,4 @@ +terratest +Copyright 2018 Gruntwork, Inc. + +This product includes software developed at Gruntwork (https://www.gruntwork.io/). \ No newline at end of file diff --git a/vendor/github.com/gruntwork-io/terratest/modules/collections/collections.go b/vendor/github.com/gruntwork-io/terratest/modules/collections/collections.go new file mode 100644 index 0000000..6967d2f --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/collections/collections.go @@ -0,0 +1,2 @@ +// Package collections allows to interact with lists of things. +package collections diff --git a/vendor/github.com/gruntwork-io/terratest/modules/collections/lists.go b/vendor/github.com/gruntwork-io/terratest/modules/collections/lists.go new file mode 100644 index 0000000..ec468d3 --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/collections/lists.go @@ -0,0 +1,40 @@ +package collections + +// ListIntersection returns all the items in both list1 and list2. Note that this will dedup the items so that the +// output is more predictable. Otherwise, the end list depends on which list was used as the base. +func ListIntersection(list1 []string, list2 []string) []string { + out := []string{} + + // Only need to iterate list1, because we want items in both lists, not union. + for _, item := range list1 { + if ListContains(list2, item) && !ListContains(out, item) { + out = append(out, item) + } + } + + return out +} + +// ListSubtract removes all the items in list2 from list1. +func ListSubtract(list1 []string, list2 []string) []string { + out := []string{} + + for _, item := range list1 { + if !ListContains(list2, item) { + out = append(out, item) + } + } + + return out +} + +// ListContains returns true if the given list of strings (haystack) contains the given string (needle). +func ListContains(haystack []string, needle string) bool { + for _, str := range haystack { + if needle == str { + return true + } + } + + return false +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/customerrors/multierror.go b/vendor/github.com/gruntwork-io/terratest/modules/customerrors/multierror.go new file mode 100644 index 0000000..1b9691c --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/customerrors/multierror.go @@ -0,0 +1,36 @@ +package customerrors + +import ( + "fmt" + "strings" +) + +type MultiError struct { + Errors []error +} + +func NewMultiError(errs ...error) error { + nilsRemoved := make([]error, 0, len(errs)) + for _, item := range errs { + if item != nil { + nilsRemoved = append(nilsRemoved, item) + } + } + + if len(nilsRemoved) == 0 { + return nil + } + + return MultiError{Errors: nilsRemoved} +} + +func (errs MultiError) Error() string { + errorMessages := []string{} + for _, err := range errs.Errors { + if err != nil { + errorMessages = append(errorMessages, err.Error()) + } + } + + return fmt.Sprintf("Hit multiple errors:\n%s", strings.Join(errorMessages, "\n")) +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/files/files.go b/vendor/github.com/gruntwork-io/terratest/modules/files/files.go new file mode 100644 index 0000000..99a57fe --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/files/files.go @@ -0,0 +1,152 @@ +// Package files allows to interact with files on a file system. +package files + +import ( + "io/ioutil" + "os" + "path/filepath" + "strings" +) + +// FileExists returns true if the given file exists. +func FileExists(path string) bool { + _, err := os.Stat(path) + return err == nil +} + +// CopyTerraformFolderToTemp creates a copy of the given folder and all its contents in a temp folder with a unique name and the given prefix. +// This is useful when running multiple tests in parallel against the same set of Terraform files to ensure the +// tests don't overwrite each other's .terraform working directory and terraform.tfstate files. This method returns +// the path to the temp folder with the copied contents. Hidden files and folders, Terraform state files, and +// terraform.tfvars files are not copied to this temp folder, as you typically don't want them interfering with your +// tests. +func CopyTerraformFolderToTemp(folderPath string, tempFolderPrefix string) (string, error) { + tmpDir, err := ioutil.TempDir("", tempFolderPrefix) + if err != nil { + return "", err + } + + // Inside of the temp folder, we create a subfolder that preserves the name of the folder we're copying from. + absFolderPath, err := filepath.Abs(folderPath) + if err != nil { + return "", err + } + folderName := filepath.Base(absFolderPath) + destFolder := filepath.Join(tmpDir, folderName) + + if err := os.MkdirAll(destFolder, 0777); err != nil { + return "", err + } + + filter := func(path string) bool { + return !PathContainsHiddenFileOrFolder(path) && !PathContainsTerraformStateOrVars(path) + } + + if err := CopyFolderContentsWithFilter(folderPath, destFolder, filter); err != nil { + return "", err + } + + return destFolder, nil +} + +// CopyFolderContents copies all the files and folders within the given source folder to the destination folder. +func CopyFolderContents(source string, destination string) error { + return CopyFolderContentsWithFilter(source, destination, func(path string) bool { + return true + }) +} + +// CopyFolderContentsWithFilter copies the files and folders within the given source folder that pass the given filter (return true) to the +// destination folder. +func CopyFolderContentsWithFilter(source string, destination string, filter func(path string) bool) error { + files, err := ioutil.ReadDir(source) + if err != nil { + return err + } + + for _, file := range files { + src := filepath.Join(source, file.Name()) + dest := filepath.Join(destination, file.Name()) + + if !filter(src) { + continue + } else if file.IsDir() { + if err := os.MkdirAll(dest, file.Mode()); err != nil { + return err + } + + if err := CopyFolderContentsWithFilter(src, dest, filter); err != nil { + return err + } + + } else if isSymLink(file) { + if err := copySymLink(src, dest); err != nil { + return err + } + } else { + if err := CopyFile(src, dest); err != nil { + return err + } + } + } + + return nil +} + +// PathContainsTerraformStateOrVars returns true if the path corresponds to a Terraform state file or .tfvars file. +func PathContainsTerraformStateOrVars(path string) bool { + filename := filepath.Base(path) + return filename == "terraform.tfstate" || filename == "terraform.tfstate.backup" || filename == "terraform.tfvars" +} + +// PathContainsHiddenFileOrFolder returns true if the given path contains a hidden file or folder. +func PathContainsHiddenFileOrFolder(path string) bool { + pathParts := strings.Split(path, string(filepath.Separator)) + for _, pathPart := range pathParts { + if strings.HasPrefix(pathPart, ".") && pathPart != "." && pathPart != ".." { + return true + } + } + return false +} + +// CopyFile copies a file from source to destination. +func CopyFile(source string, destination string) error { + contents, err := ioutil.ReadFile(source) + if err != nil { + return err + } + + return WriteFileWithSamePermissions(source, destination, contents) +} + +// WriteFileWithSamePermissions writes a file to the given destination with the given contents using the same permissions as the file at source. +func WriteFileWithSamePermissions(source string, destination string, contents []byte) error { + fileInfo, err := os.Stat(source) + if err != nil { + return err + } + + return ioutil.WriteFile(destination, contents, fileInfo.Mode()) +} + +// isSymLink returns true if the given file is a symbolic link +// Per https://stackoverflow.com/a/18062079/2308858 +func isSymLink(file os.FileInfo) bool { + return file.Mode()&os.ModeSymlink != 0 +} + +// copySymLink copies the source symbolic link to the given destination. +func copySymLink(source string, destination string) error { + symlinkPath, err := os.Readlink(source) + if err != nil { + return err + } + + err = os.Symlink(symlinkPath, destination) + if err != nil { + return err + } + + return nil +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/logger/logger.go b/vendor/github.com/gruntwork-io/terratest/modules/logger/logger.go new file mode 100644 index 0000000..a8a570a --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/logger/logger.go @@ -0,0 +1,71 @@ +// Package logger contains different methods to log. +package logger + +import ( + "fmt" + "io" + "os" + "runtime" + "strings" + "testing" + "time" +) + +// Logf logs the given format and arguments, formatted using fmt.Sprintf, to stdout, along with a timestamp and information +// about what test and file is doing the logging. This is an alternative to t.Logf that logs to stdout immediately, +// rather than buffering all log output and only displaying it at the very end of the test. This is useful because: +// +// 1. It allows you to iterate faster locally, as you get feedback on whether your code changes are working as expected +// right away, rather than at the very end of the test run. +// +// 2. If you have a bug in your code that causes a test to never complete or if the test code crashes,, t.Logf would +// show you no log output whatsoever, making debugging very hard, where as this method will show you all the log +// output available. +// +// 3. If you have a test that takes a long time to complete, some CI systems will kill the test suite prematurely +// because there is no log output with t.Logf (e.g., CircleCI kills tests after 10 minutes of no log output). With +// this log method, you get log output continuously. +// +// Note that there is a proposal to improve t.Logf (https://github.com/golang/go/issues/24929), but until that's +// implemented, this method is our best bet. +func Logf(t *testing.T, format string, args ...interface{}) { + DoLog(t, 2, os.Stdout, fmt.Sprintf(format, args...)) +} + +// Log logs the given arguments to stdout, along with a timestamp and information about what test and file is doing the +// logging. This is an alternative to t.Logf that logs to stdout immediately, rather than buffering all log output and +// only displaying it at the very end of the test. See the Logf method for more info. +func Log(t *testing.T, args ...interface{}) { + DoLog(t, 2, os.Stdout, args...) +} + +// DoLog logs the given arguments to the given writer, along with a timestamp and information about what test and file is +// doing the logging. +func DoLog(t *testing.T, callDepth int, writer io.Writer, args ...interface{}) { + date := time.Now() + prefix := fmt.Sprintf("%s %s %s:", t.Name(), date.Format(time.RFC3339), CallerPrefix(callDepth+1)) + allArgs := append([]interface{}{prefix}, args...) + fmt.Fprintln(writer, allArgs...) +} + +// CallerPrefix returns the file and line number information about the methods that called this method, based on the current +// goroutine's stack. The argument callDepth is the number of stack frames to ascend, with 0 identifying the method +// that called CallerPrefix, 1 identifying the method that called that method, and so on. +// +// This code is adapted from testing.go, where it is in a private method called decorate. +func CallerPrefix(callDepth int) string { + _, file, line, ok := runtime.Caller(callDepth) + if ok { + // Truncate file name at last file name separator. + if index := strings.LastIndex(file, "/"); index >= 0 { + file = file[index+1:] + } else if index = strings.LastIndex(file, "\\"); index >= 0 { + file = file[index+1:] + } + } else { + file = "???" + line = 1 + } + + return fmt.Sprintf("%s:%d", file, line) +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/retry/retry.go b/vendor/github.com/gruntwork-io/terratest/modules/retry/retry.go new file mode 100644 index 0000000..5698f53 --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/retry/retry.go @@ -0,0 +1,153 @@ +// Package retry contains logic to retry actions with certain conditions. +package retry + +import ( + "fmt" + "testing" + "time" + + "github.com/gruntwork-io/terratest/modules/logger" + "golang.org/x/net/context" +) + +// Either contains a result and potentially an error. +type Either struct { + Result string + Error error +} + +// DoWithTimeout runs the specified action and waits up to the specified timeout for it to complete. Return the output of the action if +// it completes on time or fail the test otherwise. +func DoWithTimeout(t *testing.T, actionDescription string, timeout time.Duration, action func() (string, error)) string { + out, err := DoWithTimeoutE(t, actionDescription, timeout, action) + if err != nil { + t.Fatal(err) + } + return out +} + +// DoWithTimeoutE runs the specified action and waits up to the specified timeout for it to complete. Return the output of the action if +// it completes on time or an error otherwise. +func DoWithTimeoutE(t *testing.T, actionDescription string, timeout time.Duration, action func() (string, error)) (string, error) { + ctx, cancel := context.WithTimeout(context.Background(), timeout) + defer cancel() + + resultChannel := make(chan Either, 1) + + go func() { + out, err := action() + resultChannel <- Either{Result: out, Error: err} + }() + + select { + case either := <-resultChannel: + return either.Result, either.Error + case <-ctx.Done(): + return "", TimeoutExceeded{Description: actionDescription, Timeout: timeout} + } +} + +// DoWithRetry runs the specified action. If it returns a value, return that value. If it returns a FatalError, return that error +// immediately. If it returns any other type of error, sleep for sleepBetweenRetries and try again, up to a maximum of +// maxRetries retries. If maxRetries is exceeded, fail the test. +func DoWithRetry(t *testing.T, actionDescription string, maxRetries int, sleepBetweenRetries time.Duration, action func() (string, error)) string { + out, err := DoWithRetryE(t, actionDescription, maxRetries, sleepBetweenRetries, action) + if err != nil { + t.Fatal(err) + } + return out +} + +// DoWithRetryE runs the specified action. If it returns a value, return that value. If it returns a FatalError, return that error +// immediately. If it returns any other type of error, sleep for sleepBetweenRetries and try again, up to a maximum of +// maxRetries retries. If maxRetries is exceeded, return a MaxRetriesExceeded error. +func DoWithRetryE(t *testing.T, actionDescription string, maxRetries int, sleepBetweenRetries time.Duration, action func() (string, error)) (string, error) { + var output string + var err error + + for i := 0; i <= maxRetries; i++ { + logger.Log(t, actionDescription) + + output, err = action() + if err == nil { + return output, nil + } + + if _, isFatalErr := err.(FatalError); isFatalErr { + logger.Logf(t, "Returning due to fatal error: %v", err) + return output, err + } + + logger.Logf(t, "%s returned an error: %s. Sleeping for %s and will try again.", actionDescription, err.Error(), sleepBetweenRetries) + time.Sleep(sleepBetweenRetries) + } + + return output, MaxRetriesExceeded{Description: actionDescription, MaxRetries: maxRetries} +} + +// Done can be stopped. +type Done struct { + stop chan bool +} + +// Done stops the execution. +func (done Done) Done() { + done.stop <- true +} + +// DoInBackgroundUntilStopped runs the specified action in the background (in a goroutine) repeatedly, waiting the specified amount of time between +// repetitions. To stop this action, call the Done() function on the returned value. +func DoInBackgroundUntilStopped(t *testing.T, actionDescription string, sleepBetweenRepeats time.Duration, action func()) Done { + stop := make(chan bool) + + go func() { + for { + logger.Logf(t, "Executing action '%s'", actionDescription) + + action() + + logger.Logf(t, "Sleeping for %s before repeating action '%s'", sleepBetweenRepeats, actionDescription) + + select { + case <-time.After(sleepBetweenRepeats): + // Nothing to do, just allow the loop to continue + case <-stop: + logger.Logf(t, "Received stop signal for action '%s'.", actionDescription) + return + } + } + }() + + return Done{stop: stop} +} + +// Custom error types + +// TimeoutExceeded is an error that occurs when a timeout is exceeded. +type TimeoutExceeded struct { + Description string + Timeout time.Duration +} + +func (err TimeoutExceeded) Error() string { + return fmt.Sprintf("'%s' did not complete before timeout of %s", err.Description, err.Timeout) +} + +// MaxRetriesExceeded is an error that occurs when the maximum amount of retries is exceeded. +type MaxRetriesExceeded struct { + Description string + MaxRetries int +} + +func (err MaxRetriesExceeded) Error() string { + return fmt.Sprintf("'%s' unsuccessful after %d retries", err.Description, err.MaxRetries) +} + +// FatalError is a marker interface for errors that should not be retried. +type FatalError struct { + Underlying error +} + +func (err FatalError) Error() string { + return fmt.Sprintf("FatalError{Underlying: %v}", err.Underlying) +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/shell/command.go b/vendor/github.com/gruntwork-io/terratest/modules/shell/command.go new file mode 100644 index 0000000..2ac96ec --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/shell/command.go @@ -0,0 +1,152 @@ +package shell + +import ( + "bufio" + "errors" + "fmt" + "io" + "os" + "os/exec" + "strings" + "sync" + "syscall" + "testing" + + "github.com/gruntwork-io/terratest/modules/logger" +) + +// Command is a simpler struct for defining commands than Go's built-in Cmd. +type Command struct { + Command string // The command to run + Args []string // The args to pass to the command + WorkingDir string // The working directory + Env map[string]string // Additional environment variables to set +} + +// RunCommand runs a shell command and redirects its stdout and stderr to the stdout of the atomic script itself. +func RunCommand(t *testing.T, command Command) { + err := RunCommandE(t, command) + if err != nil { + t.Fatal(err) + } +} + +// RunCommandE runs a shell command and redirects its stdout and stderr to the stdout of the atomic script itself. +func RunCommandE(t *testing.T, command Command) error { + _, err := RunCommandAndGetOutputE(t, command) + return err +} + +// RunCommandAndGetOutput runs a shell command and returns its stdout and stderr as a string. The stdout and stderr of that command will also +// be printed to the stdout and stderr of this Go program to make debugging easier. +func RunCommandAndGetOutput(t *testing.T, command Command) string { + out, err := RunCommandAndGetOutputE(t, command) + if err != nil { + t.Fatal(err) + } + return out +} + +// RunCommandAndGetOutputE runs a shell command and returns its stdout and stderr as a string. The stdout and stderr of that command will also +// be printed to the stdout and stderr of this Go program to make debugging easier. +func RunCommandAndGetOutputE(t *testing.T, command Command) (string, error) { + logger.Logf(t, "Running command %s with args %s", command.Command, command.Args) + + cmd := exec.Command(command.Command, command.Args...) + cmd.Dir = command.WorkingDir + cmd.Stdin = os.Stdin + cmd.Env = formatEnvVars(command) + + stdout, err := cmd.StdoutPipe() + if err != nil { + return "", err + } + + stderr, err := cmd.StderrPipe() + if err != nil { + return "", err + } + + err = cmd.Start() + if err != nil { + return "", err + } + + output, err := readStdoutAndStderr(t, stdout, stderr) + if err != nil { + return output, err + } + + if err := cmd.Wait(); err != nil { + return output, err + } + + return output, nil +} + +// This function captures stdout and stderr while still printing it to the stdout and stderr of this Go program +func readStdoutAndStderr(t *testing.T, stdout io.ReadCloser, stderr io.ReadCloser) (string, error) { + allOutput := []string{} + + stdoutScanner := bufio.NewScanner(stdout) + stderrScanner := bufio.NewScanner(stderr) + + wg := &sync.WaitGroup{} + mutex := &sync.Mutex{} + wg.Add(2) + go readData(t, stdoutScanner, wg, mutex, &allOutput) + go readData(t, stderrScanner, wg, mutex, &allOutput) + wg.Wait() + + if err := stdoutScanner.Err(); err != nil { + return "", err + } + + if err := stderrScanner.Err(); err != nil { + return "", err + } + + return strings.Join(allOutput, "\n"), nil +} + +func readData(t *testing.T, scanner *bufio.Scanner, wg *sync.WaitGroup, mutex *sync.Mutex, allOutput *[]string) { + defer wg.Done() + for scanner.Scan() { + logTextAndAppendToOutput(t, mutex, scanner.Text(), allOutput) + } +} + +func logTextAndAppendToOutput(t *testing.T, mutex *sync.Mutex, text string, allOutput *[]string) { + defer mutex.Unlock() + logger.Log(t, text) + mutex.Lock() + *allOutput = append(*allOutput, text) +} + +// GetExitCodeForRunCommandError tries to read the exit code for the error object returned from running a shell command. This is a bit tricky to do +// in a way that works across platforms. +func GetExitCodeForRunCommandError(err error) (int, error) { + // http://stackoverflow.com/a/10385867/483528 + if exitErr, ok := err.(*exec.ExitError); ok { + // The program has exited with an exit code != 0 + + // This works on both Unix and Windows. Although package + // syscall is generally platform dependent, WaitStatus is + // defined for both Unix and Windows and in both cases has + // an ExitStatus() method with the same signature. + if status, ok := exitErr.Sys().(syscall.WaitStatus); ok { + return status.ExitStatus(), nil + } + return 1, errors.New("could not determine exit code") + } + + return 0, nil +} + +func formatEnvVars(command Command) []string { + env := os.Environ() + for key, value := range command.Env { + env = append(env, fmt.Sprintf("%s=%s", key, value)) + } + return env +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/shell/shell.go b/vendor/github.com/gruntwork-io/terratest/modules/shell/shell.go new file mode 100644 index 0000000..5bbccbc --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/shell/shell.go @@ -0,0 +1,2 @@ +// Package shell allows to run commands in a shell. +package shell diff --git a/vendor/github.com/gruntwork-io/terratest/modules/ssh/agent.go b/vendor/github.com/gruntwork-io/terratest/modules/ssh/agent.go new file mode 100644 index 0000000..328fdd2 --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/ssh/agent.go @@ -0,0 +1,140 @@ +package ssh + +import ( + "crypto/x509" + "encoding/pem" + "io" + "io/ioutil" + "net" + "os" + "path/filepath" + "testing" + + "golang.org/x/crypto/ssh/agent" +) + +type SshAgent struct { + stop chan bool + stopped chan bool + socketDir string + socketFile string + agent agent.Agent + ln net.Listener +} + +// Create SSH agent, start it in background and returns control back to the main thread +// You should stop the agent to cleanup files afterwards by calling `defer s.Stop()` +func NewSshAgent(t *testing.T, socketDir string, socketFile string) (*SshAgent, error) { + var err error + s := &SshAgent{make(chan bool), make(chan bool), socketDir, socketFile, agent.NewKeyring(), nil} + s.ln, err = net.Listen("unix", s.socketFile) + if err != nil { + return nil, err + } + go s.run(t) + return s, nil +} + +// expose socketFile variable +func (s *SshAgent) SocketFile() string { + return s.socketFile +} + +// SSH Agent listener and handler +func (s *SshAgent) run(t *testing.T) { + defer close(s.stopped) + for { + select { + case <-s.stop: + return + default: + c, err := s.ln.Accept() + if err != nil { + select { + // When s.Stop() closes the listener, s.ln.Accept() returns an error that can be ignored + // since the agent is in stopping process + case <-s.stop: + return + // When s.ln.Accept() returns a legit error, we print it and continue accepting further requests + default: + t.Logf("could not accept connection to agent %v", err) + continue + } + } else { + defer c.Close() + go func(c io.ReadWriter) { + err := agent.ServeAgent(s.agent, c) + if err != nil { + t.Logf("could not serve ssh agent %v", err) + } + }(c) + } + } + } +} + +// Stop and clean up SSH agent +func (s *SshAgent) Stop() { + close(s.stop) + s.ln.Close() + <-s.stopped + os.RemoveAll(s.socketDir) +} + +// Instantiates and returns an in-memory ssh agent with the given KeyPair already added +// You should stop the agent to cleanup files afterwards by calling `defer sshAgent.Stop()` +func SshAgentWithKeyPair(t *testing.T, keyPair *KeyPair) *SshAgent { + sshAgent, err := SshAgentWithKeyPairE(t, keyPair) + + if err != nil { + t.Fatal(err) + } + + return sshAgent +} + +func SshAgentWithKeyPairE(t *testing.T, keyPair *KeyPair) (*SshAgent, error) { + sshAgent, err := SshAgentWithKeyPairsE(t, []*KeyPair{keyPair}) + return sshAgent, err +} + +func SshAgentWithKeyPairs(t *testing.T, keyPairs []*KeyPair) *SshAgent { + sshAgent, err := SshAgentWithKeyPairsE(t, keyPairs) + + if err != nil { + t.Fatal(err) + } + + return sshAgent +} + +// Instantiates and returns an in-memory ssh agent with the given KeyPair(s) already added +// You should stop the agent to cleanup files afterwards by calling `defer sshAgent.Stop()` +func SshAgentWithKeyPairsE(t *testing.T, keyPairs []*KeyPair) (*SshAgent, error) { + t.Log("Generating SSH Agent with given KeyPair(s)") + + // Instantiate a temporary SSH agent + socketDir, err := ioutil.TempDir("", "ssh-agent-") + if err != nil { + return nil, err + } + socketFile := filepath.Join(socketDir, "ssh_auth.sock") + sshAgent, err := NewSshAgent(t, socketDir, socketFile) + if err != nil { + return nil, err + } + + // add given ssh keys to the newly created agent + for _, keyPair := range keyPairs { + // Create SSH key for the agent using the given SSH key pair(s) + block, _ := pem.Decode([]byte(keyPair.PrivateKey)) + privateKey, err := x509.ParsePKCS1PrivateKey(block.Bytes) + if err != nil { + return nil, err + } + key := agent.AddedKey{PrivateKey: privateKey} + sshAgent.agent.Add(key) + } + + return sshAgent, err +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/ssh/key_pair.go b/vendor/github.com/gruntwork-io/terratest/modules/ssh/key_pair.go new file mode 100644 index 0000000..86cb19a --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/ssh/key_pair.go @@ -0,0 +1,57 @@ +package ssh + +import ( + "crypto/rand" + "crypto/rsa" + "crypto/x509" + "encoding/pem" + "testing" + + "github.com/gruntwork-io/terratest/modules/logger" + "golang.org/x/crypto/ssh" +) + +// KeyPair is a public and private key pair that can be used for SSH access. +type KeyPair struct { + PublicKey string + PrivateKey string +} + +// GenerateRSAKeyPair generates an RSA Keypair and return the public and private keys. +func GenerateRSAKeyPair(t *testing.T, keySize int) *KeyPair { + keyPair, err := GenerateRSAKeyPairE(t, keySize) + if err != nil { + t.Fatal(err) + } + return keyPair +} + +// GenerateRSAKeyPairE generates an RSA Keypair and return the public and private keys. +func GenerateRSAKeyPairE(t *testing.T, keySize int) (*KeyPair, error) { + logger.Logf(t, "Generating new public/private key of size %d", keySize) + + rsaKeyPair, err := rsa.GenerateKey(rand.Reader, keySize) + if err != nil { + return nil, err + } + + // Extract the private key + keyPemBlock := &pem.Block{ + Type: "RSA PRIVATE KEY", + Bytes: x509.MarshalPKCS1PrivateKey(rsaKeyPair), + } + + keyPem := string(pem.EncodeToMemory(keyPemBlock)) + + // Extract the public key + sshPubKey, err := ssh.NewPublicKey(rsaKeyPair.Public()) + if err != nil { + return nil, err + } + + sshPubKeyBytes := ssh.MarshalAuthorizedKey(sshPubKey) + sshPubKeyStr := string(sshPubKeyBytes) + + // Return + return &KeyPair{PublicKey: sshPubKeyStr, PrivateKey: keyPem}, nil +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/ssh/session.go b/vendor/github.com/gruntwork-io/terratest/modules/ssh/session.go new file mode 100644 index 0000000..f69f88c --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/ssh/session.go @@ -0,0 +1,95 @@ +package ssh + +import ( + "fmt" + "io" + "net" + "reflect" + "testing" + + "github.com/gruntwork-io/terratest/modules/collections" + "github.com/gruntwork-io/terratest/modules/logger" + "golang.org/x/crypto/ssh" +) + +// SshConnectionOptions are the options for an SSH connection. +type SshConnectionOptions struct { + Username string + Address string + Port int + AuthMethods []ssh.AuthMethod + Command string + JumpHost *SshConnectionOptions +} + +// ConnectionString returns the connection string for an SSH connection. +func (options *SshConnectionOptions) ConnectionString() string { + return fmt.Sprintf("%s:%d", options.Address, options.Port) +} + +// SshSession is a container object for all resources created by an SSH session. The reason we need this is so that we can do a +// single defer in a top-level method that calls the Cleanup method to go through and ensure all of these resources are +// released and cleaned up. +type SshSession struct { + Options *SshConnectionOptions + Client *ssh.Client + Session *ssh.Session + JumpHost *JumpHostSession + Input *func(io.WriteCloser) +} + +// Cleanup cleans up an existing SSH session. +func (sshSession *SshSession) Cleanup(t *testing.T) { + if sshSession == nil { + return + } + + // Closing the session may result in an EOF error if it's already closed (e.g. due to hitting CTRL + D), so + // don't report those errors, as there is nothing actually wrong in that case. + Close(t, sshSession.Session, io.EOF.Error()) + Close(t, sshSession.Client) + sshSession.JumpHost.Cleanup(t) +} + +// JumpHostSession is a session with a jump host. +type JumpHostSession struct { + JumpHostClient *ssh.Client + HostVirtualConnection net.Conn + HostConnection ssh.Conn +} + +// Cleanup cleans the jump host session up. +func (jumpHost *JumpHostSession) Cleanup(t *testing.T) { + if jumpHost == nil { + return + } + + // Closing a connection may result in an EOF error if it's already closed (e.g. due to hitting CTRL + D), so + // don't report those errors, as there is nothing actually wrong in that case. + Close(t, jumpHost.HostConnection, io.EOF.Error()) + Close(t, jumpHost.HostVirtualConnection, io.EOF.Error()) + Close(t, jumpHost.JumpHostClient) +} + +// Closeable can be closed. +type Closeable interface { + Close() error +} + +// Close closes a Closeable. +func Close(t *testing.T, closeable Closeable, ignoreErrors ...string) { + if interfaceIsNil(closeable) { + return + } + + if err := closeable.Close(); err != nil && !collections.ListContains(ignoreErrors, err.Error()) { + logger.Logf(t, "Error closing %s: %s", closeable, err.Error()) + } +} + +// Go is a shitty language. Checking an interface directly against nil does not work, and if you don't know the exact +// types the interface may be ahead of time, the only way to know if you're dealing with nil is to use reflection. +// http://stackoverflow.com/questions/13476349/check-for-nil-and-nil-interface-in-go +func interfaceIsNil(i interface{}) bool { + return i == nil || reflect.ValueOf(i).IsNil() +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/ssh/ssh.go b/vendor/github.com/gruntwork-io/terratest/modules/ssh/ssh.go new file mode 100644 index 0000000..1ef973b --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/ssh/ssh.go @@ -0,0 +1,578 @@ +// Package ssh allows to manage SSH connections and send commands through them. +package ssh + +import ( + "errors" + "fmt" + "io" + "net" + "os" + "path/filepath" + "strconv" + "strings" + "testing" + "time" + + "github.com/gruntwork-io/terratest/modules/customerrors" + "github.com/gruntwork-io/terratest/modules/files" + "github.com/gruntwork-io/terratest/modules/logger" + "golang.org/x/crypto/ssh" + "golang.org/x/crypto/ssh/agent" +) + +// Host is a host on AWS. +type Host struct { + Hostname string // host name or ip address + SshUserName string // user name + // set one or more authentication methods, + // the first valid method will be used + SshKeyPair *KeyPair // ssh key pair to use as authentication method (disabled by default) + SshAgent bool // enable authentication using your existing local SSH agent (disabled by default) + OverrideSshAgent *SshAgent // enable an in process `SshAgent` for connections to this host (disabled by default) +} + +type ScpDownloadOptions struct { + FileNameFilters []string //File names to match. May include bash-style wildcards. E.g., *.log. + MaxFileSizeMB int //Don't grab any files > MaxFileSizeMB + RemoteDir string //Copy from this directory on the remote machine + LocalDir string //Copy RemoteDir to this directory on the local machine + RemoteHost Host //Connection information for the remote machine +} + +// ScpFileToE uploads the contents using SCP to the given host and fails the test if the connection fails. +func ScpFileTo(t *testing.T, host Host, mode os.FileMode, remotePath, contents string) { + err := ScpFileToE(t, host, mode, remotePath, contents) + if err != nil { + t.Fatal(err) + } +} + +// ScpFileToE uploads the contents using SCP to the given host and return an error if the process fails. +func ScpFileToE(t *testing.T, host Host, mode os.FileMode, remotePath, contents string) error { + authMethods, err := createAuthMethodsForHost(host) + if err != nil { + return err + } + dir, file := filepath.Split(remotePath) + + hostOptions := SshConnectionOptions{ + Username: host.SshUserName, + Address: host.Hostname, + Port: 22, + Command: "/usr/bin/scp -t " + dir, + AuthMethods: authMethods, + } + + scp := sendScpCommandsToCopyFile(mode, file, contents) + + sshSession := &SshSession{ + Options: &hostOptions, + JumpHost: &JumpHostSession{}, + Input: &scp, + } + + defer sshSession.Cleanup(t) + + _, err = runSSHCommand(t, sshSession) + return err +} + +// ScpFileFrom downloads the file from remotePath on the given host using SCP. +func ScpFileFrom(t *testing.T, host Host, remotePath string, localDestination *os.File, useSudo bool) { + err := ScpFileFromE(t, host, remotePath, localDestination, useSudo) + + if err != nil { + t.Fatal(err) + } +} + +// ScpFileFromE downloads the file from remotePath on the given host using SCP and returns an error if the process fails. +func ScpFileFromE(t *testing.T, host Host, remotePath string, localDestination *os.File, useSudo bool) error { + authMethods, err := createAuthMethodsForHost(host) + + if err != nil { + return err + } + + dir := filepath.Dir(remotePath) + + hostOptions := SshConnectionOptions{ + Username: host.SshUserName, + Address: host.Hostname, + Port: 22, + Command: "/usr/bin/scp -t " + dir, + AuthMethods: authMethods, + } + + sshSession := &SshSession{ + Options: &hostOptions, + JumpHost: &JumpHostSession{}, + } + + defer sshSession.Cleanup(t) + + return copyFileFromRemote(t, sshSession, localDestination, remotePath, useSudo) +} + +// ScpDirFrom downloads all the files from remotePath on the given host using SCP. +func ScpDirFrom(t *testing.T, options ScpDownloadOptions, useSudo bool) { + err := ScpDirFromE(t, options, useSudo) + + if err != nil { + t.Fatal(err) + } +} + +// ScpDirFromE downloads all the files from remotePath on the given host using SCP +// and returns an error if the process fails. NOTE: only files within remotePath will +// be downloaded. This function will not recursively download subdirectories or follow +// symlinks. +func ScpDirFromE(t *testing.T, options ScpDownloadOptions, useSudo bool) error { + authMethods, err := createAuthMethodsForHost(options.RemoteHost) + if err != nil { + return err + } + + hostOptions := SshConnectionOptions{ + Username: options.RemoteHost.SshUserName, + Address: options.RemoteHost.Hostname, + Port: 22, + Command: "/usr/bin/scp -t " + options.RemoteDir, + AuthMethods: authMethods, + } + + sshSession := &SshSession{ + Options: &hostOptions, + JumpHost: &JumpHostSession{}, + } + + defer sshSession.Cleanup(t) + + filesInDir, err := listFileInRemoteDir(t, sshSession, options, useSudo) + + if err != nil { + return err + } + + if !files.FileExists(options.LocalDir) { + err := os.MkdirAll(options.LocalDir, 0755) + + if err != nil { + return err + } + } + + errorsOccurred := []error{} + + for _, fullRemoteFilePath := range filesInDir { + fileName := filepath.Base(fullRemoteFilePath) + + localFilePath := filepath.Join(options.LocalDir, fileName) + localFile, err := os.Create(localFilePath) + + if err != nil { + return err + } + + logger.Logf(t, "Copying remote file: %s to local path %s", fullRemoteFilePath, localFilePath) + + err = copyFileFromRemote(t, sshSession, localFile, fullRemoteFilePath, useSudo) + errorsOccurred = append(errorsOccurred, err) + } + + return customerrors.NewMultiError(errorsOccurred...) +} + +// CheckSshConnection checks that you can connect via SSH to the given host and fail the test if the connection fails. +func CheckSshConnection(t *testing.T, host Host) { + err := CheckSshConnectionE(t, host) + if err != nil { + t.Fatal(err) + } +} + +// CheckSshConnectionE checks that you can connect via SSH to the given host and return an error if the connection fails. +func CheckSshConnectionE(t *testing.T, host Host) error { + _, err := CheckSshCommandE(t, host, "'exit'") + return err +} + +// CheckSshCommand checks that you can connect via SSH to the given host and run the given command. Returns the stdout/stderr. +func CheckSshCommand(t *testing.T, host Host, command string) string { + out, err := CheckSshCommandE(t, host, command) + if err != nil { + t.Fatal(err) + } + return out +} + +// CheckSshCommandE checks that you can connect via SSH to the given host and run the given command. Returns the stdout/stderr. +func CheckSshCommandE(t *testing.T, host Host, command string) (string, error) { + authMethods, err := createAuthMethodsForHost(host) + if err != nil { + return "", err + } + + hostOptions := SshConnectionOptions{ + Username: host.SshUserName, + Address: host.Hostname, + Port: 22, + Command: command, + AuthMethods: authMethods, + } + + sshSession := &SshSession{ + Options: &hostOptions, + JumpHost: &JumpHostSession{}, + } + + defer sshSession.Cleanup(t) + + return runSSHCommand(t, sshSession) +} + +// CheckPrivateSshConnection attempts to connect to privateHost (which is not addressable from the Internet) via a +// separate publicHost (which is addressable from the Internet) and then executes "command" on privateHost and returns +// its output. It is useful for checking that it's possible to SSH from a Bastion Host to a private instance. +func CheckPrivateSshConnection(t *testing.T, publicHost Host, privateHost Host, command string) string { + out, err := CheckPrivateSshConnectionE(t, publicHost, privateHost, command) + if err != nil { + t.Fatal(err) + } + return out +} + +// CheckPrivateSshConnectionE attempts to connect to privateHost (which is not addressable from the Internet) via a +// separate publicHost (which is addressable from the Internet) and then executes "command" on privateHost and returns +// its output. It is useful for checking that it's possible to SSH from a Bastion Host to a private instance. +func CheckPrivateSshConnectionE(t *testing.T, publicHost Host, privateHost Host, command string) (string, error) { + jumpHostAuthMethods, err := createAuthMethodsForHost(publicHost) + if err != nil { + return "", err + } + + jumpHostOptions := SshConnectionOptions{ + Username: publicHost.SshUserName, + Address: publicHost.Hostname, + Port: 22, + AuthMethods: jumpHostAuthMethods, + } + + hostAuthMethods, err := createAuthMethodsForHost(privateHost) + if err != nil { + return "", err + } + + hostOptions := SshConnectionOptions{ + Username: privateHost.SshUserName, + Address: privateHost.Hostname, + Port: 22, + Command: command, + AuthMethods: hostAuthMethods, + JumpHost: &jumpHostOptions, + } + + sshSession := &SshSession{ + Options: &hostOptions, + JumpHost: &JumpHostSession{}, + } + + defer sshSession.Cleanup(t) + + return runSSHCommand(t, sshSession) +} + +// FetchContentsOfFiles connects to the given host via SSH and fetches the contents of the files at the given filePaths. +// If useSudo is true, then the contents will be retrieved using sudo. This method returns a map from file path to +// contents. +func FetchContentsOfFiles(t *testing.T, host Host, useSudo bool, filePaths ...string) map[string]string { + out, err := FetchContentsOfFilesE(t, host, useSudo, filePaths...) + if err != nil { + t.Fatal(err) + } + return out +} + +// FetchContentsOfFilesE connects to the given host via SSH and fetches the contents of the files at the given filePaths. +// If useSudo is true, then the contents will be retrieved using sudo. This method returns a map from file path to +// contents. +func FetchContentsOfFilesE(t *testing.T, host Host, useSudo bool, filePaths ...string) (map[string]string, error) { + filePathToContents := map[string]string{} + + for _, filePath := range filePaths { + contents, err := FetchContentsOfFileE(t, host, useSudo, filePath) + if err != nil { + return nil, err + } + + filePathToContents[filePath] = contents + } + + return filePathToContents, nil +} + +// FetchContentsOfFile connects to the given host via SSH and fetches the contents of the file at the given filePath. +// If useSudo is true, then the contents will be retrieved using sudo. This method returns the contents of that file. +func FetchContentsOfFile(t *testing.T, host Host, useSudo bool, filePath string) string { + out, err := FetchContentsOfFileE(t, host, useSudo, filePath) + if err != nil { + t.Fatal(err) + } + return out +} + +// FetchContentsOfFileE connects to the given host via SSH and fetches the contents of the file at the given filePath. +// If useSudo is true, then the contents will be retrieved using sudo. This method returns the contents of that file. +func FetchContentsOfFileE(t *testing.T, host Host, useSudo bool, filePath string) (string, error) { + command := fmt.Sprintf("cat %s", filePath) + if useSudo { + command = fmt.Sprintf("sudo %s", command) + } + + return CheckSshCommandE(t, host, command) +} + +func listFileInRemoteDir(t *testing.T, sshSession *SshSession, options ScpDownloadOptions, useSudo bool) ([]string, error) { + logger.Logf(t, "Running command %s on %s@%s", sshSession.Options.Command, sshSession.Options.Username, sshSession.Options.Address) + + var result []string + var findCommandArgs []string + + if useSudo { + findCommandArgs = append(findCommandArgs, "sudo") + } + + findCommandArgs = append(findCommandArgs, "find", options.RemoteDir) + findCommandArgs = append(findCommandArgs, "-type", "f") + + filtersLength := len(options.FileNameFilters) + if options.FileNameFilters != nil && filtersLength > 0 { + + findCommandArgs = append(findCommandArgs, "\\(") + for i, curFilter := range options.FileNameFilters { + // due to inconsistent bash behavior we need to wrap the + // filter in single quotes + curFilter = fmt.Sprintf("'%s'", curFilter) + findCommandArgs = append(findCommandArgs, "-name", curFilter) + + // only add the or flag if we're not the last element + if filtersLength-i > 1 { + findCommandArgs = append(findCommandArgs, "-o") + } + } + findCommandArgs = append(findCommandArgs, "\\)") + } + + if options.MaxFileSizeMB != 0 { + findCommandArgs = append(findCommandArgs, "-size", fmt.Sprintf("-%dM", options.MaxFileSizeMB)) + } + + finalCommandString := strings.Join(findCommandArgs, " ") + resultString, err := CheckSshCommandE(t, options.RemoteHost, finalCommandString) + + if err != nil { + return result, err + } + + // The last character returned is `\n` this results in an extra "" array + // member when we do the split below. Cut off the last character to avoid + // having to remove the blank entry in the array. + resultString = resultString[:len(resultString)-1] + + result = append(result, strings.Split(resultString, "\n")...) + return result, nil +} + +// Added based on code: https://github.com/bramvdbogaerde/go-scp/pull/6/files +func copyFileFromRemote(t *testing.T, sshSession *SshSession, file *os.File, remotePath string, useSudo bool) error { + logger.Logf(t, "Running command %s on %s@%s", sshSession.Options.Command, sshSession.Options.Username, sshSession.Options.Address) + if err := setUpSSHClient(sshSession); err != nil { + return err + } + + if err := setUpSSHSession(sshSession); err != nil { + return err + } + + command := fmt.Sprintf("dd if=%s", remotePath) + if useSudo { + command = fmt.Sprintf("sudo %s", command) + } + + r, err := sshSession.Session.Output(command) + if err != nil { + fmt.Printf("error reading from remote stdout: %s", err) + } + defer sshSession.Session.Close() + //write to local file + _, err = file.Write(r) + + return err +} + +func runSSHCommand(t *testing.T, sshSession *SshSession) (string, error) { + logger.Logf(t, "Running command %s on %s@%s", sshSession.Options.Command, sshSession.Options.Username, sshSession.Options.Address) + if err := setUpSSHClient(sshSession); err != nil { + return "", err + } + + if err := setUpSSHSession(sshSession); err != nil { + return "", err + } + + if sshSession.Input != nil { + w, err := sshSession.Session.StdinPipe() + if err != nil { + return "", err + } + go func() { + defer w.Close() + (*sshSession.Input)(w) + }() + } + + bytes, err := sshSession.Session.CombinedOutput(sshSession.Options.Command) + if err != nil { + return string(bytes), err + } + + return string(bytes), nil +} + +func setUpSSHClient(sshSession *SshSession) error { + if sshSession.Options.JumpHost == nil { + return fillSSHClientForHost(sshSession) + } + return fillSSHClientForJumpHost(sshSession) +} + +func fillSSHClientForHost(sshSession *SshSession) error { + client, err := createSSHClient(sshSession.Options) + + if err != nil { + return err + } + + sshSession.Client = client + return nil +} + +func fillSSHClientForJumpHost(sshSession *SshSession) error { + jumpHostClient, err := createSSHClient(sshSession.Options.JumpHost) + if err != nil { + return err + } + sshSession.JumpHost.JumpHostClient = jumpHostClient + + hostVirtualConn, err := jumpHostClient.Dial("tcp", sshSession.Options.ConnectionString()) + if err != nil { + return err + } + sshSession.JumpHost.HostVirtualConnection = hostVirtualConn + + hostConn, hostIncomingChannels, hostIncomingRequests, err := ssh.NewClientConn(hostVirtualConn, sshSession.Options.ConnectionString(), createSSHClientConfig(sshSession.Options)) + if err != nil { + return err + } + sshSession.JumpHost.HostConnection = hostConn + + sshSession.Client = ssh.NewClient(hostConn, hostIncomingChannels, hostIncomingRequests) + return nil +} + +func setUpSSHSession(sshSession *SshSession) error { + session, err := sshSession.Client.NewSession() + if err != nil { + return err + } + + sshSession.Session = session + return nil +} + +func createSSHClient(options *SshConnectionOptions) (*ssh.Client, error) { + sshClientConfig := createSSHClientConfig(options) + return ssh.Dial("tcp", options.ConnectionString(), sshClientConfig) +} + +func createSSHClientConfig(hostOptions *SshConnectionOptions) *ssh.ClientConfig { + clientConfig := &ssh.ClientConfig{ + User: hostOptions.Username, + Auth: hostOptions.AuthMethods, + // Do not do a host key check, as Terratest is only used for testing, not prod + HostKeyCallback: NoOpHostKeyCallback, + // By default, Go does not impose a timeout, so a SSH connection attempt can hang for a LONG time. + Timeout: 10 * time.Second, + } + clientConfig.SetDefaults() + return clientConfig +} + +// NoOpHostKeyCallback is an ssh.HostKeyCallback that does nothing. Only use this when you're sure you don't want to check the host key at all +// (e.g., only for testing and non-production use cases). +func NoOpHostKeyCallback(hostname string, remote net.Addr, key ssh.PublicKey) error { + return nil +} + +// Returns an array of authentication methods +func createAuthMethodsForHost(host Host) ([]ssh.AuthMethod, error) { + var methods []ssh.AuthMethod + + // override local ssh agent with given sshAgent instance + if host.OverrideSshAgent != nil { + conn, err := net.Dial("unix", host.OverrideSshAgent.socketFile) + if err != nil { + fmt.Print("Failed to dial in memory ssh agent") + return methods, err + } + agentClient := agent.NewClient(conn) + methods = append(methods, []ssh.AuthMethod{ssh.PublicKeysCallback(agentClient.Signers)}...) + } + + // use existing ssh agent socket + // if agent authentication is enabled and no agent is set up, returns an error + if host.SshAgent { + socket := os.Getenv("SSH_AUTH_SOCK") + conn, err := net.Dial("unix", socket) + if err != nil { + return methods, err + } + agentClient := agent.NewClient(conn) + methods = append(methods, []ssh.AuthMethod{ssh.PublicKeysCallback(agentClient.Signers)}...) + } + + // use provided ssh key pair + if host.SshKeyPair != nil { + signer, err := ssh.ParsePrivateKey([]byte(host.SshKeyPair.PrivateKey)) + if err != nil { + return methods, err + } + methods = append(methods, []ssh.AuthMethod{ssh.PublicKeys(signer)}...) + } + + // no valid authentication method was provided + if len(methods) < 1 { + return methods, errors.New("no authentication method defined") + } + + return methods, nil +} + +// sendScpCommandsToCopyFile returns a function which will send commands to the SCP binary to output a file on the remote machine. +// A full explanation of the SCP protocol can be found at +// https://web.archive.org/web/20170215184048/https://blogs.oracle.com/janp/entry/how_the_scp_protocol_works +func sendScpCommandsToCopyFile(mode os.FileMode, fileName, contents string) func(io.WriteCloser) { + return func(input io.WriteCloser) { + + octalMode := "0" + strconv.FormatInt(int64(mode), 8) + + // Create a file at with Unix permissions set to and the file will be bytes long. + fmt.Fprintln(input, "C"+octalMode, len(contents), fileName) + + // Actually send the file + fmt.Fprint(input, contents) + + // End of transfer + fmt.Fprint(input, "\x00") + } +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/apply.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/apply.go new file mode 100644 index 0000000..b8eac4f --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/apply.go @@ -0,0 +1,47 @@ +package terraform + +import ( + "testing" +) + +// InitAndApply runs terraform init and apply with the given options and return stdout/stderr from the apply command. Note that this +// method does NOT call destroy and assumes the caller is responsible for cleaning up any resources created by running +// apply. +func InitAndApply(t *testing.T, options *Options) string { + out, err := InitAndApplyE(t, options) + if err != nil { + t.Fatal(err) + } + return out +} + +// InitAndApplyE runs terraform init and apply with the given options and return stdout/stderr from the apply command. Note that this +// method does NOT call destroy and assumes the caller is responsible for cleaning up any resources created by running +// apply. +func InitAndApplyE(t *testing.T, options *Options) (string, error) { + if _, err := InitE(t, options); err != nil { + return "", err + } + + if _, err := GetE(t, options); err != nil { + return "", err + } + + return ApplyE(t, options) +} + +// Apply runs terraform apply with the given options and return stdout/stderr. Note that this method does NOT call destroy and +// assumes the caller is responsible for cleaning up any resources created by running apply. +func Apply(t *testing.T, options *Options) string { + out, err := ApplyE(t, options) + if err != nil { + t.Fatal(err) + } + return out +} + +// ApplyE runs terraform apply with the given options and return stdout/stderr. Note that this method does NOT call destroy and +// assumes the caller is responsible for cleaning up any resources created by running apply. +func ApplyE(t *testing.T, options *Options) (string, error) { + return RunTerraformCommandE(t, options, FormatArgs(options, "apply", "-input=false", "-lock=false", "-auto-approve")...) +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/cmd.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/cmd.go new file mode 100644 index 0000000..3793dc6 --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/cmd.go @@ -0,0 +1,98 @@ +package terraform + +import ( + "fmt" + "strings" + "testing" + + "github.com/gruntwork-io/terratest/modules/collections" + "github.com/gruntwork-io/terratest/modules/logger" + "github.com/gruntwork-io/terratest/modules/retry" + "github.com/gruntwork-io/terratest/modules/shell" +) + +// GetCommonOptions extracts commons terraform options +func GetCommonOptions(options *Options, args ...string) (*Options, []string) { + if options.NoColor && !collections.ListContains(args, "-no-color") { + args = append(args, "-no-color") + } + // if SshAgent is provided, override the local SSH agent with the socket of our in-process agent + if options.SshAgent != nil { + // Initialize EnvVars, if it hasn't been set yet + if options.EnvVars == nil { + options.EnvVars = map[string]string{} + } + options.EnvVars["SSH_AUTH_SOCK"] = options.SshAgent.SocketFile() + } + return options, args +} + +// RunTerraformCommand runs terraform with the given arguments and options and return stdout/stderr. +func RunTerraformCommand(t *testing.T, additionalOptions *Options, args ...string) string { + out, err := RunTerraformCommandE(t, additionalOptions, args...) + if err != nil { + t.Fatal(err) + } + return out +} + +// RunTerraformCommandE runs terraform with the given arguments and options and return stdout/stderr. +func RunTerraformCommandE(t *testing.T, additionalOptions *Options, additionalArgs ...string) (string, error) { + options, args := GetCommonOptions(additionalOptions, additionalArgs...) + + description := fmt.Sprintf("Running terraform %v", args) + return retry.DoWithRetryE(t, description, options.MaxRetries, options.TimeBetweenRetries, func() (string, error) { + cmd := shell.Command{ + Command: "terraform", + Args: args, + WorkingDir: options.TerraformDir, + Env: options.EnvVars, + } + + out, err := shell.RunCommandAndGetOutputE(t, cmd) + if err == nil { + return out, nil + } + + for errorText, errorMessage := range options.RetryableTerraformErrors { + if strings.Contains(out, errorText) { + logger.Logf(t, "terraform failed with the error '%s' but this error was expected and warrants a retry. Further details: %s\n", errorText, errorMessage) + return out, err + } + } + + return out, retry.FatalError{Underlying: err} + }) +} + +// GetExitCodeForTerraformCommand runs terraform with the given arguments and options and returns exit code +func GetExitCodeForTerraformCommand(t *testing.T, additionalOptions *Options, args ...string) int { + exitCode, err := GetExitCodeForTerraformCommandE(t, additionalOptions, args...) + if err != nil { + t.Fatal(err) + } + return exitCode +} + +// GetExitCodeForTerraformCommandE runs terraform with the given arguments and options and returns exit code +func GetExitCodeForTerraformCommandE(t *testing.T, additionalOptions *Options, additionalArgs ...string) (int, error) { + options, args := GetCommonOptions(additionalOptions, additionalArgs...) + + logger.Log(t, "Running terraform %v", args) + cmd := shell.Command{ + Command: "terraform", + Args: args, + WorkingDir: options.TerraformDir, + Env: options.EnvVars, + } + + _, err := shell.RunCommandAndGetOutputE(t, cmd) + if err == nil { + return DefaultSuccessExitCode, nil + } + exitCode, getExitCodeErr := shell.GetExitCodeForRunCommandError(err) + if getExitCodeErr == nil { + return exitCode, nil + } + return DefaultErrorExitCode, getExitCodeErr +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/destroy.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/destroy.go new file mode 100644 index 0000000..9b1c763 --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/destroy.go @@ -0,0 +1,19 @@ +package terraform + +import ( + "testing" +) + +// Destroy runs terraform destroy with the given options and return stdout/stderr. +func Destroy(t *testing.T, options *Options) string { + out, err := DestroyE(t, options) + if err != nil { + t.Fatal(err) + } + return out +} + +// DestroyE runs terraform destroy with the given options and return stdout/stderr. +func DestroyE(t *testing.T, options *Options) (string, error) { + return RunTerraformCommandE(t, options, FormatArgs(options, "destroy", "-auto-approve", "-input=false", "-lock=false")...) +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/format.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/format.go new file mode 100644 index 0000000..96b2d3b --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/format.go @@ -0,0 +1,162 @@ +package terraform + +import ( + "fmt" + "reflect" + "strings" +) + +// FormatArgs converts the inputs to a format palatable to terraform. This includes converting the given vars to the +// format the Terraform CLI expects (-var key=value). +func FormatArgs(options *Options, args ...string) []string { + var terraformArgs []string + terraformArgs = append(terraformArgs, args...) + terraformArgs = append(terraformArgs, FormatTerraformVarsAsArgs(options.Vars)...) + terraformArgs = append(terraformArgs, FormatTerraformArgs("-var-file", options.VarFiles)...) + terraformArgs = append(terraformArgs, FormatTerraformArgs("-target", options.Targets)...) + return terraformArgs +} + +// FormatTerraformVarsAsArgs formats the given variables as command-line args for Terraform (e.g. of the format +// -var key=value). +func FormatTerraformVarsAsArgs(vars map[string]interface{}) []string { + return formatTerraformArgs(vars, "-var") +} + +// FormatTerraformArgs will format multiple args with the arg name (e.g. "-var-file", []string{"foo.tfvars", "bar.tfvars"}) +// returns "-var-file foo.tfvars -var-file bar.tfvars" +func FormatTerraformArgs(argName string, args []string) []string { + argsList := []string{} + for _, argValue := range args { + argsList = append(argsList, argName, argValue) + } + return argsList +} + +// FormatTerraformBackendConfigAsArgs formats the given variables as backend config args for Terraform (e.g. of the +// format -backend-config key=value). +func FormatTerraformBackendConfigAsArgs(vars map[string]interface{}) []string { + return formatTerraformArgs(vars, "-backend-config") +} + +// Format the given vars into 'Terraform' format, with each var being prefixed with the given prefix. +func formatTerraformArgs(vars map[string]interface{}, prefix string) []string { + var args []string + + for key, value := range vars { + hclString := toHclString(value) + argValue := fmt.Sprintf("%s=%s", key, hclString) + args = append(args, prefix, argValue) + } + + return args +} + +// Terraform allows you to pass in command-line variables using HCL syntax (e.g. -var foo=[1,2,3]). Unfortunately, +// while their golang hcl library can convert an HCL string to a Go type, they don't seem to offer a library to convert +// arbitrary Go types to an HCL string. Therefore, this method is a simple implementation that correctly handles +// ints, booleans, lists, and maps. Everything else is forced into a string using Sprintf. Hopefully, this approach is +// good enough for the type of variables we deal with in Terratest. +func toHclString(value interface{}) string { + // Ideally, we'd use a type switch here to identify slices and maps, but we can't do that, because Go doesn't + // support generics, and the type switch only matches concrete types. So we could match []interface{}, but if + // a user passes in []string{}, that would NOT match (the same logic applies to maps). Therefore, we have to + // use reflection and manually convert into []interface{} and map[string]interface{}. + + if slice, isSlice := tryToConvertToGenericSlice(value); isSlice { + return sliceToHclString(slice) + } else if m, isMap := tryToConvertToGenericMap(value); isMap { + return mapToHclString(m) + } else { + return primitiveToHclString(value) + } +} + +// Try to convert the given value to a generic slice. Return the slice and true if the underlying value itself was a +// slice and an empty slice and false if it wasn't. This is necessary because Go is a shitty language that doesn't +// have generics, nor useful utility methods built-in. For more info, see: http://stackoverflow.com/a/12754757/483528 +func tryToConvertToGenericSlice(value interface{}) ([]interface{}, bool) { + reflectValue := reflect.ValueOf(value) + if reflectValue.Kind() != reflect.Slice { + return []interface{}{}, false + } + + genericSlice := make([]interface{}, reflectValue.Len()) + + for i := 0; i < reflectValue.Len(); i++ { + genericSlice[i] = reflectValue.Index(i).Interface() + } + + return genericSlice, true +} + +// Try to convert the given value to a generic map. Return the map and true if the underlying value itself was a +// map and an empty map and false if it wasn't. This is necessary because Go is a shitty language that doesn't +// have generics, nor useful utility methods built-in. For more info, see: http://stackoverflow.com/a/12754757/483528 +func tryToConvertToGenericMap(value interface{}) (map[string]interface{}, bool) { + reflectValue := reflect.ValueOf(value) + if reflectValue.Kind() != reflect.Map { + return map[string]interface{}{}, false + } + + reflectType := reflect.TypeOf(value) + if reflectType.Key().Kind() != reflect.String { + return map[string]interface{}{}, false + } + + genericMap := make(map[string]interface{}, reflectValue.Len()) + + mapKeys := reflectValue.MapKeys() + for _, key := range mapKeys { + genericMap[key.String()] = reflectValue.MapIndex(key).Interface() + } + + return genericMap, true +} + +// Convert a slice to an HCL string. See ToHclString for details. +func sliceToHclString(slice []interface{}) string { + hclValues := []string{} + + for _, value := range slice { + hclValue := toHclString(value) + hclValues = append(hclValues, hclValue) + } + + return fmt.Sprintf("[%s]", strings.Join(hclValues, ", ")) +} + +// Convert a map to an HCL string. See ToHclString for details. +func mapToHclString(m map[string]interface{}) string { + keyValuePairs := []string{} + + for key, value := range m { + keyValuePair := fmt.Sprintf("%s = %s", key, toHclString(value)) + keyValuePairs = append(keyValuePairs, keyValuePair) + } + + return fmt.Sprintf("{%s}", strings.Join(keyValuePairs, ", ")) +} + +// Convert a primitive, such as a bool, int, or string, to an HCL string. If this isn't a primitive, force its value +// using Sprintf. See ToHclString for details. +func primitiveToHclString(value interface{}) string { + switch v := value.(type) { + + // Terraform treats a boolean true as a 1 and a boolean false as a 0. It's best to convert to these ints when + // passing booleans as -var parameters. Moreover, due to a Terraform bug + // (https://github.com/hashicorp/terraform/issues/7962), all ints must be wrapped as strings. + case bool: + if v { + return "\"1\"" + } + return "\"0\"" + + // Note: due to a Terraform bug (https://github.com/hashicorp/terraform/issues/7962), we can't use proper HCL + // syntax for ints have to wrap them as strings by falling through to the default case + //case int: return strconv.Itoa(v) + + default: + return fmt.Sprintf("\"%v\"", v) + } +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/get.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/get.go new file mode 100644 index 0000000..04df931 --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/get.go @@ -0,0 +1,19 @@ +package terraform + +import ( + "testing" +) + +// Get calls terraform get and return stdout/stderr. +func Get(t *testing.T, options *Options) string { + out, err := GetE(t, options) + if err != nil { + t.Fatal(err) + } + return out +} + +// GetE calls terraform get and return stdout/stderr. +func GetE(t *testing.T, options *Options) (string, error) { + return RunTerraformCommandE(t, options, "get", "-update") +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/init.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/init.go new file mode 100644 index 0000000..471dc1b --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/init.go @@ -0,0 +1,22 @@ +package terraform + +import ( + "fmt" + "testing" +) + +// Init calls terraform init and return stdout/stderr. +func Init(t *testing.T, options *Options) string { + out, err := InitE(t, options) + if err != nil { + t.Fatal(err) + } + return out +} + +// InitE calls terraform init and return stdout/stderr. +func InitE(t *testing.T, options *Options) (string, error) { + args := []string{"init", fmt.Sprintf("-upgrade=%t", options.Upgrade)} + args = append(args, FormatTerraformBackendConfigAsArgs(options.BackendConfig)...) + return RunTerraformCommandE(t, options, args...) +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/options.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/options.go new file mode 100644 index 0000000..6322ccd --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/options.go @@ -0,0 +1,23 @@ +package terraform + +import ( + "time" + + "github.com/gruntwork-io/terratest/modules/ssh" +) + +// Options for running Terraform commands +type Options struct { + TerraformDir string // The path to the folder where the Terraform code is defined. + Vars map[string]interface{} // The vars to pass to Terraform commands using the -var option. + VarFiles []string // The var file paths to pass to Terraform commands using -var-file option. + Targets []string // The target resources to pass to the terraform command with -target + EnvVars map[string]string // Environment variables to set when running Terraform + BackendConfig map[string]interface{} // The vars to pass to the terraform init command for extra configuration for the backend + RetryableTerraformErrors map[string]string // If Terraform apply fails with one of these (transient) errors, retry. The keys are text to look for in the error and the message is what to display to a user if that error is found. + MaxRetries int // Maximum number of times to retry errors matching RetryableTerraformErrors + TimeBetweenRetries time.Duration // The amount of time to wait between retries + Upgrade bool // Whether the -upgrade flag of the terraform init command should be set to true or not + NoColor bool // Whether the -no-color flag will be set for any Terraform command or not + SshAgent *ssh.SshAgent // Overrides local SSH agent with the given in-process agent +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/output.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/output.go new file mode 100644 index 0000000..8a12920 --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/output.go @@ -0,0 +1,196 @@ +package terraform + +import ( + "encoding/json" + "fmt" + "strings" + "testing" +) + +// Output calls terraform output for the given variable and return its value. +func Output(t *testing.T, options *Options, key string) string { + out, err := OutputE(t, options, key) + if err != nil { + t.Fatal(err) + } + return out +} + +// OutputE calls terraform output for the given variable and return its value. +func OutputE(t *testing.T, options *Options, key string) (string, error) { + output, err := RunTerraformCommandE(t, options, "output", "-no-color", key) + + if err != nil { + return "", err + } + + return strings.TrimSpace(output), nil +} + +// OutputRequired calls terraform output for the given variable and return its value. If the value is empty, fail the test. +func OutputRequired(t *testing.T, options *Options, key string) string { + out, err := OutputRequiredE(t, options, key) + if err != nil { + t.Fatal(err) + } + return out +} + +// OutputRequiredE calls terraform output for the given variable and return its value. If the value is empty, return an error. +func OutputRequiredE(t *testing.T, options *Options, key string) (string, error) { + out, err := OutputE(t, options, key) + + if err != nil { + return "", err + } + if out == "" { + return "", EmptyOutput(key) + } + + return out, nil +} + +// OutputList calls terraform output for the given variable and returns its value as a list. +// If the output value is not a list type, then it fails the test. +func OutputList(t *testing.T, options *Options, key string) []string { + out, err := OutputListE(t, options, key) + if err != nil { + t.Fatal(err) + } + return out +} + +// OutputListE calls terraform output for the given variable and returns its value as a list. +// If the output value is not a list type, then it returns an error. +func OutputListE(t *testing.T, options *Options, key string) ([]string, error) { + out, err := RunTerraformCommandE(t, options, "output", "-no-color", "-json", key) + if err != nil { + return nil, err + } + + outputMap := map[string]interface{}{} + if err := json.Unmarshal([]byte(out), &outputMap); err != nil { + return nil, err + } + + value, containsValue := outputMap["value"] + if !containsValue { + return nil, fmt.Errorf("Output doesn't contain a value for the key %q", key) + } + + list := []string{} + switch t := value.(type) { + case []interface{}: + for _, item := range t { + list = append(list, fmt.Sprintf("%v", item)) + } + default: + return nil, fmt.Errorf("Output value %q is not a list", value) + } + + return list, nil +} + +// OutputMap calls terraform output for the given variable and returns its value as a map. +// If the output value is not a map type, then it fails the test. +func OutputMap(t *testing.T, options *Options, key string) map[string]string { + out, err := OutputMapE(t, options, key) + if err != nil { + t.Fatal(err) + } + return out +} + +// OutputMapE calls terraform output for the given variable and returns its value as a map. +// If the output value is not a map type, then it returns an error. +func OutputMapE(t *testing.T, options *Options, key string) (map[string]string, error) { + out, err := RunTerraformCommandE(t, options, "output", "-no-color", "-json", key) + if err != nil { + return nil, err + } + + outputMap := map[string]interface{}{} + if err := json.Unmarshal([]byte(out), &outputMap); err != nil { + return nil, err + } + + value, containsValue := outputMap["value"] + if !containsValue { + return nil, fmt.Errorf("Output doesn't contain a value for the key %q", key) + } + + valueMap, ok := value.(map[string]interface{}) + if !ok { + return nil, fmt.Errorf("Output value %q is not a map", value) + } + + resultMap := make(map[string]string) + for k, v := range valueMap { + resultMap[k] = fmt.Sprintf("%v", v) + } + return resultMap, nil +} + +// OutputForKeysE calls terraform output for the given key list and returns values as a map. +// If keys not found in the output, fails the test +func OutputForKeys(t *testing.T, options *Options, keys []string) map[string]interface{} { + out, err := OutputForKeysE(t, options, keys) + if err != nil { + t.Fatal(err) + } + return out +} + +// OutputForKeysE calls terraform output for the given key list and returns values as a map. +// The returned values are of type interface{} and need to be type casted as necessary. Refer to output_test.go +func OutputForKeysE(t *testing.T, options *Options, keys []string) (map[string]interface{}, error) { + out, err := RunTerraformCommandE(t, options, "output", "-no-color", "-json") + if err != nil { + return nil, err + } + + outputMap := map[string]map[string]interface{}{} + if err := json.Unmarshal([]byte(out), &outputMap); err != nil { + return nil, err + } + + if keys == nil { + outputKeys := make([]string, 0, len(outputMap)) + for k := range outputMap { + outputKeys = append(outputKeys, k) + } + keys = outputKeys + } + + resultMap := make(map[string]interface{}) + for _, key := range keys { + value, containsValue := outputMap[key]["value"] + if !containsValue { + return nil, fmt.Errorf("output doesn't contain a value for the key %q", key) + } + resultMap[key] = value + } + return resultMap, nil +} + +// OutputAll calls terraform output returns all values as a map. +// If there is error fetching the output, fails the test +func OutputAll(t *testing.T, options *Options) map[string]interface{} { + out, err := OutputAllE(t, options) + if err != nil { + t.Fatal(err) + } + return out +} + +// OutputListE calls terraform output and returns all the outputs as a map +func OutputAllE(t *testing.T, options *Options) (map[string]interface{}, error) { + return OutputForKeysE(t, options, nil) +} + +// EmptyOutput is an error that occurs when an output is empty. +type EmptyOutput string + +func (outputName EmptyOutput) Error() string { + return fmt.Sprintf("Required output %s was empty", string(outputName)) +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/plan.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/plan.go new file mode 100644 index 0000000..58cb72d --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/plan.go @@ -0,0 +1,37 @@ +package terraform + +import ( + "testing" +) + +// InitAndPlan runs terraform init and plan with the given options and return stdout/stderr from the apply command. +func InitAndPlan(t *testing.T, options *Options) int { + exitCode, err := InitAndPlanE(t, options) + if err != nil { + t.Fatal(err) + } + return exitCode +} + +// InitAndPlanE runs terraform init and plan with the given options and return stdout/stderr from the apply command. +func InitAndPlanE(t *testing.T, options *Options) (int, error) { + if _, err := InitE(t, options); err != nil { + return DefaultErrorExitCode, err + } + + return PlanExitCodeE(t, options) +} + +// PlanExitCode runs terraform apply with the given options and returns the detailed exitcode. +func PlanExitCode(t *testing.T, options *Options) int { + exitCode, err := PlanExitCodeE(t, options) + if err != nil { + t.Fatal(err) + } + return exitCode +} + +// PlanExitCodeE runs terraform apply with the given options and returns the detailed exitcode. +func PlanExitCodeE(t *testing.T, options *Options) (int, error) { + return GetExitCodeForTerraformCommandE(t, options, FormatArgs(options, "plan", "-input=false", "-lock=true", "-detailed-exitcode")...) +} diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/terraform.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/terraform.go new file mode 100644 index 0000000..24a7581 --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/terraform.go @@ -0,0 +1,13 @@ +// Package terraform allows to interact with Terraform. +package terraform + +// https://www.terraform.io/docs/commands/plan.html#detailed-exitcode + +// TerraformPlanChangesPresentExitCode is the exit code returned by terraform plan detailed exitcode when changes are present +const TerraformPlanChangesPresentExitCode = 2 + +// DefaultSuccessExitCode is the exit code returned when terraform command succeeds +const DefaultSuccessExitCode = 0 + +// DefaultErrorExitCode is the exit code returned when terraform command fails +const DefaultErrorExitCode = 1 diff --git a/vendor/github.com/gruntwork-io/terratest/modules/terraform/workspace.go b/vendor/github.com/gruntwork-io/terratest/modules/terraform/workspace.go new file mode 100644 index 0000000..98c57a9 --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/modules/terraform/workspace.go @@ -0,0 +1,61 @@ +package terraform + +import ( + "fmt" + "regexp" + "strings" + "testing" +) + +// WorkspaceSelectOrNew runs terraform workspace with the given options and the workspace name +// and returns a name of the current workspace. It tries to select a workspace with the given +// name, or it creates a new one if it doesn't exist. +func WorkspaceSelectOrNew(t *testing.T, options *Options, name string) string { + out, err := WorkspaceSelectOrNewE(t, options, name) + if err != nil { + t.Fatal(err) + } + return out +} + +// WorkspaceSelectOrNewE runs terraform workspace with the given options and the workspace name +// and returns a name of the current workspace. It tries to select a workspace with the given +// name, or it creates a new one if it doesn't exist. +func WorkspaceSelectOrNewE(t *testing.T, options *Options, name string) (string, error) { + out, err := RunTerraformCommandE(t, options, "workspace", "list") + if err != nil { + return "", err + } + + if isExistingWorkspace(out, name) { + _, err = RunTerraformCommandE(t, options, "workspace", "select", name) + } else { + _, err = RunTerraformCommandE(t, options, "workspace", "new", name) + } + if err != nil { + return "", err + } + + return RunTerraformCommandE(t, options, "workspace", "show") +} + +func isExistingWorkspace(out string, name string) bool { + workspaces := strings.Split(out, "\n") + for _, ws := range workspaces { + if nameMatchesWorkspace(name, ws) { + return true + } + } + return false +} + +func nameMatchesWorkspace(name string, workspace string) bool { + // Regex for matching workspace should match for strings with optional leading asterisk "*" + // following optional white spaces following the workspace name. + // E.g. for the given name "terratest", following strings will match: + // + // "* terratest" + // " terratest" + match, _ := regexp.MatchString(fmt.Sprintf("^\\*?\\s*%s$", name), workspace) + return match +} diff --git a/vendor/github.com/gruntwork-io/terratest/test/fixtures/copy-folder-contents/symlinks/bar.txt b/vendor/github.com/gruntwork-io/terratest/test/fixtures/copy-folder-contents/symlinks/bar.txt new file mode 120000 index 0000000..9551c0b --- /dev/null +++ b/vendor/github.com/gruntwork-io/terratest/test/fixtures/copy-folder-contents/symlinks/bar.txt @@ -0,0 +1 @@ +subfolder/bar.txt \ No newline at end of file diff --git a/vendor/github.com/pmezard/go-difflib/LICENSE b/vendor/github.com/pmezard/go-difflib/LICENSE new file mode 100644 index 0000000..c67dad6 --- /dev/null +++ b/vendor/github.com/pmezard/go-difflib/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2013, Patrick Mezard +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + Redistributions in binary form must reproduce the above copyright +notice, this list of conditions and the following disclaimer in the +documentation and/or other materials provided with the distribution. + The names of its contributors may not be used to endorse or promote +products derived from this software without specific prior written +permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS +IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED +TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A +PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED +TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR +PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF +LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/github.com/pmezard/go-difflib/difflib/difflib.go b/vendor/github.com/pmezard/go-difflib/difflib/difflib.go new file mode 100644 index 0000000..003e99f --- /dev/null +++ b/vendor/github.com/pmezard/go-difflib/difflib/difflib.go @@ -0,0 +1,772 @@ +// Package difflib is a partial port of Python difflib module. +// +// It provides tools to compare sequences of strings and generate textual diffs. +// +// The following class and functions have been ported: +// +// - SequenceMatcher +// +// - unified_diff +// +// - context_diff +// +// Getting unified diffs was the main goal of the port. Keep in mind this code +// is mostly suitable to output text differences in a human friendly way, there +// are no guarantees generated diffs are consumable by patch(1). +package difflib + +import ( + "bufio" + "bytes" + "fmt" + "io" + "strings" +) + +func min(a, b int) int { + if a < b { + return a + } + return b +} + +func max(a, b int) int { + if a > b { + return a + } + return b +} + +func calculateRatio(matches, length int) float64 { + if length > 0 { + return 2.0 * float64(matches) / float64(length) + } + return 1.0 +} + +type Match struct { + A int + B int + Size int +} + +type OpCode struct { + Tag byte + I1 int + I2 int + J1 int + J2 int +} + +// SequenceMatcher compares sequence of strings. The basic +// algorithm predates, and is a little fancier than, an algorithm +// published in the late 1980's by Ratcliff and Obershelp under the +// hyperbolic name "gestalt pattern matching". The basic idea is to find +// the longest contiguous matching subsequence that contains no "junk" +// elements (R-O doesn't address junk). The same idea is then applied +// recursively to the pieces of the sequences to the left and to the right +// of the matching subsequence. This does not yield minimal edit +// sequences, but does tend to yield matches that "look right" to people. +// +// SequenceMatcher tries to compute a "human-friendly diff" between two +// sequences. Unlike e.g. UNIX(tm) diff, the fundamental notion is the +// longest *contiguous* & junk-free matching subsequence. That's what +// catches peoples' eyes. The Windows(tm) windiff has another interesting +// notion, pairing up elements that appear uniquely in each sequence. +// That, and the method here, appear to yield more intuitive difference +// reports than does diff. This method appears to be the least vulnerable +// to synching up on blocks of "junk lines", though (like blank lines in +// ordinary text files, or maybe "

" lines in HTML files). That may be +// because this is the only method of the 3 that has a *concept* of +// "junk" . +// +// Timing: Basic R-O is cubic time worst case and quadratic time expected +// case. SequenceMatcher is quadratic time for the worst case and has +// expected-case behavior dependent in a complicated way on how many +// elements the sequences have in common; best case time is linear. +type SequenceMatcher struct { + a []string + b []string + b2j map[string][]int + IsJunk func(string) bool + autoJunk bool + bJunk map[string]struct{} + matchingBlocks []Match + fullBCount map[string]int + bPopular map[string]struct{} + opCodes []OpCode +} + +func NewMatcher(a, b []string) *SequenceMatcher { + m := SequenceMatcher{autoJunk: true} + m.SetSeqs(a, b) + return &m +} + +func NewMatcherWithJunk(a, b []string, autoJunk bool, + isJunk func(string) bool) *SequenceMatcher { + + m := SequenceMatcher{IsJunk: isJunk, autoJunk: autoJunk} + m.SetSeqs(a, b) + return &m +} + +// Set two sequences to be compared. +func (m *SequenceMatcher) SetSeqs(a, b []string) { + m.SetSeq1(a) + m.SetSeq2(b) +} + +// Set the first sequence to be compared. The second sequence to be compared is +// not changed. +// +// SequenceMatcher computes and caches detailed information about the second +// sequence, so if you want to compare one sequence S against many sequences, +// use .SetSeq2(s) once and call .SetSeq1(x) repeatedly for each of the other +// sequences. +// +// See also SetSeqs() and SetSeq2(). +func (m *SequenceMatcher) SetSeq1(a []string) { + if &a == &m.a { + return + } + m.a = a + m.matchingBlocks = nil + m.opCodes = nil +} + +// Set the second sequence to be compared. The first sequence to be compared is +// not changed. +func (m *SequenceMatcher) SetSeq2(b []string) { + if &b == &m.b { + return + } + m.b = b + m.matchingBlocks = nil + m.opCodes = nil + m.fullBCount = nil + m.chainB() +} + +func (m *SequenceMatcher) chainB() { + // Populate line -> index mapping + b2j := map[string][]int{} + for i, s := range m.b { + indices := b2j[s] + indices = append(indices, i) + b2j[s] = indices + } + + // Purge junk elements + m.bJunk = map[string]struct{}{} + if m.IsJunk != nil { + junk := m.bJunk + for s, _ := range b2j { + if m.IsJunk(s) { + junk[s] = struct{}{} + } + } + for s, _ := range junk { + delete(b2j, s) + } + } + + // Purge remaining popular elements + popular := map[string]struct{}{} + n := len(m.b) + if m.autoJunk && n >= 200 { + ntest := n/100 + 1 + for s, indices := range b2j { + if len(indices) > ntest { + popular[s] = struct{}{} + } + } + for s, _ := range popular { + delete(b2j, s) + } + } + m.bPopular = popular + m.b2j = b2j +} + +func (m *SequenceMatcher) isBJunk(s string) bool { + _, ok := m.bJunk[s] + return ok +} + +// Find longest matching block in a[alo:ahi] and b[blo:bhi]. +// +// If IsJunk is not defined: +// +// Return (i,j,k) such that a[i:i+k] is equal to b[j:j+k], where +// alo <= i <= i+k <= ahi +// blo <= j <= j+k <= bhi +// and for all (i',j',k') meeting those conditions, +// k >= k' +// i <= i' +// and if i == i', j <= j' +// +// In other words, of all maximal matching blocks, return one that +// starts earliest in a, and of all those maximal matching blocks that +// start earliest in a, return the one that starts earliest in b. +// +// If IsJunk is defined, first the longest matching block is +// determined as above, but with the additional restriction that no +// junk element appears in the block. Then that block is extended as +// far as possible by matching (only) junk elements on both sides. So +// the resulting block never matches on junk except as identical junk +// happens to be adjacent to an "interesting" match. +// +// If no blocks match, return (alo, blo, 0). +func (m *SequenceMatcher) findLongestMatch(alo, ahi, blo, bhi int) Match { + // CAUTION: stripping common prefix or suffix would be incorrect. + // E.g., + // ab + // acab + // Longest matching block is "ab", but if common prefix is + // stripped, it's "a" (tied with "b"). UNIX(tm) diff does so + // strip, so ends up claiming that ab is changed to acab by + // inserting "ca" in the middle. That's minimal but unintuitive: + // "it's obvious" that someone inserted "ac" at the front. + // Windiff ends up at the same place as diff, but by pairing up + // the unique 'b's and then matching the first two 'a's. + besti, bestj, bestsize := alo, blo, 0 + + // find longest junk-free match + // during an iteration of the loop, j2len[j] = length of longest + // junk-free match ending with a[i-1] and b[j] + j2len := map[int]int{} + for i := alo; i != ahi; i++ { + // look at all instances of a[i] in b; note that because + // b2j has no junk keys, the loop is skipped if a[i] is junk + newj2len := map[int]int{} + for _, j := range m.b2j[m.a[i]] { + // a[i] matches b[j] + if j < blo { + continue + } + if j >= bhi { + break + } + k := j2len[j-1] + 1 + newj2len[j] = k + if k > bestsize { + besti, bestj, bestsize = i-k+1, j-k+1, k + } + } + j2len = newj2len + } + + // Extend the best by non-junk elements on each end. In particular, + // "popular" non-junk elements aren't in b2j, which greatly speeds + // the inner loop above, but also means "the best" match so far + // doesn't contain any junk *or* popular non-junk elements. + for besti > alo && bestj > blo && !m.isBJunk(m.b[bestj-1]) && + m.a[besti-1] == m.b[bestj-1] { + besti, bestj, bestsize = besti-1, bestj-1, bestsize+1 + } + for besti+bestsize < ahi && bestj+bestsize < bhi && + !m.isBJunk(m.b[bestj+bestsize]) && + m.a[besti+bestsize] == m.b[bestj+bestsize] { + bestsize += 1 + } + + // Now that we have a wholly interesting match (albeit possibly + // empty!), we may as well suck up the matching junk on each + // side of it too. Can't think of a good reason not to, and it + // saves post-processing the (possibly considerable) expense of + // figuring out what to do with it. In the case of an empty + // interesting match, this is clearly the right thing to do, + // because no other kind of match is possible in the regions. + for besti > alo && bestj > blo && m.isBJunk(m.b[bestj-1]) && + m.a[besti-1] == m.b[bestj-1] { + besti, bestj, bestsize = besti-1, bestj-1, bestsize+1 + } + for besti+bestsize < ahi && bestj+bestsize < bhi && + m.isBJunk(m.b[bestj+bestsize]) && + m.a[besti+bestsize] == m.b[bestj+bestsize] { + bestsize += 1 + } + + return Match{A: besti, B: bestj, Size: bestsize} +} + +// Return list of triples describing matching subsequences. +// +// Each triple is of the form (i, j, n), and means that +// a[i:i+n] == b[j:j+n]. The triples are monotonically increasing in +// i and in j. It's also guaranteed that if (i, j, n) and (i', j', n') are +// adjacent triples in the list, and the second is not the last triple in the +// list, then i+n != i' or j+n != j'. IOW, adjacent triples never describe +// adjacent equal blocks. +// +// The last triple is a dummy, (len(a), len(b), 0), and is the only +// triple with n==0. +func (m *SequenceMatcher) GetMatchingBlocks() []Match { + if m.matchingBlocks != nil { + return m.matchingBlocks + } + + var matchBlocks func(alo, ahi, blo, bhi int, matched []Match) []Match + matchBlocks = func(alo, ahi, blo, bhi int, matched []Match) []Match { + match := m.findLongestMatch(alo, ahi, blo, bhi) + i, j, k := match.A, match.B, match.Size + if match.Size > 0 { + if alo < i && blo < j { + matched = matchBlocks(alo, i, blo, j, matched) + } + matched = append(matched, match) + if i+k < ahi && j+k < bhi { + matched = matchBlocks(i+k, ahi, j+k, bhi, matched) + } + } + return matched + } + matched := matchBlocks(0, len(m.a), 0, len(m.b), nil) + + // It's possible that we have adjacent equal blocks in the + // matching_blocks list now. + nonAdjacent := []Match{} + i1, j1, k1 := 0, 0, 0 + for _, b := range matched { + // Is this block adjacent to i1, j1, k1? + i2, j2, k2 := b.A, b.B, b.Size + if i1+k1 == i2 && j1+k1 == j2 { + // Yes, so collapse them -- this just increases the length of + // the first block by the length of the second, and the first + // block so lengthened remains the block to compare against. + k1 += k2 + } else { + // Not adjacent. Remember the first block (k1==0 means it's + // the dummy we started with), and make the second block the + // new block to compare against. + if k1 > 0 { + nonAdjacent = append(nonAdjacent, Match{i1, j1, k1}) + } + i1, j1, k1 = i2, j2, k2 + } + } + if k1 > 0 { + nonAdjacent = append(nonAdjacent, Match{i1, j1, k1}) + } + + nonAdjacent = append(nonAdjacent, Match{len(m.a), len(m.b), 0}) + m.matchingBlocks = nonAdjacent + return m.matchingBlocks +} + +// Return list of 5-tuples describing how to turn a into b. +// +// Each tuple is of the form (tag, i1, i2, j1, j2). The first tuple +// has i1 == j1 == 0, and remaining tuples have i1 == the i2 from the +// tuple preceding it, and likewise for j1 == the previous j2. +// +// The tags are characters, with these meanings: +// +// 'r' (replace): a[i1:i2] should be replaced by b[j1:j2] +// +// 'd' (delete): a[i1:i2] should be deleted, j1==j2 in this case. +// +// 'i' (insert): b[j1:j2] should be inserted at a[i1:i1], i1==i2 in this case. +// +// 'e' (equal): a[i1:i2] == b[j1:j2] +func (m *SequenceMatcher) GetOpCodes() []OpCode { + if m.opCodes != nil { + return m.opCodes + } + i, j := 0, 0 + matching := m.GetMatchingBlocks() + opCodes := make([]OpCode, 0, len(matching)) + for _, m := range matching { + // invariant: we've pumped out correct diffs to change + // a[:i] into b[:j], and the next matching block is + // a[ai:ai+size] == b[bj:bj+size]. So we need to pump + // out a diff to change a[i:ai] into b[j:bj], pump out + // the matching block, and move (i,j) beyond the match + ai, bj, size := m.A, m.B, m.Size + tag := byte(0) + if i < ai && j < bj { + tag = 'r' + } else if i < ai { + tag = 'd' + } else if j < bj { + tag = 'i' + } + if tag > 0 { + opCodes = append(opCodes, OpCode{tag, i, ai, j, bj}) + } + i, j = ai+size, bj+size + // the list of matching blocks is terminated by a + // sentinel with size 0 + if size > 0 { + opCodes = append(opCodes, OpCode{'e', ai, i, bj, j}) + } + } + m.opCodes = opCodes + return m.opCodes +} + +// Isolate change clusters by eliminating ranges with no changes. +// +// Return a generator of groups with up to n lines of context. +// Each group is in the same format as returned by GetOpCodes(). +func (m *SequenceMatcher) GetGroupedOpCodes(n int) [][]OpCode { + if n < 0 { + n = 3 + } + codes := m.GetOpCodes() + if len(codes) == 0 { + codes = []OpCode{OpCode{'e', 0, 1, 0, 1}} + } + // Fixup leading and trailing groups if they show no changes. + if codes[0].Tag == 'e' { + c := codes[0] + i1, i2, j1, j2 := c.I1, c.I2, c.J1, c.J2 + codes[0] = OpCode{c.Tag, max(i1, i2-n), i2, max(j1, j2-n), j2} + } + if codes[len(codes)-1].Tag == 'e' { + c := codes[len(codes)-1] + i1, i2, j1, j2 := c.I1, c.I2, c.J1, c.J2 + codes[len(codes)-1] = OpCode{c.Tag, i1, min(i2, i1+n), j1, min(j2, j1+n)} + } + nn := n + n + groups := [][]OpCode{} + group := []OpCode{} + for _, c := range codes { + i1, i2, j1, j2 := c.I1, c.I2, c.J1, c.J2 + // End the current group and start a new one whenever + // there is a large range with no changes. + if c.Tag == 'e' && i2-i1 > nn { + group = append(group, OpCode{c.Tag, i1, min(i2, i1+n), + j1, min(j2, j1+n)}) + groups = append(groups, group) + group = []OpCode{} + i1, j1 = max(i1, i2-n), max(j1, j2-n) + } + group = append(group, OpCode{c.Tag, i1, i2, j1, j2}) + } + if len(group) > 0 && !(len(group) == 1 && group[0].Tag == 'e') { + groups = append(groups, group) + } + return groups +} + +// Return a measure of the sequences' similarity (float in [0,1]). +// +// Where T is the total number of elements in both sequences, and +// M is the number of matches, this is 2.0*M / T. +// Note that this is 1 if the sequences are identical, and 0 if +// they have nothing in common. +// +// .Ratio() is expensive to compute if you haven't already computed +// .GetMatchingBlocks() or .GetOpCodes(), in which case you may +// want to try .QuickRatio() or .RealQuickRation() first to get an +// upper bound. +func (m *SequenceMatcher) Ratio() float64 { + matches := 0 + for _, m := range m.GetMatchingBlocks() { + matches += m.Size + } + return calculateRatio(matches, len(m.a)+len(m.b)) +} + +// Return an upper bound on ratio() relatively quickly. +// +// This isn't defined beyond that it is an upper bound on .Ratio(), and +// is faster to compute. +func (m *SequenceMatcher) QuickRatio() float64 { + // viewing a and b as multisets, set matches to the cardinality + // of their intersection; this counts the number of matches + // without regard to order, so is clearly an upper bound + if m.fullBCount == nil { + m.fullBCount = map[string]int{} + for _, s := range m.b { + m.fullBCount[s] = m.fullBCount[s] + 1 + } + } + + // avail[x] is the number of times x appears in 'b' less the + // number of times we've seen it in 'a' so far ... kinda + avail := map[string]int{} + matches := 0 + for _, s := range m.a { + n, ok := avail[s] + if !ok { + n = m.fullBCount[s] + } + avail[s] = n - 1 + if n > 0 { + matches += 1 + } + } + return calculateRatio(matches, len(m.a)+len(m.b)) +} + +// Return an upper bound on ratio() very quickly. +// +// This isn't defined beyond that it is an upper bound on .Ratio(), and +// is faster to compute than either .Ratio() or .QuickRatio(). +func (m *SequenceMatcher) RealQuickRatio() float64 { + la, lb := len(m.a), len(m.b) + return calculateRatio(min(la, lb), la+lb) +} + +// Convert range to the "ed" format +func formatRangeUnified(start, stop int) string { + // Per the diff spec at http://www.unix.org/single_unix_specification/ + beginning := start + 1 // lines start numbering with one + length := stop - start + if length == 1 { + return fmt.Sprintf("%d", beginning) + } + if length == 0 { + beginning -= 1 // empty ranges begin at line just before the range + } + return fmt.Sprintf("%d,%d", beginning, length) +} + +// Unified diff parameters +type UnifiedDiff struct { + A []string // First sequence lines + FromFile string // First file name + FromDate string // First file time + B []string // Second sequence lines + ToFile string // Second file name + ToDate string // Second file time + Eol string // Headers end of line, defaults to LF + Context int // Number of context lines +} + +// Compare two sequences of lines; generate the delta as a unified diff. +// +// Unified diffs are a compact way of showing line changes and a few +// lines of context. The number of context lines is set by 'n' which +// defaults to three. +// +// By default, the diff control lines (those with ---, +++, or @@) are +// created with a trailing newline. This is helpful so that inputs +// created from file.readlines() result in diffs that are suitable for +// file.writelines() since both the inputs and outputs have trailing +// newlines. +// +// For inputs that do not have trailing newlines, set the lineterm +// argument to "" so that the output will be uniformly newline free. +// +// The unidiff format normally has a header for filenames and modification +// times. Any or all of these may be specified using strings for +// 'fromfile', 'tofile', 'fromfiledate', and 'tofiledate'. +// The modification times are normally expressed in the ISO 8601 format. +func WriteUnifiedDiff(writer io.Writer, diff UnifiedDiff) error { + buf := bufio.NewWriter(writer) + defer buf.Flush() + wf := func(format string, args ...interface{}) error { + _, err := buf.WriteString(fmt.Sprintf(format, args...)) + return err + } + ws := func(s string) error { + _, err := buf.WriteString(s) + return err + } + + if len(diff.Eol) == 0 { + diff.Eol = "\n" + } + + started := false + m := NewMatcher(diff.A, diff.B) + for _, g := range m.GetGroupedOpCodes(diff.Context) { + if !started { + started = true + fromDate := "" + if len(diff.FromDate) > 0 { + fromDate = "\t" + diff.FromDate + } + toDate := "" + if len(diff.ToDate) > 0 { + toDate = "\t" + diff.ToDate + } + if diff.FromFile != "" || diff.ToFile != "" { + err := wf("--- %s%s%s", diff.FromFile, fromDate, diff.Eol) + if err != nil { + return err + } + err = wf("+++ %s%s%s", diff.ToFile, toDate, diff.Eol) + if err != nil { + return err + } + } + } + first, last := g[0], g[len(g)-1] + range1 := formatRangeUnified(first.I1, last.I2) + range2 := formatRangeUnified(first.J1, last.J2) + if err := wf("@@ -%s +%s @@%s", range1, range2, diff.Eol); err != nil { + return err + } + for _, c := range g { + i1, i2, j1, j2 := c.I1, c.I2, c.J1, c.J2 + if c.Tag == 'e' { + for _, line := range diff.A[i1:i2] { + if err := ws(" " + line); err != nil { + return err + } + } + continue + } + if c.Tag == 'r' || c.Tag == 'd' { + for _, line := range diff.A[i1:i2] { + if err := ws("-" + line); err != nil { + return err + } + } + } + if c.Tag == 'r' || c.Tag == 'i' { + for _, line := range diff.B[j1:j2] { + if err := ws("+" + line); err != nil { + return err + } + } + } + } + } + return nil +} + +// Like WriteUnifiedDiff but returns the diff a string. +func GetUnifiedDiffString(diff UnifiedDiff) (string, error) { + w := &bytes.Buffer{} + err := WriteUnifiedDiff(w, diff) + return string(w.Bytes()), err +} + +// Convert range to the "ed" format. +func formatRangeContext(start, stop int) string { + // Per the diff spec at http://www.unix.org/single_unix_specification/ + beginning := start + 1 // lines start numbering with one + length := stop - start + if length == 0 { + beginning -= 1 // empty ranges begin at line just before the range + } + if length <= 1 { + return fmt.Sprintf("%d", beginning) + } + return fmt.Sprintf("%d,%d", beginning, beginning+length-1) +} + +type ContextDiff UnifiedDiff + +// Compare two sequences of lines; generate the delta as a context diff. +// +// Context diffs are a compact way of showing line changes and a few +// lines of context. The number of context lines is set by diff.Context +// which defaults to three. +// +// By default, the diff control lines (those with *** or ---) are +// created with a trailing newline. +// +// For inputs that do not have trailing newlines, set the diff.Eol +// argument to "" so that the output will be uniformly newline free. +// +// The context diff format normally has a header for filenames and +// modification times. Any or all of these may be specified using +// strings for diff.FromFile, diff.ToFile, diff.FromDate, diff.ToDate. +// The modification times are normally expressed in the ISO 8601 format. +// If not specified, the strings default to blanks. +func WriteContextDiff(writer io.Writer, diff ContextDiff) error { + buf := bufio.NewWriter(writer) + defer buf.Flush() + var diffErr error + wf := func(format string, args ...interface{}) { + _, err := buf.WriteString(fmt.Sprintf(format, args...)) + if diffErr == nil && err != nil { + diffErr = err + } + } + ws := func(s string) { + _, err := buf.WriteString(s) + if diffErr == nil && err != nil { + diffErr = err + } + } + + if len(diff.Eol) == 0 { + diff.Eol = "\n" + } + + prefix := map[byte]string{ + 'i': "+ ", + 'd': "- ", + 'r': "! ", + 'e': " ", + } + + started := false + m := NewMatcher(diff.A, diff.B) + for _, g := range m.GetGroupedOpCodes(diff.Context) { + if !started { + started = true + fromDate := "" + if len(diff.FromDate) > 0 { + fromDate = "\t" + diff.FromDate + } + toDate := "" + if len(diff.ToDate) > 0 { + toDate = "\t" + diff.ToDate + } + if diff.FromFile != "" || diff.ToFile != "" { + wf("*** %s%s%s", diff.FromFile, fromDate, diff.Eol) + wf("--- %s%s%s", diff.ToFile, toDate, diff.Eol) + } + } + + first, last := g[0], g[len(g)-1] + ws("***************" + diff.Eol) + + range1 := formatRangeContext(first.I1, last.I2) + wf("*** %s ****%s", range1, diff.Eol) + for _, c := range g { + if c.Tag == 'r' || c.Tag == 'd' { + for _, cc := range g { + if cc.Tag == 'i' { + continue + } + for _, line := range diff.A[cc.I1:cc.I2] { + ws(prefix[cc.Tag] + line) + } + } + break + } + } + + range2 := formatRangeContext(first.J1, last.J2) + wf("--- %s ----%s", range2, diff.Eol) + for _, c := range g { + if c.Tag == 'r' || c.Tag == 'i' { + for _, cc := range g { + if cc.Tag == 'd' { + continue + } + for _, line := range diff.B[cc.J1:cc.J2] { + ws(prefix[cc.Tag] + line) + } + } + break + } + } + } + return diffErr +} + +// Like WriteContextDiff but returns the diff a string. +func GetContextDiffString(diff ContextDiff) (string, error) { + w := &bytes.Buffer{} + err := WriteContextDiff(w, diff) + return string(w.Bytes()), err +} + +// Split a string on "\n" while preserving them. The output can be used +// as input for UnifiedDiff and ContextDiff structures. +func SplitLines(s string) []string { + lines := strings.SplitAfter(s, "\n") + lines[len(lines)-1] += "\n" + return lines +} diff --git a/vendor/github.com/stretchr/testify/LICENSE b/vendor/github.com/stretchr/testify/LICENSE new file mode 100644 index 0000000..f38ec59 --- /dev/null +++ b/vendor/github.com/stretchr/testify/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2012-2018 Mat Ryer and Tyler Bunnell + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/vendor/github.com/stretchr/testify/assert/assertion_format.go b/vendor/github.com/stretchr/testify/assert/assertion_format.go new file mode 100644 index 0000000..aa1c2b9 --- /dev/null +++ b/vendor/github.com/stretchr/testify/assert/assertion_format.go @@ -0,0 +1,484 @@ +/* +* CODE GENERATED AUTOMATICALLY WITH github.com/stretchr/testify/_codegen +* THIS FILE MUST NOT BE EDITED BY HAND + */ + +package assert + +import ( + http "net/http" + url "net/url" + time "time" +) + +// Conditionf uses a Comparison to assert a complex condition. +func Conditionf(t TestingT, comp Comparison, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Condition(t, comp, append([]interface{}{msg}, args...)...) +} + +// Containsf asserts that the specified string, list(array, slice...) or map contains the +// specified substring or element. +// +// assert.Containsf(t, "Hello World", "World", "error message %s", "formatted") +// assert.Containsf(t, ["Hello", "World"], "World", "error message %s", "formatted") +// assert.Containsf(t, {"Hello": "World"}, "Hello", "error message %s", "formatted") +func Containsf(t TestingT, s interface{}, contains interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Contains(t, s, contains, append([]interface{}{msg}, args...)...) +} + +// DirExistsf checks whether a directory exists in the given path. It also fails if the path is a file rather a directory or there is an error checking whether it exists. +func DirExistsf(t TestingT, path string, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return DirExists(t, path, append([]interface{}{msg}, args...)...) +} + +// ElementsMatchf asserts that the specified listA(array, slice...) is equal to specified +// listB(array, slice...) ignoring the order of the elements. If there are duplicate elements, +// the number of appearances of each of them in both lists should match. +// +// assert.ElementsMatchf(t, [1, 3, 2, 3], [1, 3, 3, 2], "error message %s", "formatted") +func ElementsMatchf(t TestingT, listA interface{}, listB interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return ElementsMatch(t, listA, listB, append([]interface{}{msg}, args...)...) +} + +// Emptyf asserts that the specified object is empty. I.e. nil, "", false, 0 or either +// a slice or a channel with len == 0. +// +// assert.Emptyf(t, obj, "error message %s", "formatted") +func Emptyf(t TestingT, object interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Empty(t, object, append([]interface{}{msg}, args...)...) +} + +// Equalf asserts that two objects are equal. +// +// assert.Equalf(t, 123, 123, "error message %s", "formatted") +// +// Pointer variable equality is determined based on the equality of the +// referenced values (as opposed to the memory addresses). Function equality +// cannot be determined and will always fail. +func Equalf(t TestingT, expected interface{}, actual interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Equal(t, expected, actual, append([]interface{}{msg}, args...)...) +} + +// EqualErrorf asserts that a function returned an error (i.e. not `nil`) +// and that it is equal to the provided error. +// +// actualObj, err := SomeFunction() +// assert.EqualErrorf(t, err, expectedErrorString, "error message %s", "formatted") +func EqualErrorf(t TestingT, theError error, errString string, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return EqualError(t, theError, errString, append([]interface{}{msg}, args...)...) +} + +// EqualValuesf asserts that two objects are equal or convertable to the same types +// and equal. +// +// assert.EqualValuesf(t, uint32(123, "error message %s", "formatted"), int32(123)) +func EqualValuesf(t TestingT, expected interface{}, actual interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return EqualValues(t, expected, actual, append([]interface{}{msg}, args...)...) +} + +// Errorf asserts that a function returned an error (i.e. not `nil`). +// +// actualObj, err := SomeFunction() +// if assert.Errorf(t, err, "error message %s", "formatted") { +// assert.Equal(t, expectedErrorf, err) +// } +func Errorf(t TestingT, err error, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Error(t, err, append([]interface{}{msg}, args...)...) +} + +// Exactlyf asserts that two objects are equal in value and type. +// +// assert.Exactlyf(t, int32(123, "error message %s", "formatted"), int64(123)) +func Exactlyf(t TestingT, expected interface{}, actual interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Exactly(t, expected, actual, append([]interface{}{msg}, args...)...) +} + +// Failf reports a failure through +func Failf(t TestingT, failureMessage string, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Fail(t, failureMessage, append([]interface{}{msg}, args...)...) +} + +// FailNowf fails test +func FailNowf(t TestingT, failureMessage string, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return FailNow(t, failureMessage, append([]interface{}{msg}, args...)...) +} + +// Falsef asserts that the specified value is false. +// +// assert.Falsef(t, myBool, "error message %s", "formatted") +func Falsef(t TestingT, value bool, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return False(t, value, append([]interface{}{msg}, args...)...) +} + +// FileExistsf checks whether a file exists in the given path. It also fails if the path points to a directory or there is an error when trying to check the file. +func FileExistsf(t TestingT, path string, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return FileExists(t, path, append([]interface{}{msg}, args...)...) +} + +// HTTPBodyContainsf asserts that a specified handler returns a +// body that contains a string. +// +// assert.HTTPBodyContainsf(t, myHandler, "GET", "www.google.com", nil, "I'm Feeling Lucky", "error message %s", "formatted") +// +// Returns whether the assertion was successful (true) or not (false). +func HTTPBodyContainsf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values, str interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return HTTPBodyContains(t, handler, method, url, values, str, append([]interface{}{msg}, args...)...) +} + +// HTTPBodyNotContainsf asserts that a specified handler returns a +// body that does not contain a string. +// +// assert.HTTPBodyNotContainsf(t, myHandler, "GET", "www.google.com", nil, "I'm Feeling Lucky", "error message %s", "formatted") +// +// Returns whether the assertion was successful (true) or not (false). +func HTTPBodyNotContainsf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values, str interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return HTTPBodyNotContains(t, handler, method, url, values, str, append([]interface{}{msg}, args...)...) +} + +// HTTPErrorf asserts that a specified handler returns an error status code. +// +// assert.HTTPErrorf(t, myHandler, "POST", "/a/b/c", url.Values{"a": []string{"b", "c"}} +// +// Returns whether the assertion was successful (true, "error message %s", "formatted") or not (false). +func HTTPErrorf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return HTTPError(t, handler, method, url, values, append([]interface{}{msg}, args...)...) +} + +// HTTPRedirectf asserts that a specified handler returns a redirect status code. +// +// assert.HTTPRedirectf(t, myHandler, "GET", "/a/b/c", url.Values{"a": []string{"b", "c"}} +// +// Returns whether the assertion was successful (true, "error message %s", "formatted") or not (false). +func HTTPRedirectf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return HTTPRedirect(t, handler, method, url, values, append([]interface{}{msg}, args...)...) +} + +// HTTPSuccessf asserts that a specified handler returns a success status code. +// +// assert.HTTPSuccessf(t, myHandler, "POST", "http://www.google.com", nil, "error message %s", "formatted") +// +// Returns whether the assertion was successful (true) or not (false). +func HTTPSuccessf(t TestingT, handler http.HandlerFunc, method string, url string, values url.Values, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return HTTPSuccess(t, handler, method, url, values, append([]interface{}{msg}, args...)...) +} + +// Implementsf asserts that an object is implemented by the specified interface. +// +// assert.Implementsf(t, (*MyInterface, "error message %s", "formatted")(nil), new(MyObject)) +func Implementsf(t TestingT, interfaceObject interface{}, object interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Implements(t, interfaceObject, object, append([]interface{}{msg}, args...)...) +} + +// InDeltaf asserts that the two numerals are within delta of each other. +// +// assert.InDeltaf(t, math.Pi, (22 / 7.0, "error message %s", "formatted"), 0.01) +func InDeltaf(t TestingT, expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return InDelta(t, expected, actual, delta, append([]interface{}{msg}, args...)...) +} + +// InDeltaMapValuesf is the same as InDelta, but it compares all values between two maps. Both maps must have exactly the same keys. +func InDeltaMapValuesf(t TestingT, expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return InDeltaMapValues(t, expected, actual, delta, append([]interface{}{msg}, args...)...) +} + +// InDeltaSlicef is the same as InDelta, except it compares two slices. +func InDeltaSlicef(t TestingT, expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return InDeltaSlice(t, expected, actual, delta, append([]interface{}{msg}, args...)...) +} + +// InEpsilonf asserts that expected and actual have a relative error less than epsilon +func InEpsilonf(t TestingT, expected interface{}, actual interface{}, epsilon float64, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return InEpsilon(t, expected, actual, epsilon, append([]interface{}{msg}, args...)...) +} + +// InEpsilonSlicef is the same as InEpsilon, except it compares each value from two slices. +func InEpsilonSlicef(t TestingT, expected interface{}, actual interface{}, epsilon float64, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return InEpsilonSlice(t, expected, actual, epsilon, append([]interface{}{msg}, args...)...) +} + +// IsTypef asserts that the specified objects are of the same type. +func IsTypef(t TestingT, expectedType interface{}, object interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return IsType(t, expectedType, object, append([]interface{}{msg}, args...)...) +} + +// JSONEqf asserts that two JSON strings are equivalent. +// +// assert.JSONEqf(t, `{"hello": "world", "foo": "bar"}`, `{"foo": "bar", "hello": "world"}`, "error message %s", "formatted") +func JSONEqf(t TestingT, expected string, actual string, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return JSONEq(t, expected, actual, append([]interface{}{msg}, args...)...) +} + +// Lenf asserts that the specified object has specific length. +// Lenf also fails if the object has a type that len() not accept. +// +// assert.Lenf(t, mySlice, 3, "error message %s", "formatted") +func Lenf(t TestingT, object interface{}, length int, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Len(t, object, length, append([]interface{}{msg}, args...)...) +} + +// Nilf asserts that the specified object is nil. +// +// assert.Nilf(t, err, "error message %s", "formatted") +func Nilf(t TestingT, object interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Nil(t, object, append([]interface{}{msg}, args...)...) +} + +// NoErrorf asserts that a function returned no error (i.e. `nil`). +// +// actualObj, err := SomeFunction() +// if assert.NoErrorf(t, err, "error message %s", "formatted") { +// assert.Equal(t, expectedObj, actualObj) +// } +func NoErrorf(t TestingT, err error, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return NoError(t, err, append([]interface{}{msg}, args...)...) +} + +// NotContainsf asserts that the specified string, list(array, slice...) or map does NOT contain the +// specified substring or element. +// +// assert.NotContainsf(t, "Hello World", "Earth", "error message %s", "formatted") +// assert.NotContainsf(t, ["Hello", "World"], "Earth", "error message %s", "formatted") +// assert.NotContainsf(t, {"Hello": "World"}, "Earth", "error message %s", "formatted") +func NotContainsf(t TestingT, s interface{}, contains interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return NotContains(t, s, contains, append([]interface{}{msg}, args...)...) +} + +// NotEmptyf asserts that the specified object is NOT empty. I.e. not nil, "", false, 0 or either +// a slice or a channel with len == 0. +// +// if assert.NotEmptyf(t, obj, "error message %s", "formatted") { +// assert.Equal(t, "two", obj[1]) +// } +func NotEmptyf(t TestingT, object interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return NotEmpty(t, object, append([]interface{}{msg}, args...)...) +} + +// NotEqualf asserts that the specified values are NOT equal. +// +// assert.NotEqualf(t, obj1, obj2, "error message %s", "formatted") +// +// Pointer variable equality is determined based on the equality of the +// referenced values (as opposed to the memory addresses). +func NotEqualf(t TestingT, expected interface{}, actual interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return NotEqual(t, expected, actual, append([]interface{}{msg}, args...)...) +} + +// NotNilf asserts that the specified object is not nil. +// +// assert.NotNilf(t, err, "error message %s", "formatted") +func NotNilf(t TestingT, object interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return NotNil(t, object, append([]interface{}{msg}, args...)...) +} + +// NotPanicsf asserts that the code inside the specified PanicTestFunc does NOT panic. +// +// assert.NotPanicsf(t, func(){ RemainCalm() }, "error message %s", "formatted") +func NotPanicsf(t TestingT, f PanicTestFunc, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return NotPanics(t, f, append([]interface{}{msg}, args...)...) +} + +// NotRegexpf asserts that a specified regexp does not match a string. +// +// assert.NotRegexpf(t, regexp.MustCompile("starts", "error message %s", "formatted"), "it's starting") +// assert.NotRegexpf(t, "^start", "it's not starting", "error message %s", "formatted") +func NotRegexpf(t TestingT, rx interface{}, str interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return NotRegexp(t, rx, str, append([]interface{}{msg}, args...)...) +} + +// NotSubsetf asserts that the specified list(array, slice...) contains not all +// elements given in the specified subset(array, slice...). +// +// assert.NotSubsetf(t, [1, 3, 4], [1, 2], "But [1, 3, 4] does not contain [1, 2]", "error message %s", "formatted") +func NotSubsetf(t TestingT, list interface{}, subset interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return NotSubset(t, list, subset, append([]interface{}{msg}, args...)...) +} + +// NotZerof asserts that i is not the zero value for its type. +func NotZerof(t TestingT, i interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return NotZero(t, i, append([]interface{}{msg}, args...)...) +} + +// Panicsf asserts that the code inside the specified PanicTestFunc panics. +// +// assert.Panicsf(t, func(){ GoCrazy() }, "error message %s", "formatted") +func Panicsf(t TestingT, f PanicTestFunc, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Panics(t, f, append([]interface{}{msg}, args...)...) +} + +// PanicsWithValuef asserts that the code inside the specified PanicTestFunc panics, and that +// the recovered panic value equals the expected panic value. +// +// assert.PanicsWithValuef(t, "crazy error", func(){ GoCrazy() }, "error message %s", "formatted") +func PanicsWithValuef(t TestingT, expected interface{}, f PanicTestFunc, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return PanicsWithValue(t, expected, f, append([]interface{}{msg}, args...)...) +} + +// Regexpf asserts that a specified regexp matches a string. +// +// assert.Regexpf(t, regexp.MustCompile("start", "error message %s", "formatted"), "it's starting") +// assert.Regexpf(t, "start...$", "it's not starting", "error message %s", "formatted") +func Regexpf(t TestingT, rx interface{}, str interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Regexp(t, rx, str, append([]interface{}{msg}, args...)...) +} + +// Subsetf asserts that the specified list(array, slice...) contains all +// elements given in the specified subset(array, slice...). +// +// assert.Subsetf(t, [1, 2, 3], [1, 2], "But [1, 2, 3] does contain [1, 2]", "error message %s", "formatted") +func Subsetf(t TestingT, list interface{}, subset interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Subset(t, list, subset, append([]interface{}{msg}, args...)...) +} + +// Truef asserts that the specified value is true. +// +// assert.Truef(t, myBool, "error message %s", "formatted") +func Truef(t TestingT, value bool, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return True(t, value, append([]interface{}{msg}, args...)...) +} + +// WithinDurationf asserts that the two times are within duration delta of each other. +// +// assert.WithinDurationf(t, time.Now(), time.Now(), 10*time.Second, "error message %s", "formatted") +func WithinDurationf(t TestingT, expected time.Time, actual time.Time, delta time.Duration, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return WithinDuration(t, expected, actual, delta, append([]interface{}{msg}, args...)...) +} + +// Zerof asserts that i is the zero value for its type. +func Zerof(t TestingT, i interface{}, msg string, args ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + return Zero(t, i, append([]interface{}{msg}, args...)...) +} diff --git a/vendor/github.com/stretchr/testify/assert/assertion_format.go.tmpl b/vendor/github.com/stretchr/testify/assert/assertion_format.go.tmpl new file mode 100644 index 0000000..d2bb0b8 --- /dev/null +++ b/vendor/github.com/stretchr/testify/assert/assertion_format.go.tmpl @@ -0,0 +1,5 @@ +{{.CommentFormat}} +func {{.DocInfo.Name}}f(t TestingT, {{.ParamsFormat}}) bool { + if h, ok := t.(tHelper); ok { h.Helper() } + return {{.DocInfo.Name}}(t, {{.ForwardedParamsFormat}}) +} diff --git a/vendor/github.com/stretchr/testify/assert/assertion_forward.go b/vendor/github.com/stretchr/testify/assert/assertion_forward.go new file mode 100644 index 0000000..de39f79 --- /dev/null +++ b/vendor/github.com/stretchr/testify/assert/assertion_forward.go @@ -0,0 +1,956 @@ +/* +* CODE GENERATED AUTOMATICALLY WITH github.com/stretchr/testify/_codegen +* THIS FILE MUST NOT BE EDITED BY HAND + */ + +package assert + +import ( + http "net/http" + url "net/url" + time "time" +) + +// Condition uses a Comparison to assert a complex condition. +func (a *Assertions) Condition(comp Comparison, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Condition(a.t, comp, msgAndArgs...) +} + +// Conditionf uses a Comparison to assert a complex condition. +func (a *Assertions) Conditionf(comp Comparison, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Conditionf(a.t, comp, msg, args...) +} + +// Contains asserts that the specified string, list(array, slice...) or map contains the +// specified substring or element. +// +// a.Contains("Hello World", "World") +// a.Contains(["Hello", "World"], "World") +// a.Contains({"Hello": "World"}, "Hello") +func (a *Assertions) Contains(s interface{}, contains interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Contains(a.t, s, contains, msgAndArgs...) +} + +// Containsf asserts that the specified string, list(array, slice...) or map contains the +// specified substring or element. +// +// a.Containsf("Hello World", "World", "error message %s", "formatted") +// a.Containsf(["Hello", "World"], "World", "error message %s", "formatted") +// a.Containsf({"Hello": "World"}, "Hello", "error message %s", "formatted") +func (a *Assertions) Containsf(s interface{}, contains interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Containsf(a.t, s, contains, msg, args...) +} + +// DirExists checks whether a directory exists in the given path. It also fails if the path is a file rather a directory or there is an error checking whether it exists. +func (a *Assertions) DirExists(path string, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return DirExists(a.t, path, msgAndArgs...) +} + +// DirExistsf checks whether a directory exists in the given path. It also fails if the path is a file rather a directory or there is an error checking whether it exists. +func (a *Assertions) DirExistsf(path string, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return DirExistsf(a.t, path, msg, args...) +} + +// ElementsMatch asserts that the specified listA(array, slice...) is equal to specified +// listB(array, slice...) ignoring the order of the elements. If there are duplicate elements, +// the number of appearances of each of them in both lists should match. +// +// a.ElementsMatch([1, 3, 2, 3], [1, 3, 3, 2]) +func (a *Assertions) ElementsMatch(listA interface{}, listB interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return ElementsMatch(a.t, listA, listB, msgAndArgs...) +} + +// ElementsMatchf asserts that the specified listA(array, slice...) is equal to specified +// listB(array, slice...) ignoring the order of the elements. If there are duplicate elements, +// the number of appearances of each of them in both lists should match. +// +// a.ElementsMatchf([1, 3, 2, 3], [1, 3, 3, 2], "error message %s", "formatted") +func (a *Assertions) ElementsMatchf(listA interface{}, listB interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return ElementsMatchf(a.t, listA, listB, msg, args...) +} + +// Empty asserts that the specified object is empty. I.e. nil, "", false, 0 or either +// a slice or a channel with len == 0. +// +// a.Empty(obj) +func (a *Assertions) Empty(object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Empty(a.t, object, msgAndArgs...) +} + +// Emptyf asserts that the specified object is empty. I.e. nil, "", false, 0 or either +// a slice or a channel with len == 0. +// +// a.Emptyf(obj, "error message %s", "formatted") +func (a *Assertions) Emptyf(object interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Emptyf(a.t, object, msg, args...) +} + +// Equal asserts that two objects are equal. +// +// a.Equal(123, 123) +// +// Pointer variable equality is determined based on the equality of the +// referenced values (as opposed to the memory addresses). Function equality +// cannot be determined and will always fail. +func (a *Assertions) Equal(expected interface{}, actual interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Equal(a.t, expected, actual, msgAndArgs...) +} + +// EqualError asserts that a function returned an error (i.e. not `nil`) +// and that it is equal to the provided error. +// +// actualObj, err := SomeFunction() +// a.EqualError(err, expectedErrorString) +func (a *Assertions) EqualError(theError error, errString string, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return EqualError(a.t, theError, errString, msgAndArgs...) +} + +// EqualErrorf asserts that a function returned an error (i.e. not `nil`) +// and that it is equal to the provided error. +// +// actualObj, err := SomeFunction() +// a.EqualErrorf(err, expectedErrorString, "error message %s", "formatted") +func (a *Assertions) EqualErrorf(theError error, errString string, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return EqualErrorf(a.t, theError, errString, msg, args...) +} + +// EqualValues asserts that two objects are equal or convertable to the same types +// and equal. +// +// a.EqualValues(uint32(123), int32(123)) +func (a *Assertions) EqualValues(expected interface{}, actual interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return EqualValues(a.t, expected, actual, msgAndArgs...) +} + +// EqualValuesf asserts that two objects are equal or convertable to the same types +// and equal. +// +// a.EqualValuesf(uint32(123, "error message %s", "formatted"), int32(123)) +func (a *Assertions) EqualValuesf(expected interface{}, actual interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return EqualValuesf(a.t, expected, actual, msg, args...) +} + +// Equalf asserts that two objects are equal. +// +// a.Equalf(123, 123, "error message %s", "formatted") +// +// Pointer variable equality is determined based on the equality of the +// referenced values (as opposed to the memory addresses). Function equality +// cannot be determined and will always fail. +func (a *Assertions) Equalf(expected interface{}, actual interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Equalf(a.t, expected, actual, msg, args...) +} + +// Error asserts that a function returned an error (i.e. not `nil`). +// +// actualObj, err := SomeFunction() +// if a.Error(err) { +// assert.Equal(t, expectedError, err) +// } +func (a *Assertions) Error(err error, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Error(a.t, err, msgAndArgs...) +} + +// Errorf asserts that a function returned an error (i.e. not `nil`). +// +// actualObj, err := SomeFunction() +// if a.Errorf(err, "error message %s", "formatted") { +// assert.Equal(t, expectedErrorf, err) +// } +func (a *Assertions) Errorf(err error, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Errorf(a.t, err, msg, args...) +} + +// Exactly asserts that two objects are equal in value and type. +// +// a.Exactly(int32(123), int64(123)) +func (a *Assertions) Exactly(expected interface{}, actual interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Exactly(a.t, expected, actual, msgAndArgs...) +} + +// Exactlyf asserts that two objects are equal in value and type. +// +// a.Exactlyf(int32(123, "error message %s", "formatted"), int64(123)) +func (a *Assertions) Exactlyf(expected interface{}, actual interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Exactlyf(a.t, expected, actual, msg, args...) +} + +// Fail reports a failure through +func (a *Assertions) Fail(failureMessage string, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Fail(a.t, failureMessage, msgAndArgs...) +} + +// FailNow fails test +func (a *Assertions) FailNow(failureMessage string, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return FailNow(a.t, failureMessage, msgAndArgs...) +} + +// FailNowf fails test +func (a *Assertions) FailNowf(failureMessage string, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return FailNowf(a.t, failureMessage, msg, args...) +} + +// Failf reports a failure through +func (a *Assertions) Failf(failureMessage string, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Failf(a.t, failureMessage, msg, args...) +} + +// False asserts that the specified value is false. +// +// a.False(myBool) +func (a *Assertions) False(value bool, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return False(a.t, value, msgAndArgs...) +} + +// Falsef asserts that the specified value is false. +// +// a.Falsef(myBool, "error message %s", "formatted") +func (a *Assertions) Falsef(value bool, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Falsef(a.t, value, msg, args...) +} + +// FileExists checks whether a file exists in the given path. It also fails if the path points to a directory or there is an error when trying to check the file. +func (a *Assertions) FileExists(path string, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return FileExists(a.t, path, msgAndArgs...) +} + +// FileExistsf checks whether a file exists in the given path. It also fails if the path points to a directory or there is an error when trying to check the file. +func (a *Assertions) FileExistsf(path string, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return FileExistsf(a.t, path, msg, args...) +} + +// HTTPBodyContains asserts that a specified handler returns a +// body that contains a string. +// +// a.HTTPBodyContains(myHandler, "GET", "www.google.com", nil, "I'm Feeling Lucky") +// +// Returns whether the assertion was successful (true) or not (false). +func (a *Assertions) HTTPBodyContains(handler http.HandlerFunc, method string, url string, values url.Values, str interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPBodyContains(a.t, handler, method, url, values, str, msgAndArgs...) +} + +// HTTPBodyContainsf asserts that a specified handler returns a +// body that contains a string. +// +// a.HTTPBodyContainsf(myHandler, "GET", "www.google.com", nil, "I'm Feeling Lucky", "error message %s", "formatted") +// +// Returns whether the assertion was successful (true) or not (false). +func (a *Assertions) HTTPBodyContainsf(handler http.HandlerFunc, method string, url string, values url.Values, str interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPBodyContainsf(a.t, handler, method, url, values, str, msg, args...) +} + +// HTTPBodyNotContains asserts that a specified handler returns a +// body that does not contain a string. +// +// a.HTTPBodyNotContains(myHandler, "GET", "www.google.com", nil, "I'm Feeling Lucky") +// +// Returns whether the assertion was successful (true) or not (false). +func (a *Assertions) HTTPBodyNotContains(handler http.HandlerFunc, method string, url string, values url.Values, str interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPBodyNotContains(a.t, handler, method, url, values, str, msgAndArgs...) +} + +// HTTPBodyNotContainsf asserts that a specified handler returns a +// body that does not contain a string. +// +// a.HTTPBodyNotContainsf(myHandler, "GET", "www.google.com", nil, "I'm Feeling Lucky", "error message %s", "formatted") +// +// Returns whether the assertion was successful (true) or not (false). +func (a *Assertions) HTTPBodyNotContainsf(handler http.HandlerFunc, method string, url string, values url.Values, str interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPBodyNotContainsf(a.t, handler, method, url, values, str, msg, args...) +} + +// HTTPError asserts that a specified handler returns an error status code. +// +// a.HTTPError(myHandler, "POST", "/a/b/c", url.Values{"a": []string{"b", "c"}} +// +// Returns whether the assertion was successful (true) or not (false). +func (a *Assertions) HTTPError(handler http.HandlerFunc, method string, url string, values url.Values, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPError(a.t, handler, method, url, values, msgAndArgs...) +} + +// HTTPErrorf asserts that a specified handler returns an error status code. +// +// a.HTTPErrorf(myHandler, "POST", "/a/b/c", url.Values{"a": []string{"b", "c"}} +// +// Returns whether the assertion was successful (true, "error message %s", "formatted") or not (false). +func (a *Assertions) HTTPErrorf(handler http.HandlerFunc, method string, url string, values url.Values, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPErrorf(a.t, handler, method, url, values, msg, args...) +} + +// HTTPRedirect asserts that a specified handler returns a redirect status code. +// +// a.HTTPRedirect(myHandler, "GET", "/a/b/c", url.Values{"a": []string{"b", "c"}} +// +// Returns whether the assertion was successful (true) or not (false). +func (a *Assertions) HTTPRedirect(handler http.HandlerFunc, method string, url string, values url.Values, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPRedirect(a.t, handler, method, url, values, msgAndArgs...) +} + +// HTTPRedirectf asserts that a specified handler returns a redirect status code. +// +// a.HTTPRedirectf(myHandler, "GET", "/a/b/c", url.Values{"a": []string{"b", "c"}} +// +// Returns whether the assertion was successful (true, "error message %s", "formatted") or not (false). +func (a *Assertions) HTTPRedirectf(handler http.HandlerFunc, method string, url string, values url.Values, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPRedirectf(a.t, handler, method, url, values, msg, args...) +} + +// HTTPSuccess asserts that a specified handler returns a success status code. +// +// a.HTTPSuccess(myHandler, "POST", "http://www.google.com", nil) +// +// Returns whether the assertion was successful (true) or not (false). +func (a *Assertions) HTTPSuccess(handler http.HandlerFunc, method string, url string, values url.Values, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPSuccess(a.t, handler, method, url, values, msgAndArgs...) +} + +// HTTPSuccessf asserts that a specified handler returns a success status code. +// +// a.HTTPSuccessf(myHandler, "POST", "http://www.google.com", nil, "error message %s", "formatted") +// +// Returns whether the assertion was successful (true) or not (false). +func (a *Assertions) HTTPSuccessf(handler http.HandlerFunc, method string, url string, values url.Values, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return HTTPSuccessf(a.t, handler, method, url, values, msg, args...) +} + +// Implements asserts that an object is implemented by the specified interface. +// +// a.Implements((*MyInterface)(nil), new(MyObject)) +func (a *Assertions) Implements(interfaceObject interface{}, object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Implements(a.t, interfaceObject, object, msgAndArgs...) +} + +// Implementsf asserts that an object is implemented by the specified interface. +// +// a.Implementsf((*MyInterface, "error message %s", "formatted")(nil), new(MyObject)) +func (a *Assertions) Implementsf(interfaceObject interface{}, object interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Implementsf(a.t, interfaceObject, object, msg, args...) +} + +// InDelta asserts that the two numerals are within delta of each other. +// +// a.InDelta(math.Pi, (22 / 7.0), 0.01) +func (a *Assertions) InDelta(expected interface{}, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InDelta(a.t, expected, actual, delta, msgAndArgs...) +} + +// InDeltaMapValues is the same as InDelta, but it compares all values between two maps. Both maps must have exactly the same keys. +func (a *Assertions) InDeltaMapValues(expected interface{}, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InDeltaMapValues(a.t, expected, actual, delta, msgAndArgs...) +} + +// InDeltaMapValuesf is the same as InDelta, but it compares all values between two maps. Both maps must have exactly the same keys. +func (a *Assertions) InDeltaMapValuesf(expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InDeltaMapValuesf(a.t, expected, actual, delta, msg, args...) +} + +// InDeltaSlice is the same as InDelta, except it compares two slices. +func (a *Assertions) InDeltaSlice(expected interface{}, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InDeltaSlice(a.t, expected, actual, delta, msgAndArgs...) +} + +// InDeltaSlicef is the same as InDelta, except it compares two slices. +func (a *Assertions) InDeltaSlicef(expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InDeltaSlicef(a.t, expected, actual, delta, msg, args...) +} + +// InDeltaf asserts that the two numerals are within delta of each other. +// +// a.InDeltaf(math.Pi, (22 / 7.0, "error message %s", "formatted"), 0.01) +func (a *Assertions) InDeltaf(expected interface{}, actual interface{}, delta float64, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InDeltaf(a.t, expected, actual, delta, msg, args...) +} + +// InEpsilon asserts that expected and actual have a relative error less than epsilon +func (a *Assertions) InEpsilon(expected interface{}, actual interface{}, epsilon float64, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InEpsilon(a.t, expected, actual, epsilon, msgAndArgs...) +} + +// InEpsilonSlice is the same as InEpsilon, except it compares each value from two slices. +func (a *Assertions) InEpsilonSlice(expected interface{}, actual interface{}, epsilon float64, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InEpsilonSlice(a.t, expected, actual, epsilon, msgAndArgs...) +} + +// InEpsilonSlicef is the same as InEpsilon, except it compares each value from two slices. +func (a *Assertions) InEpsilonSlicef(expected interface{}, actual interface{}, epsilon float64, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InEpsilonSlicef(a.t, expected, actual, epsilon, msg, args...) +} + +// InEpsilonf asserts that expected and actual have a relative error less than epsilon +func (a *Assertions) InEpsilonf(expected interface{}, actual interface{}, epsilon float64, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return InEpsilonf(a.t, expected, actual, epsilon, msg, args...) +} + +// IsType asserts that the specified objects are of the same type. +func (a *Assertions) IsType(expectedType interface{}, object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return IsType(a.t, expectedType, object, msgAndArgs...) +} + +// IsTypef asserts that the specified objects are of the same type. +func (a *Assertions) IsTypef(expectedType interface{}, object interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return IsTypef(a.t, expectedType, object, msg, args...) +} + +// JSONEq asserts that two JSON strings are equivalent. +// +// a.JSONEq(`{"hello": "world", "foo": "bar"}`, `{"foo": "bar", "hello": "world"}`) +func (a *Assertions) JSONEq(expected string, actual string, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return JSONEq(a.t, expected, actual, msgAndArgs...) +} + +// JSONEqf asserts that two JSON strings are equivalent. +// +// a.JSONEqf(`{"hello": "world", "foo": "bar"}`, `{"foo": "bar", "hello": "world"}`, "error message %s", "formatted") +func (a *Assertions) JSONEqf(expected string, actual string, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return JSONEqf(a.t, expected, actual, msg, args...) +} + +// Len asserts that the specified object has specific length. +// Len also fails if the object has a type that len() not accept. +// +// a.Len(mySlice, 3) +func (a *Assertions) Len(object interface{}, length int, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Len(a.t, object, length, msgAndArgs...) +} + +// Lenf asserts that the specified object has specific length. +// Lenf also fails if the object has a type that len() not accept. +// +// a.Lenf(mySlice, 3, "error message %s", "formatted") +func (a *Assertions) Lenf(object interface{}, length int, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Lenf(a.t, object, length, msg, args...) +} + +// Nil asserts that the specified object is nil. +// +// a.Nil(err) +func (a *Assertions) Nil(object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Nil(a.t, object, msgAndArgs...) +} + +// Nilf asserts that the specified object is nil. +// +// a.Nilf(err, "error message %s", "formatted") +func (a *Assertions) Nilf(object interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Nilf(a.t, object, msg, args...) +} + +// NoError asserts that a function returned no error (i.e. `nil`). +// +// actualObj, err := SomeFunction() +// if a.NoError(err) { +// assert.Equal(t, expectedObj, actualObj) +// } +func (a *Assertions) NoError(err error, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NoError(a.t, err, msgAndArgs...) +} + +// NoErrorf asserts that a function returned no error (i.e. `nil`). +// +// actualObj, err := SomeFunction() +// if a.NoErrorf(err, "error message %s", "formatted") { +// assert.Equal(t, expectedObj, actualObj) +// } +func (a *Assertions) NoErrorf(err error, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NoErrorf(a.t, err, msg, args...) +} + +// NotContains asserts that the specified string, list(array, slice...) or map does NOT contain the +// specified substring or element. +// +// a.NotContains("Hello World", "Earth") +// a.NotContains(["Hello", "World"], "Earth") +// a.NotContains({"Hello": "World"}, "Earth") +func (a *Assertions) NotContains(s interface{}, contains interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotContains(a.t, s, contains, msgAndArgs...) +} + +// NotContainsf asserts that the specified string, list(array, slice...) or map does NOT contain the +// specified substring or element. +// +// a.NotContainsf("Hello World", "Earth", "error message %s", "formatted") +// a.NotContainsf(["Hello", "World"], "Earth", "error message %s", "formatted") +// a.NotContainsf({"Hello": "World"}, "Earth", "error message %s", "formatted") +func (a *Assertions) NotContainsf(s interface{}, contains interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotContainsf(a.t, s, contains, msg, args...) +} + +// NotEmpty asserts that the specified object is NOT empty. I.e. not nil, "", false, 0 or either +// a slice or a channel with len == 0. +// +// if a.NotEmpty(obj) { +// assert.Equal(t, "two", obj[1]) +// } +func (a *Assertions) NotEmpty(object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotEmpty(a.t, object, msgAndArgs...) +} + +// NotEmptyf asserts that the specified object is NOT empty. I.e. not nil, "", false, 0 or either +// a slice or a channel with len == 0. +// +// if a.NotEmptyf(obj, "error message %s", "formatted") { +// assert.Equal(t, "two", obj[1]) +// } +func (a *Assertions) NotEmptyf(object interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotEmptyf(a.t, object, msg, args...) +} + +// NotEqual asserts that the specified values are NOT equal. +// +// a.NotEqual(obj1, obj2) +// +// Pointer variable equality is determined based on the equality of the +// referenced values (as opposed to the memory addresses). +func (a *Assertions) NotEqual(expected interface{}, actual interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotEqual(a.t, expected, actual, msgAndArgs...) +} + +// NotEqualf asserts that the specified values are NOT equal. +// +// a.NotEqualf(obj1, obj2, "error message %s", "formatted") +// +// Pointer variable equality is determined based on the equality of the +// referenced values (as opposed to the memory addresses). +func (a *Assertions) NotEqualf(expected interface{}, actual interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotEqualf(a.t, expected, actual, msg, args...) +} + +// NotNil asserts that the specified object is not nil. +// +// a.NotNil(err) +func (a *Assertions) NotNil(object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotNil(a.t, object, msgAndArgs...) +} + +// NotNilf asserts that the specified object is not nil. +// +// a.NotNilf(err, "error message %s", "formatted") +func (a *Assertions) NotNilf(object interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotNilf(a.t, object, msg, args...) +} + +// NotPanics asserts that the code inside the specified PanicTestFunc does NOT panic. +// +// a.NotPanics(func(){ RemainCalm() }) +func (a *Assertions) NotPanics(f PanicTestFunc, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotPanics(a.t, f, msgAndArgs...) +} + +// NotPanicsf asserts that the code inside the specified PanicTestFunc does NOT panic. +// +// a.NotPanicsf(func(){ RemainCalm() }, "error message %s", "formatted") +func (a *Assertions) NotPanicsf(f PanicTestFunc, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotPanicsf(a.t, f, msg, args...) +} + +// NotRegexp asserts that a specified regexp does not match a string. +// +// a.NotRegexp(regexp.MustCompile("starts"), "it's starting") +// a.NotRegexp("^start", "it's not starting") +func (a *Assertions) NotRegexp(rx interface{}, str interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotRegexp(a.t, rx, str, msgAndArgs...) +} + +// NotRegexpf asserts that a specified regexp does not match a string. +// +// a.NotRegexpf(regexp.MustCompile("starts", "error message %s", "formatted"), "it's starting") +// a.NotRegexpf("^start", "it's not starting", "error message %s", "formatted") +func (a *Assertions) NotRegexpf(rx interface{}, str interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotRegexpf(a.t, rx, str, msg, args...) +} + +// NotSubset asserts that the specified list(array, slice...) contains not all +// elements given in the specified subset(array, slice...). +// +// a.NotSubset([1, 3, 4], [1, 2], "But [1, 3, 4] does not contain [1, 2]") +func (a *Assertions) NotSubset(list interface{}, subset interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotSubset(a.t, list, subset, msgAndArgs...) +} + +// NotSubsetf asserts that the specified list(array, slice...) contains not all +// elements given in the specified subset(array, slice...). +// +// a.NotSubsetf([1, 3, 4], [1, 2], "But [1, 3, 4] does not contain [1, 2]", "error message %s", "formatted") +func (a *Assertions) NotSubsetf(list interface{}, subset interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotSubsetf(a.t, list, subset, msg, args...) +} + +// NotZero asserts that i is not the zero value for its type. +func (a *Assertions) NotZero(i interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotZero(a.t, i, msgAndArgs...) +} + +// NotZerof asserts that i is not the zero value for its type. +func (a *Assertions) NotZerof(i interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return NotZerof(a.t, i, msg, args...) +} + +// Panics asserts that the code inside the specified PanicTestFunc panics. +// +// a.Panics(func(){ GoCrazy() }) +func (a *Assertions) Panics(f PanicTestFunc, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Panics(a.t, f, msgAndArgs...) +} + +// PanicsWithValue asserts that the code inside the specified PanicTestFunc panics, and that +// the recovered panic value equals the expected panic value. +// +// a.PanicsWithValue("crazy error", func(){ GoCrazy() }) +func (a *Assertions) PanicsWithValue(expected interface{}, f PanicTestFunc, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return PanicsWithValue(a.t, expected, f, msgAndArgs...) +} + +// PanicsWithValuef asserts that the code inside the specified PanicTestFunc panics, and that +// the recovered panic value equals the expected panic value. +// +// a.PanicsWithValuef("crazy error", func(){ GoCrazy() }, "error message %s", "formatted") +func (a *Assertions) PanicsWithValuef(expected interface{}, f PanicTestFunc, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return PanicsWithValuef(a.t, expected, f, msg, args...) +} + +// Panicsf asserts that the code inside the specified PanicTestFunc panics. +// +// a.Panicsf(func(){ GoCrazy() }, "error message %s", "formatted") +func (a *Assertions) Panicsf(f PanicTestFunc, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Panicsf(a.t, f, msg, args...) +} + +// Regexp asserts that a specified regexp matches a string. +// +// a.Regexp(regexp.MustCompile("start"), "it's starting") +// a.Regexp("start...$", "it's not starting") +func (a *Assertions) Regexp(rx interface{}, str interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Regexp(a.t, rx, str, msgAndArgs...) +} + +// Regexpf asserts that a specified regexp matches a string. +// +// a.Regexpf(regexp.MustCompile("start", "error message %s", "formatted"), "it's starting") +// a.Regexpf("start...$", "it's not starting", "error message %s", "formatted") +func (a *Assertions) Regexpf(rx interface{}, str interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Regexpf(a.t, rx, str, msg, args...) +} + +// Subset asserts that the specified list(array, slice...) contains all +// elements given in the specified subset(array, slice...). +// +// a.Subset([1, 2, 3], [1, 2], "But [1, 2, 3] does contain [1, 2]") +func (a *Assertions) Subset(list interface{}, subset interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Subset(a.t, list, subset, msgAndArgs...) +} + +// Subsetf asserts that the specified list(array, slice...) contains all +// elements given in the specified subset(array, slice...). +// +// a.Subsetf([1, 2, 3], [1, 2], "But [1, 2, 3] does contain [1, 2]", "error message %s", "formatted") +func (a *Assertions) Subsetf(list interface{}, subset interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Subsetf(a.t, list, subset, msg, args...) +} + +// True asserts that the specified value is true. +// +// a.True(myBool) +func (a *Assertions) True(value bool, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return True(a.t, value, msgAndArgs...) +} + +// Truef asserts that the specified value is true. +// +// a.Truef(myBool, "error message %s", "formatted") +func (a *Assertions) Truef(value bool, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Truef(a.t, value, msg, args...) +} + +// WithinDuration asserts that the two times are within duration delta of each other. +// +// a.WithinDuration(time.Now(), time.Now(), 10*time.Second) +func (a *Assertions) WithinDuration(expected time.Time, actual time.Time, delta time.Duration, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return WithinDuration(a.t, expected, actual, delta, msgAndArgs...) +} + +// WithinDurationf asserts that the two times are within duration delta of each other. +// +// a.WithinDurationf(time.Now(), time.Now(), 10*time.Second, "error message %s", "formatted") +func (a *Assertions) WithinDurationf(expected time.Time, actual time.Time, delta time.Duration, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return WithinDurationf(a.t, expected, actual, delta, msg, args...) +} + +// Zero asserts that i is the zero value for its type. +func (a *Assertions) Zero(i interface{}, msgAndArgs ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Zero(a.t, i, msgAndArgs...) +} + +// Zerof asserts that i is the zero value for its type. +func (a *Assertions) Zerof(i interface{}, msg string, args ...interface{}) bool { + if h, ok := a.t.(tHelper); ok { + h.Helper() + } + return Zerof(a.t, i, msg, args...) +} diff --git a/vendor/github.com/stretchr/testify/assert/assertion_forward.go.tmpl b/vendor/github.com/stretchr/testify/assert/assertion_forward.go.tmpl new file mode 100644 index 0000000..188bb9e --- /dev/null +++ b/vendor/github.com/stretchr/testify/assert/assertion_forward.go.tmpl @@ -0,0 +1,5 @@ +{{.CommentWithoutT "a"}} +func (a *Assertions) {{.DocInfo.Name}}({{.Params}}) bool { + if h, ok := a.t.(tHelper); ok { h.Helper() } + return {{.DocInfo.Name}}(a.t, {{.ForwardedParams}}) +} diff --git a/vendor/github.com/stretchr/testify/assert/assertions.go b/vendor/github.com/stretchr/testify/assert/assertions.go new file mode 100644 index 0000000..9bd4a80 --- /dev/null +++ b/vendor/github.com/stretchr/testify/assert/assertions.go @@ -0,0 +1,1416 @@ +package assert + +import ( + "bufio" + "bytes" + "encoding/json" + "errors" + "fmt" + "math" + "os" + "reflect" + "regexp" + "runtime" + "strings" + "time" + "unicode" + "unicode/utf8" + + "github.com/davecgh/go-spew/spew" + "github.com/pmezard/go-difflib/difflib" +) + +//go:generate go run ../_codegen/main.go -output-package=assert -template=assertion_format.go.tmpl + +// TestingT is an interface wrapper around *testing.T +type TestingT interface { + Errorf(format string, args ...interface{}) +} + +// ComparisonAssertionFunc is a common function prototype when comparing two values. Can be useful +// for table driven tests. +type ComparisonAssertionFunc func(TestingT, interface{}, interface{}, ...interface{}) bool + +// ValueAssertionFunc is a common function prototype when validating a single value. Can be useful +// for table driven tests. +type ValueAssertionFunc func(TestingT, interface{}, ...interface{}) bool + +// BoolAssertionFunc is a common function prototype when validating a bool value. Can be useful +// for table driven tests. +type BoolAssertionFunc func(TestingT, bool, ...interface{}) bool + +// ErrorAssertionFunc is a common function prototype when validating an error value. Can be useful +// for table driven tests. +type ErrorAssertionFunc func(TestingT, error, ...interface{}) bool + +// Comparison a custom function that returns true on success and false on failure +type Comparison func() (success bool) + +/* + Helper functions +*/ + +// ObjectsAreEqual determines if two objects are considered equal. +// +// This function does no assertion of any kind. +func ObjectsAreEqual(expected, actual interface{}) bool { + if expected == nil || actual == nil { + return expected == actual + } + + exp, ok := expected.([]byte) + if !ok { + return reflect.DeepEqual(expected, actual) + } + + act, ok := actual.([]byte) + if !ok { + return false + } + if exp == nil || act == nil { + return exp == nil && act == nil + } + return bytes.Equal(exp, act) +} + +// ObjectsAreEqualValues gets whether two objects are equal, or if their +// values are equal. +func ObjectsAreEqualValues(expected, actual interface{}) bool { + if ObjectsAreEqual(expected, actual) { + return true + } + + actualType := reflect.TypeOf(actual) + if actualType == nil { + return false + } + expectedValue := reflect.ValueOf(expected) + if expectedValue.IsValid() && expectedValue.Type().ConvertibleTo(actualType) { + // Attempt comparison after type conversion + return reflect.DeepEqual(expectedValue.Convert(actualType).Interface(), actual) + } + + return false +} + +/* CallerInfo is necessary because the assert functions use the testing object +internally, causing it to print the file:line of the assert method, rather than where +the problem actually occurred in calling code.*/ + +// CallerInfo returns an array of strings containing the file and line number +// of each stack frame leading from the current test to the assert call that +// failed. +func CallerInfo() []string { + + pc := uintptr(0) + file := "" + line := 0 + ok := false + name := "" + + callers := []string{} + for i := 0; ; i++ { + pc, file, line, ok = runtime.Caller(i) + if !ok { + // The breaks below failed to terminate the loop, and we ran off the + // end of the call stack. + break + } + + // This is a huge edge case, but it will panic if this is the case, see #180 + if file == "" { + break + } + + f := runtime.FuncForPC(pc) + if f == nil { + break + } + name = f.Name() + + // testing.tRunner is the standard library function that calls + // tests. Subtests are called directly by tRunner, without going through + // the Test/Benchmark/Example function that contains the t.Run calls, so + // with subtests we should break when we hit tRunner, without adding it + // to the list of callers. + if name == "testing.tRunner" { + break + } + + parts := strings.Split(file, "/") + file = parts[len(parts)-1] + if len(parts) > 1 { + dir := parts[len(parts)-2] + if (dir != "assert" && dir != "mock" && dir != "require") || file == "mock_test.go" { + callers = append(callers, fmt.Sprintf("%s:%d", file, line)) + } + } + + // Drop the package + segments := strings.Split(name, ".") + name = segments[len(segments)-1] + if isTest(name, "Test") || + isTest(name, "Benchmark") || + isTest(name, "Example") { + break + } + } + + return callers +} + +// Stolen from the `go test` tool. +// isTest tells whether name looks like a test (or benchmark, according to prefix). +// It is a Test (say) if there is a character after Test that is not a lower-case letter. +// We don't want TesticularCancer. +func isTest(name, prefix string) bool { + if !strings.HasPrefix(name, prefix) { + return false + } + if len(name) == len(prefix) { // "Test" is ok + return true + } + rune, _ := utf8.DecodeRuneInString(name[len(prefix):]) + return !unicode.IsLower(rune) +} + +func messageFromMsgAndArgs(msgAndArgs ...interface{}) string { + if len(msgAndArgs) == 0 || msgAndArgs == nil { + return "" + } + if len(msgAndArgs) == 1 { + msg := msgAndArgs[0] + if msgAsStr, ok := msg.(string); ok { + return msgAsStr + } + return fmt.Sprintf("%+v", msg) + } + if len(msgAndArgs) > 1 { + return fmt.Sprintf(msgAndArgs[0].(string), msgAndArgs[1:]...) + } + return "" +} + +// Aligns the provided message so that all lines after the first line start at the same location as the first line. +// Assumes that the first line starts at the correct location (after carriage return, tab, label, spacer and tab). +// The longestLabelLen parameter specifies the length of the longest label in the output (required becaues this is the +// basis on which the alignment occurs). +func indentMessageLines(message string, longestLabelLen int) string { + outBuf := new(bytes.Buffer) + + for i, scanner := 0, bufio.NewScanner(strings.NewReader(message)); scanner.Scan(); i++ { + // no need to align first line because it starts at the correct location (after the label) + if i != 0 { + // append alignLen+1 spaces to align with "{{longestLabel}}:" before adding tab + outBuf.WriteString("\n\t" + strings.Repeat(" ", longestLabelLen+1) + "\t") + } + outBuf.WriteString(scanner.Text()) + } + + return outBuf.String() +} + +type failNower interface { + FailNow() +} + +// FailNow fails test +func FailNow(t TestingT, failureMessage string, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + Fail(t, failureMessage, msgAndArgs...) + + // We cannot extend TestingT with FailNow() and + // maintain backwards compatibility, so we fallback + // to panicking when FailNow is not available in + // TestingT. + // See issue #263 + + if t, ok := t.(failNower); ok { + t.FailNow() + } else { + panic("test failed and t is missing `FailNow()`") + } + return false +} + +// Fail reports a failure through +func Fail(t TestingT, failureMessage string, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + content := []labeledContent{ + {"Error Trace", strings.Join(CallerInfo(), "\n\t\t\t")}, + {"Error", failureMessage}, + } + + // Add test name if the Go version supports it + if n, ok := t.(interface { + Name() string + }); ok { + content = append(content, labeledContent{"Test", n.Name()}) + } + + message := messageFromMsgAndArgs(msgAndArgs...) + if len(message) > 0 { + content = append(content, labeledContent{"Messages", message}) + } + + t.Errorf("\n%s", ""+labeledOutput(content...)) + + return false +} + +type labeledContent struct { + label string + content string +} + +// labeledOutput returns a string consisting of the provided labeledContent. Each labeled output is appended in the following manner: +// +// \t{{label}}:{{align_spaces}}\t{{content}}\n +// +// The initial carriage return is required to undo/erase any padding added by testing.T.Errorf. The "\t{{label}}:" is for the label. +// If a label is shorter than the longest label provided, padding spaces are added to make all the labels match in length. Once this +// alignment is achieved, "\t{{content}}\n" is added for the output. +// +// If the content of the labeledOutput contains line breaks, the subsequent lines are aligned so that they start at the same location as the first line. +func labeledOutput(content ...labeledContent) string { + longestLabel := 0 + for _, v := range content { + if len(v.label) > longestLabel { + longestLabel = len(v.label) + } + } + var output string + for _, v := range content { + output += "\t" + v.label + ":" + strings.Repeat(" ", longestLabel-len(v.label)) + "\t" + indentMessageLines(v.content, longestLabel) + "\n" + } + return output +} + +// Implements asserts that an object is implemented by the specified interface. +// +// assert.Implements(t, (*MyInterface)(nil), new(MyObject)) +func Implements(t TestingT, interfaceObject interface{}, object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + interfaceType := reflect.TypeOf(interfaceObject).Elem() + + if object == nil { + return Fail(t, fmt.Sprintf("Cannot check if nil implements %v", interfaceType), msgAndArgs...) + } + if !reflect.TypeOf(object).Implements(interfaceType) { + return Fail(t, fmt.Sprintf("%T must implement %v", object, interfaceType), msgAndArgs...) + } + + return true +} + +// IsType asserts that the specified objects are of the same type. +func IsType(t TestingT, expectedType interface{}, object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + if !ObjectsAreEqual(reflect.TypeOf(object), reflect.TypeOf(expectedType)) { + return Fail(t, fmt.Sprintf("Object expected to be of type %v, but was %v", reflect.TypeOf(expectedType), reflect.TypeOf(object)), msgAndArgs...) + } + + return true +} + +// Equal asserts that two objects are equal. +// +// assert.Equal(t, 123, 123) +// +// Pointer variable equality is determined based on the equality of the +// referenced values (as opposed to the memory addresses). Function equality +// cannot be determined and will always fail. +func Equal(t TestingT, expected, actual interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if err := validateEqualArgs(expected, actual); err != nil { + return Fail(t, fmt.Sprintf("Invalid operation: %#v == %#v (%s)", + expected, actual, err), msgAndArgs...) + } + + if !ObjectsAreEqual(expected, actual) { + diff := diff(expected, actual) + expected, actual = formatUnequalValues(expected, actual) + return Fail(t, fmt.Sprintf("Not equal: \n"+ + "expected: %s\n"+ + "actual : %s%s", expected, actual, diff), msgAndArgs...) + } + + return true + +} + +// formatUnequalValues takes two values of arbitrary types and returns string +// representations appropriate to be presented to the user. +// +// If the values are not of like type, the returned strings will be prefixed +// with the type name, and the value will be enclosed in parenthesis similar +// to a type conversion in the Go grammar. +func formatUnequalValues(expected, actual interface{}) (e string, a string) { + if reflect.TypeOf(expected) != reflect.TypeOf(actual) { + return fmt.Sprintf("%T(%#v)", expected, expected), + fmt.Sprintf("%T(%#v)", actual, actual) + } + + return fmt.Sprintf("%#v", expected), + fmt.Sprintf("%#v", actual) +} + +// EqualValues asserts that two objects are equal or convertable to the same types +// and equal. +// +// assert.EqualValues(t, uint32(123), int32(123)) +func EqualValues(t TestingT, expected, actual interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + if !ObjectsAreEqualValues(expected, actual) { + diff := diff(expected, actual) + expected, actual = formatUnequalValues(expected, actual) + return Fail(t, fmt.Sprintf("Not equal: \n"+ + "expected: %s\n"+ + "actual : %s%s", expected, actual, diff), msgAndArgs...) + } + + return true + +} + +// Exactly asserts that two objects are equal in value and type. +// +// assert.Exactly(t, int32(123), int64(123)) +func Exactly(t TestingT, expected, actual interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + aType := reflect.TypeOf(expected) + bType := reflect.TypeOf(actual) + + if aType != bType { + return Fail(t, fmt.Sprintf("Types expected to match exactly\n\t%v != %v", aType, bType), msgAndArgs...) + } + + return Equal(t, expected, actual, msgAndArgs...) + +} + +// NotNil asserts that the specified object is not nil. +// +// assert.NotNil(t, err) +func NotNil(t TestingT, object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if !isNil(object) { + return true + } + return Fail(t, "Expected value not to be nil.", msgAndArgs...) +} + +// containsKind checks if a specified kind in the slice of kinds. +func containsKind(kinds []reflect.Kind, kind reflect.Kind) bool { + for i := 0; i < len(kinds); i++ { + if kind == kinds[i] { + return true + } + } + + return false +} + +// isNil checks if a specified object is nil or not, without Failing. +func isNil(object interface{}) bool { + if object == nil { + return true + } + + value := reflect.ValueOf(object) + kind := value.Kind() + isNilableKind := containsKind( + []reflect.Kind{ + reflect.Chan, reflect.Func, + reflect.Interface, reflect.Map, + reflect.Ptr, reflect.Slice}, + kind) + + if isNilableKind && value.IsNil() { + return true + } + + return false +} + +// Nil asserts that the specified object is nil. +// +// assert.Nil(t, err) +func Nil(t TestingT, object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if isNil(object) { + return true + } + return Fail(t, fmt.Sprintf("Expected nil, but got: %#v", object), msgAndArgs...) +} + +// isEmpty gets whether the specified object is considered empty or not. +func isEmpty(object interface{}) bool { + + // get nil case out of the way + if object == nil { + return true + } + + objValue := reflect.ValueOf(object) + + switch objValue.Kind() { + // collection types are empty when they have no element + case reflect.Array, reflect.Chan, reflect.Map, reflect.Slice: + return objValue.Len() == 0 + // pointers are empty if nil or if the value they point to is empty + case reflect.Ptr: + if objValue.IsNil() { + return true + } + deref := objValue.Elem().Interface() + return isEmpty(deref) + // for all other types, compare against the zero value + default: + zero := reflect.Zero(objValue.Type()) + return reflect.DeepEqual(object, zero.Interface()) + } +} + +// Empty asserts that the specified object is empty. I.e. nil, "", false, 0 or either +// a slice or a channel with len == 0. +// +// assert.Empty(t, obj) +func Empty(t TestingT, object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + pass := isEmpty(object) + if !pass { + Fail(t, fmt.Sprintf("Should be empty, but was %v", object), msgAndArgs...) + } + + return pass + +} + +// NotEmpty asserts that the specified object is NOT empty. I.e. not nil, "", false, 0 or either +// a slice or a channel with len == 0. +// +// if assert.NotEmpty(t, obj) { +// assert.Equal(t, "two", obj[1]) +// } +func NotEmpty(t TestingT, object interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + pass := !isEmpty(object) + if !pass { + Fail(t, fmt.Sprintf("Should NOT be empty, but was %v", object), msgAndArgs...) + } + + return pass + +} + +// getLen try to get length of object. +// return (false, 0) if impossible. +func getLen(x interface{}) (ok bool, length int) { + v := reflect.ValueOf(x) + defer func() { + if e := recover(); e != nil { + ok = false + } + }() + return true, v.Len() +} + +// Len asserts that the specified object has specific length. +// Len also fails if the object has a type that len() not accept. +// +// assert.Len(t, mySlice, 3) +func Len(t TestingT, object interface{}, length int, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + ok, l := getLen(object) + if !ok { + return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", object), msgAndArgs...) + } + + if l != length { + return Fail(t, fmt.Sprintf("\"%s\" should have %d item(s), but has %d", object, length, l), msgAndArgs...) + } + return true +} + +// True asserts that the specified value is true. +// +// assert.True(t, myBool) +func True(t TestingT, value bool, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if h, ok := t.(interface { + Helper() + }); ok { + h.Helper() + } + + if value != true { + return Fail(t, "Should be true", msgAndArgs...) + } + + return true + +} + +// False asserts that the specified value is false. +// +// assert.False(t, myBool) +func False(t TestingT, value bool, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + if value != false { + return Fail(t, "Should be false", msgAndArgs...) + } + + return true + +} + +// NotEqual asserts that the specified values are NOT equal. +// +// assert.NotEqual(t, obj1, obj2) +// +// Pointer variable equality is determined based on the equality of the +// referenced values (as opposed to the memory addresses). +func NotEqual(t TestingT, expected, actual interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if err := validateEqualArgs(expected, actual); err != nil { + return Fail(t, fmt.Sprintf("Invalid operation: %#v != %#v (%s)", + expected, actual, err), msgAndArgs...) + } + + if ObjectsAreEqual(expected, actual) { + return Fail(t, fmt.Sprintf("Should not be: %#v\n", actual), msgAndArgs...) + } + + return true + +} + +// containsElement try loop over the list check if the list includes the element. +// return (false, false) if impossible. +// return (true, false) if element was not found. +// return (true, true) if element was found. +func includeElement(list interface{}, element interface{}) (ok, found bool) { + + listValue := reflect.ValueOf(list) + elementValue := reflect.ValueOf(element) + defer func() { + if e := recover(); e != nil { + ok = false + found = false + } + }() + + if reflect.TypeOf(list).Kind() == reflect.String { + return true, strings.Contains(listValue.String(), elementValue.String()) + } + + if reflect.TypeOf(list).Kind() == reflect.Map { + mapKeys := listValue.MapKeys() + for i := 0; i < len(mapKeys); i++ { + if ObjectsAreEqual(mapKeys[i].Interface(), element) { + return true, true + } + } + return true, false + } + + for i := 0; i < listValue.Len(); i++ { + if ObjectsAreEqual(listValue.Index(i).Interface(), element) { + return true, true + } + } + return true, false + +} + +// Contains asserts that the specified string, list(array, slice...) or map contains the +// specified substring or element. +// +// assert.Contains(t, "Hello World", "World") +// assert.Contains(t, ["Hello", "World"], "World") +// assert.Contains(t, {"Hello": "World"}, "Hello") +func Contains(t TestingT, s, contains interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + ok, found := includeElement(s, contains) + if !ok { + return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", s), msgAndArgs...) + } + if !found { + return Fail(t, fmt.Sprintf("\"%s\" does not contain \"%s\"", s, contains), msgAndArgs...) + } + + return true + +} + +// NotContains asserts that the specified string, list(array, slice...) or map does NOT contain the +// specified substring or element. +// +// assert.NotContains(t, "Hello World", "Earth") +// assert.NotContains(t, ["Hello", "World"], "Earth") +// assert.NotContains(t, {"Hello": "World"}, "Earth") +func NotContains(t TestingT, s, contains interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + ok, found := includeElement(s, contains) + if !ok { + return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", s), msgAndArgs...) + } + if found { + return Fail(t, fmt.Sprintf("\"%s\" should not contain \"%s\"", s, contains), msgAndArgs...) + } + + return true + +} + +// Subset asserts that the specified list(array, slice...) contains all +// elements given in the specified subset(array, slice...). +// +// assert.Subset(t, [1, 2, 3], [1, 2], "But [1, 2, 3] does contain [1, 2]") +func Subset(t TestingT, list, subset interface{}, msgAndArgs ...interface{}) (ok bool) { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if subset == nil { + return true // we consider nil to be equal to the nil set + } + + subsetValue := reflect.ValueOf(subset) + defer func() { + if e := recover(); e != nil { + ok = false + } + }() + + listKind := reflect.TypeOf(list).Kind() + subsetKind := reflect.TypeOf(subset).Kind() + + if listKind != reflect.Array && listKind != reflect.Slice { + return Fail(t, fmt.Sprintf("%q has an unsupported type %s", list, listKind), msgAndArgs...) + } + + if subsetKind != reflect.Array && subsetKind != reflect.Slice { + return Fail(t, fmt.Sprintf("%q has an unsupported type %s", subset, subsetKind), msgAndArgs...) + } + + for i := 0; i < subsetValue.Len(); i++ { + element := subsetValue.Index(i).Interface() + ok, found := includeElement(list, element) + if !ok { + return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", list), msgAndArgs...) + } + if !found { + return Fail(t, fmt.Sprintf("\"%s\" does not contain \"%s\"", list, element), msgAndArgs...) + } + } + + return true +} + +// NotSubset asserts that the specified list(array, slice...) contains not all +// elements given in the specified subset(array, slice...). +// +// assert.NotSubset(t, [1, 3, 4], [1, 2], "But [1, 3, 4] does not contain [1, 2]") +func NotSubset(t TestingT, list, subset interface{}, msgAndArgs ...interface{}) (ok bool) { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if subset == nil { + return Fail(t, fmt.Sprintf("nil is the empty set which is a subset of every set"), msgAndArgs...) + } + + subsetValue := reflect.ValueOf(subset) + defer func() { + if e := recover(); e != nil { + ok = false + } + }() + + listKind := reflect.TypeOf(list).Kind() + subsetKind := reflect.TypeOf(subset).Kind() + + if listKind != reflect.Array && listKind != reflect.Slice { + return Fail(t, fmt.Sprintf("%q has an unsupported type %s", list, listKind), msgAndArgs...) + } + + if subsetKind != reflect.Array && subsetKind != reflect.Slice { + return Fail(t, fmt.Sprintf("%q has an unsupported type %s", subset, subsetKind), msgAndArgs...) + } + + for i := 0; i < subsetValue.Len(); i++ { + element := subsetValue.Index(i).Interface() + ok, found := includeElement(list, element) + if !ok { + return Fail(t, fmt.Sprintf("\"%s\" could not be applied builtin len()", list), msgAndArgs...) + } + if !found { + return true + } + } + + return Fail(t, fmt.Sprintf("%q is a subset of %q", subset, list), msgAndArgs...) +} + +// ElementsMatch asserts that the specified listA(array, slice...) is equal to specified +// listB(array, slice...) ignoring the order of the elements. If there are duplicate elements, +// the number of appearances of each of them in both lists should match. +// +// assert.ElementsMatch(t, [1, 3, 2, 3], [1, 3, 3, 2]) +func ElementsMatch(t TestingT, listA, listB interface{}, msgAndArgs ...interface{}) (ok bool) { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if isEmpty(listA) && isEmpty(listB) { + return true + } + + aKind := reflect.TypeOf(listA).Kind() + bKind := reflect.TypeOf(listB).Kind() + + if aKind != reflect.Array && aKind != reflect.Slice { + return Fail(t, fmt.Sprintf("%q has an unsupported type %s", listA, aKind), msgAndArgs...) + } + + if bKind != reflect.Array && bKind != reflect.Slice { + return Fail(t, fmt.Sprintf("%q has an unsupported type %s", listB, bKind), msgAndArgs...) + } + + aValue := reflect.ValueOf(listA) + bValue := reflect.ValueOf(listB) + + aLen := aValue.Len() + bLen := bValue.Len() + + if aLen != bLen { + return Fail(t, fmt.Sprintf("lengths don't match: %d != %d", aLen, bLen), msgAndArgs...) + } + + // Mark indexes in bValue that we already used + visited := make([]bool, bLen) + for i := 0; i < aLen; i++ { + element := aValue.Index(i).Interface() + found := false + for j := 0; j < bLen; j++ { + if visited[j] { + continue + } + if ObjectsAreEqual(bValue.Index(j).Interface(), element) { + visited[j] = true + found = true + break + } + } + if !found { + return Fail(t, fmt.Sprintf("element %s appears more times in %s than in %s", element, aValue, bValue), msgAndArgs...) + } + } + + return true +} + +// Condition uses a Comparison to assert a complex condition. +func Condition(t TestingT, comp Comparison, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + result := comp() + if !result { + Fail(t, "Condition failed!", msgAndArgs...) + } + return result +} + +// PanicTestFunc defines a func that should be passed to the assert.Panics and assert.NotPanics +// methods, and represents a simple func that takes no arguments, and returns nothing. +type PanicTestFunc func() + +// didPanic returns true if the function passed to it panics. Otherwise, it returns false. +func didPanic(f PanicTestFunc) (bool, interface{}) { + + didPanic := false + var message interface{} + func() { + + defer func() { + if message = recover(); message != nil { + didPanic = true + } + }() + + // call the target function + f() + + }() + + return didPanic, message + +} + +// Panics asserts that the code inside the specified PanicTestFunc panics. +// +// assert.Panics(t, func(){ GoCrazy() }) +func Panics(t TestingT, f PanicTestFunc, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + if funcDidPanic, panicValue := didPanic(f); !funcDidPanic { + return Fail(t, fmt.Sprintf("func %#v should panic\n\tPanic value:\t%#v", f, panicValue), msgAndArgs...) + } + + return true +} + +// PanicsWithValue asserts that the code inside the specified PanicTestFunc panics, and that +// the recovered panic value equals the expected panic value. +// +// assert.PanicsWithValue(t, "crazy error", func(){ GoCrazy() }) +func PanicsWithValue(t TestingT, expected interface{}, f PanicTestFunc, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + funcDidPanic, panicValue := didPanic(f) + if !funcDidPanic { + return Fail(t, fmt.Sprintf("func %#v should panic\n\tPanic value:\t%#v", f, panicValue), msgAndArgs...) + } + if panicValue != expected { + return Fail(t, fmt.Sprintf("func %#v should panic with value:\t%#v\n\tPanic value:\t%#v", f, expected, panicValue), msgAndArgs...) + } + + return true +} + +// NotPanics asserts that the code inside the specified PanicTestFunc does NOT panic. +// +// assert.NotPanics(t, func(){ RemainCalm() }) +func NotPanics(t TestingT, f PanicTestFunc, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + if funcDidPanic, panicValue := didPanic(f); funcDidPanic { + return Fail(t, fmt.Sprintf("func %#v should not panic\n\tPanic value:\t%v", f, panicValue), msgAndArgs...) + } + + return true +} + +// WithinDuration asserts that the two times are within duration delta of each other. +// +// assert.WithinDuration(t, time.Now(), time.Now(), 10*time.Second) +func WithinDuration(t TestingT, expected, actual time.Time, delta time.Duration, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + dt := expected.Sub(actual) + if dt < -delta || dt > delta { + return Fail(t, fmt.Sprintf("Max difference between %v and %v allowed is %v, but difference was %v", expected, actual, delta, dt), msgAndArgs...) + } + + return true +} + +func toFloat(x interface{}) (float64, bool) { + var xf float64 + xok := true + + switch xn := x.(type) { + case uint8: + xf = float64(xn) + case uint16: + xf = float64(xn) + case uint32: + xf = float64(xn) + case uint64: + xf = float64(xn) + case int: + xf = float64(xn) + case int8: + xf = float64(xn) + case int16: + xf = float64(xn) + case int32: + xf = float64(xn) + case int64: + xf = float64(xn) + case float32: + xf = float64(xn) + case float64: + xf = float64(xn) + case time.Duration: + xf = float64(xn) + default: + xok = false + } + + return xf, xok +} + +// InDelta asserts that the two numerals are within delta of each other. +// +// assert.InDelta(t, math.Pi, (22 / 7.0), 0.01) +func InDelta(t TestingT, expected, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + af, aok := toFloat(expected) + bf, bok := toFloat(actual) + + if !aok || !bok { + return Fail(t, fmt.Sprintf("Parameters must be numerical"), msgAndArgs...) + } + + if math.IsNaN(af) { + return Fail(t, fmt.Sprintf("Expected must not be NaN"), msgAndArgs...) + } + + if math.IsNaN(bf) { + return Fail(t, fmt.Sprintf("Expected %v with delta %v, but was NaN", expected, delta), msgAndArgs...) + } + + dt := af - bf + if dt < -delta || dt > delta { + return Fail(t, fmt.Sprintf("Max difference between %v and %v allowed is %v, but difference was %v", expected, actual, delta, dt), msgAndArgs...) + } + + return true +} + +// InDeltaSlice is the same as InDelta, except it compares two slices. +func InDeltaSlice(t TestingT, expected, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if expected == nil || actual == nil || + reflect.TypeOf(actual).Kind() != reflect.Slice || + reflect.TypeOf(expected).Kind() != reflect.Slice { + return Fail(t, fmt.Sprintf("Parameters must be slice"), msgAndArgs...) + } + + actualSlice := reflect.ValueOf(actual) + expectedSlice := reflect.ValueOf(expected) + + for i := 0; i < actualSlice.Len(); i++ { + result := InDelta(t, actualSlice.Index(i).Interface(), expectedSlice.Index(i).Interface(), delta, msgAndArgs...) + if !result { + return result + } + } + + return true +} + +// InDeltaMapValues is the same as InDelta, but it compares all values between two maps. Both maps must have exactly the same keys. +func InDeltaMapValues(t TestingT, expected, actual interface{}, delta float64, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if expected == nil || actual == nil || + reflect.TypeOf(actual).Kind() != reflect.Map || + reflect.TypeOf(expected).Kind() != reflect.Map { + return Fail(t, "Arguments must be maps", msgAndArgs...) + } + + expectedMap := reflect.ValueOf(expected) + actualMap := reflect.ValueOf(actual) + + if expectedMap.Len() != actualMap.Len() { + return Fail(t, "Arguments must have the same number of keys", msgAndArgs...) + } + + for _, k := range expectedMap.MapKeys() { + ev := expectedMap.MapIndex(k) + av := actualMap.MapIndex(k) + + if !ev.IsValid() { + return Fail(t, fmt.Sprintf("missing key %q in expected map", k), msgAndArgs...) + } + + if !av.IsValid() { + return Fail(t, fmt.Sprintf("missing key %q in actual map", k), msgAndArgs...) + } + + if !InDelta( + t, + ev.Interface(), + av.Interface(), + delta, + msgAndArgs..., + ) { + return false + } + } + + return true +} + +func calcRelativeError(expected, actual interface{}) (float64, error) { + af, aok := toFloat(expected) + if !aok { + return 0, fmt.Errorf("expected value %q cannot be converted to float", expected) + } + if af == 0 { + return 0, fmt.Errorf("expected value must have a value other than zero to calculate the relative error") + } + bf, bok := toFloat(actual) + if !bok { + return 0, fmt.Errorf("actual value %q cannot be converted to float", actual) + } + + return math.Abs(af-bf) / math.Abs(af), nil +} + +// InEpsilon asserts that expected and actual have a relative error less than epsilon +func InEpsilon(t TestingT, expected, actual interface{}, epsilon float64, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + actualEpsilon, err := calcRelativeError(expected, actual) + if err != nil { + return Fail(t, err.Error(), msgAndArgs...) + } + if actualEpsilon > epsilon { + return Fail(t, fmt.Sprintf("Relative error is too high: %#v (expected)\n"+ + " < %#v (actual)", epsilon, actualEpsilon), msgAndArgs...) + } + + return true +} + +// InEpsilonSlice is the same as InEpsilon, except it compares each value from two slices. +func InEpsilonSlice(t TestingT, expected, actual interface{}, epsilon float64, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if expected == nil || actual == nil || + reflect.TypeOf(actual).Kind() != reflect.Slice || + reflect.TypeOf(expected).Kind() != reflect.Slice { + return Fail(t, fmt.Sprintf("Parameters must be slice"), msgAndArgs...) + } + + actualSlice := reflect.ValueOf(actual) + expectedSlice := reflect.ValueOf(expected) + + for i := 0; i < actualSlice.Len(); i++ { + result := InEpsilon(t, actualSlice.Index(i).Interface(), expectedSlice.Index(i).Interface(), epsilon) + if !result { + return result + } + } + + return true +} + +/* + Errors +*/ + +// NoError asserts that a function returned no error (i.e. `nil`). +// +// actualObj, err := SomeFunction() +// if assert.NoError(t, err) { +// assert.Equal(t, expectedObj, actualObj) +// } +func NoError(t TestingT, err error, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if err != nil { + return Fail(t, fmt.Sprintf("Received unexpected error:\n%+v", err), msgAndArgs...) + } + + return true +} + +// Error asserts that a function returned an error (i.e. not `nil`). +// +// actualObj, err := SomeFunction() +// if assert.Error(t, err) { +// assert.Equal(t, expectedError, err) +// } +func Error(t TestingT, err error, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + if err == nil { + return Fail(t, "An error is expected but got nil.", msgAndArgs...) + } + + return true +} + +// EqualError asserts that a function returned an error (i.e. not `nil`) +// and that it is equal to the provided error. +// +// actualObj, err := SomeFunction() +// assert.EqualError(t, err, expectedErrorString) +func EqualError(t TestingT, theError error, errString string, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if !Error(t, theError, msgAndArgs...) { + return false + } + expected := errString + actual := theError.Error() + // don't need to use deep equals here, we know they are both strings + if expected != actual { + return Fail(t, fmt.Sprintf("Error message not equal:\n"+ + "expected: %q\n"+ + "actual : %q", expected, actual), msgAndArgs...) + } + return true +} + +// matchRegexp return true if a specified regexp matches a string. +func matchRegexp(rx interface{}, str interface{}) bool { + + var r *regexp.Regexp + if rr, ok := rx.(*regexp.Regexp); ok { + r = rr + } else { + r = regexp.MustCompile(fmt.Sprint(rx)) + } + + return (r.FindStringIndex(fmt.Sprint(str)) != nil) + +} + +// Regexp asserts that a specified regexp matches a string. +// +// assert.Regexp(t, regexp.MustCompile("start"), "it's starting") +// assert.Regexp(t, "start...$", "it's not starting") +func Regexp(t TestingT, rx interface{}, str interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + + match := matchRegexp(rx, str) + + if !match { + Fail(t, fmt.Sprintf("Expect \"%v\" to match \"%v\"", str, rx), msgAndArgs...) + } + + return match +} + +// NotRegexp asserts that a specified regexp does not match a string. +// +// assert.NotRegexp(t, regexp.MustCompile("starts"), "it's starting") +// assert.NotRegexp(t, "^start", "it's not starting") +func NotRegexp(t TestingT, rx interface{}, str interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + match := matchRegexp(rx, str) + + if match { + Fail(t, fmt.Sprintf("Expect \"%v\" to NOT match \"%v\"", str, rx), msgAndArgs...) + } + + return !match + +} + +// Zero asserts that i is the zero value for its type. +func Zero(t TestingT, i interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if i != nil && !reflect.DeepEqual(i, reflect.Zero(reflect.TypeOf(i)).Interface()) { + return Fail(t, fmt.Sprintf("Should be zero, but was %v", i), msgAndArgs...) + } + return true +} + +// NotZero asserts that i is not the zero value for its type. +func NotZero(t TestingT, i interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + if i == nil || reflect.DeepEqual(i, reflect.Zero(reflect.TypeOf(i)).Interface()) { + return Fail(t, fmt.Sprintf("Should not be zero, but was %v", i), msgAndArgs...) + } + return true +} + +// FileExists checks whether a file exists in the given path. It also fails if the path points to a directory or there is an error when trying to check the file. +func FileExists(t TestingT, path string, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + info, err := os.Lstat(path) + if err != nil { + if os.IsNotExist(err) { + return Fail(t, fmt.Sprintf("unable to find file %q", path), msgAndArgs...) + } + return Fail(t, fmt.Sprintf("error when running os.Lstat(%q): %s", path, err), msgAndArgs...) + } + if info.IsDir() { + return Fail(t, fmt.Sprintf("%q is a directory", path), msgAndArgs...) + } + return true +} + +// DirExists checks whether a directory exists in the given path. It also fails if the path is a file rather a directory or there is an error checking whether it exists. +func DirExists(t TestingT, path string, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + info, err := os.Lstat(path) + if err != nil { + if os.IsNotExist(err) { + return Fail(t, fmt.Sprintf("unable to find file %q", path), msgAndArgs...) + } + return Fail(t, fmt.Sprintf("error when running os.Lstat(%q): %s", path, err), msgAndArgs...) + } + if !info.IsDir() { + return Fail(t, fmt.Sprintf("%q is a file", path), msgAndArgs...) + } + return true +} + +// JSONEq asserts that two JSON strings are equivalent. +// +// assert.JSONEq(t, `{"hello": "world", "foo": "bar"}`, `{"foo": "bar", "hello": "world"}`) +func JSONEq(t TestingT, expected string, actual string, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + var expectedJSONAsInterface, actualJSONAsInterface interface{} + + if err := json.Unmarshal([]byte(expected), &expectedJSONAsInterface); err != nil { + return Fail(t, fmt.Sprintf("Expected value ('%s') is not valid json.\nJSON parsing error: '%s'", expected, err.Error()), msgAndArgs...) + } + + if err := json.Unmarshal([]byte(actual), &actualJSONAsInterface); err != nil { + return Fail(t, fmt.Sprintf("Input ('%s') needs to be valid json.\nJSON parsing error: '%s'", actual, err.Error()), msgAndArgs...) + } + + return Equal(t, expectedJSONAsInterface, actualJSONAsInterface, msgAndArgs...) +} + +func typeAndKind(v interface{}) (reflect.Type, reflect.Kind) { + t := reflect.TypeOf(v) + k := t.Kind() + + if k == reflect.Ptr { + t = t.Elem() + k = t.Kind() + } + return t, k +} + +// diff returns a diff of both values as long as both are of the same type and +// are a struct, map, slice, array or string. Otherwise it returns an empty string. +func diff(expected interface{}, actual interface{}) string { + if expected == nil || actual == nil { + return "" + } + + et, ek := typeAndKind(expected) + at, _ := typeAndKind(actual) + + if et != at { + return "" + } + + if ek != reflect.Struct && ek != reflect.Map && ek != reflect.Slice && ek != reflect.Array && ek != reflect.String { + return "" + } + + var e, a string + if et != reflect.TypeOf("") { + e = spewConfig.Sdump(expected) + a = spewConfig.Sdump(actual) + } else { + e = expected.(string) + a = actual.(string) + } + + diff, _ := difflib.GetUnifiedDiffString(difflib.UnifiedDiff{ + A: difflib.SplitLines(e), + B: difflib.SplitLines(a), + FromFile: "Expected", + FromDate: "", + ToFile: "Actual", + ToDate: "", + Context: 1, + }) + + return "\n\nDiff:\n" + diff +} + +// validateEqualArgs checks whether provided arguments can be safely used in the +// Equal/NotEqual functions. +func validateEqualArgs(expected, actual interface{}) error { + if isFunction(expected) || isFunction(actual) { + return errors.New("cannot take func type as argument") + } + return nil +} + +func isFunction(arg interface{}) bool { + if arg == nil { + return false + } + return reflect.TypeOf(arg).Kind() == reflect.Func +} + +var spewConfig = spew.ConfigState{ + Indent: " ", + DisablePointerAddresses: true, + DisableCapacities: true, + SortKeys: true, +} + +type tHelper interface { + Helper() +} diff --git a/vendor/github.com/stretchr/testify/assert/doc.go b/vendor/github.com/stretchr/testify/assert/doc.go new file mode 100644 index 0000000..c9dccc4 --- /dev/null +++ b/vendor/github.com/stretchr/testify/assert/doc.go @@ -0,0 +1,45 @@ +// Package assert provides a set of comprehensive testing tools for use with the normal Go testing system. +// +// Example Usage +// +// The following is a complete example using assert in a standard test function: +// import ( +// "testing" +// "github.com/stretchr/testify/assert" +// ) +// +// func TestSomething(t *testing.T) { +// +// var a string = "Hello" +// var b string = "Hello" +// +// assert.Equal(t, a, b, "The two words should be the same.") +// +// } +// +// if you assert many times, use the format below: +// +// import ( +// "testing" +// "github.com/stretchr/testify/assert" +// ) +// +// func TestSomething(t *testing.T) { +// assert := assert.New(t) +// +// var a string = "Hello" +// var b string = "Hello" +// +// assert.Equal(a, b, "The two words should be the same.") +// } +// +// Assertions +// +// Assertions allow you to easily write test code, and are global funcs in the `assert` package. +// All assertion functions take, as the first argument, the `*testing.T` object provided by the +// testing framework. This allows the assertion funcs to write the failings and other details to +// the correct place. +// +// Every assertion function also takes an optional string message as the final argument, +// allowing custom error messages to be appended to the message the assertion method outputs. +package assert diff --git a/vendor/github.com/stretchr/testify/assert/errors.go b/vendor/github.com/stretchr/testify/assert/errors.go new file mode 100644 index 0000000..ac9dc9d --- /dev/null +++ b/vendor/github.com/stretchr/testify/assert/errors.go @@ -0,0 +1,10 @@ +package assert + +import ( + "errors" +) + +// AnError is an error instance useful for testing. If the code does not care +// about error specifics, and only needs to return the error for example, this +// error should be used to make the test code more readable. +var AnError = errors.New("assert.AnError general error for testing") diff --git a/vendor/github.com/stretchr/testify/assert/forward_assertions.go b/vendor/github.com/stretchr/testify/assert/forward_assertions.go new file mode 100644 index 0000000..9ad5685 --- /dev/null +++ b/vendor/github.com/stretchr/testify/assert/forward_assertions.go @@ -0,0 +1,16 @@ +package assert + +// Assertions provides assertion methods around the +// TestingT interface. +type Assertions struct { + t TestingT +} + +// New makes a new Assertions object for the specified TestingT. +func New(t TestingT) *Assertions { + return &Assertions{ + t: t, + } +} + +//go:generate go run ../_codegen/main.go -output-package=assert -template=assertion_forward.go.tmpl -include-format-funcs diff --git a/vendor/github.com/stretchr/testify/assert/http_assertions.go b/vendor/github.com/stretchr/testify/assert/http_assertions.go new file mode 100644 index 0000000..df46fa7 --- /dev/null +++ b/vendor/github.com/stretchr/testify/assert/http_assertions.go @@ -0,0 +1,143 @@ +package assert + +import ( + "fmt" + "net/http" + "net/http/httptest" + "net/url" + "strings" +) + +// httpCode is a helper that returns HTTP code of the response. It returns -1 and +// an error if building a new request fails. +func httpCode(handler http.HandlerFunc, method, url string, values url.Values) (int, error) { + w := httptest.NewRecorder() + req, err := http.NewRequest(method, url, nil) + if err != nil { + return -1, err + } + req.URL.RawQuery = values.Encode() + handler(w, req) + return w.Code, nil +} + +// HTTPSuccess asserts that a specified handler returns a success status code. +// +// assert.HTTPSuccess(t, myHandler, "POST", "http://www.google.com", nil) +// +// Returns whether the assertion was successful (true) or not (false). +func HTTPSuccess(t TestingT, handler http.HandlerFunc, method, url string, values url.Values, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + code, err := httpCode(handler, method, url, values) + if err != nil { + Fail(t, fmt.Sprintf("Failed to build test request, got error: %s", err)) + return false + } + + isSuccessCode := code >= http.StatusOK && code <= http.StatusPartialContent + if !isSuccessCode { + Fail(t, fmt.Sprintf("Expected HTTP success status code for %q but received %d", url+"?"+values.Encode(), code)) + } + + return isSuccessCode +} + +// HTTPRedirect asserts that a specified handler returns a redirect status code. +// +// assert.HTTPRedirect(t, myHandler, "GET", "/a/b/c", url.Values{"a": []string{"b", "c"}} +// +// Returns whether the assertion was successful (true) or not (false). +func HTTPRedirect(t TestingT, handler http.HandlerFunc, method, url string, values url.Values, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + code, err := httpCode(handler, method, url, values) + if err != nil { + Fail(t, fmt.Sprintf("Failed to build test request, got error: %s", err)) + return false + } + + isRedirectCode := code >= http.StatusMultipleChoices && code <= http.StatusTemporaryRedirect + if !isRedirectCode { + Fail(t, fmt.Sprintf("Expected HTTP redirect status code for %q but received %d", url+"?"+values.Encode(), code)) + } + + return isRedirectCode +} + +// HTTPError asserts that a specified handler returns an error status code. +// +// assert.HTTPError(t, myHandler, "POST", "/a/b/c", url.Values{"a": []string{"b", "c"}} +// +// Returns whether the assertion was successful (true) or not (false). +func HTTPError(t TestingT, handler http.HandlerFunc, method, url string, values url.Values, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + code, err := httpCode(handler, method, url, values) + if err != nil { + Fail(t, fmt.Sprintf("Failed to build test request, got error: %s", err)) + return false + } + + isErrorCode := code >= http.StatusBadRequest + if !isErrorCode { + Fail(t, fmt.Sprintf("Expected HTTP error status code for %q but received %d", url+"?"+values.Encode(), code)) + } + + return isErrorCode +} + +// HTTPBody is a helper that returns HTTP body of the response. It returns +// empty string if building a new request fails. +func HTTPBody(handler http.HandlerFunc, method, url string, values url.Values) string { + w := httptest.NewRecorder() + req, err := http.NewRequest(method, url+"?"+values.Encode(), nil) + if err != nil { + return "" + } + handler(w, req) + return w.Body.String() +} + +// HTTPBodyContains asserts that a specified handler returns a +// body that contains a string. +// +// assert.HTTPBodyContains(t, myHandler, "GET", "www.google.com", nil, "I'm Feeling Lucky") +// +// Returns whether the assertion was successful (true) or not (false). +func HTTPBodyContains(t TestingT, handler http.HandlerFunc, method, url string, values url.Values, str interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + body := HTTPBody(handler, method, url, values) + + contains := strings.Contains(body, fmt.Sprint(str)) + if !contains { + Fail(t, fmt.Sprintf("Expected response body for \"%s\" to contain \"%s\" but found \"%s\"", url+"?"+values.Encode(), str, body)) + } + + return contains +} + +// HTTPBodyNotContains asserts that a specified handler returns a +// body that does not contain a string. +// +// assert.HTTPBodyNotContains(t, myHandler, "GET", "www.google.com", nil, "I'm Feeling Lucky") +// +// Returns whether the assertion was successful (true) or not (false). +func HTTPBodyNotContains(t TestingT, handler http.HandlerFunc, method, url string, values url.Values, str interface{}, msgAndArgs ...interface{}) bool { + if h, ok := t.(tHelper); ok { + h.Helper() + } + body := HTTPBody(handler, method, url, values) + + contains := strings.Contains(body, fmt.Sprint(str)) + if contains { + Fail(t, fmt.Sprintf("Expected response body for \"%s\" to NOT contain \"%s\" but found \"%s\"", url+"?"+values.Encode(), str, body)) + } + + return !contains +} diff --git a/vendor/golang.org/x/crypto/AUTHORS b/vendor/golang.org/x/crypto/AUTHORS new file mode 100644 index 0000000..2b00ddb --- /dev/null +++ b/vendor/golang.org/x/crypto/AUTHORS @@ -0,0 +1,3 @@ +# This source code refers to The Go Authors for copyright purposes. +# The master list of authors is in the main Go distribution, +# visible at https://tip.golang.org/AUTHORS. diff --git a/vendor/golang.org/x/crypto/CONTRIBUTORS b/vendor/golang.org/x/crypto/CONTRIBUTORS new file mode 100644 index 0000000..1fbd3e9 --- /dev/null +++ b/vendor/golang.org/x/crypto/CONTRIBUTORS @@ -0,0 +1,3 @@ +# This source code was written by the Go contributors. +# The master list of contributors is in the main Go distribution, +# visible at https://tip.golang.org/CONTRIBUTORS. diff --git a/vendor/golang.org/x/crypto/LICENSE b/vendor/golang.org/x/crypto/LICENSE new file mode 100644 index 0000000..6a66aea --- /dev/null +++ b/vendor/golang.org/x/crypto/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/crypto/PATENTS b/vendor/golang.org/x/crypto/PATENTS new file mode 100644 index 0000000..7330990 --- /dev/null +++ b/vendor/golang.org/x/crypto/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/crypto/curve25519/const_amd64.h b/vendor/golang.org/x/crypto/curve25519/const_amd64.h new file mode 100644 index 0000000..b3f7416 --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/const_amd64.h @@ -0,0 +1,8 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This code was translated into a form compatible with 6a from the public +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html + +#define REDMASK51 0x0007FFFFFFFFFFFF diff --git a/vendor/golang.org/x/crypto/curve25519/const_amd64.s b/vendor/golang.org/x/crypto/curve25519/const_amd64.s new file mode 100644 index 0000000..ee7b4bd --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/const_amd64.s @@ -0,0 +1,20 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This code was translated into a form compatible with 6a from the public +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html + +// +build amd64,!gccgo,!appengine + +// These constants cannot be encoded in non-MOVQ immediates. +// We access them directly from memory instead. + +DATA ·_121666_213(SB)/8, $996687872 +GLOBL ·_121666_213(SB), 8, $8 + +DATA ·_2P0(SB)/8, $0xFFFFFFFFFFFDA +GLOBL ·_2P0(SB), 8, $8 + +DATA ·_2P1234(SB)/8, $0xFFFFFFFFFFFFE +GLOBL ·_2P1234(SB), 8, $8 diff --git a/vendor/golang.org/x/crypto/curve25519/cswap_amd64.s b/vendor/golang.org/x/crypto/curve25519/cswap_amd64.s new file mode 100644 index 0000000..cd793a5 --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/cswap_amd64.s @@ -0,0 +1,65 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build amd64,!gccgo,!appengine + +// func cswap(inout *[4][5]uint64, v uint64) +TEXT ·cswap(SB),7,$0 + MOVQ inout+0(FP),DI + MOVQ v+8(FP),SI + + SUBQ $1, SI + NOTQ SI + MOVQ SI, X15 + PSHUFD $0x44, X15, X15 + + MOVOU 0(DI), X0 + MOVOU 16(DI), X2 + MOVOU 32(DI), X4 + MOVOU 48(DI), X6 + MOVOU 64(DI), X8 + MOVOU 80(DI), X1 + MOVOU 96(DI), X3 + MOVOU 112(DI), X5 + MOVOU 128(DI), X7 + MOVOU 144(DI), X9 + + MOVO X1, X10 + MOVO X3, X11 + MOVO X5, X12 + MOVO X7, X13 + MOVO X9, X14 + + PXOR X0, X10 + PXOR X2, X11 + PXOR X4, X12 + PXOR X6, X13 + PXOR X8, X14 + PAND X15, X10 + PAND X15, X11 + PAND X15, X12 + PAND X15, X13 + PAND X15, X14 + PXOR X10, X0 + PXOR X10, X1 + PXOR X11, X2 + PXOR X11, X3 + PXOR X12, X4 + PXOR X12, X5 + PXOR X13, X6 + PXOR X13, X7 + PXOR X14, X8 + PXOR X14, X9 + + MOVOU X0, 0(DI) + MOVOU X2, 16(DI) + MOVOU X4, 32(DI) + MOVOU X6, 48(DI) + MOVOU X8, 64(DI) + MOVOU X1, 80(DI) + MOVOU X3, 96(DI) + MOVOU X5, 112(DI) + MOVOU X7, 128(DI) + MOVOU X9, 144(DI) + RET diff --git a/vendor/golang.org/x/crypto/curve25519/curve25519.go b/vendor/golang.org/x/crypto/curve25519/curve25519.go new file mode 100644 index 0000000..75f24ba --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/curve25519.go @@ -0,0 +1,834 @@ +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// We have an implementation in amd64 assembly so this code is only run on +// non-amd64 platforms. The amd64 assembly does not support gccgo. +// +build !amd64 gccgo appengine + +package curve25519 + +import ( + "encoding/binary" +) + +// This code is a port of the public domain, "ref10" implementation of +// curve25519 from SUPERCOP 20130419 by D. J. Bernstein. + +// fieldElement represents an element of the field GF(2^255 - 19). An element +// t, entries t[0]...t[9], represents the integer t[0]+2^26 t[1]+2^51 t[2]+2^77 +// t[3]+2^102 t[4]+...+2^230 t[9]. Bounds on each t[i] vary depending on +// context. +type fieldElement [10]int32 + +func feZero(fe *fieldElement) { + for i := range fe { + fe[i] = 0 + } +} + +func feOne(fe *fieldElement) { + feZero(fe) + fe[0] = 1 +} + +func feAdd(dst, a, b *fieldElement) { + for i := range dst { + dst[i] = a[i] + b[i] + } +} + +func feSub(dst, a, b *fieldElement) { + for i := range dst { + dst[i] = a[i] - b[i] + } +} + +func feCopy(dst, src *fieldElement) { + for i := range dst { + dst[i] = src[i] + } +} + +// feCSwap replaces (f,g) with (g,f) if b == 1; replaces (f,g) with (f,g) if b == 0. +// +// Preconditions: b in {0,1}. +func feCSwap(f, g *fieldElement, b int32) { + b = -b + for i := range f { + t := b & (f[i] ^ g[i]) + f[i] ^= t + g[i] ^= t + } +} + +// load3 reads a 24-bit, little-endian value from in. +func load3(in []byte) int64 { + var r int64 + r = int64(in[0]) + r |= int64(in[1]) << 8 + r |= int64(in[2]) << 16 + return r +} + +// load4 reads a 32-bit, little-endian value from in. +func load4(in []byte) int64 { + return int64(binary.LittleEndian.Uint32(in)) +} + +func feFromBytes(dst *fieldElement, src *[32]byte) { + h0 := load4(src[:]) + h1 := load3(src[4:]) << 6 + h2 := load3(src[7:]) << 5 + h3 := load3(src[10:]) << 3 + h4 := load3(src[13:]) << 2 + h5 := load4(src[16:]) + h6 := load3(src[20:]) << 7 + h7 := load3(src[23:]) << 5 + h8 := load3(src[26:]) << 4 + h9 := (load3(src[29:]) & 0x7fffff) << 2 + + var carry [10]int64 + carry[9] = (h9 + 1<<24) >> 25 + h0 += carry[9] * 19 + h9 -= carry[9] << 25 + carry[1] = (h1 + 1<<24) >> 25 + h2 += carry[1] + h1 -= carry[1] << 25 + carry[3] = (h3 + 1<<24) >> 25 + h4 += carry[3] + h3 -= carry[3] << 25 + carry[5] = (h5 + 1<<24) >> 25 + h6 += carry[5] + h5 -= carry[5] << 25 + carry[7] = (h7 + 1<<24) >> 25 + h8 += carry[7] + h7 -= carry[7] << 25 + + carry[0] = (h0 + 1<<25) >> 26 + h1 += carry[0] + h0 -= carry[0] << 26 + carry[2] = (h2 + 1<<25) >> 26 + h3 += carry[2] + h2 -= carry[2] << 26 + carry[4] = (h4 + 1<<25) >> 26 + h5 += carry[4] + h4 -= carry[4] << 26 + carry[6] = (h6 + 1<<25) >> 26 + h7 += carry[6] + h6 -= carry[6] << 26 + carry[8] = (h8 + 1<<25) >> 26 + h9 += carry[8] + h8 -= carry[8] << 26 + + dst[0] = int32(h0) + dst[1] = int32(h1) + dst[2] = int32(h2) + dst[3] = int32(h3) + dst[4] = int32(h4) + dst[5] = int32(h5) + dst[6] = int32(h6) + dst[7] = int32(h7) + dst[8] = int32(h8) + dst[9] = int32(h9) +} + +// feToBytes marshals h to s. +// Preconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +// +// Write p=2^255-19; q=floor(h/p). +// Basic claim: q = floor(2^(-255)(h + 19 2^(-25)h9 + 2^(-1))). +// +// Proof: +// Have |h|<=p so |q|<=1 so |19^2 2^(-255) q|<1/4. +// Also have |h-2^230 h9|<2^230 so |19 2^(-255)(h-2^230 h9)|<1/4. +// +// Write y=2^(-1)-19^2 2^(-255)q-19 2^(-255)(h-2^230 h9). +// Then 0> 25 + q = (h[0] + q) >> 26 + q = (h[1] + q) >> 25 + q = (h[2] + q) >> 26 + q = (h[3] + q) >> 25 + q = (h[4] + q) >> 26 + q = (h[5] + q) >> 25 + q = (h[6] + q) >> 26 + q = (h[7] + q) >> 25 + q = (h[8] + q) >> 26 + q = (h[9] + q) >> 25 + + // Goal: Output h-(2^255-19)q, which is between 0 and 2^255-20. + h[0] += 19 * q + // Goal: Output h-2^255 q, which is between 0 and 2^255-20. + + carry[0] = h[0] >> 26 + h[1] += carry[0] + h[0] -= carry[0] << 26 + carry[1] = h[1] >> 25 + h[2] += carry[1] + h[1] -= carry[1] << 25 + carry[2] = h[2] >> 26 + h[3] += carry[2] + h[2] -= carry[2] << 26 + carry[3] = h[3] >> 25 + h[4] += carry[3] + h[3] -= carry[3] << 25 + carry[4] = h[4] >> 26 + h[5] += carry[4] + h[4] -= carry[4] << 26 + carry[5] = h[5] >> 25 + h[6] += carry[5] + h[5] -= carry[5] << 25 + carry[6] = h[6] >> 26 + h[7] += carry[6] + h[6] -= carry[6] << 26 + carry[7] = h[7] >> 25 + h[8] += carry[7] + h[7] -= carry[7] << 25 + carry[8] = h[8] >> 26 + h[9] += carry[8] + h[8] -= carry[8] << 26 + carry[9] = h[9] >> 25 + h[9] -= carry[9] << 25 + // h10 = carry9 + + // Goal: Output h[0]+...+2^255 h10-2^255 q, which is between 0 and 2^255-20. + // Have h[0]+...+2^230 h[9] between 0 and 2^255-1; + // evidently 2^255 h10-2^255 q = 0. + // Goal: Output h[0]+...+2^230 h[9]. + + s[0] = byte(h[0] >> 0) + s[1] = byte(h[0] >> 8) + s[2] = byte(h[0] >> 16) + s[3] = byte((h[0] >> 24) | (h[1] << 2)) + s[4] = byte(h[1] >> 6) + s[5] = byte(h[1] >> 14) + s[6] = byte((h[1] >> 22) | (h[2] << 3)) + s[7] = byte(h[2] >> 5) + s[8] = byte(h[2] >> 13) + s[9] = byte((h[2] >> 21) | (h[3] << 5)) + s[10] = byte(h[3] >> 3) + s[11] = byte(h[3] >> 11) + s[12] = byte((h[3] >> 19) | (h[4] << 6)) + s[13] = byte(h[4] >> 2) + s[14] = byte(h[4] >> 10) + s[15] = byte(h[4] >> 18) + s[16] = byte(h[5] >> 0) + s[17] = byte(h[5] >> 8) + s[18] = byte(h[5] >> 16) + s[19] = byte((h[5] >> 24) | (h[6] << 1)) + s[20] = byte(h[6] >> 7) + s[21] = byte(h[6] >> 15) + s[22] = byte((h[6] >> 23) | (h[7] << 3)) + s[23] = byte(h[7] >> 5) + s[24] = byte(h[7] >> 13) + s[25] = byte((h[7] >> 21) | (h[8] << 4)) + s[26] = byte(h[8] >> 4) + s[27] = byte(h[8] >> 12) + s[28] = byte((h[8] >> 20) | (h[9] << 6)) + s[29] = byte(h[9] >> 2) + s[30] = byte(h[9] >> 10) + s[31] = byte(h[9] >> 18) +} + +// feMul calculates h = f * g +// Can overlap h with f or g. +// +// Preconditions: +// |f| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// |g| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// +// Postconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +// +// Notes on implementation strategy: +// +// Using schoolbook multiplication. +// Karatsuba would save a little in some cost models. +// +// Most multiplications by 2 and 19 are 32-bit precomputations; +// cheaper than 64-bit postcomputations. +// +// There is one remaining multiplication by 19 in the carry chain; +// one *19 precomputation can be merged into this, +// but the resulting data flow is considerably less clean. +// +// There are 12 carries below. +// 10 of them are 2-way parallelizable and vectorizable. +// Can get away with 11 carries, but then data flow is much deeper. +// +// With tighter constraints on inputs can squeeze carries into int32. +func feMul(h, f, g *fieldElement) { + f0 := f[0] + f1 := f[1] + f2 := f[2] + f3 := f[3] + f4 := f[4] + f5 := f[5] + f6 := f[6] + f7 := f[7] + f8 := f[8] + f9 := f[9] + g0 := g[0] + g1 := g[1] + g2 := g[2] + g3 := g[3] + g4 := g[4] + g5 := g[5] + g6 := g[6] + g7 := g[7] + g8 := g[8] + g9 := g[9] + g1_19 := 19 * g1 // 1.4*2^29 + g2_19 := 19 * g2 // 1.4*2^30; still ok + g3_19 := 19 * g3 + g4_19 := 19 * g4 + g5_19 := 19 * g5 + g6_19 := 19 * g6 + g7_19 := 19 * g7 + g8_19 := 19 * g8 + g9_19 := 19 * g9 + f1_2 := 2 * f1 + f3_2 := 2 * f3 + f5_2 := 2 * f5 + f7_2 := 2 * f7 + f9_2 := 2 * f9 + f0g0 := int64(f0) * int64(g0) + f0g1 := int64(f0) * int64(g1) + f0g2 := int64(f0) * int64(g2) + f0g3 := int64(f0) * int64(g3) + f0g4 := int64(f0) * int64(g4) + f0g5 := int64(f0) * int64(g5) + f0g6 := int64(f0) * int64(g6) + f0g7 := int64(f0) * int64(g7) + f0g8 := int64(f0) * int64(g8) + f0g9 := int64(f0) * int64(g9) + f1g0 := int64(f1) * int64(g0) + f1g1_2 := int64(f1_2) * int64(g1) + f1g2 := int64(f1) * int64(g2) + f1g3_2 := int64(f1_2) * int64(g3) + f1g4 := int64(f1) * int64(g4) + f1g5_2 := int64(f1_2) * int64(g5) + f1g6 := int64(f1) * int64(g6) + f1g7_2 := int64(f1_2) * int64(g7) + f1g8 := int64(f1) * int64(g8) + f1g9_38 := int64(f1_2) * int64(g9_19) + f2g0 := int64(f2) * int64(g0) + f2g1 := int64(f2) * int64(g1) + f2g2 := int64(f2) * int64(g2) + f2g3 := int64(f2) * int64(g3) + f2g4 := int64(f2) * int64(g4) + f2g5 := int64(f2) * int64(g5) + f2g6 := int64(f2) * int64(g6) + f2g7 := int64(f2) * int64(g7) + f2g8_19 := int64(f2) * int64(g8_19) + f2g9_19 := int64(f2) * int64(g9_19) + f3g0 := int64(f3) * int64(g0) + f3g1_2 := int64(f3_2) * int64(g1) + f3g2 := int64(f3) * int64(g2) + f3g3_2 := int64(f3_2) * int64(g3) + f3g4 := int64(f3) * int64(g4) + f3g5_2 := int64(f3_2) * int64(g5) + f3g6 := int64(f3) * int64(g6) + f3g7_38 := int64(f3_2) * int64(g7_19) + f3g8_19 := int64(f3) * int64(g8_19) + f3g9_38 := int64(f3_2) * int64(g9_19) + f4g0 := int64(f4) * int64(g0) + f4g1 := int64(f4) * int64(g1) + f4g2 := int64(f4) * int64(g2) + f4g3 := int64(f4) * int64(g3) + f4g4 := int64(f4) * int64(g4) + f4g5 := int64(f4) * int64(g5) + f4g6_19 := int64(f4) * int64(g6_19) + f4g7_19 := int64(f4) * int64(g7_19) + f4g8_19 := int64(f4) * int64(g8_19) + f4g9_19 := int64(f4) * int64(g9_19) + f5g0 := int64(f5) * int64(g0) + f5g1_2 := int64(f5_2) * int64(g1) + f5g2 := int64(f5) * int64(g2) + f5g3_2 := int64(f5_2) * int64(g3) + f5g4 := int64(f5) * int64(g4) + f5g5_38 := int64(f5_2) * int64(g5_19) + f5g6_19 := int64(f5) * int64(g6_19) + f5g7_38 := int64(f5_2) * int64(g7_19) + f5g8_19 := int64(f5) * int64(g8_19) + f5g9_38 := int64(f5_2) * int64(g9_19) + f6g0 := int64(f6) * int64(g0) + f6g1 := int64(f6) * int64(g1) + f6g2 := int64(f6) * int64(g2) + f6g3 := int64(f6) * int64(g3) + f6g4_19 := int64(f6) * int64(g4_19) + f6g5_19 := int64(f6) * int64(g5_19) + f6g6_19 := int64(f6) * int64(g6_19) + f6g7_19 := int64(f6) * int64(g7_19) + f6g8_19 := int64(f6) * int64(g8_19) + f6g9_19 := int64(f6) * int64(g9_19) + f7g0 := int64(f7) * int64(g0) + f7g1_2 := int64(f7_2) * int64(g1) + f7g2 := int64(f7) * int64(g2) + f7g3_38 := int64(f7_2) * int64(g3_19) + f7g4_19 := int64(f7) * int64(g4_19) + f7g5_38 := int64(f7_2) * int64(g5_19) + f7g6_19 := int64(f7) * int64(g6_19) + f7g7_38 := int64(f7_2) * int64(g7_19) + f7g8_19 := int64(f7) * int64(g8_19) + f7g9_38 := int64(f7_2) * int64(g9_19) + f8g0 := int64(f8) * int64(g0) + f8g1 := int64(f8) * int64(g1) + f8g2_19 := int64(f8) * int64(g2_19) + f8g3_19 := int64(f8) * int64(g3_19) + f8g4_19 := int64(f8) * int64(g4_19) + f8g5_19 := int64(f8) * int64(g5_19) + f8g6_19 := int64(f8) * int64(g6_19) + f8g7_19 := int64(f8) * int64(g7_19) + f8g8_19 := int64(f8) * int64(g8_19) + f8g9_19 := int64(f8) * int64(g9_19) + f9g0 := int64(f9) * int64(g0) + f9g1_38 := int64(f9_2) * int64(g1_19) + f9g2_19 := int64(f9) * int64(g2_19) + f9g3_38 := int64(f9_2) * int64(g3_19) + f9g4_19 := int64(f9) * int64(g4_19) + f9g5_38 := int64(f9_2) * int64(g5_19) + f9g6_19 := int64(f9) * int64(g6_19) + f9g7_38 := int64(f9_2) * int64(g7_19) + f9g8_19 := int64(f9) * int64(g8_19) + f9g9_38 := int64(f9_2) * int64(g9_19) + h0 := f0g0 + f1g9_38 + f2g8_19 + f3g7_38 + f4g6_19 + f5g5_38 + f6g4_19 + f7g3_38 + f8g2_19 + f9g1_38 + h1 := f0g1 + f1g0 + f2g9_19 + f3g8_19 + f4g7_19 + f5g6_19 + f6g5_19 + f7g4_19 + f8g3_19 + f9g2_19 + h2 := f0g2 + f1g1_2 + f2g0 + f3g9_38 + f4g8_19 + f5g7_38 + f6g6_19 + f7g5_38 + f8g4_19 + f9g3_38 + h3 := f0g3 + f1g2 + f2g1 + f3g0 + f4g9_19 + f5g8_19 + f6g7_19 + f7g6_19 + f8g5_19 + f9g4_19 + h4 := f0g4 + f1g3_2 + f2g2 + f3g1_2 + f4g0 + f5g9_38 + f6g8_19 + f7g7_38 + f8g6_19 + f9g5_38 + h5 := f0g5 + f1g4 + f2g3 + f3g2 + f4g1 + f5g0 + f6g9_19 + f7g8_19 + f8g7_19 + f9g6_19 + h6 := f0g6 + f1g5_2 + f2g4 + f3g3_2 + f4g2 + f5g1_2 + f6g0 + f7g9_38 + f8g8_19 + f9g7_38 + h7 := f0g7 + f1g6 + f2g5 + f3g4 + f4g3 + f5g2 + f6g1 + f7g0 + f8g9_19 + f9g8_19 + h8 := f0g8 + f1g7_2 + f2g6 + f3g5_2 + f4g4 + f5g3_2 + f6g2 + f7g1_2 + f8g0 + f9g9_38 + h9 := f0g9 + f1g8 + f2g7 + f3g6 + f4g5 + f5g4 + f6g3 + f7g2 + f8g1 + f9g0 + var carry [10]int64 + + // |h0| <= (1.1*1.1*2^52*(1+19+19+19+19)+1.1*1.1*2^50*(38+38+38+38+38)) + // i.e. |h0| <= 1.2*2^59; narrower ranges for h2, h4, h6, h8 + // |h1| <= (1.1*1.1*2^51*(1+1+19+19+19+19+19+19+19+19)) + // i.e. |h1| <= 1.5*2^58; narrower ranges for h3, h5, h7, h9 + + carry[0] = (h0 + (1 << 25)) >> 26 + h1 += carry[0] + h0 -= carry[0] << 26 + carry[4] = (h4 + (1 << 25)) >> 26 + h5 += carry[4] + h4 -= carry[4] << 26 + // |h0| <= 2^25 + // |h4| <= 2^25 + // |h1| <= 1.51*2^58 + // |h5| <= 1.51*2^58 + + carry[1] = (h1 + (1 << 24)) >> 25 + h2 += carry[1] + h1 -= carry[1] << 25 + carry[5] = (h5 + (1 << 24)) >> 25 + h6 += carry[5] + h5 -= carry[5] << 25 + // |h1| <= 2^24; from now on fits into int32 + // |h5| <= 2^24; from now on fits into int32 + // |h2| <= 1.21*2^59 + // |h6| <= 1.21*2^59 + + carry[2] = (h2 + (1 << 25)) >> 26 + h3 += carry[2] + h2 -= carry[2] << 26 + carry[6] = (h6 + (1 << 25)) >> 26 + h7 += carry[6] + h6 -= carry[6] << 26 + // |h2| <= 2^25; from now on fits into int32 unchanged + // |h6| <= 2^25; from now on fits into int32 unchanged + // |h3| <= 1.51*2^58 + // |h7| <= 1.51*2^58 + + carry[3] = (h3 + (1 << 24)) >> 25 + h4 += carry[3] + h3 -= carry[3] << 25 + carry[7] = (h7 + (1 << 24)) >> 25 + h8 += carry[7] + h7 -= carry[7] << 25 + // |h3| <= 2^24; from now on fits into int32 unchanged + // |h7| <= 2^24; from now on fits into int32 unchanged + // |h4| <= 1.52*2^33 + // |h8| <= 1.52*2^33 + + carry[4] = (h4 + (1 << 25)) >> 26 + h5 += carry[4] + h4 -= carry[4] << 26 + carry[8] = (h8 + (1 << 25)) >> 26 + h9 += carry[8] + h8 -= carry[8] << 26 + // |h4| <= 2^25; from now on fits into int32 unchanged + // |h8| <= 2^25; from now on fits into int32 unchanged + // |h5| <= 1.01*2^24 + // |h9| <= 1.51*2^58 + + carry[9] = (h9 + (1 << 24)) >> 25 + h0 += carry[9] * 19 + h9 -= carry[9] << 25 + // |h9| <= 2^24; from now on fits into int32 unchanged + // |h0| <= 1.8*2^37 + + carry[0] = (h0 + (1 << 25)) >> 26 + h1 += carry[0] + h0 -= carry[0] << 26 + // |h0| <= 2^25; from now on fits into int32 unchanged + // |h1| <= 1.01*2^24 + + h[0] = int32(h0) + h[1] = int32(h1) + h[2] = int32(h2) + h[3] = int32(h3) + h[4] = int32(h4) + h[5] = int32(h5) + h[6] = int32(h6) + h[7] = int32(h7) + h[8] = int32(h8) + h[9] = int32(h9) +} + +// feSquare calculates h = f*f. Can overlap h with f. +// +// Preconditions: +// |f| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// +// Postconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +func feSquare(h, f *fieldElement) { + f0 := f[0] + f1 := f[1] + f2 := f[2] + f3 := f[3] + f4 := f[4] + f5 := f[5] + f6 := f[6] + f7 := f[7] + f8 := f[8] + f9 := f[9] + f0_2 := 2 * f0 + f1_2 := 2 * f1 + f2_2 := 2 * f2 + f3_2 := 2 * f3 + f4_2 := 2 * f4 + f5_2 := 2 * f5 + f6_2 := 2 * f6 + f7_2 := 2 * f7 + f5_38 := 38 * f5 // 1.31*2^30 + f6_19 := 19 * f6 // 1.31*2^30 + f7_38 := 38 * f7 // 1.31*2^30 + f8_19 := 19 * f8 // 1.31*2^30 + f9_38 := 38 * f9 // 1.31*2^30 + f0f0 := int64(f0) * int64(f0) + f0f1_2 := int64(f0_2) * int64(f1) + f0f2_2 := int64(f0_2) * int64(f2) + f0f3_2 := int64(f0_2) * int64(f3) + f0f4_2 := int64(f0_2) * int64(f4) + f0f5_2 := int64(f0_2) * int64(f5) + f0f6_2 := int64(f0_2) * int64(f6) + f0f7_2 := int64(f0_2) * int64(f7) + f0f8_2 := int64(f0_2) * int64(f8) + f0f9_2 := int64(f0_2) * int64(f9) + f1f1_2 := int64(f1_2) * int64(f1) + f1f2_2 := int64(f1_2) * int64(f2) + f1f3_4 := int64(f1_2) * int64(f3_2) + f1f4_2 := int64(f1_2) * int64(f4) + f1f5_4 := int64(f1_2) * int64(f5_2) + f1f6_2 := int64(f1_2) * int64(f6) + f1f7_4 := int64(f1_2) * int64(f7_2) + f1f8_2 := int64(f1_2) * int64(f8) + f1f9_76 := int64(f1_2) * int64(f9_38) + f2f2 := int64(f2) * int64(f2) + f2f3_2 := int64(f2_2) * int64(f3) + f2f4_2 := int64(f2_2) * int64(f4) + f2f5_2 := int64(f2_2) * int64(f5) + f2f6_2 := int64(f2_2) * int64(f6) + f2f7_2 := int64(f2_2) * int64(f7) + f2f8_38 := int64(f2_2) * int64(f8_19) + f2f9_38 := int64(f2) * int64(f9_38) + f3f3_2 := int64(f3_2) * int64(f3) + f3f4_2 := int64(f3_2) * int64(f4) + f3f5_4 := int64(f3_2) * int64(f5_2) + f3f6_2 := int64(f3_2) * int64(f6) + f3f7_76 := int64(f3_2) * int64(f7_38) + f3f8_38 := int64(f3_2) * int64(f8_19) + f3f9_76 := int64(f3_2) * int64(f9_38) + f4f4 := int64(f4) * int64(f4) + f4f5_2 := int64(f4_2) * int64(f5) + f4f6_38 := int64(f4_2) * int64(f6_19) + f4f7_38 := int64(f4) * int64(f7_38) + f4f8_38 := int64(f4_2) * int64(f8_19) + f4f9_38 := int64(f4) * int64(f9_38) + f5f5_38 := int64(f5) * int64(f5_38) + f5f6_38 := int64(f5_2) * int64(f6_19) + f5f7_76 := int64(f5_2) * int64(f7_38) + f5f8_38 := int64(f5_2) * int64(f8_19) + f5f9_76 := int64(f5_2) * int64(f9_38) + f6f6_19 := int64(f6) * int64(f6_19) + f6f7_38 := int64(f6) * int64(f7_38) + f6f8_38 := int64(f6_2) * int64(f8_19) + f6f9_38 := int64(f6) * int64(f9_38) + f7f7_38 := int64(f7) * int64(f7_38) + f7f8_38 := int64(f7_2) * int64(f8_19) + f7f9_76 := int64(f7_2) * int64(f9_38) + f8f8_19 := int64(f8) * int64(f8_19) + f8f9_38 := int64(f8) * int64(f9_38) + f9f9_38 := int64(f9) * int64(f9_38) + h0 := f0f0 + f1f9_76 + f2f8_38 + f3f7_76 + f4f6_38 + f5f5_38 + h1 := f0f1_2 + f2f9_38 + f3f8_38 + f4f7_38 + f5f6_38 + h2 := f0f2_2 + f1f1_2 + f3f9_76 + f4f8_38 + f5f7_76 + f6f6_19 + h3 := f0f3_2 + f1f2_2 + f4f9_38 + f5f8_38 + f6f7_38 + h4 := f0f4_2 + f1f3_4 + f2f2 + f5f9_76 + f6f8_38 + f7f7_38 + h5 := f0f5_2 + f1f4_2 + f2f3_2 + f6f9_38 + f7f8_38 + h6 := f0f6_2 + f1f5_4 + f2f4_2 + f3f3_2 + f7f9_76 + f8f8_19 + h7 := f0f7_2 + f1f6_2 + f2f5_2 + f3f4_2 + f8f9_38 + h8 := f0f8_2 + f1f7_4 + f2f6_2 + f3f5_4 + f4f4 + f9f9_38 + h9 := f0f9_2 + f1f8_2 + f2f7_2 + f3f6_2 + f4f5_2 + var carry [10]int64 + + carry[0] = (h0 + (1 << 25)) >> 26 + h1 += carry[0] + h0 -= carry[0] << 26 + carry[4] = (h4 + (1 << 25)) >> 26 + h5 += carry[4] + h4 -= carry[4] << 26 + + carry[1] = (h1 + (1 << 24)) >> 25 + h2 += carry[1] + h1 -= carry[1] << 25 + carry[5] = (h5 + (1 << 24)) >> 25 + h6 += carry[5] + h5 -= carry[5] << 25 + + carry[2] = (h2 + (1 << 25)) >> 26 + h3 += carry[2] + h2 -= carry[2] << 26 + carry[6] = (h6 + (1 << 25)) >> 26 + h7 += carry[6] + h6 -= carry[6] << 26 + + carry[3] = (h3 + (1 << 24)) >> 25 + h4 += carry[3] + h3 -= carry[3] << 25 + carry[7] = (h7 + (1 << 24)) >> 25 + h8 += carry[7] + h7 -= carry[7] << 25 + + carry[4] = (h4 + (1 << 25)) >> 26 + h5 += carry[4] + h4 -= carry[4] << 26 + carry[8] = (h8 + (1 << 25)) >> 26 + h9 += carry[8] + h8 -= carry[8] << 26 + + carry[9] = (h9 + (1 << 24)) >> 25 + h0 += carry[9] * 19 + h9 -= carry[9] << 25 + + carry[0] = (h0 + (1 << 25)) >> 26 + h1 += carry[0] + h0 -= carry[0] << 26 + + h[0] = int32(h0) + h[1] = int32(h1) + h[2] = int32(h2) + h[3] = int32(h3) + h[4] = int32(h4) + h[5] = int32(h5) + h[6] = int32(h6) + h[7] = int32(h7) + h[8] = int32(h8) + h[9] = int32(h9) +} + +// feMul121666 calculates h = f * 121666. Can overlap h with f. +// +// Preconditions: +// |f| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// +// Postconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +func feMul121666(h, f *fieldElement) { + h0 := int64(f[0]) * 121666 + h1 := int64(f[1]) * 121666 + h2 := int64(f[2]) * 121666 + h3 := int64(f[3]) * 121666 + h4 := int64(f[4]) * 121666 + h5 := int64(f[5]) * 121666 + h6 := int64(f[6]) * 121666 + h7 := int64(f[7]) * 121666 + h8 := int64(f[8]) * 121666 + h9 := int64(f[9]) * 121666 + var carry [10]int64 + + carry[9] = (h9 + (1 << 24)) >> 25 + h0 += carry[9] * 19 + h9 -= carry[9] << 25 + carry[1] = (h1 + (1 << 24)) >> 25 + h2 += carry[1] + h1 -= carry[1] << 25 + carry[3] = (h3 + (1 << 24)) >> 25 + h4 += carry[3] + h3 -= carry[3] << 25 + carry[5] = (h5 + (1 << 24)) >> 25 + h6 += carry[5] + h5 -= carry[5] << 25 + carry[7] = (h7 + (1 << 24)) >> 25 + h8 += carry[7] + h7 -= carry[7] << 25 + + carry[0] = (h0 + (1 << 25)) >> 26 + h1 += carry[0] + h0 -= carry[0] << 26 + carry[2] = (h2 + (1 << 25)) >> 26 + h3 += carry[2] + h2 -= carry[2] << 26 + carry[4] = (h4 + (1 << 25)) >> 26 + h5 += carry[4] + h4 -= carry[4] << 26 + carry[6] = (h6 + (1 << 25)) >> 26 + h7 += carry[6] + h6 -= carry[6] << 26 + carry[8] = (h8 + (1 << 25)) >> 26 + h9 += carry[8] + h8 -= carry[8] << 26 + + h[0] = int32(h0) + h[1] = int32(h1) + h[2] = int32(h2) + h[3] = int32(h3) + h[4] = int32(h4) + h[5] = int32(h5) + h[6] = int32(h6) + h[7] = int32(h7) + h[8] = int32(h8) + h[9] = int32(h9) +} + +// feInvert sets out = z^-1. +func feInvert(out, z *fieldElement) { + var t0, t1, t2, t3 fieldElement + var i int + + feSquare(&t0, z) + for i = 1; i < 1; i++ { + feSquare(&t0, &t0) + } + feSquare(&t1, &t0) + for i = 1; i < 2; i++ { + feSquare(&t1, &t1) + } + feMul(&t1, z, &t1) + feMul(&t0, &t0, &t1) + feSquare(&t2, &t0) + for i = 1; i < 1; i++ { + feSquare(&t2, &t2) + } + feMul(&t1, &t1, &t2) + feSquare(&t2, &t1) + for i = 1; i < 5; i++ { + feSquare(&t2, &t2) + } + feMul(&t1, &t2, &t1) + feSquare(&t2, &t1) + for i = 1; i < 10; i++ { + feSquare(&t2, &t2) + } + feMul(&t2, &t2, &t1) + feSquare(&t3, &t2) + for i = 1; i < 20; i++ { + feSquare(&t3, &t3) + } + feMul(&t2, &t3, &t2) + feSquare(&t2, &t2) + for i = 1; i < 10; i++ { + feSquare(&t2, &t2) + } + feMul(&t1, &t2, &t1) + feSquare(&t2, &t1) + for i = 1; i < 50; i++ { + feSquare(&t2, &t2) + } + feMul(&t2, &t2, &t1) + feSquare(&t3, &t2) + for i = 1; i < 100; i++ { + feSquare(&t3, &t3) + } + feMul(&t2, &t3, &t2) + feSquare(&t2, &t2) + for i = 1; i < 50; i++ { + feSquare(&t2, &t2) + } + feMul(&t1, &t2, &t1) + feSquare(&t1, &t1) + for i = 1; i < 5; i++ { + feSquare(&t1, &t1) + } + feMul(out, &t1, &t0) +} + +func scalarMult(out, in, base *[32]byte) { + var e [32]byte + + copy(e[:], in[:]) + e[0] &= 248 + e[31] &= 127 + e[31] |= 64 + + var x1, x2, z2, x3, z3, tmp0, tmp1 fieldElement + feFromBytes(&x1, base) + feOne(&x2) + feCopy(&x3, &x1) + feOne(&z3) + + swap := int32(0) + for pos := 254; pos >= 0; pos-- { + b := e[pos/8] >> uint(pos&7) + b &= 1 + swap ^= int32(b) + feCSwap(&x2, &x3, swap) + feCSwap(&z2, &z3, swap) + swap = int32(b) + + feSub(&tmp0, &x3, &z3) + feSub(&tmp1, &x2, &z2) + feAdd(&x2, &x2, &z2) + feAdd(&z2, &x3, &z3) + feMul(&z3, &tmp0, &x2) + feMul(&z2, &z2, &tmp1) + feSquare(&tmp0, &tmp1) + feSquare(&tmp1, &x2) + feAdd(&x3, &z3, &z2) + feSub(&z2, &z3, &z2) + feMul(&x2, &tmp1, &tmp0) + feSub(&tmp1, &tmp1, &tmp0) + feSquare(&z2, &z2) + feMul121666(&z3, &tmp1) + feSquare(&x3, &x3) + feAdd(&tmp0, &tmp0, &z3) + feMul(&z3, &x1, &z2) + feMul(&z2, &tmp1, &tmp0) + } + + feCSwap(&x2, &x3, swap) + feCSwap(&z2, &z3, swap) + + feInvert(&z2, &z2) + feMul(&x2, &x2, &z2) + feToBytes(out, &x2) +} diff --git a/vendor/golang.org/x/crypto/curve25519/doc.go b/vendor/golang.org/x/crypto/curve25519/doc.go new file mode 100644 index 0000000..da9b10d --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/doc.go @@ -0,0 +1,23 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package curve25519 provides an implementation of scalar multiplication on +// the elliptic curve known as curve25519. See https://cr.yp.to/ecdh.html +package curve25519 // import "golang.org/x/crypto/curve25519" + +// basePoint is the x coordinate of the generator of the curve. +var basePoint = [32]byte{9, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0} + +// ScalarMult sets dst to the product in*base where dst and base are the x +// coordinates of group points and all values are in little-endian form. +func ScalarMult(dst, in, base *[32]byte) { + scalarMult(dst, in, base) +} + +// ScalarBaseMult sets dst to the product in*base where dst and base are the x +// coordinates of group points, base is the standard generator and all values +// are in little-endian form. +func ScalarBaseMult(dst, in *[32]byte) { + ScalarMult(dst, in, &basePoint) +} diff --git a/vendor/golang.org/x/crypto/curve25519/freeze_amd64.s b/vendor/golang.org/x/crypto/curve25519/freeze_amd64.s new file mode 100644 index 0000000..3908161 --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/freeze_amd64.s @@ -0,0 +1,73 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This code was translated into a form compatible with 6a from the public +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html + +// +build amd64,!gccgo,!appengine + +#include "const_amd64.h" + +// func freeze(inout *[5]uint64) +TEXT ·freeze(SB),7,$0-8 + MOVQ inout+0(FP), DI + + MOVQ 0(DI),SI + MOVQ 8(DI),DX + MOVQ 16(DI),CX + MOVQ 24(DI),R8 + MOVQ 32(DI),R9 + MOVQ $REDMASK51,AX + MOVQ AX,R10 + SUBQ $18,R10 + MOVQ $3,R11 +REDUCELOOP: + MOVQ SI,R12 + SHRQ $51,R12 + ANDQ AX,SI + ADDQ R12,DX + MOVQ DX,R12 + SHRQ $51,R12 + ANDQ AX,DX + ADDQ R12,CX + MOVQ CX,R12 + SHRQ $51,R12 + ANDQ AX,CX + ADDQ R12,R8 + MOVQ R8,R12 + SHRQ $51,R12 + ANDQ AX,R8 + ADDQ R12,R9 + MOVQ R9,R12 + SHRQ $51,R12 + ANDQ AX,R9 + IMUL3Q $19,R12,R12 + ADDQ R12,SI + SUBQ $1,R11 + JA REDUCELOOP + MOVQ $1,R12 + CMPQ R10,SI + CMOVQLT R11,R12 + CMPQ AX,DX + CMOVQNE R11,R12 + CMPQ AX,CX + CMOVQNE R11,R12 + CMPQ AX,R8 + CMOVQNE R11,R12 + CMPQ AX,R9 + CMOVQNE R11,R12 + NEGQ R12 + ANDQ R12,AX + ANDQ R12,R10 + SUBQ R10,SI + SUBQ AX,DX + SUBQ AX,CX + SUBQ AX,R8 + SUBQ AX,R9 + MOVQ SI,0(DI) + MOVQ DX,8(DI) + MOVQ CX,16(DI) + MOVQ R8,24(DI) + MOVQ R9,32(DI) + RET diff --git a/vendor/golang.org/x/crypto/curve25519/ladderstep_amd64.s b/vendor/golang.org/x/crypto/curve25519/ladderstep_amd64.s new file mode 100644 index 0000000..9e9040b --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/ladderstep_amd64.s @@ -0,0 +1,1377 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This code was translated into a form compatible with 6a from the public +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html + +// +build amd64,!gccgo,!appengine + +#include "const_amd64.h" + +// func ladderstep(inout *[5][5]uint64) +TEXT ·ladderstep(SB),0,$296-8 + MOVQ inout+0(FP),DI + + MOVQ 40(DI),SI + MOVQ 48(DI),DX + MOVQ 56(DI),CX + MOVQ 64(DI),R8 + MOVQ 72(DI),R9 + MOVQ SI,AX + MOVQ DX,R10 + MOVQ CX,R11 + MOVQ R8,R12 + MOVQ R9,R13 + ADDQ ·_2P0(SB),AX + ADDQ ·_2P1234(SB),R10 + ADDQ ·_2P1234(SB),R11 + ADDQ ·_2P1234(SB),R12 + ADDQ ·_2P1234(SB),R13 + ADDQ 80(DI),SI + ADDQ 88(DI),DX + ADDQ 96(DI),CX + ADDQ 104(DI),R8 + ADDQ 112(DI),R9 + SUBQ 80(DI),AX + SUBQ 88(DI),R10 + SUBQ 96(DI),R11 + SUBQ 104(DI),R12 + SUBQ 112(DI),R13 + MOVQ SI,0(SP) + MOVQ DX,8(SP) + MOVQ CX,16(SP) + MOVQ R8,24(SP) + MOVQ R9,32(SP) + MOVQ AX,40(SP) + MOVQ R10,48(SP) + MOVQ R11,56(SP) + MOVQ R12,64(SP) + MOVQ R13,72(SP) + MOVQ 40(SP),AX + MULQ 40(SP) + MOVQ AX,SI + MOVQ DX,CX + MOVQ 40(SP),AX + SHLQ $1,AX + MULQ 48(SP) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 40(SP),AX + SHLQ $1,AX + MULQ 56(SP) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 40(SP),AX + SHLQ $1,AX + MULQ 64(SP) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 40(SP),AX + SHLQ $1,AX + MULQ 72(SP) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 48(SP),AX + MULQ 48(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 48(SP),AX + SHLQ $1,AX + MULQ 56(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 48(SP),AX + SHLQ $1,AX + MULQ 64(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 48(SP),DX + IMUL3Q $38,DX,AX + MULQ 72(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 56(SP),AX + MULQ 56(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 56(SP),DX + IMUL3Q $38,DX,AX + MULQ 64(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 56(SP),DX + IMUL3Q $38,DX,AX + MULQ 72(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 64(SP),DX + IMUL3Q $19,DX,AX + MULQ 64(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 64(SP),DX + IMUL3Q $38,DX,AX + MULQ 72(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 72(SP),DX + IMUL3Q $19,DX,AX + MULQ 72(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ $REDMASK51,DX + SHLQ $13,CX:SI + ANDQ DX,SI + SHLQ $13,R9:R8 + ANDQ DX,R8 + ADDQ CX,R8 + SHLQ $13,R11:R10 + ANDQ DX,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ DX,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ DX,R14 + ADDQ R13,R14 + IMUL3Q $19,R15,CX + ADDQ CX,SI + MOVQ SI,CX + SHRQ $51,CX + ADDQ R8,CX + ANDQ DX,SI + MOVQ CX,R8 + SHRQ $51,CX + ADDQ R10,CX + ANDQ DX,R8 + MOVQ CX,R9 + SHRQ $51,CX + ADDQ R12,CX + ANDQ DX,R9 + MOVQ CX,AX + SHRQ $51,CX + ADDQ R14,CX + ANDQ DX,AX + MOVQ CX,R10 + SHRQ $51,CX + IMUL3Q $19,CX,CX + ADDQ CX,SI + ANDQ DX,R10 + MOVQ SI,80(SP) + MOVQ R8,88(SP) + MOVQ R9,96(SP) + MOVQ AX,104(SP) + MOVQ R10,112(SP) + MOVQ 0(SP),AX + MULQ 0(SP) + MOVQ AX,SI + MOVQ DX,CX + MOVQ 0(SP),AX + SHLQ $1,AX + MULQ 8(SP) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 0(SP),AX + SHLQ $1,AX + MULQ 16(SP) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 0(SP),AX + SHLQ $1,AX + MULQ 24(SP) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 0(SP),AX + SHLQ $1,AX + MULQ 32(SP) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 8(SP),AX + MULQ 8(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 8(SP),AX + SHLQ $1,AX + MULQ 16(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 8(SP),AX + SHLQ $1,AX + MULQ 24(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 8(SP),DX + IMUL3Q $38,DX,AX + MULQ 32(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 16(SP),AX + MULQ 16(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 16(SP),DX + IMUL3Q $38,DX,AX + MULQ 24(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 16(SP),DX + IMUL3Q $38,DX,AX + MULQ 32(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 24(SP),DX + IMUL3Q $19,DX,AX + MULQ 24(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 24(SP),DX + IMUL3Q $38,DX,AX + MULQ 32(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 32(SP),DX + IMUL3Q $19,DX,AX + MULQ 32(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ $REDMASK51,DX + SHLQ $13,CX:SI + ANDQ DX,SI + SHLQ $13,R9:R8 + ANDQ DX,R8 + ADDQ CX,R8 + SHLQ $13,R11:R10 + ANDQ DX,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ DX,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ DX,R14 + ADDQ R13,R14 + IMUL3Q $19,R15,CX + ADDQ CX,SI + MOVQ SI,CX + SHRQ $51,CX + ADDQ R8,CX + ANDQ DX,SI + MOVQ CX,R8 + SHRQ $51,CX + ADDQ R10,CX + ANDQ DX,R8 + MOVQ CX,R9 + SHRQ $51,CX + ADDQ R12,CX + ANDQ DX,R9 + MOVQ CX,AX + SHRQ $51,CX + ADDQ R14,CX + ANDQ DX,AX + MOVQ CX,R10 + SHRQ $51,CX + IMUL3Q $19,CX,CX + ADDQ CX,SI + ANDQ DX,R10 + MOVQ SI,120(SP) + MOVQ R8,128(SP) + MOVQ R9,136(SP) + MOVQ AX,144(SP) + MOVQ R10,152(SP) + MOVQ SI,SI + MOVQ R8,DX + MOVQ R9,CX + MOVQ AX,R8 + MOVQ R10,R9 + ADDQ ·_2P0(SB),SI + ADDQ ·_2P1234(SB),DX + ADDQ ·_2P1234(SB),CX + ADDQ ·_2P1234(SB),R8 + ADDQ ·_2P1234(SB),R9 + SUBQ 80(SP),SI + SUBQ 88(SP),DX + SUBQ 96(SP),CX + SUBQ 104(SP),R8 + SUBQ 112(SP),R9 + MOVQ SI,160(SP) + MOVQ DX,168(SP) + MOVQ CX,176(SP) + MOVQ R8,184(SP) + MOVQ R9,192(SP) + MOVQ 120(DI),SI + MOVQ 128(DI),DX + MOVQ 136(DI),CX + MOVQ 144(DI),R8 + MOVQ 152(DI),R9 + MOVQ SI,AX + MOVQ DX,R10 + MOVQ CX,R11 + MOVQ R8,R12 + MOVQ R9,R13 + ADDQ ·_2P0(SB),AX + ADDQ ·_2P1234(SB),R10 + ADDQ ·_2P1234(SB),R11 + ADDQ ·_2P1234(SB),R12 + ADDQ ·_2P1234(SB),R13 + ADDQ 160(DI),SI + ADDQ 168(DI),DX + ADDQ 176(DI),CX + ADDQ 184(DI),R8 + ADDQ 192(DI),R9 + SUBQ 160(DI),AX + SUBQ 168(DI),R10 + SUBQ 176(DI),R11 + SUBQ 184(DI),R12 + SUBQ 192(DI),R13 + MOVQ SI,200(SP) + MOVQ DX,208(SP) + MOVQ CX,216(SP) + MOVQ R8,224(SP) + MOVQ R9,232(SP) + MOVQ AX,240(SP) + MOVQ R10,248(SP) + MOVQ R11,256(SP) + MOVQ R12,264(SP) + MOVQ R13,272(SP) + MOVQ 224(SP),SI + IMUL3Q $19,SI,AX + MOVQ AX,280(SP) + MULQ 56(SP) + MOVQ AX,SI + MOVQ DX,CX + MOVQ 232(SP),DX + IMUL3Q $19,DX,AX + MOVQ AX,288(SP) + MULQ 48(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 200(SP),AX + MULQ 40(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 200(SP),AX + MULQ 48(SP) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 200(SP),AX + MULQ 56(SP) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 200(SP),AX + MULQ 64(SP) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 200(SP),AX + MULQ 72(SP) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 208(SP),AX + MULQ 40(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 208(SP),AX + MULQ 48(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 208(SP),AX + MULQ 56(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 208(SP),AX + MULQ 64(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 208(SP),DX + IMUL3Q $19,DX,AX + MULQ 72(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 216(SP),AX + MULQ 40(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 216(SP),AX + MULQ 48(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 216(SP),AX + MULQ 56(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 216(SP),DX + IMUL3Q $19,DX,AX + MULQ 64(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 216(SP),DX + IMUL3Q $19,DX,AX + MULQ 72(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 224(SP),AX + MULQ 40(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 224(SP),AX + MULQ 48(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 280(SP),AX + MULQ 64(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 280(SP),AX + MULQ 72(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 232(SP),AX + MULQ 40(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 288(SP),AX + MULQ 56(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 288(SP),AX + MULQ 64(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 288(SP),AX + MULQ 72(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ $REDMASK51,DX + SHLQ $13,CX:SI + ANDQ DX,SI + SHLQ $13,R9:R8 + ANDQ DX,R8 + ADDQ CX,R8 + SHLQ $13,R11:R10 + ANDQ DX,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ DX,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ DX,R14 + ADDQ R13,R14 + IMUL3Q $19,R15,CX + ADDQ CX,SI + MOVQ SI,CX + SHRQ $51,CX + ADDQ R8,CX + MOVQ CX,R8 + SHRQ $51,CX + ANDQ DX,SI + ADDQ R10,CX + MOVQ CX,R9 + SHRQ $51,CX + ANDQ DX,R8 + ADDQ R12,CX + MOVQ CX,AX + SHRQ $51,CX + ANDQ DX,R9 + ADDQ R14,CX + MOVQ CX,R10 + SHRQ $51,CX + ANDQ DX,AX + IMUL3Q $19,CX,CX + ADDQ CX,SI + ANDQ DX,R10 + MOVQ SI,40(SP) + MOVQ R8,48(SP) + MOVQ R9,56(SP) + MOVQ AX,64(SP) + MOVQ R10,72(SP) + MOVQ 264(SP),SI + IMUL3Q $19,SI,AX + MOVQ AX,200(SP) + MULQ 16(SP) + MOVQ AX,SI + MOVQ DX,CX + MOVQ 272(SP),DX + IMUL3Q $19,DX,AX + MOVQ AX,208(SP) + MULQ 8(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 240(SP),AX + MULQ 0(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 240(SP),AX + MULQ 8(SP) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 240(SP),AX + MULQ 16(SP) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 240(SP),AX + MULQ 24(SP) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 240(SP),AX + MULQ 32(SP) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 248(SP),AX + MULQ 0(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 248(SP),AX + MULQ 8(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 248(SP),AX + MULQ 16(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 248(SP),AX + MULQ 24(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 248(SP),DX + IMUL3Q $19,DX,AX + MULQ 32(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 256(SP),AX + MULQ 0(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 256(SP),AX + MULQ 8(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 256(SP),AX + MULQ 16(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 256(SP),DX + IMUL3Q $19,DX,AX + MULQ 24(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 256(SP),DX + IMUL3Q $19,DX,AX + MULQ 32(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 264(SP),AX + MULQ 0(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 264(SP),AX + MULQ 8(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 200(SP),AX + MULQ 24(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 200(SP),AX + MULQ 32(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 272(SP),AX + MULQ 0(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 208(SP),AX + MULQ 16(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 208(SP),AX + MULQ 24(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 208(SP),AX + MULQ 32(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ $REDMASK51,DX + SHLQ $13,CX:SI + ANDQ DX,SI + SHLQ $13,R9:R8 + ANDQ DX,R8 + ADDQ CX,R8 + SHLQ $13,R11:R10 + ANDQ DX,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ DX,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ DX,R14 + ADDQ R13,R14 + IMUL3Q $19,R15,CX + ADDQ CX,SI + MOVQ SI,CX + SHRQ $51,CX + ADDQ R8,CX + MOVQ CX,R8 + SHRQ $51,CX + ANDQ DX,SI + ADDQ R10,CX + MOVQ CX,R9 + SHRQ $51,CX + ANDQ DX,R8 + ADDQ R12,CX + MOVQ CX,AX + SHRQ $51,CX + ANDQ DX,R9 + ADDQ R14,CX + MOVQ CX,R10 + SHRQ $51,CX + ANDQ DX,AX + IMUL3Q $19,CX,CX + ADDQ CX,SI + ANDQ DX,R10 + MOVQ SI,DX + MOVQ R8,CX + MOVQ R9,R11 + MOVQ AX,R12 + MOVQ R10,R13 + ADDQ ·_2P0(SB),DX + ADDQ ·_2P1234(SB),CX + ADDQ ·_2P1234(SB),R11 + ADDQ ·_2P1234(SB),R12 + ADDQ ·_2P1234(SB),R13 + ADDQ 40(SP),SI + ADDQ 48(SP),R8 + ADDQ 56(SP),R9 + ADDQ 64(SP),AX + ADDQ 72(SP),R10 + SUBQ 40(SP),DX + SUBQ 48(SP),CX + SUBQ 56(SP),R11 + SUBQ 64(SP),R12 + SUBQ 72(SP),R13 + MOVQ SI,120(DI) + MOVQ R8,128(DI) + MOVQ R9,136(DI) + MOVQ AX,144(DI) + MOVQ R10,152(DI) + MOVQ DX,160(DI) + MOVQ CX,168(DI) + MOVQ R11,176(DI) + MOVQ R12,184(DI) + MOVQ R13,192(DI) + MOVQ 120(DI),AX + MULQ 120(DI) + MOVQ AX,SI + MOVQ DX,CX + MOVQ 120(DI),AX + SHLQ $1,AX + MULQ 128(DI) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 120(DI),AX + SHLQ $1,AX + MULQ 136(DI) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 120(DI),AX + SHLQ $1,AX + MULQ 144(DI) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 120(DI),AX + SHLQ $1,AX + MULQ 152(DI) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 128(DI),AX + MULQ 128(DI) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 128(DI),AX + SHLQ $1,AX + MULQ 136(DI) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 128(DI),AX + SHLQ $1,AX + MULQ 144(DI) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 128(DI),DX + IMUL3Q $38,DX,AX + MULQ 152(DI) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 136(DI),AX + MULQ 136(DI) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 136(DI),DX + IMUL3Q $38,DX,AX + MULQ 144(DI) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 136(DI),DX + IMUL3Q $38,DX,AX + MULQ 152(DI) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 144(DI),DX + IMUL3Q $19,DX,AX + MULQ 144(DI) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 144(DI),DX + IMUL3Q $38,DX,AX + MULQ 152(DI) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 152(DI),DX + IMUL3Q $19,DX,AX + MULQ 152(DI) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ $REDMASK51,DX + SHLQ $13,CX:SI + ANDQ DX,SI + SHLQ $13,R9:R8 + ANDQ DX,R8 + ADDQ CX,R8 + SHLQ $13,R11:R10 + ANDQ DX,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ DX,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ DX,R14 + ADDQ R13,R14 + IMUL3Q $19,R15,CX + ADDQ CX,SI + MOVQ SI,CX + SHRQ $51,CX + ADDQ R8,CX + ANDQ DX,SI + MOVQ CX,R8 + SHRQ $51,CX + ADDQ R10,CX + ANDQ DX,R8 + MOVQ CX,R9 + SHRQ $51,CX + ADDQ R12,CX + ANDQ DX,R9 + MOVQ CX,AX + SHRQ $51,CX + ADDQ R14,CX + ANDQ DX,AX + MOVQ CX,R10 + SHRQ $51,CX + IMUL3Q $19,CX,CX + ADDQ CX,SI + ANDQ DX,R10 + MOVQ SI,120(DI) + MOVQ R8,128(DI) + MOVQ R9,136(DI) + MOVQ AX,144(DI) + MOVQ R10,152(DI) + MOVQ 160(DI),AX + MULQ 160(DI) + MOVQ AX,SI + MOVQ DX,CX + MOVQ 160(DI),AX + SHLQ $1,AX + MULQ 168(DI) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 160(DI),AX + SHLQ $1,AX + MULQ 176(DI) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 160(DI),AX + SHLQ $1,AX + MULQ 184(DI) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 160(DI),AX + SHLQ $1,AX + MULQ 192(DI) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 168(DI),AX + MULQ 168(DI) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 168(DI),AX + SHLQ $1,AX + MULQ 176(DI) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 168(DI),AX + SHLQ $1,AX + MULQ 184(DI) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 168(DI),DX + IMUL3Q $38,DX,AX + MULQ 192(DI) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 176(DI),AX + MULQ 176(DI) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 176(DI),DX + IMUL3Q $38,DX,AX + MULQ 184(DI) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 176(DI),DX + IMUL3Q $38,DX,AX + MULQ 192(DI) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 184(DI),DX + IMUL3Q $19,DX,AX + MULQ 184(DI) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 184(DI),DX + IMUL3Q $38,DX,AX + MULQ 192(DI) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 192(DI),DX + IMUL3Q $19,DX,AX + MULQ 192(DI) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ $REDMASK51,DX + SHLQ $13,CX:SI + ANDQ DX,SI + SHLQ $13,R9:R8 + ANDQ DX,R8 + ADDQ CX,R8 + SHLQ $13,R11:R10 + ANDQ DX,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ DX,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ DX,R14 + ADDQ R13,R14 + IMUL3Q $19,R15,CX + ADDQ CX,SI + MOVQ SI,CX + SHRQ $51,CX + ADDQ R8,CX + ANDQ DX,SI + MOVQ CX,R8 + SHRQ $51,CX + ADDQ R10,CX + ANDQ DX,R8 + MOVQ CX,R9 + SHRQ $51,CX + ADDQ R12,CX + ANDQ DX,R9 + MOVQ CX,AX + SHRQ $51,CX + ADDQ R14,CX + ANDQ DX,AX + MOVQ CX,R10 + SHRQ $51,CX + IMUL3Q $19,CX,CX + ADDQ CX,SI + ANDQ DX,R10 + MOVQ SI,160(DI) + MOVQ R8,168(DI) + MOVQ R9,176(DI) + MOVQ AX,184(DI) + MOVQ R10,192(DI) + MOVQ 184(DI),SI + IMUL3Q $19,SI,AX + MOVQ AX,0(SP) + MULQ 16(DI) + MOVQ AX,SI + MOVQ DX,CX + MOVQ 192(DI),DX + IMUL3Q $19,DX,AX + MOVQ AX,8(SP) + MULQ 8(DI) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 160(DI),AX + MULQ 0(DI) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 160(DI),AX + MULQ 8(DI) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 160(DI),AX + MULQ 16(DI) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 160(DI),AX + MULQ 24(DI) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 160(DI),AX + MULQ 32(DI) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 168(DI),AX + MULQ 0(DI) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 168(DI),AX + MULQ 8(DI) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 168(DI),AX + MULQ 16(DI) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 168(DI),AX + MULQ 24(DI) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 168(DI),DX + IMUL3Q $19,DX,AX + MULQ 32(DI) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 176(DI),AX + MULQ 0(DI) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 176(DI),AX + MULQ 8(DI) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 176(DI),AX + MULQ 16(DI) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 176(DI),DX + IMUL3Q $19,DX,AX + MULQ 24(DI) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 176(DI),DX + IMUL3Q $19,DX,AX + MULQ 32(DI) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 184(DI),AX + MULQ 0(DI) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 184(DI),AX + MULQ 8(DI) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 0(SP),AX + MULQ 24(DI) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 0(SP),AX + MULQ 32(DI) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 192(DI),AX + MULQ 0(DI) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 8(SP),AX + MULQ 16(DI) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 8(SP),AX + MULQ 24(DI) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 8(SP),AX + MULQ 32(DI) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ $REDMASK51,DX + SHLQ $13,CX:SI + ANDQ DX,SI + SHLQ $13,R9:R8 + ANDQ DX,R8 + ADDQ CX,R8 + SHLQ $13,R11:R10 + ANDQ DX,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ DX,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ DX,R14 + ADDQ R13,R14 + IMUL3Q $19,R15,CX + ADDQ CX,SI + MOVQ SI,CX + SHRQ $51,CX + ADDQ R8,CX + MOVQ CX,R8 + SHRQ $51,CX + ANDQ DX,SI + ADDQ R10,CX + MOVQ CX,R9 + SHRQ $51,CX + ANDQ DX,R8 + ADDQ R12,CX + MOVQ CX,AX + SHRQ $51,CX + ANDQ DX,R9 + ADDQ R14,CX + MOVQ CX,R10 + SHRQ $51,CX + ANDQ DX,AX + IMUL3Q $19,CX,CX + ADDQ CX,SI + ANDQ DX,R10 + MOVQ SI,160(DI) + MOVQ R8,168(DI) + MOVQ R9,176(DI) + MOVQ AX,184(DI) + MOVQ R10,192(DI) + MOVQ 144(SP),SI + IMUL3Q $19,SI,AX + MOVQ AX,0(SP) + MULQ 96(SP) + MOVQ AX,SI + MOVQ DX,CX + MOVQ 152(SP),DX + IMUL3Q $19,DX,AX + MOVQ AX,8(SP) + MULQ 88(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 120(SP),AX + MULQ 80(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 120(SP),AX + MULQ 88(SP) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 120(SP),AX + MULQ 96(SP) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 120(SP),AX + MULQ 104(SP) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 120(SP),AX + MULQ 112(SP) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 128(SP),AX + MULQ 80(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 128(SP),AX + MULQ 88(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 128(SP),AX + MULQ 96(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 128(SP),AX + MULQ 104(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 128(SP),DX + IMUL3Q $19,DX,AX + MULQ 112(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 136(SP),AX + MULQ 80(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 136(SP),AX + MULQ 88(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 136(SP),AX + MULQ 96(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 136(SP),DX + IMUL3Q $19,DX,AX + MULQ 104(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 136(SP),DX + IMUL3Q $19,DX,AX + MULQ 112(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 144(SP),AX + MULQ 80(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 144(SP),AX + MULQ 88(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 0(SP),AX + MULQ 104(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 0(SP),AX + MULQ 112(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 152(SP),AX + MULQ 80(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 8(SP),AX + MULQ 96(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 8(SP),AX + MULQ 104(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 8(SP),AX + MULQ 112(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ $REDMASK51,DX + SHLQ $13,CX:SI + ANDQ DX,SI + SHLQ $13,R9:R8 + ANDQ DX,R8 + ADDQ CX,R8 + SHLQ $13,R11:R10 + ANDQ DX,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ DX,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ DX,R14 + ADDQ R13,R14 + IMUL3Q $19,R15,CX + ADDQ CX,SI + MOVQ SI,CX + SHRQ $51,CX + ADDQ R8,CX + MOVQ CX,R8 + SHRQ $51,CX + ANDQ DX,SI + ADDQ R10,CX + MOVQ CX,R9 + SHRQ $51,CX + ANDQ DX,R8 + ADDQ R12,CX + MOVQ CX,AX + SHRQ $51,CX + ANDQ DX,R9 + ADDQ R14,CX + MOVQ CX,R10 + SHRQ $51,CX + ANDQ DX,AX + IMUL3Q $19,CX,CX + ADDQ CX,SI + ANDQ DX,R10 + MOVQ SI,40(DI) + MOVQ R8,48(DI) + MOVQ R9,56(DI) + MOVQ AX,64(DI) + MOVQ R10,72(DI) + MOVQ 160(SP),AX + MULQ ·_121666_213(SB) + SHRQ $13,AX + MOVQ AX,SI + MOVQ DX,CX + MOVQ 168(SP),AX + MULQ ·_121666_213(SB) + SHRQ $13,AX + ADDQ AX,CX + MOVQ DX,R8 + MOVQ 176(SP),AX + MULQ ·_121666_213(SB) + SHRQ $13,AX + ADDQ AX,R8 + MOVQ DX,R9 + MOVQ 184(SP),AX + MULQ ·_121666_213(SB) + SHRQ $13,AX + ADDQ AX,R9 + MOVQ DX,R10 + MOVQ 192(SP),AX + MULQ ·_121666_213(SB) + SHRQ $13,AX + ADDQ AX,R10 + IMUL3Q $19,DX,DX + ADDQ DX,SI + ADDQ 80(SP),SI + ADDQ 88(SP),CX + ADDQ 96(SP),R8 + ADDQ 104(SP),R9 + ADDQ 112(SP),R10 + MOVQ SI,80(DI) + MOVQ CX,88(DI) + MOVQ R8,96(DI) + MOVQ R9,104(DI) + MOVQ R10,112(DI) + MOVQ 104(DI),SI + IMUL3Q $19,SI,AX + MOVQ AX,0(SP) + MULQ 176(SP) + MOVQ AX,SI + MOVQ DX,CX + MOVQ 112(DI),DX + IMUL3Q $19,DX,AX + MOVQ AX,8(SP) + MULQ 168(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 80(DI),AX + MULQ 160(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 80(DI),AX + MULQ 168(SP) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 80(DI),AX + MULQ 176(SP) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 80(DI),AX + MULQ 184(SP) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 80(DI),AX + MULQ 192(SP) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 88(DI),AX + MULQ 160(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 88(DI),AX + MULQ 168(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 88(DI),AX + MULQ 176(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 88(DI),AX + MULQ 184(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 88(DI),DX + IMUL3Q $19,DX,AX + MULQ 192(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 96(DI),AX + MULQ 160(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 96(DI),AX + MULQ 168(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 96(DI),AX + MULQ 176(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 96(DI),DX + IMUL3Q $19,DX,AX + MULQ 184(SP) + ADDQ AX,SI + ADCQ DX,CX + MOVQ 96(DI),DX + IMUL3Q $19,DX,AX + MULQ 192(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 104(DI),AX + MULQ 160(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 104(DI),AX + MULQ 168(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 0(SP),AX + MULQ 184(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 0(SP),AX + MULQ 192(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 112(DI),AX + MULQ 160(SP) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 8(SP),AX + MULQ 176(SP) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 8(SP),AX + MULQ 184(SP) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 8(SP),AX + MULQ 192(SP) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ $REDMASK51,DX + SHLQ $13,CX:SI + ANDQ DX,SI + SHLQ $13,R9:R8 + ANDQ DX,R8 + ADDQ CX,R8 + SHLQ $13,R11:R10 + ANDQ DX,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ DX,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ DX,R14 + ADDQ R13,R14 + IMUL3Q $19,R15,CX + ADDQ CX,SI + MOVQ SI,CX + SHRQ $51,CX + ADDQ R8,CX + MOVQ CX,R8 + SHRQ $51,CX + ANDQ DX,SI + ADDQ R10,CX + MOVQ CX,R9 + SHRQ $51,CX + ANDQ DX,R8 + ADDQ R12,CX + MOVQ CX,AX + SHRQ $51,CX + ANDQ DX,R9 + ADDQ R14,CX + MOVQ CX,R10 + SHRQ $51,CX + ANDQ DX,AX + IMUL3Q $19,CX,CX + ADDQ CX,SI + ANDQ DX,R10 + MOVQ SI,80(DI) + MOVQ R8,88(DI) + MOVQ R9,96(DI) + MOVQ AX,104(DI) + MOVQ R10,112(DI) + RET diff --git a/vendor/golang.org/x/crypto/curve25519/mont25519_amd64.go b/vendor/golang.org/x/crypto/curve25519/mont25519_amd64.go new file mode 100644 index 0000000..5822bd5 --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/mont25519_amd64.go @@ -0,0 +1,240 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build amd64,!gccgo,!appengine + +package curve25519 + +// These functions are implemented in the .s files. The names of the functions +// in the rest of the file are also taken from the SUPERCOP sources to help +// people following along. + +//go:noescape + +func cswap(inout *[5]uint64, v uint64) + +//go:noescape + +func ladderstep(inout *[5][5]uint64) + +//go:noescape + +func freeze(inout *[5]uint64) + +//go:noescape + +func mul(dest, a, b *[5]uint64) + +//go:noescape + +func square(out, in *[5]uint64) + +// mladder uses a Montgomery ladder to calculate (xr/zr) *= s. +func mladder(xr, zr *[5]uint64, s *[32]byte) { + var work [5][5]uint64 + + work[0] = *xr + setint(&work[1], 1) + setint(&work[2], 0) + work[3] = *xr + setint(&work[4], 1) + + j := uint(6) + var prevbit byte + + for i := 31; i >= 0; i-- { + for j < 8 { + bit := ((*s)[i] >> j) & 1 + swap := bit ^ prevbit + prevbit = bit + cswap(&work[1], uint64(swap)) + ladderstep(&work) + j-- + } + j = 7 + } + + *xr = work[1] + *zr = work[2] +} + +func scalarMult(out, in, base *[32]byte) { + var e [32]byte + copy(e[:], (*in)[:]) + e[0] &= 248 + e[31] &= 127 + e[31] |= 64 + + var t, z [5]uint64 + unpack(&t, base) + mladder(&t, &z, &e) + invert(&z, &z) + mul(&t, &t, &z) + pack(out, &t) +} + +func setint(r *[5]uint64, v uint64) { + r[0] = v + r[1] = 0 + r[2] = 0 + r[3] = 0 + r[4] = 0 +} + +// unpack sets r = x where r consists of 5, 51-bit limbs in little-endian +// order. +func unpack(r *[5]uint64, x *[32]byte) { + r[0] = uint64(x[0]) | + uint64(x[1])<<8 | + uint64(x[2])<<16 | + uint64(x[3])<<24 | + uint64(x[4])<<32 | + uint64(x[5])<<40 | + uint64(x[6]&7)<<48 + + r[1] = uint64(x[6])>>3 | + uint64(x[7])<<5 | + uint64(x[8])<<13 | + uint64(x[9])<<21 | + uint64(x[10])<<29 | + uint64(x[11])<<37 | + uint64(x[12]&63)<<45 + + r[2] = uint64(x[12])>>6 | + uint64(x[13])<<2 | + uint64(x[14])<<10 | + uint64(x[15])<<18 | + uint64(x[16])<<26 | + uint64(x[17])<<34 | + uint64(x[18])<<42 | + uint64(x[19]&1)<<50 + + r[3] = uint64(x[19])>>1 | + uint64(x[20])<<7 | + uint64(x[21])<<15 | + uint64(x[22])<<23 | + uint64(x[23])<<31 | + uint64(x[24])<<39 | + uint64(x[25]&15)<<47 + + r[4] = uint64(x[25])>>4 | + uint64(x[26])<<4 | + uint64(x[27])<<12 | + uint64(x[28])<<20 | + uint64(x[29])<<28 | + uint64(x[30])<<36 | + uint64(x[31]&127)<<44 +} + +// pack sets out = x where out is the usual, little-endian form of the 5, +// 51-bit limbs in x. +func pack(out *[32]byte, x *[5]uint64) { + t := *x + freeze(&t) + + out[0] = byte(t[0]) + out[1] = byte(t[0] >> 8) + out[2] = byte(t[0] >> 16) + out[3] = byte(t[0] >> 24) + out[4] = byte(t[0] >> 32) + out[5] = byte(t[0] >> 40) + out[6] = byte(t[0] >> 48) + + out[6] ^= byte(t[1]<<3) & 0xf8 + out[7] = byte(t[1] >> 5) + out[8] = byte(t[1] >> 13) + out[9] = byte(t[1] >> 21) + out[10] = byte(t[1] >> 29) + out[11] = byte(t[1] >> 37) + out[12] = byte(t[1] >> 45) + + out[12] ^= byte(t[2]<<6) & 0xc0 + out[13] = byte(t[2] >> 2) + out[14] = byte(t[2] >> 10) + out[15] = byte(t[2] >> 18) + out[16] = byte(t[2] >> 26) + out[17] = byte(t[2] >> 34) + out[18] = byte(t[2] >> 42) + out[19] = byte(t[2] >> 50) + + out[19] ^= byte(t[3]<<1) & 0xfe + out[20] = byte(t[3] >> 7) + out[21] = byte(t[3] >> 15) + out[22] = byte(t[3] >> 23) + out[23] = byte(t[3] >> 31) + out[24] = byte(t[3] >> 39) + out[25] = byte(t[3] >> 47) + + out[25] ^= byte(t[4]<<4) & 0xf0 + out[26] = byte(t[4] >> 4) + out[27] = byte(t[4] >> 12) + out[28] = byte(t[4] >> 20) + out[29] = byte(t[4] >> 28) + out[30] = byte(t[4] >> 36) + out[31] = byte(t[4] >> 44) +} + +// invert calculates r = x^-1 mod p using Fermat's little theorem. +func invert(r *[5]uint64, x *[5]uint64) { + var z2, z9, z11, z2_5_0, z2_10_0, z2_20_0, z2_50_0, z2_100_0, t [5]uint64 + + square(&z2, x) /* 2 */ + square(&t, &z2) /* 4 */ + square(&t, &t) /* 8 */ + mul(&z9, &t, x) /* 9 */ + mul(&z11, &z9, &z2) /* 11 */ + square(&t, &z11) /* 22 */ + mul(&z2_5_0, &t, &z9) /* 2^5 - 2^0 = 31 */ + + square(&t, &z2_5_0) /* 2^6 - 2^1 */ + for i := 1; i < 5; i++ { /* 2^20 - 2^10 */ + square(&t, &t) + } + mul(&z2_10_0, &t, &z2_5_0) /* 2^10 - 2^0 */ + + square(&t, &z2_10_0) /* 2^11 - 2^1 */ + for i := 1; i < 10; i++ { /* 2^20 - 2^10 */ + square(&t, &t) + } + mul(&z2_20_0, &t, &z2_10_0) /* 2^20 - 2^0 */ + + square(&t, &z2_20_0) /* 2^21 - 2^1 */ + for i := 1; i < 20; i++ { /* 2^40 - 2^20 */ + square(&t, &t) + } + mul(&t, &t, &z2_20_0) /* 2^40 - 2^0 */ + + square(&t, &t) /* 2^41 - 2^1 */ + for i := 1; i < 10; i++ { /* 2^50 - 2^10 */ + square(&t, &t) + } + mul(&z2_50_0, &t, &z2_10_0) /* 2^50 - 2^0 */ + + square(&t, &z2_50_0) /* 2^51 - 2^1 */ + for i := 1; i < 50; i++ { /* 2^100 - 2^50 */ + square(&t, &t) + } + mul(&z2_100_0, &t, &z2_50_0) /* 2^100 - 2^0 */ + + square(&t, &z2_100_0) /* 2^101 - 2^1 */ + for i := 1; i < 100; i++ { /* 2^200 - 2^100 */ + square(&t, &t) + } + mul(&t, &t, &z2_100_0) /* 2^200 - 2^0 */ + + square(&t, &t) /* 2^201 - 2^1 */ + for i := 1; i < 50; i++ { /* 2^250 - 2^50 */ + square(&t, &t) + } + mul(&t, &t, &z2_50_0) /* 2^250 - 2^0 */ + + square(&t, &t) /* 2^251 - 2^1 */ + square(&t, &t) /* 2^252 - 2^2 */ + square(&t, &t) /* 2^253 - 2^3 */ + + square(&t, &t) /* 2^254 - 2^4 */ + + square(&t, &t) /* 2^255 - 2^5 */ + mul(r, &t, &z11) /* 2^255 - 21 */ +} diff --git a/vendor/golang.org/x/crypto/curve25519/mul_amd64.s b/vendor/golang.org/x/crypto/curve25519/mul_amd64.s new file mode 100644 index 0000000..5ce80a2 --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/mul_amd64.s @@ -0,0 +1,169 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This code was translated into a form compatible with 6a from the public +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html + +// +build amd64,!gccgo,!appengine + +#include "const_amd64.h" + +// func mul(dest, a, b *[5]uint64) +TEXT ·mul(SB),0,$16-24 + MOVQ dest+0(FP), DI + MOVQ a+8(FP), SI + MOVQ b+16(FP), DX + + MOVQ DX,CX + MOVQ 24(SI),DX + IMUL3Q $19,DX,AX + MOVQ AX,0(SP) + MULQ 16(CX) + MOVQ AX,R8 + MOVQ DX,R9 + MOVQ 32(SI),DX + IMUL3Q $19,DX,AX + MOVQ AX,8(SP) + MULQ 8(CX) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 0(SI),AX + MULQ 0(CX) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 0(SI),AX + MULQ 8(CX) + MOVQ AX,R10 + MOVQ DX,R11 + MOVQ 0(SI),AX + MULQ 16(CX) + MOVQ AX,R12 + MOVQ DX,R13 + MOVQ 0(SI),AX + MULQ 24(CX) + MOVQ AX,R14 + MOVQ DX,R15 + MOVQ 0(SI),AX + MULQ 32(CX) + MOVQ AX,BX + MOVQ DX,BP + MOVQ 8(SI),AX + MULQ 0(CX) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 8(SI),AX + MULQ 8(CX) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 8(SI),AX + MULQ 16(CX) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 8(SI),AX + MULQ 24(CX) + ADDQ AX,BX + ADCQ DX,BP + MOVQ 8(SI),DX + IMUL3Q $19,DX,AX + MULQ 32(CX) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 16(SI),AX + MULQ 0(CX) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 16(SI),AX + MULQ 8(CX) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 16(SI),AX + MULQ 16(CX) + ADDQ AX,BX + ADCQ DX,BP + MOVQ 16(SI),DX + IMUL3Q $19,DX,AX + MULQ 24(CX) + ADDQ AX,R8 + ADCQ DX,R9 + MOVQ 16(SI),DX + IMUL3Q $19,DX,AX + MULQ 32(CX) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 24(SI),AX + MULQ 0(CX) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ 24(SI),AX + MULQ 8(CX) + ADDQ AX,BX + ADCQ DX,BP + MOVQ 0(SP),AX + MULQ 24(CX) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 0(SP),AX + MULQ 32(CX) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 32(SI),AX + MULQ 0(CX) + ADDQ AX,BX + ADCQ DX,BP + MOVQ 8(SP),AX + MULQ 16(CX) + ADDQ AX,R10 + ADCQ DX,R11 + MOVQ 8(SP),AX + MULQ 24(CX) + ADDQ AX,R12 + ADCQ DX,R13 + MOVQ 8(SP),AX + MULQ 32(CX) + ADDQ AX,R14 + ADCQ DX,R15 + MOVQ $REDMASK51,SI + SHLQ $13,R9:R8 + ANDQ SI,R8 + SHLQ $13,R11:R10 + ANDQ SI,R10 + ADDQ R9,R10 + SHLQ $13,R13:R12 + ANDQ SI,R12 + ADDQ R11,R12 + SHLQ $13,R15:R14 + ANDQ SI,R14 + ADDQ R13,R14 + SHLQ $13,BP:BX + ANDQ SI,BX + ADDQ R15,BX + IMUL3Q $19,BP,DX + ADDQ DX,R8 + MOVQ R8,DX + SHRQ $51,DX + ADDQ R10,DX + MOVQ DX,CX + SHRQ $51,DX + ANDQ SI,R8 + ADDQ R12,DX + MOVQ DX,R9 + SHRQ $51,DX + ANDQ SI,CX + ADDQ R14,DX + MOVQ DX,AX + SHRQ $51,DX + ANDQ SI,R9 + ADDQ BX,DX + MOVQ DX,R10 + SHRQ $51,DX + ANDQ SI,AX + IMUL3Q $19,DX,DX + ADDQ DX,R8 + ANDQ SI,R10 + MOVQ R8,0(DI) + MOVQ CX,8(DI) + MOVQ R9,16(DI) + MOVQ AX,24(DI) + MOVQ R10,32(DI) + RET diff --git a/vendor/golang.org/x/crypto/curve25519/square_amd64.s b/vendor/golang.org/x/crypto/curve25519/square_amd64.s new file mode 100644 index 0000000..12f7373 --- /dev/null +++ b/vendor/golang.org/x/crypto/curve25519/square_amd64.s @@ -0,0 +1,132 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This code was translated into a form compatible with 6a from the public +// domain sources in SUPERCOP: https://bench.cr.yp.to/supercop.html + +// +build amd64,!gccgo,!appengine + +#include "const_amd64.h" + +// func square(out, in *[5]uint64) +TEXT ·square(SB),7,$0-16 + MOVQ out+0(FP), DI + MOVQ in+8(FP), SI + + MOVQ 0(SI),AX + MULQ 0(SI) + MOVQ AX,CX + MOVQ DX,R8 + MOVQ 0(SI),AX + SHLQ $1,AX + MULQ 8(SI) + MOVQ AX,R9 + MOVQ DX,R10 + MOVQ 0(SI),AX + SHLQ $1,AX + MULQ 16(SI) + MOVQ AX,R11 + MOVQ DX,R12 + MOVQ 0(SI),AX + SHLQ $1,AX + MULQ 24(SI) + MOVQ AX,R13 + MOVQ DX,R14 + MOVQ 0(SI),AX + SHLQ $1,AX + MULQ 32(SI) + MOVQ AX,R15 + MOVQ DX,BX + MOVQ 8(SI),AX + MULQ 8(SI) + ADDQ AX,R11 + ADCQ DX,R12 + MOVQ 8(SI),AX + SHLQ $1,AX + MULQ 16(SI) + ADDQ AX,R13 + ADCQ DX,R14 + MOVQ 8(SI),AX + SHLQ $1,AX + MULQ 24(SI) + ADDQ AX,R15 + ADCQ DX,BX + MOVQ 8(SI),DX + IMUL3Q $38,DX,AX + MULQ 32(SI) + ADDQ AX,CX + ADCQ DX,R8 + MOVQ 16(SI),AX + MULQ 16(SI) + ADDQ AX,R15 + ADCQ DX,BX + MOVQ 16(SI),DX + IMUL3Q $38,DX,AX + MULQ 24(SI) + ADDQ AX,CX + ADCQ DX,R8 + MOVQ 16(SI),DX + IMUL3Q $38,DX,AX + MULQ 32(SI) + ADDQ AX,R9 + ADCQ DX,R10 + MOVQ 24(SI),DX + IMUL3Q $19,DX,AX + MULQ 24(SI) + ADDQ AX,R9 + ADCQ DX,R10 + MOVQ 24(SI),DX + IMUL3Q $38,DX,AX + MULQ 32(SI) + ADDQ AX,R11 + ADCQ DX,R12 + MOVQ 32(SI),DX + IMUL3Q $19,DX,AX + MULQ 32(SI) + ADDQ AX,R13 + ADCQ DX,R14 + MOVQ $REDMASK51,SI + SHLQ $13,R8:CX + ANDQ SI,CX + SHLQ $13,R10:R9 + ANDQ SI,R9 + ADDQ R8,R9 + SHLQ $13,R12:R11 + ANDQ SI,R11 + ADDQ R10,R11 + SHLQ $13,R14:R13 + ANDQ SI,R13 + ADDQ R12,R13 + SHLQ $13,BX:R15 + ANDQ SI,R15 + ADDQ R14,R15 + IMUL3Q $19,BX,DX + ADDQ DX,CX + MOVQ CX,DX + SHRQ $51,DX + ADDQ R9,DX + ANDQ SI,CX + MOVQ DX,R8 + SHRQ $51,DX + ADDQ R11,DX + ANDQ SI,R8 + MOVQ DX,R9 + SHRQ $51,DX + ADDQ R13,DX + ANDQ SI,R9 + MOVQ DX,AX + SHRQ $51,DX + ADDQ R15,DX + ANDQ SI,AX + MOVQ DX,R10 + SHRQ $51,DX + IMUL3Q $19,DX,DX + ADDQ DX,CX + ANDQ SI,R10 + MOVQ CX,0(DI) + MOVQ R8,8(DI) + MOVQ R9,16(DI) + MOVQ AX,24(DI) + MOVQ R10,32(DI) + RET diff --git a/vendor/golang.org/x/crypto/ed25519/ed25519.go b/vendor/golang.org/x/crypto/ed25519/ed25519.go new file mode 100644 index 0000000..d6f683b --- /dev/null +++ b/vendor/golang.org/x/crypto/ed25519/ed25519.go @@ -0,0 +1,217 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package ed25519 implements the Ed25519 signature algorithm. See +// https://ed25519.cr.yp.to/. +// +// These functions are also compatible with the “Ed25519” function defined in +// RFC 8032. However, unlike RFC 8032's formulation, this package's private key +// representation includes a public key suffix to make multiple signing +// operations with the same key more efficient. This package refers to the RFC +// 8032 private key as the “seed”. +package ed25519 + +// This code is a port of the public domain, “ref10” implementation of ed25519 +// from SUPERCOP. + +import ( + "bytes" + "crypto" + cryptorand "crypto/rand" + "crypto/sha512" + "errors" + "io" + "strconv" + + "golang.org/x/crypto/ed25519/internal/edwards25519" +) + +const ( + // PublicKeySize is the size, in bytes, of public keys as used in this package. + PublicKeySize = 32 + // PrivateKeySize is the size, in bytes, of private keys as used in this package. + PrivateKeySize = 64 + // SignatureSize is the size, in bytes, of signatures generated and verified by this package. + SignatureSize = 64 + // SeedSize is the size, in bytes, of private key seeds. These are the private key representations used by RFC 8032. + SeedSize = 32 +) + +// PublicKey is the type of Ed25519 public keys. +type PublicKey []byte + +// PrivateKey is the type of Ed25519 private keys. It implements crypto.Signer. +type PrivateKey []byte + +// Public returns the PublicKey corresponding to priv. +func (priv PrivateKey) Public() crypto.PublicKey { + publicKey := make([]byte, PublicKeySize) + copy(publicKey, priv[32:]) + return PublicKey(publicKey) +} + +// Seed returns the private key seed corresponding to priv. It is provided for +// interoperability with RFC 8032. RFC 8032's private keys correspond to seeds +// in this package. +func (priv PrivateKey) Seed() []byte { + seed := make([]byte, SeedSize) + copy(seed, priv[:32]) + return seed +} + +// Sign signs the given message with priv. +// Ed25519 performs two passes over messages to be signed and therefore cannot +// handle pre-hashed messages. Thus opts.HashFunc() must return zero to +// indicate the message hasn't been hashed. This can be achieved by passing +// crypto.Hash(0) as the value for opts. +func (priv PrivateKey) Sign(rand io.Reader, message []byte, opts crypto.SignerOpts) (signature []byte, err error) { + if opts.HashFunc() != crypto.Hash(0) { + return nil, errors.New("ed25519: cannot sign hashed message") + } + + return Sign(priv, message), nil +} + +// GenerateKey generates a public/private key pair using entropy from rand. +// If rand is nil, crypto/rand.Reader will be used. +func GenerateKey(rand io.Reader) (PublicKey, PrivateKey, error) { + if rand == nil { + rand = cryptorand.Reader + } + + seed := make([]byte, SeedSize) + if _, err := io.ReadFull(rand, seed); err != nil { + return nil, nil, err + } + + privateKey := NewKeyFromSeed(seed) + publicKey := make([]byte, PublicKeySize) + copy(publicKey, privateKey[32:]) + + return publicKey, privateKey, nil +} + +// NewKeyFromSeed calculates a private key from a seed. It will panic if +// len(seed) is not SeedSize. This function is provided for interoperability +// with RFC 8032. RFC 8032's private keys correspond to seeds in this +// package. +func NewKeyFromSeed(seed []byte) PrivateKey { + if l := len(seed); l != SeedSize { + panic("ed25519: bad seed length: " + strconv.Itoa(l)) + } + + digest := sha512.Sum512(seed) + digest[0] &= 248 + digest[31] &= 127 + digest[31] |= 64 + + var A edwards25519.ExtendedGroupElement + var hBytes [32]byte + copy(hBytes[:], digest[:]) + edwards25519.GeScalarMultBase(&A, &hBytes) + var publicKeyBytes [32]byte + A.ToBytes(&publicKeyBytes) + + privateKey := make([]byte, PrivateKeySize) + copy(privateKey, seed) + copy(privateKey[32:], publicKeyBytes[:]) + + return privateKey +} + +// Sign signs the message with privateKey and returns a signature. It will +// panic if len(privateKey) is not PrivateKeySize. +func Sign(privateKey PrivateKey, message []byte) []byte { + if l := len(privateKey); l != PrivateKeySize { + panic("ed25519: bad private key length: " + strconv.Itoa(l)) + } + + h := sha512.New() + h.Write(privateKey[:32]) + + var digest1, messageDigest, hramDigest [64]byte + var expandedSecretKey [32]byte + h.Sum(digest1[:0]) + copy(expandedSecretKey[:], digest1[:]) + expandedSecretKey[0] &= 248 + expandedSecretKey[31] &= 63 + expandedSecretKey[31] |= 64 + + h.Reset() + h.Write(digest1[32:]) + h.Write(message) + h.Sum(messageDigest[:0]) + + var messageDigestReduced [32]byte + edwards25519.ScReduce(&messageDigestReduced, &messageDigest) + var R edwards25519.ExtendedGroupElement + edwards25519.GeScalarMultBase(&R, &messageDigestReduced) + + var encodedR [32]byte + R.ToBytes(&encodedR) + + h.Reset() + h.Write(encodedR[:]) + h.Write(privateKey[32:]) + h.Write(message) + h.Sum(hramDigest[:0]) + var hramDigestReduced [32]byte + edwards25519.ScReduce(&hramDigestReduced, &hramDigest) + + var s [32]byte + edwards25519.ScMulAdd(&s, &hramDigestReduced, &expandedSecretKey, &messageDigestReduced) + + signature := make([]byte, SignatureSize) + copy(signature[:], encodedR[:]) + copy(signature[32:], s[:]) + + return signature +} + +// Verify reports whether sig is a valid signature of message by publicKey. It +// will panic if len(publicKey) is not PublicKeySize. +func Verify(publicKey PublicKey, message, sig []byte) bool { + if l := len(publicKey); l != PublicKeySize { + panic("ed25519: bad public key length: " + strconv.Itoa(l)) + } + + if len(sig) != SignatureSize || sig[63]&224 != 0 { + return false + } + + var A edwards25519.ExtendedGroupElement + var publicKeyBytes [32]byte + copy(publicKeyBytes[:], publicKey) + if !A.FromBytes(&publicKeyBytes) { + return false + } + edwards25519.FeNeg(&A.X, &A.X) + edwards25519.FeNeg(&A.T, &A.T) + + h := sha512.New() + h.Write(sig[:32]) + h.Write(publicKey[:]) + h.Write(message) + var digest [64]byte + h.Sum(digest[:0]) + + var hReduced [32]byte + edwards25519.ScReduce(&hReduced, &digest) + + var R edwards25519.ProjectiveGroupElement + var s [32]byte + copy(s[:], sig[32:]) + + // https://tools.ietf.org/html/rfc8032#section-5.1.7 requires that s be in + // the range [0, order) in order to prevent signature malleability. + if !edwards25519.ScMinimal(&s) { + return false + } + + edwards25519.GeDoubleScalarMultVartime(&R, &hReduced, &A, &s) + + var checkR [32]byte + R.ToBytes(&checkR) + return bytes.Equal(sig[:32], checkR[:]) +} diff --git a/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/const.go b/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/const.go new file mode 100644 index 0000000..e39f086 --- /dev/null +++ b/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/const.go @@ -0,0 +1,1422 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package edwards25519 + +// These values are from the public domain, “ref10” implementation of ed25519 +// from SUPERCOP. + +// d is a constant in the Edwards curve equation. +var d = FieldElement{ + -10913610, 13857413, -15372611, 6949391, 114729, -8787816, -6275908, -3247719, -18696448, -12055116, +} + +// d2 is 2*d. +var d2 = FieldElement{ + -21827239, -5839606, -30745221, 13898782, 229458, 15978800, -12551817, -6495438, 29715968, 9444199, +} + +// SqrtM1 is the square-root of -1 in the field. +var SqrtM1 = FieldElement{ + -32595792, -7943725, 9377950, 3500415, 12389472, -272473, -25146209, -2005654, 326686, 11406482, +} + +// A is a constant in the Montgomery-form of curve25519. +var A = FieldElement{ + 486662, 0, 0, 0, 0, 0, 0, 0, 0, 0, +} + +// bi contains precomputed multiples of the base-point. See the Ed25519 paper +// for a discussion about how these values are used. +var bi = [8]PreComputedGroupElement{ + { + FieldElement{25967493, -14356035, 29566456, 3660896, -12694345, 4014787, 27544626, -11754271, -6079156, 2047605}, + FieldElement{-12545711, 934262, -2722910, 3049990, -727428, 9406986, 12720692, 5043384, 19500929, -15469378}, + FieldElement{-8738181, 4489570, 9688441, -14785194, 10184609, -12363380, 29287919, 11864899, -24514362, -4438546}, + }, + { + FieldElement{15636291, -9688557, 24204773, -7912398, 616977, -16685262, 27787600, -14772189, 28944400, -1550024}, + FieldElement{16568933, 4717097, -11556148, -1102322, 15682896, -11807043, 16354577, -11775962, 7689662, 11199574}, + FieldElement{30464156, -5976125, -11779434, -15670865, 23220365, 15915852, 7512774, 10017326, -17749093, -9920357}, + }, + { + FieldElement{10861363, 11473154, 27284546, 1981175, -30064349, 12577861, 32867885, 14515107, -15438304, 10819380}, + FieldElement{4708026, 6336745, 20377586, 9066809, -11272109, 6594696, -25653668, 12483688, -12668491, 5581306}, + FieldElement{19563160, 16186464, -29386857, 4097519, 10237984, -4348115, 28542350, 13850243, -23678021, -15815942}, + }, + { + FieldElement{5153746, 9909285, 1723747, -2777874, 30523605, 5516873, 19480852, 5230134, -23952439, -15175766}, + FieldElement{-30269007, -3463509, 7665486, 10083793, 28475525, 1649722, 20654025, 16520125, 30598449, 7715701}, + FieldElement{28881845, 14381568, 9657904, 3680757, -20181635, 7843316, -31400660, 1370708, 29794553, -1409300}, + }, + { + FieldElement{-22518993, -6692182, 14201702, -8745502, -23510406, 8844726, 18474211, -1361450, -13062696, 13821877}, + FieldElement{-6455177, -7839871, 3374702, -4740862, -27098617, -10571707, 31655028, -7212327, 18853322, -14220951}, + FieldElement{4566830, -12963868, -28974889, -12240689, -7602672, -2830569, -8514358, -10431137, 2207753, -3209784}, + }, + { + FieldElement{-25154831, -4185821, 29681144, 7868801, -6854661, -9423865, -12437364, -663000, -31111463, -16132436}, + FieldElement{25576264, -2703214, 7349804, -11814844, 16472782, 9300885, 3844789, 15725684, 171356, 6466918}, + FieldElement{23103977, 13316479, 9739013, -16149481, 817875, -15038942, 8965339, -14088058, -30714912, 16193877}, + }, + { + FieldElement{-33521811, 3180713, -2394130, 14003687, -16903474, -16270840, 17238398, 4729455, -18074513, 9256800}, + FieldElement{-25182317, -4174131, 32336398, 5036987, -21236817, 11360617, 22616405, 9761698, -19827198, 630305}, + FieldElement{-13720693, 2639453, -24237460, -7406481, 9494427, -5774029, -6554551, -15960994, -2449256, -14291300}, + }, + { + FieldElement{-3151181, -5046075, 9282714, 6866145, -31907062, -863023, -18940575, 15033784, 25105118, -7894876}, + FieldElement{-24326370, 15950226, -31801215, -14592823, -11662737, -5090925, 1573892, -2625887, 2198790, -15804619}, + FieldElement{-3099351, 10324967, -2241613, 7453183, -5446979, -2735503, -13812022, -16236442, -32461234, -12290683}, + }, +} + +// base contains precomputed multiples of the base-point. See the Ed25519 paper +// for a discussion about how these values are used. +var base = [32][8]PreComputedGroupElement{ + { + { + FieldElement{25967493, -14356035, 29566456, 3660896, -12694345, 4014787, 27544626, -11754271, -6079156, 2047605}, + FieldElement{-12545711, 934262, -2722910, 3049990, -727428, 9406986, 12720692, 5043384, 19500929, -15469378}, + FieldElement{-8738181, 4489570, 9688441, -14785194, 10184609, -12363380, 29287919, 11864899, -24514362, -4438546}, + }, + { + FieldElement{-12815894, -12976347, -21581243, 11784320, -25355658, -2750717, -11717903, -3814571, -358445, -10211303}, + FieldElement{-21703237, 6903825, 27185491, 6451973, -29577724, -9554005, -15616551, 11189268, -26829678, -5319081}, + FieldElement{26966642, 11152617, 32442495, 15396054, 14353839, -12752335, -3128826, -9541118, -15472047, -4166697}, + }, + { + FieldElement{15636291, -9688557, 24204773, -7912398, 616977, -16685262, 27787600, -14772189, 28944400, -1550024}, + FieldElement{16568933, 4717097, -11556148, -1102322, 15682896, -11807043, 16354577, -11775962, 7689662, 11199574}, + FieldElement{30464156, -5976125, -11779434, -15670865, 23220365, 15915852, 7512774, 10017326, -17749093, -9920357}, + }, + { + FieldElement{-17036878, 13921892, 10945806, -6033431, 27105052, -16084379, -28926210, 15006023, 3284568, -6276540}, + FieldElement{23599295, -8306047, -11193664, -7687416, 13236774, 10506355, 7464579, 9656445, 13059162, 10374397}, + FieldElement{7798556, 16710257, 3033922, 2874086, 28997861, 2835604, 32406664, -3839045, -641708, -101325}, + }, + { + FieldElement{10861363, 11473154, 27284546, 1981175, -30064349, 12577861, 32867885, 14515107, -15438304, 10819380}, + FieldElement{4708026, 6336745, 20377586, 9066809, -11272109, 6594696, -25653668, 12483688, -12668491, 5581306}, + FieldElement{19563160, 16186464, -29386857, 4097519, 10237984, -4348115, 28542350, 13850243, -23678021, -15815942}, + }, + { + FieldElement{-15371964, -12862754, 32573250, 4720197, -26436522, 5875511, -19188627, -15224819, -9818940, -12085777}, + FieldElement{-8549212, 109983, 15149363, 2178705, 22900618, 4543417, 3044240, -15689887, 1762328, 14866737}, + FieldElement{-18199695, -15951423, -10473290, 1707278, -17185920, 3916101, -28236412, 3959421, 27914454, 4383652}, + }, + { + FieldElement{5153746, 9909285, 1723747, -2777874, 30523605, 5516873, 19480852, 5230134, -23952439, -15175766}, + FieldElement{-30269007, -3463509, 7665486, 10083793, 28475525, 1649722, 20654025, 16520125, 30598449, 7715701}, + FieldElement{28881845, 14381568, 9657904, 3680757, -20181635, 7843316, -31400660, 1370708, 29794553, -1409300}, + }, + { + FieldElement{14499471, -2729599, -33191113, -4254652, 28494862, 14271267, 30290735, 10876454, -33154098, 2381726}, + FieldElement{-7195431, -2655363, -14730155, 462251, -27724326, 3941372, -6236617, 3696005, -32300832, 15351955}, + FieldElement{27431194, 8222322, 16448760, -3907995, -18707002, 11938355, -32961401, -2970515, 29551813, 10109425}, + }, + }, + { + { + FieldElement{-13657040, -13155431, -31283750, 11777098, 21447386, 6519384, -2378284, -1627556, 10092783, -4764171}, + FieldElement{27939166, 14210322, 4677035, 16277044, -22964462, -12398139, -32508754, 12005538, -17810127, 12803510}, + FieldElement{17228999, -15661624, -1233527, 300140, -1224870, -11714777, 30364213, -9038194, 18016357, 4397660}, + }, + { + FieldElement{-10958843, -7690207, 4776341, -14954238, 27850028, -15602212, -26619106, 14544525, -17477504, 982639}, + FieldElement{29253598, 15796703, -2863982, -9908884, 10057023, 3163536, 7332899, -4120128, -21047696, 9934963}, + FieldElement{5793303, 16271923, -24131614, -10116404, 29188560, 1206517, -14747930, 4559895, -30123922, -10897950}, + }, + { + FieldElement{-27643952, -11493006, 16282657, -11036493, 28414021, -15012264, 24191034, 4541697, -13338309, 5500568}, + FieldElement{12650548, -1497113, 9052871, 11355358, -17680037, -8400164, -17430592, 12264343, 10874051, 13524335}, + FieldElement{25556948, -3045990, 714651, 2510400, 23394682, -10415330, 33119038, 5080568, -22528059, 5376628}, + }, + { + FieldElement{-26088264, -4011052, -17013699, -3537628, -6726793, 1920897, -22321305, -9447443, 4535768, 1569007}, + FieldElement{-2255422, 14606630, -21692440, -8039818, 28430649, 8775819, -30494562, 3044290, 31848280, 12543772}, + FieldElement{-22028579, 2943893, -31857513, 6777306, 13784462, -4292203, -27377195, -2062731, 7718482, 14474653}, + }, + { + FieldElement{2385315, 2454213, -22631320, 46603, -4437935, -15680415, 656965, -7236665, 24316168, -5253567}, + FieldElement{13741529, 10911568, -33233417, -8603737, -20177830, -1033297, 33040651, -13424532, -20729456, 8321686}, + FieldElement{21060490, -2212744, 15712757, -4336099, 1639040, 10656336, 23845965, -11874838, -9984458, 608372}, + }, + { + FieldElement{-13672732, -15087586, -10889693, -7557059, -6036909, 11305547, 1123968, -6780577, 27229399, 23887}, + FieldElement{-23244140, -294205, -11744728, 14712571, -29465699, -2029617, 12797024, -6440308, -1633405, 16678954}, + FieldElement{-29500620, 4770662, -16054387, 14001338, 7830047, 9564805, -1508144, -4795045, -17169265, 4904953}, + }, + { + FieldElement{24059557, 14617003, 19037157, -15039908, 19766093, -14906429, 5169211, 16191880, 2128236, -4326833}, + FieldElement{-16981152, 4124966, -8540610, -10653797, 30336522, -14105247, -29806336, 916033, -6882542, -2986532}, + FieldElement{-22630907, 12419372, -7134229, -7473371, -16478904, 16739175, 285431, 2763829, 15736322, 4143876}, + }, + { + FieldElement{2379352, 11839345, -4110402, -5988665, 11274298, 794957, 212801, -14594663, 23527084, -16458268}, + FieldElement{33431127, -11130478, -17838966, -15626900, 8909499, 8376530, -32625340, 4087881, -15188911, -14416214}, + FieldElement{1767683, 7197987, -13205226, -2022635, -13091350, 448826, 5799055, 4357868, -4774191, -16323038}, + }, + }, + { + { + FieldElement{6721966, 13833823, -23523388, -1551314, 26354293, -11863321, 23365147, -3949732, 7390890, 2759800}, + FieldElement{4409041, 2052381, 23373853, 10530217, 7676779, -12885954, 21302353, -4264057, 1244380, -12919645}, + FieldElement{-4421239, 7169619, 4982368, -2957590, 30256825, -2777540, 14086413, 9208236, 15886429, 16489664}, + }, + { + FieldElement{1996075, 10375649, 14346367, 13311202, -6874135, -16438411, -13693198, 398369, -30606455, -712933}, + FieldElement{-25307465, 9795880, -2777414, 14878809, -33531835, 14780363, 13348553, 12076947, -30836462, 5113182}, + FieldElement{-17770784, 11797796, 31950843, 13929123, -25888302, 12288344, -30341101, -7336386, 13847711, 5387222}, + }, + { + FieldElement{-18582163, -3416217, 17824843, -2340966, 22744343, -10442611, 8763061, 3617786, -19600662, 10370991}, + FieldElement{20246567, -14369378, 22358229, -543712, 18507283, -10413996, 14554437, -8746092, 32232924, 16763880}, + FieldElement{9648505, 10094563, 26416693, 14745928, -30374318, -6472621, 11094161, 15689506, 3140038, -16510092}, + }, + { + FieldElement{-16160072, 5472695, 31895588, 4744994, 8823515, 10365685, -27224800, 9448613, -28774454, 366295}, + FieldElement{19153450, 11523972, -11096490, -6503142, -24647631, 5420647, 28344573, 8041113, 719605, 11671788}, + FieldElement{8678025, 2694440, -6808014, 2517372, 4964326, 11152271, -15432916, -15266516, 27000813, -10195553}, + }, + { + FieldElement{-15157904, 7134312, 8639287, -2814877, -7235688, 10421742, 564065, 5336097, 6750977, -14521026}, + FieldElement{11836410, -3979488, 26297894, 16080799, 23455045, 15735944, 1695823, -8819122, 8169720, 16220347}, + FieldElement{-18115838, 8653647, 17578566, -6092619, -8025777, -16012763, -11144307, -2627664, -5990708, -14166033}, + }, + { + FieldElement{-23308498, -10968312, 15213228, -10081214, -30853605, -11050004, 27884329, 2847284, 2655861, 1738395}, + FieldElement{-27537433, -14253021, -25336301, -8002780, -9370762, 8129821, 21651608, -3239336, -19087449, -11005278}, + FieldElement{1533110, 3437855, 23735889, 459276, 29970501, 11335377, 26030092, 5821408, 10478196, 8544890}, + }, + { + FieldElement{32173121, -16129311, 24896207, 3921497, 22579056, -3410854, 19270449, 12217473, 17789017, -3395995}, + FieldElement{-30552961, -2228401, -15578829, -10147201, 13243889, 517024, 15479401, -3853233, 30460520, 1052596}, + FieldElement{-11614875, 13323618, 32618793, 8175907, -15230173, 12596687, 27491595, -4612359, 3179268, -9478891}, + }, + { + FieldElement{31947069, -14366651, -4640583, -15339921, -15125977, -6039709, -14756777, -16411740, 19072640, -9511060}, + FieldElement{11685058, 11822410, 3158003, -13952594, 33402194, -4165066, 5977896, -5215017, 473099, 5040608}, + FieldElement{-20290863, 8198642, -27410132, 11602123, 1290375, -2799760, 28326862, 1721092, -19558642, -3131606}, + }, + }, + { + { + FieldElement{7881532, 10687937, 7578723, 7738378, -18951012, -2553952, 21820786, 8076149, -27868496, 11538389}, + FieldElement{-19935666, 3899861, 18283497, -6801568, -15728660, -11249211, 8754525, 7446702, -5676054, 5797016}, + FieldElement{-11295600, -3793569, -15782110, -7964573, 12708869, -8456199, 2014099, -9050574, -2369172, -5877341}, + }, + { + FieldElement{-22472376, -11568741, -27682020, 1146375, 18956691, 16640559, 1192730, -3714199, 15123619, 10811505}, + FieldElement{14352098, -3419715, -18942044, 10822655, 32750596, 4699007, -70363, 15776356, -28886779, -11974553}, + FieldElement{-28241164, -8072475, -4978962, -5315317, 29416931, 1847569, -20654173, -16484855, 4714547, -9600655}, + }, + { + FieldElement{15200332, 8368572, 19679101, 15970074, -31872674, 1959451, 24611599, -4543832, -11745876, 12340220}, + FieldElement{12876937, -10480056, 33134381, 6590940, -6307776, 14872440, 9613953, 8241152, 15370987, 9608631}, + FieldElement{-4143277, -12014408, 8446281, -391603, 4407738, 13629032, -7724868, 15866074, -28210621, -8814099}, + }, + { + FieldElement{26660628, -15677655, 8393734, 358047, -7401291, 992988, -23904233, 858697, 20571223, 8420556}, + FieldElement{14620715, 13067227, -15447274, 8264467, 14106269, 15080814, 33531827, 12516406, -21574435, -12476749}, + FieldElement{236881, 10476226, 57258, -14677024, 6472998, 2466984, 17258519, 7256740, 8791136, 15069930}, + }, + { + FieldElement{1276410, -9371918, 22949635, -16322807, -23493039, -5702186, 14711875, 4874229, -30663140, -2331391}, + FieldElement{5855666, 4990204, -13711848, 7294284, -7804282, 1924647, -1423175, -7912378, -33069337, 9234253}, + FieldElement{20590503, -9018988, 31529744, -7352666, -2706834, 10650548, 31559055, -11609587, 18979186, 13396066}, + }, + { + FieldElement{24474287, 4968103, 22267082, 4407354, 24063882, -8325180, -18816887, 13594782, 33514650, 7021958}, + FieldElement{-11566906, -6565505, -21365085, 15928892, -26158305, 4315421, -25948728, -3916677, -21480480, 12868082}, + FieldElement{-28635013, 13504661, 19988037, -2132761, 21078225, 6443208, -21446107, 2244500, -12455797, -8089383}, + }, + { + FieldElement{-30595528, 13793479, -5852820, 319136, -25723172, -6263899, 33086546, 8957937, -15233648, 5540521}, + FieldElement{-11630176, -11503902, -8119500, -7643073, 2620056, 1022908, -23710744, -1568984, -16128528, -14962807}, + FieldElement{23152971, 775386, 27395463, 14006635, -9701118, 4649512, 1689819, 892185, -11513277, -15205948}, + }, + { + FieldElement{9770129, 9586738, 26496094, 4324120, 1556511, -3550024, 27453819, 4763127, -19179614, 5867134}, + FieldElement{-32765025, 1927590, 31726409, -4753295, 23962434, -16019500, 27846559, 5931263, -29749703, -16108455}, + FieldElement{27461885, -2977536, 22380810, 1815854, -23033753, -3031938, 7283490, -15148073, -19526700, 7734629}, + }, + }, + { + { + FieldElement{-8010264, -9590817, -11120403, 6196038, 29344158, -13430885, 7585295, -3176626, 18549497, 15302069}, + FieldElement{-32658337, -6171222, -7672793, -11051681, 6258878, 13504381, 10458790, -6418461, -8872242, 8424746}, + FieldElement{24687205, 8613276, -30667046, -3233545, 1863892, -1830544, 19206234, 7134917, -11284482, -828919}, + }, + { + FieldElement{11334899, -9218022, 8025293, 12707519, 17523892, -10476071, 10243738, -14685461, -5066034, 16498837}, + FieldElement{8911542, 6887158, -9584260, -6958590, 11145641, -9543680, 17303925, -14124238, 6536641, 10543906}, + FieldElement{-28946384, 15479763, -17466835, 568876, -1497683, 11223454, -2669190, -16625574, -27235709, 8876771}, + }, + { + FieldElement{-25742899, -12566864, -15649966, -846607, -33026686, -796288, -33481822, 15824474, -604426, -9039817}, + FieldElement{10330056, 70051, 7957388, -9002667, 9764902, 15609756, 27698697, -4890037, 1657394, 3084098}, + FieldElement{10477963, -7470260, 12119566, -13250805, 29016247, -5365589, 31280319, 14396151, -30233575, 15272409}, + }, + { + FieldElement{-12288309, 3169463, 28813183, 16658753, 25116432, -5630466, -25173957, -12636138, -25014757, 1950504}, + FieldElement{-26180358, 9489187, 11053416, -14746161, -31053720, 5825630, -8384306, -8767532, 15341279, 8373727}, + FieldElement{28685821, 7759505, -14378516, -12002860, -31971820, 4079242, 298136, -10232602, -2878207, 15190420}, + }, + { + FieldElement{-32932876, 13806336, -14337485, -15794431, -24004620, 10940928, 8669718, 2742393, -26033313, -6875003}, + FieldElement{-1580388, -11729417, -25979658, -11445023, -17411874, -10912854, 9291594, -16247779, -12154742, 6048605}, + FieldElement{-30305315, 14843444, 1539301, 11864366, 20201677, 1900163, 13934231, 5128323, 11213262, 9168384}, + }, + { + FieldElement{-26280513, 11007847, 19408960, -940758, -18592965, -4328580, -5088060, -11105150, 20470157, -16398701}, + FieldElement{-23136053, 9282192, 14855179, -15390078, -7362815, -14408560, -22783952, 14461608, 14042978, 5230683}, + FieldElement{29969567, -2741594, -16711867, -8552442, 9175486, -2468974, 21556951, 3506042, -5933891, -12449708}, + }, + { + FieldElement{-3144746, 8744661, 19704003, 4581278, -20430686, 6830683, -21284170, 8971513, -28539189, 15326563}, + FieldElement{-19464629, 10110288, -17262528, -3503892, -23500387, 1355669, -15523050, 15300988, -20514118, 9168260}, + FieldElement{-5353335, 4488613, -23803248, 16314347, 7780487, -15638939, -28948358, 9601605, 33087103, -9011387}, + }, + { + FieldElement{-19443170, -15512900, -20797467, -12445323, -29824447, 10229461, -27444329, -15000531, -5996870, 15664672}, + FieldElement{23294591, -16632613, -22650781, -8470978, 27844204, 11461195, 13099750, -2460356, 18151676, 13417686}, + FieldElement{-24722913, -4176517, -31150679, 5988919, -26858785, 6685065, 1661597, -12551441, 15271676, -15452665}, + }, + }, + { + { + FieldElement{11433042, -13228665, 8239631, -5279517, -1985436, -725718, -18698764, 2167544, -6921301, -13440182}, + FieldElement{-31436171, 15575146, 30436815, 12192228, -22463353, 9395379, -9917708, -8638997, 12215110, 12028277}, + FieldElement{14098400, 6555944, 23007258, 5757252, -15427832, -12950502, 30123440, 4617780, -16900089, -655628}, + }, + { + FieldElement{-4026201, -15240835, 11893168, 13718664, -14809462, 1847385, -15819999, 10154009, 23973261, -12684474}, + FieldElement{-26531820, -3695990, -1908898, 2534301, -31870557, -16550355, 18341390, -11419951, 32013174, -10103539}, + FieldElement{-25479301, 10876443, -11771086, -14625140, -12369567, 1838104, 21911214, 6354752, 4425632, -837822}, + }, + { + FieldElement{-10433389, -14612966, 22229858, -3091047, -13191166, 776729, -17415375, -12020462, 4725005, 14044970}, + FieldElement{19268650, -7304421, 1555349, 8692754, -21474059, -9910664, 6347390, -1411784, -19522291, -16109756}, + FieldElement{-24864089, 12986008, -10898878, -5558584, -11312371, -148526, 19541418, 8180106, 9282262, 10282508}, + }, + { + FieldElement{-26205082, 4428547, -8661196, -13194263, 4098402, -14165257, 15522535, 8372215, 5542595, -10702683}, + FieldElement{-10562541, 14895633, 26814552, -16673850, -17480754, -2489360, -2781891, 6993761, -18093885, 10114655}, + FieldElement{-20107055, -929418, 31422704, 10427861, -7110749, 6150669, -29091755, -11529146, 25953725, -106158}, + }, + { + FieldElement{-4234397, -8039292, -9119125, 3046000, 2101609, -12607294, 19390020, 6094296, -3315279, 12831125}, + FieldElement{-15998678, 7578152, 5310217, 14408357, -33548620, -224739, 31575954, 6326196, 7381791, -2421839}, + FieldElement{-20902779, 3296811, 24736065, -16328389, 18374254, 7318640, 6295303, 8082724, -15362489, 12339664}, + }, + { + FieldElement{27724736, 2291157, 6088201, -14184798, 1792727, 5857634, 13848414, 15768922, 25091167, 14856294}, + FieldElement{-18866652, 8331043, 24373479, 8541013, -701998, -9269457, 12927300, -12695493, -22182473, -9012899}, + FieldElement{-11423429, -5421590, 11632845, 3405020, 30536730, -11674039, -27260765, 13866390, 30146206, 9142070}, + }, + { + FieldElement{3924129, -15307516, -13817122, -10054960, 12291820, -668366, -27702774, 9326384, -8237858, 4171294}, + FieldElement{-15921940, 16037937, 6713787, 16606682, -21612135, 2790944, 26396185, 3731949, 345228, -5462949}, + FieldElement{-21327538, 13448259, 25284571, 1143661, 20614966, -8849387, 2031539, -12391231, -16253183, -13582083}, + }, + { + FieldElement{31016211, -16722429, 26371392, -14451233, -5027349, 14854137, 17477601, 3842657, 28012650, -16405420}, + FieldElement{-5075835, 9368966, -8562079, -4600902, -15249953, 6970560, -9189873, 16292057, -8867157, 3507940}, + FieldElement{29439664, 3537914, 23333589, 6997794, -17555561, -11018068, -15209202, -15051267, -9164929, 6580396}, + }, + }, + { + { + FieldElement{-12185861, -7679788, 16438269, 10826160, -8696817, -6235611, 17860444, -9273846, -2095802, 9304567}, + FieldElement{20714564, -4336911, 29088195, 7406487, 11426967, -5095705, 14792667, -14608617, 5289421, -477127}, + FieldElement{-16665533, -10650790, -6160345, -13305760, 9192020, -1802462, 17271490, 12349094, 26939669, -3752294}, + }, + { + FieldElement{-12889898, 9373458, 31595848, 16374215, 21471720, 13221525, -27283495, -12348559, -3698806, 117887}, + FieldElement{22263325, -6560050, 3984570, -11174646, -15114008, -566785, 28311253, 5358056, -23319780, 541964}, + FieldElement{16259219, 3261970, 2309254, -15534474, -16885711, -4581916, 24134070, -16705829, -13337066, -13552195}, + }, + { + FieldElement{9378160, -13140186, -22845982, -12745264, 28198281, -7244098, -2399684, -717351, 690426, 14876244}, + FieldElement{24977353, -314384, -8223969, -13465086, 28432343, -1176353, -13068804, -12297348, -22380984, 6618999}, + FieldElement{-1538174, 11685646, 12944378, 13682314, -24389511, -14413193, 8044829, -13817328, 32239829, -5652762}, + }, + { + FieldElement{-18603066, 4762990, -926250, 8885304, -28412480, -3187315, 9781647, -10350059, 32779359, 5095274}, + FieldElement{-33008130, -5214506, -32264887, -3685216, 9460461, -9327423, -24601656, 14506724, 21639561, -2630236}, + FieldElement{-16400943, -13112215, 25239338, 15531969, 3987758, -4499318, -1289502, -6863535, 17874574, 558605}, + }, + { + FieldElement{-13600129, 10240081, 9171883, 16131053, -20869254, 9599700, 33499487, 5080151, 2085892, 5119761}, + FieldElement{-22205145, -2519528, -16381601, 414691, -25019550, 2170430, 30634760, -8363614, -31999993, -5759884}, + FieldElement{-6845704, 15791202, 8550074, -1312654, 29928809, -12092256, 27534430, -7192145, -22351378, 12961482}, + }, + { + FieldElement{-24492060, -9570771, 10368194, 11582341, -23397293, -2245287, 16533930, 8206996, -30194652, -5159638}, + FieldElement{-11121496, -3382234, 2307366, 6362031, -135455, 8868177, -16835630, 7031275, 7589640, 8945490}, + FieldElement{-32152748, 8917967, 6661220, -11677616, -1192060, -15793393, 7251489, -11182180, 24099109, -14456170}, + }, + { + FieldElement{5019558, -7907470, 4244127, -14714356, -26933272, 6453165, -19118182, -13289025, -6231896, -10280736}, + FieldElement{10853594, 10721687, 26480089, 5861829, -22995819, 1972175, -1866647, -10557898, -3363451, -6441124}, + FieldElement{-17002408, 5906790, 221599, -6563147, 7828208, -13248918, 24362661, -2008168, -13866408, 7421392}, + }, + { + FieldElement{8139927, -6546497, 32257646, -5890546, 30375719, 1886181, -21175108, 15441252, 28826358, -4123029}, + FieldElement{6267086, 9695052, 7709135, -16603597, -32869068, -1886135, 14795160, -7840124, 13746021, -1742048}, + FieldElement{28584902, 7787108, -6732942, -15050729, 22846041, -7571236, -3181936, -363524, 4771362, -8419958}, + }, + }, + { + { + FieldElement{24949256, 6376279, -27466481, -8174608, -18646154, -9930606, 33543569, -12141695, 3569627, 11342593}, + FieldElement{26514989, 4740088, 27912651, 3697550, 19331575, -11472339, 6809886, 4608608, 7325975, -14801071}, + FieldElement{-11618399, -14554430, -24321212, 7655128, -1369274, 5214312, -27400540, 10258390, -17646694, -8186692}, + }, + { + FieldElement{11431204, 15823007, 26570245, 14329124, 18029990, 4796082, -31446179, 15580664, 9280358, -3973687}, + FieldElement{-160783, -10326257, -22855316, -4304997, -20861367, -13621002, -32810901, -11181622, -15545091, 4387441}, + FieldElement{-20799378, 12194512, 3937617, -5805892, -27154820, 9340370, -24513992, 8548137, 20617071, -7482001}, + }, + { + FieldElement{-938825, -3930586, -8714311, 16124718, 24603125, -6225393, -13775352, -11875822, 24345683, 10325460}, + FieldElement{-19855277, -1568885, -22202708, 8714034, 14007766, 6928528, 16318175, -1010689, 4766743, 3552007}, + FieldElement{-21751364, -16730916, 1351763, -803421, -4009670, 3950935, 3217514, 14481909, 10988822, -3994762}, + }, + { + FieldElement{15564307, -14311570, 3101243, 5684148, 30446780, -8051356, 12677127, -6505343, -8295852, 13296005}, + FieldElement{-9442290, 6624296, -30298964, -11913677, -4670981, -2057379, 31521204, 9614054, -30000824, 12074674}, + FieldElement{4771191, -135239, 14290749, -13089852, 27992298, 14998318, -1413936, -1556716, 29832613, -16391035}, + }, + { + FieldElement{7064884, -7541174, -19161962, -5067537, -18891269, -2912736, 25825242, 5293297, -27122660, 13101590}, + FieldElement{-2298563, 2439670, -7466610, 1719965, -27267541, -16328445, 32512469, -5317593, -30356070, -4190957}, + FieldElement{-30006540, 10162316, -33180176, 3981723, -16482138, -13070044, 14413974, 9515896, 19568978, 9628812}, + }, + { + FieldElement{33053803, 199357, 15894591, 1583059, 27380243, -4580435, -17838894, -6106839, -6291786, 3437740}, + FieldElement{-18978877, 3884493, 19469877, 12726490, 15913552, 13614290, -22961733, 70104, 7463304, 4176122}, + FieldElement{-27124001, 10659917, 11482427, -16070381, 12771467, -6635117, -32719404, -5322751, 24216882, 5944158}, + }, + { + FieldElement{8894125, 7450974, -2664149, -9765752, -28080517, -12389115, 19345746, 14680796, 11632993, 5847885}, + FieldElement{26942781, -2315317, 9129564, -4906607, 26024105, 11769399, -11518837, 6367194, -9727230, 4782140}, + FieldElement{19916461, -4828410, -22910704, -11414391, 25606324, -5972441, 33253853, 8220911, 6358847, -1873857}, + }, + { + FieldElement{801428, -2081702, 16569428, 11065167, 29875704, 96627, 7908388, -4480480, -13538503, 1387155}, + FieldElement{19646058, 5720633, -11416706, 12814209, 11607948, 12749789, 14147075, 15156355, -21866831, 11835260}, + FieldElement{19299512, 1155910, 28703737, 14890794, 2925026, 7269399, 26121523, 15467869, -26560550, 5052483}, + }, + }, + { + { + FieldElement{-3017432, 10058206, 1980837, 3964243, 22160966, 12322533, -6431123, -12618185, 12228557, -7003677}, + FieldElement{32944382, 14922211, -22844894, 5188528, 21913450, -8719943, 4001465, 13238564, -6114803, 8653815}, + FieldElement{22865569, -4652735, 27603668, -12545395, 14348958, 8234005, 24808405, 5719875, 28483275, 2841751}, + }, + { + FieldElement{-16420968, -1113305, -327719, -12107856, 21886282, -15552774, -1887966, -315658, 19932058, -12739203}, + FieldElement{-11656086, 10087521, -8864888, -5536143, -19278573, -3055912, 3999228, 13239134, -4777469, -13910208}, + FieldElement{1382174, -11694719, 17266790, 9194690, -13324356, 9720081, 20403944, 11284705, -14013818, 3093230}, + }, + { + FieldElement{16650921, -11037932, -1064178, 1570629, -8329746, 7352753, -302424, 16271225, -24049421, -6691850}, + FieldElement{-21911077, -5927941, -4611316, -5560156, -31744103, -10785293, 24123614, 15193618, -21652117, -16739389}, + FieldElement{-9935934, -4289447, -25279823, 4372842, 2087473, 10399484, 31870908, 14690798, 17361620, 11864968}, + }, + { + FieldElement{-11307610, 6210372, 13206574, 5806320, -29017692, -13967200, -12331205, -7486601, -25578460, -16240689}, + FieldElement{14668462, -12270235, 26039039, 15305210, 25515617, 4542480, 10453892, 6577524, 9145645, -6443880}, + FieldElement{5974874, 3053895, -9433049, -10385191, -31865124, 3225009, -7972642, 3936128, -5652273, -3050304}, + }, + { + FieldElement{30625386, -4729400, -25555961, -12792866, -20484575, 7695099, 17097188, -16303496, -27999779, 1803632}, + FieldElement{-3553091, 9865099, -5228566, 4272701, -5673832, -16689700, 14911344, 12196514, -21405489, 7047412}, + FieldElement{20093277, 9920966, -11138194, -5343857, 13161587, 12044805, -32856851, 4124601, -32343828, -10257566}, + }, + { + FieldElement{-20788824, 14084654, -13531713, 7842147, 19119038, -13822605, 4752377, -8714640, -21679658, 2288038}, + FieldElement{-26819236, -3283715, 29965059, 3039786, -14473765, 2540457, 29457502, 14625692, -24819617, 12570232}, + FieldElement{-1063558, -11551823, 16920318, 12494842, 1278292, -5869109, -21159943, -3498680, -11974704, 4724943}, + }, + { + FieldElement{17960970, -11775534, -4140968, -9702530, -8876562, -1410617, -12907383, -8659932, -29576300, 1903856}, + FieldElement{23134274, -14279132, -10681997, -1611936, 20684485, 15770816, -12989750, 3190296, 26955097, 14109738}, + FieldElement{15308788, 5320727, -30113809, -14318877, 22902008, 7767164, 29425325, -11277562, 31960942, 11934971}, + }, + { + FieldElement{-27395711, 8435796, 4109644, 12222639, -24627868, 14818669, 20638173, 4875028, 10491392, 1379718}, + FieldElement{-13159415, 9197841, 3875503, -8936108, -1383712, -5879801, 33518459, 16176658, 21432314, 12180697}, + FieldElement{-11787308, 11500838, 13787581, -13832590, -22430679, 10140205, 1465425, 12689540, -10301319, -13872883}, + }, + }, + { + { + FieldElement{5414091, -15386041, -21007664, 9643570, 12834970, 1186149, -2622916, -1342231, 26128231, 6032912}, + FieldElement{-26337395, -13766162, 32496025, -13653919, 17847801, -12669156, 3604025, 8316894, -25875034, -10437358}, + FieldElement{3296484, 6223048, 24680646, -12246460, -23052020, 5903205, -8862297, -4639164, 12376617, 3188849}, + }, + { + FieldElement{29190488, -14659046, 27549113, -1183516, 3520066, -10697301, 32049515, -7309113, -16109234, -9852307}, + FieldElement{-14744486, -9309156, 735818, -598978, -20407687, -5057904, 25246078, -15795669, 18640741, -960977}, + FieldElement{-6928835, -16430795, 10361374, 5642961, 4910474, 12345252, -31638386, -494430, 10530747, 1053335}, + }, + { + FieldElement{-29265967, -14186805, -13538216, -12117373, -19457059, -10655384, -31462369, -2948985, 24018831, 15026644}, + FieldElement{-22592535, -3145277, -2289276, 5953843, -13440189, 9425631, 25310643, 13003497, -2314791, -15145616}, + FieldElement{-27419985, -603321, -8043984, -1669117, -26092265, 13987819, -27297622, 187899, -23166419, -2531735}, + }, + { + FieldElement{-21744398, -13810475, 1844840, 5021428, -10434399, -15911473, 9716667, 16266922, -5070217, 726099}, + FieldElement{29370922, -6053998, 7334071, -15342259, 9385287, 2247707, -13661962, -4839461, 30007388, -15823341}, + FieldElement{-936379, 16086691, 23751945, -543318, -1167538, -5189036, 9137109, 730663, 9835848, 4555336}, + }, + { + FieldElement{-23376435, 1410446, -22253753, -12899614, 30867635, 15826977, 17693930, 544696, -11985298, 12422646}, + FieldElement{31117226, -12215734, -13502838, 6561947, -9876867, -12757670, -5118685, -4096706, 29120153, 13924425}, + FieldElement{-17400879, -14233209, 19675799, -2734756, -11006962, -5858820, -9383939, -11317700, 7240931, -237388}, + }, + { + FieldElement{-31361739, -11346780, -15007447, -5856218, -22453340, -12152771, 1222336, 4389483, 3293637, -15551743}, + FieldElement{-16684801, -14444245, 11038544, 11054958, -13801175, -3338533, -24319580, 7733547, 12796905, -6335822}, + FieldElement{-8759414, -10817836, -25418864, 10783769, -30615557, -9746811, -28253339, 3647836, 3222231, -11160462}, + }, + { + FieldElement{18606113, 1693100, -25448386, -15170272, 4112353, 10045021, 23603893, -2048234, -7550776, 2484985}, + FieldElement{9255317, -3131197, -12156162, -1004256, 13098013, -9214866, 16377220, -2102812, -19802075, -3034702}, + FieldElement{-22729289, 7496160, -5742199, 11329249, 19991973, -3347502, -31718148, 9936966, -30097688, -10618797}, + }, + { + FieldElement{21878590, -5001297, 4338336, 13643897, -3036865, 13160960, 19708896, 5415497, -7360503, -4109293}, + FieldElement{27736861, 10103576, 12500508, 8502413, -3413016, -9633558, 10436918, -1550276, -23659143, -8132100}, + FieldElement{19492550, -12104365, -29681976, -852630, -3208171, 12403437, 30066266, 8367329, 13243957, 8709688}, + }, + }, + { + { + FieldElement{12015105, 2801261, 28198131, 10151021, 24818120, -4743133, -11194191, -5645734, 5150968, 7274186}, + FieldElement{2831366, -12492146, 1478975, 6122054, 23825128, -12733586, 31097299, 6083058, 31021603, -9793610}, + FieldElement{-2529932, -2229646, 445613, 10720828, -13849527, -11505937, -23507731, 16354465, 15067285, -14147707}, + }, + { + FieldElement{7840942, 14037873, -33364863, 15934016, -728213, -3642706, 21403988, 1057586, -19379462, -12403220}, + FieldElement{915865, -16469274, 15608285, -8789130, -24357026, 6060030, -17371319, 8410997, -7220461, 16527025}, + FieldElement{32922597, -556987, 20336074, -16184568, 10903705, -5384487, 16957574, 52992, 23834301, 6588044}, + }, + { + FieldElement{32752030, 11232950, 3381995, -8714866, 22652988, -10744103, 17159699, 16689107, -20314580, -1305992}, + FieldElement{-4689649, 9166776, -25710296, -10847306, 11576752, 12733943, 7924251, -2752281, 1976123, -7249027}, + FieldElement{21251222, 16309901, -2983015, -6783122, 30810597, 12967303, 156041, -3371252, 12331345, -8237197}, + }, + { + FieldElement{8651614, -4477032, -16085636, -4996994, 13002507, 2950805, 29054427, -5106970, 10008136, -4667901}, + FieldElement{31486080, 15114593, -14261250, 12951354, 14369431, -7387845, 16347321, -13662089, 8684155, -10532952}, + FieldElement{19443825, 11385320, 24468943, -9659068, -23919258, 2187569, -26263207, -6086921, 31316348, 14219878}, + }, + { + FieldElement{-28594490, 1193785, 32245219, 11392485, 31092169, 15722801, 27146014, 6992409, 29126555, 9207390}, + FieldElement{32382935, 1110093, 18477781, 11028262, -27411763, -7548111, -4980517, 10843782, -7957600, -14435730}, + FieldElement{2814918, 7836403, 27519878, -7868156, -20894015, -11553689, -21494559, 8550130, 28346258, 1994730}, + }, + { + FieldElement{-19578299, 8085545, -14000519, -3948622, 2785838, -16231307, -19516951, 7174894, 22628102, 8115180}, + FieldElement{-30405132, 955511, -11133838, -15078069, -32447087, -13278079, -25651578, 3317160, -9943017, 930272}, + FieldElement{-15303681, -6833769, 28856490, 1357446, 23421993, 1057177, 24091212, -1388970, -22765376, -10650715}, + }, + { + FieldElement{-22751231, -5303997, -12907607, -12768866, -15811511, -7797053, -14839018, -16554220, -1867018, 8398970}, + FieldElement{-31969310, 2106403, -4736360, 1362501, 12813763, 16200670, 22981545, -6291273, 18009408, -15772772}, + FieldElement{-17220923, -9545221, -27784654, 14166835, 29815394, 7444469, 29551787, -3727419, 19288549, 1325865}, + }, + { + FieldElement{15100157, -15835752, -23923978, -1005098, -26450192, 15509408, 12376730, -3479146, 33166107, -8042750}, + FieldElement{20909231, 13023121, -9209752, 16251778, -5778415, -8094914, 12412151, 10018715, 2213263, -13878373}, + FieldElement{32529814, -11074689, 30361439, -16689753, -9135940, 1513226, 22922121, 6382134, -5766928, 8371348}, + }, + }, + { + { + FieldElement{9923462, 11271500, 12616794, 3544722, -29998368, -1721626, 12891687, -8193132, -26442943, 10486144}, + FieldElement{-22597207, -7012665, 8587003, -8257861, 4084309, -12970062, 361726, 2610596, -23921530, -11455195}, + FieldElement{5408411, -1136691, -4969122, 10561668, 24145918, 14240566, 31319731, -4235541, 19985175, -3436086}, + }, + { + FieldElement{-13994457, 16616821, 14549246, 3341099, 32155958, 13648976, -17577068, 8849297, 65030, 8370684}, + FieldElement{-8320926, -12049626, 31204563, 5839400, -20627288, -1057277, -19442942, 6922164, 12743482, -9800518}, + FieldElement{-2361371, 12678785, 28815050, 4759974, -23893047, 4884717, 23783145, 11038569, 18800704, 255233}, + }, + { + FieldElement{-5269658, -1773886, 13957886, 7990715, 23132995, 728773, 13393847, 9066957, 19258688, -14753793}, + FieldElement{-2936654, -10827535, -10432089, 14516793, -3640786, 4372541, -31934921, 2209390, -1524053, 2055794}, + FieldElement{580882, 16705327, 5468415, -2683018, -30926419, -14696000, -7203346, -8994389, -30021019, 7394435}, + }, + { + FieldElement{23838809, 1822728, -15738443, 15242727, 8318092, -3733104, -21672180, -3492205, -4821741, 14799921}, + FieldElement{13345610, 9759151, 3371034, -16137791, 16353039, 8577942, 31129804, 13496856, -9056018, 7402518}, + FieldElement{2286874, -4435931, -20042458, -2008336, -13696227, 5038122, 11006906, -15760352, 8205061, 1607563}, + }, + { + FieldElement{14414086, -8002132, 3331830, -3208217, 22249151, -5594188, 18364661, -2906958, 30019587, -9029278}, + FieldElement{-27688051, 1585953, -10775053, 931069, -29120221, -11002319, -14410829, 12029093, 9944378, 8024}, + FieldElement{4368715, -3709630, 29874200, -15022983, -20230386, -11410704, -16114594, -999085, -8142388, 5640030}, + }, + { + FieldElement{10299610, 13746483, 11661824, 16234854, 7630238, 5998374, 9809887, -16694564, 15219798, -14327783}, + FieldElement{27425505, -5719081, 3055006, 10660664, 23458024, 595578, -15398605, -1173195, -18342183, 9742717}, + FieldElement{6744077, 2427284, 26042789, 2720740, -847906, 1118974, 32324614, 7406442, 12420155, 1994844}, + }, + { + FieldElement{14012521, -5024720, -18384453, -9578469, -26485342, -3936439, -13033478, -10909803, 24319929, -6446333}, + FieldElement{16412690, -4507367, 10772641, 15929391, -17068788, -4658621, 10555945, -10484049, -30102368, -4739048}, + FieldElement{22397382, -7767684, -9293161, -12792868, 17166287, -9755136, -27333065, 6199366, 21880021, -12250760}, + }, + { + FieldElement{-4283307, 5368523, -31117018, 8163389, -30323063, 3209128, 16557151, 8890729, 8840445, 4957760}, + FieldElement{-15447727, 709327, -6919446, -10870178, -29777922, 6522332, -21720181, 12130072, -14796503, 5005757}, + FieldElement{-2114751, -14308128, 23019042, 15765735, -25269683, 6002752, 10183197, -13239326, -16395286, -2176112}, + }, + }, + { + { + FieldElement{-19025756, 1632005, 13466291, -7995100, -23640451, 16573537, -32013908, -3057104, 22208662, 2000468}, + FieldElement{3065073, -1412761, -25598674, -361432, -17683065, -5703415, -8164212, 11248527, -3691214, -7414184}, + FieldElement{10379208, -6045554, 8877319, 1473647, -29291284, -12507580, 16690915, 2553332, -3132688, 16400289}, + }, + { + FieldElement{15716668, 1254266, -18472690, 7446274, -8448918, 6344164, -22097271, -7285580, 26894937, 9132066}, + FieldElement{24158887, 12938817, 11085297, -8177598, -28063478, -4457083, -30576463, 64452, -6817084, -2692882}, + FieldElement{13488534, 7794716, 22236231, 5989356, 25426474, -12578208, 2350710, -3418511, -4688006, 2364226}, + }, + { + FieldElement{16335052, 9132434, 25640582, 6678888, 1725628, 8517937, -11807024, -11697457, 15445875, -7798101}, + FieldElement{29004207, -7867081, 28661402, -640412, -12794003, -7943086, 31863255, -4135540, -278050, -15759279}, + FieldElement{-6122061, -14866665, -28614905, 14569919, -10857999, -3591829, 10343412, -6976290, -29828287, -10815811}, + }, + { + FieldElement{27081650, 3463984, 14099042, -4517604, 1616303, -6205604, 29542636, 15372179, 17293797, 960709}, + FieldElement{20263915, 11434237, -5765435, 11236810, 13505955, -10857102, -16111345, 6493122, -19384511, 7639714}, + FieldElement{-2830798, -14839232, 25403038, -8215196, -8317012, -16173699, 18006287, -16043750, 29994677, -15808121}, + }, + { + FieldElement{9769828, 5202651, -24157398, -13631392, -28051003, -11561624, -24613141, -13860782, -31184575, 709464}, + FieldElement{12286395, 13076066, -21775189, -1176622, -25003198, 4057652, -32018128, -8890874, 16102007, 13205847}, + FieldElement{13733362, 5599946, 10557076, 3195751, -5557991, 8536970, -25540170, 8525972, 10151379, 10394400}, + }, + { + FieldElement{4024660, -16137551, 22436262, 12276534, -9099015, -2686099, 19698229, 11743039, -33302334, 8934414}, + FieldElement{-15879800, -4525240, -8580747, -2934061, 14634845, -698278, -9449077, 3137094, -11536886, 11721158}, + FieldElement{17555939, -5013938, 8268606, 2331751, -22738815, 9761013, 9319229, 8835153, -9205489, -1280045}, + }, + { + FieldElement{-461409, -7830014, 20614118, 16688288, -7514766, -4807119, 22300304, 505429, 6108462, -6183415}, + FieldElement{-5070281, 12367917, -30663534, 3234473, 32617080, -8422642, 29880583, -13483331, -26898490, -7867459}, + FieldElement{-31975283, 5726539, 26934134, 10237677, -3173717, -605053, 24199304, 3795095, 7592688, -14992079}, + }, + { + FieldElement{21594432, -14964228, 17466408, -4077222, 32537084, 2739898, 6407723, 12018833, -28256052, 4298412}, + FieldElement{-20650503, -11961496, -27236275, 570498, 3767144, -1717540, 13891942, -1569194, 13717174, 10805743}, + FieldElement{-14676630, -15644296, 15287174, 11927123, 24177847, -8175568, -796431, 14860609, -26938930, -5863836}, + }, + }, + { + { + FieldElement{12962541, 5311799, -10060768, 11658280, 18855286, -7954201, 13286263, -12808704, -4381056, 9882022}, + FieldElement{18512079, 11319350, -20123124, 15090309, 18818594, 5271736, -22727904, 3666879, -23967430, -3299429}, + FieldElement{-6789020, -3146043, 16192429, 13241070, 15898607, -14206114, -10084880, -6661110, -2403099, 5276065}, + }, + { + FieldElement{30169808, -5317648, 26306206, -11750859, 27814964, 7069267, 7152851, 3684982, 1449224, 13082861}, + FieldElement{10342826, 3098505, 2119311, 193222, 25702612, 12233820, 23697382, 15056736, -21016438, -8202000}, + FieldElement{-33150110, 3261608, 22745853, 7948688, 19370557, -15177665, -26171976, 6482814, -10300080, -11060101}, + }, + { + FieldElement{32869458, -5408545, 25609743, 15678670, -10687769, -15471071, 26112421, 2521008, -22664288, 6904815}, + FieldElement{29506923, 4457497, 3377935, -9796444, -30510046, 12935080, 1561737, 3841096, -29003639, -6657642}, + FieldElement{10340844, -6630377, -18656632, -2278430, 12621151, -13339055, 30878497, -11824370, -25584551, 5181966}, + }, + { + FieldElement{25940115, -12658025, 17324188, -10307374, -8671468, 15029094, 24396252, -16450922, -2322852, -12388574}, + FieldElement{-21765684, 9916823, -1300409, 4079498, -1028346, 11909559, 1782390, 12641087, 20603771, -6561742}, + FieldElement{-18882287, -11673380, 24849422, 11501709, 13161720, -4768874, 1925523, 11914390, 4662781, 7820689}, + }, + { + FieldElement{12241050, -425982, 8132691, 9393934, 32846760, -1599620, 29749456, 12172924, 16136752, 15264020}, + FieldElement{-10349955, -14680563, -8211979, 2330220, -17662549, -14545780, 10658213, 6671822, 19012087, 3772772}, + FieldElement{3753511, -3421066, 10617074, 2028709, 14841030, -6721664, 28718732, -15762884, 20527771, 12988982}, + }, + { + FieldElement{-14822485, -5797269, -3707987, 12689773, -898983, -10914866, -24183046, -10564943, 3299665, -12424953}, + FieldElement{-16777703, -15253301, -9642417, 4978983, 3308785, 8755439, 6943197, 6461331, -25583147, 8991218}, + FieldElement{-17226263, 1816362, -1673288, -6086439, 31783888, -8175991, -32948145, 7417950, -30242287, 1507265}, + }, + { + FieldElement{29692663, 6829891, -10498800, 4334896, 20945975, -11906496, -28887608, 8209391, 14606362, -10647073}, + FieldElement{-3481570, 8707081, 32188102, 5672294, 22096700, 1711240, -33020695, 9761487, 4170404, -2085325}, + FieldElement{-11587470, 14855945, -4127778, -1531857, -26649089, 15084046, 22186522, 16002000, -14276837, -8400798}, + }, + { + FieldElement{-4811456, 13761029, -31703877, -2483919, -3312471, 7869047, -7113572, -9620092, 13240845, 10965870}, + FieldElement{-7742563, -8256762, -14768334, -13656260, -23232383, 12387166, 4498947, 14147411, 29514390, 4302863}, + FieldElement{-13413405, -12407859, 20757302, -13801832, 14785143, 8976368, -5061276, -2144373, 17846988, -13971927}, + }, + }, + { + { + FieldElement{-2244452, -754728, -4597030, -1066309, -6247172, 1455299, -21647728, -9214789, -5222701, 12650267}, + FieldElement{-9906797, -16070310, 21134160, 12198166, -27064575, 708126, 387813, 13770293, -19134326, 10958663}, + FieldElement{22470984, 12369526, 23446014, -5441109, -21520802, -9698723, -11772496, -11574455, -25083830, 4271862}, + }, + { + FieldElement{-25169565, -10053642, -19909332, 15361595, -5984358, 2159192, 75375, -4278529, -32526221, 8469673}, + FieldElement{15854970, 4148314, -8893890, 7259002, 11666551, 13824734, -30531198, 2697372, 24154791, -9460943}, + FieldElement{15446137, -15806644, 29759747, 14019369, 30811221, -9610191, -31582008, 12840104, 24913809, 9815020}, + }, + { + FieldElement{-4709286, -5614269, -31841498, -12288893, -14443537, 10799414, -9103676, 13438769, 18735128, 9466238}, + FieldElement{11933045, 9281483, 5081055, -5183824, -2628162, -4905629, -7727821, -10896103, -22728655, 16199064}, + FieldElement{14576810, 379472, -26786533, -8317236, -29426508, -10812974, -102766, 1876699, 30801119, 2164795}, + }, + { + FieldElement{15995086, 3199873, 13672555, 13712240, -19378835, -4647646, -13081610, -15496269, -13492807, 1268052}, + FieldElement{-10290614, -3659039, -3286592, 10948818, 23037027, 3794475, -3470338, -12600221, -17055369, 3565904}, + FieldElement{29210088, -9419337, -5919792, -4952785, 10834811, -13327726, -16512102, -10820713, -27162222, -14030531}, + }, + { + FieldElement{-13161890, 15508588, 16663704, -8156150, -28349942, 9019123, -29183421, -3769423, 2244111, -14001979}, + FieldElement{-5152875, -3800936, -9306475, -6071583, 16243069, 14684434, -25673088, -16180800, 13491506, 4641841}, + FieldElement{10813417, 643330, -19188515, -728916, 30292062, -16600078, 27548447, -7721242, 14476989, -12767431}, + }, + { + FieldElement{10292079, 9984945, 6481436, 8279905, -7251514, 7032743, 27282937, -1644259, -27912810, 12651324}, + FieldElement{-31185513, -813383, 22271204, 11835308, 10201545, 15351028, 17099662, 3988035, 21721536, -3148940}, + FieldElement{10202177, -6545839, -31373232, -9574638, -32150642, -8119683, -12906320, 3852694, 13216206, 14842320}, + }, + { + FieldElement{-15815640, -10601066, -6538952, -7258995, -6984659, -6581778, -31500847, 13765824, -27434397, 9900184}, + FieldElement{14465505, -13833331, -32133984, -14738873, -27443187, 12990492, 33046193, 15796406, -7051866, -8040114}, + FieldElement{30924417, -8279620, 6359016, -12816335, 16508377, 9071735, -25488601, 15413635, 9524356, -7018878}, + }, + { + FieldElement{12274201, -13175547, 32627641, -1785326, 6736625, 13267305, 5237659, -5109483, 15663516, 4035784}, + FieldElement{-2951309, 8903985, 17349946, 601635, -16432815, -4612556, -13732739, -15889334, -22258478, 4659091}, + FieldElement{-16916263, -4952973, -30393711, -15158821, 20774812, 15897498, 5736189, 15026997, -2178256, -13455585}, + }, + }, + { + { + FieldElement{-8858980, -2219056, 28571666, -10155518, -474467, -10105698, -3801496, 278095, 23440562, -290208}, + FieldElement{10226241, -5928702, 15139956, 120818, -14867693, 5218603, 32937275, 11551483, -16571960, -7442864}, + FieldElement{17932739, -12437276, -24039557, 10749060, 11316803, 7535897, 22503767, 5561594, -3646624, 3898661}, + }, + { + FieldElement{7749907, -969567, -16339731, -16464, -25018111, 15122143, -1573531, 7152530, 21831162, 1245233}, + FieldElement{26958459, -14658026, 4314586, 8346991, -5677764, 11960072, -32589295, -620035, -30402091, -16716212}, + FieldElement{-12165896, 9166947, 33491384, 13673479, 29787085, 13096535, 6280834, 14587357, -22338025, 13987525}, + }, + { + FieldElement{-24349909, 7778775, 21116000, 15572597, -4833266, -5357778, -4300898, -5124639, -7469781, -2858068}, + FieldElement{9681908, -6737123, -31951644, 13591838, -6883821, 386950, 31622781, 6439245, -14581012, 4091397}, + FieldElement{-8426427, 1470727, -28109679, -1596990, 3978627, -5123623, -19622683, 12092163, 29077877, -14741988}, + }, + { + FieldElement{5269168, -6859726, -13230211, -8020715, 25932563, 1763552, -5606110, -5505881, -20017847, 2357889}, + FieldElement{32264008, -15407652, -5387735, -1160093, -2091322, -3946900, 23104804, -12869908, 5727338, 189038}, + FieldElement{14609123, -8954470, -6000566, -16622781, -14577387, -7743898, -26745169, 10942115, -25888931, -14884697}, + }, + { + FieldElement{20513500, 5557931, -15604613, 7829531, 26413943, -2019404, -21378968, 7471781, 13913677, -5137875}, + FieldElement{-25574376, 11967826, 29233242, 12948236, -6754465, 4713227, -8940970, 14059180, 12878652, 8511905}, + FieldElement{-25656801, 3393631, -2955415, -7075526, -2250709, 9366908, -30223418, 6812974, 5568676, -3127656}, + }, + { + FieldElement{11630004, 12144454, 2116339, 13606037, 27378885, 15676917, -17408753, -13504373, -14395196, 8070818}, + FieldElement{27117696, -10007378, -31282771, -5570088, 1127282, 12772488, -29845906, 10483306, -11552749, -1028714}, + FieldElement{10637467, -5688064, 5674781, 1072708, -26343588, -6982302, -1683975, 9177853, -27493162, 15431203}, + }, + { + FieldElement{20525145, 10892566, -12742472, 12779443, -29493034, 16150075, -28240519, 14943142, -15056790, -7935931}, + FieldElement{-30024462, 5626926, -551567, -9981087, 753598, 11981191, 25244767, -3239766, -3356550, 9594024}, + FieldElement{-23752644, 2636870, -5163910, -10103818, 585134, 7877383, 11345683, -6492290, 13352335, -10977084}, + }, + { + FieldElement{-1931799, -5407458, 3304649, -12884869, 17015806, -4877091, -29783850, -7752482, -13215537, -319204}, + FieldElement{20239939, 6607058, 6203985, 3483793, -18386976, -779229, -20723742, 15077870, -22750759, 14523817}, + FieldElement{27406042, -6041657, 27423596, -4497394, 4996214, 10002360, -28842031, -4545494, -30172742, -4805667}, + }, + }, + { + { + FieldElement{11374242, 12660715, 17861383, -12540833, 10935568, 1099227, -13886076, -9091740, -27727044, 11358504}, + FieldElement{-12730809, 10311867, 1510375, 10778093, -2119455, -9145702, 32676003, 11149336, -26123651, 4985768}, + FieldElement{-19096303, 341147, -6197485, -239033, 15756973, -8796662, -983043, 13794114, -19414307, -15621255}, + }, + { + FieldElement{6490081, 11940286, 25495923, -7726360, 8668373, -8751316, 3367603, 6970005, -1691065, -9004790}, + FieldElement{1656497, 13457317, 15370807, 6364910, 13605745, 8362338, -19174622, -5475723, -16796596, -5031438}, + FieldElement{-22273315, -13524424, -64685, -4334223, -18605636, -10921968, -20571065, -7007978, -99853, -10237333}, + }, + { + FieldElement{17747465, 10039260, 19368299, -4050591, -20630635, -16041286, 31992683, -15857976, -29260363, -5511971}, + FieldElement{31932027, -4986141, -19612382, 16366580, 22023614, 88450, 11371999, -3744247, 4882242, -10626905}, + FieldElement{29796507, 37186, 19818052, 10115756, -11829032, 3352736, 18551198, 3272828, -5190932, -4162409}, + }, + { + FieldElement{12501286, 4044383, -8612957, -13392385, -32430052, 5136599, -19230378, -3529697, 330070, -3659409}, + FieldElement{6384877, 2899513, 17807477, 7663917, -2358888, 12363165, 25366522, -8573892, -271295, 12071499}, + FieldElement{-8365515, -4042521, 25133448, -4517355, -6211027, 2265927, -32769618, 1936675, -5159697, 3829363}, + }, + { + FieldElement{28425966, -5835433, -577090, -4697198, -14217555, 6870930, 7921550, -6567787, 26333140, 14267664}, + FieldElement{-11067219, 11871231, 27385719, -10559544, -4585914, -11189312, 10004786, -8709488, -21761224, 8930324}, + FieldElement{-21197785, -16396035, 25654216, -1725397, 12282012, 11008919, 1541940, 4757911, -26491501, -16408940}, + }, + { + FieldElement{13537262, -7759490, -20604840, 10961927, -5922820, -13218065, -13156584, 6217254, -15943699, 13814990}, + FieldElement{-17422573, 15157790, 18705543, 29619, 24409717, -260476, 27361681, 9257833, -1956526, -1776914}, + FieldElement{-25045300, -10191966, 15366585, 15166509, -13105086, 8423556, -29171540, 12361135, -18685978, 4578290}, + }, + { + FieldElement{24579768, 3711570, 1342322, -11180126, -27005135, 14124956, -22544529, 14074919, 21964432, 8235257}, + FieldElement{-6528613, -2411497, 9442966, -5925588, 12025640, -1487420, -2981514, -1669206, 13006806, 2355433}, + FieldElement{-16304899, -13605259, -6632427, -5142349, 16974359, -10911083, 27202044, 1719366, 1141648, -12796236}, + }, + { + FieldElement{-12863944, -13219986, -8318266, -11018091, -6810145, -4843894, 13475066, -3133972, 32674895, 13715045}, + FieldElement{11423335, -5468059, 32344216, 8962751, 24989809, 9241752, -13265253, 16086212, -28740881, -15642093}, + FieldElement{-1409668, 12530728, -6368726, 10847387, 19531186, -14132160, -11709148, 7791794, -27245943, 4383347}, + }, + }, + { + { + FieldElement{-28970898, 5271447, -1266009, -9736989, -12455236, 16732599, -4862407, -4906449, 27193557, 6245191}, + FieldElement{-15193956, 5362278, -1783893, 2695834, 4960227, 12840725, 23061898, 3260492, 22510453, 8577507}, + FieldElement{-12632451, 11257346, -32692994, 13548177, -721004, 10879011, 31168030, 13952092, -29571492, -3635906}, + }, + { + FieldElement{3877321, -9572739, 32416692, 5405324, -11004407, -13656635, 3759769, 11935320, 5611860, 8164018}, + FieldElement{-16275802, 14667797, 15906460, 12155291, -22111149, -9039718, 32003002, -8832289, 5773085, -8422109}, + FieldElement{-23788118, -8254300, 1950875, 8937633, 18686727, 16459170, -905725, 12376320, 31632953, 190926}, + }, + { + FieldElement{-24593607, -16138885, -8423991, 13378746, 14162407, 6901328, -8288749, 4508564, -25341555, -3627528}, + FieldElement{8884438, -5884009, 6023974, 10104341, -6881569, -4941533, 18722941, -14786005, -1672488, 827625}, + FieldElement{-32720583, -16289296, -32503547, 7101210, 13354605, 2659080, -1800575, -14108036, -24878478, 1541286}, + }, + { + FieldElement{2901347, -1117687, 3880376, -10059388, -17620940, -3612781, -21802117, -3567481, 20456845, -1885033}, + FieldElement{27019610, 12299467, -13658288, -1603234, -12861660, -4861471, -19540150, -5016058, 29439641, 15138866}, + FieldElement{21536104, -6626420, -32447818, -10690208, -22408077, 5175814, -5420040, -16361163, 7779328, 109896}, + }, + { + FieldElement{30279744, 14648750, -8044871, 6425558, 13639621, -743509, 28698390, 12180118, 23177719, -554075}, + FieldElement{26572847, 3405927, -31701700, 12890905, -19265668, 5335866, -6493768, 2378492, 4439158, -13279347}, + FieldElement{-22716706, 3489070, -9225266, -332753, 18875722, -1140095, 14819434, -12731527, -17717757, -5461437}, + }, + { + FieldElement{-5056483, 16566551, 15953661, 3767752, -10436499, 15627060, -820954, 2177225, 8550082, -15114165}, + FieldElement{-18473302, 16596775, -381660, 15663611, 22860960, 15585581, -27844109, -3582739, -23260460, -8428588}, + FieldElement{-32480551, 15707275, -8205912, -5652081, 29464558, 2713815, -22725137, 15860482, -21902570, 1494193}, + }, + { + FieldElement{-19562091, -14087393, -25583872, -9299552, 13127842, 759709, 21923482, 16529112, 8742704, 12967017}, + FieldElement{-28464899, 1553205, 32536856, -10473729, -24691605, -406174, -8914625, -2933896, -29903758, 15553883}, + FieldElement{21877909, 3230008, 9881174, 10539357, -4797115, 2841332, 11543572, 14513274, 19375923, -12647961}, + }, + { + FieldElement{8832269, -14495485, 13253511, 5137575, 5037871, 4078777, 24880818, -6222716, 2862653, 9455043}, + FieldElement{29306751, 5123106, 20245049, -14149889, 9592566, 8447059, -2077124, -2990080, 15511449, 4789663}, + FieldElement{-20679756, 7004547, 8824831, -9434977, -4045704, -3750736, -5754762, 108893, 23513200, 16652362}, + }, + }, + { + { + FieldElement{-33256173, 4144782, -4476029, -6579123, 10770039, -7155542, -6650416, -12936300, -18319198, 10212860}, + FieldElement{2756081, 8598110, 7383731, -6859892, 22312759, -1105012, 21179801, 2600940, -9988298, -12506466}, + FieldElement{-24645692, 13317462, -30449259, -15653928, 21365574, -10869657, 11344424, 864440, -2499677, -16710063}, + }, + { + FieldElement{-26432803, 6148329, -17184412, -14474154, 18782929, -275997, -22561534, 211300, 2719757, 4940997}, + FieldElement{-1323882, 3911313, -6948744, 14759765, -30027150, 7851207, 21690126, 8518463, 26699843, 5276295}, + FieldElement{-13149873, -6429067, 9396249, 365013, 24703301, -10488939, 1321586, 149635, -15452774, 7159369}, + }, + { + FieldElement{9987780, -3404759, 17507962, 9505530, 9731535, -2165514, 22356009, 8312176, 22477218, -8403385}, + FieldElement{18155857, -16504990, 19744716, 9006923, 15154154, -10538976, 24256460, -4864995, -22548173, 9334109}, + FieldElement{2986088, -4911893, 10776628, -3473844, 10620590, -7083203, -21413845, 14253545, -22587149, 536906}, + }, + { + FieldElement{4377756, 8115836, 24567078, 15495314, 11625074, 13064599, 7390551, 10589625, 10838060, -15420424}, + FieldElement{-19342404, 867880, 9277171, -3218459, -14431572, -1986443, 19295826, -15796950, 6378260, 699185}, + FieldElement{7895026, 4057113, -7081772, -13077756, -17886831, -323126, -716039, 15693155, -5045064, -13373962}, + }, + { + FieldElement{-7737563, -5869402, -14566319, -7406919, 11385654, 13201616, 31730678, -10962840, -3918636, -9669325}, + FieldElement{10188286, -15770834, -7336361, 13427543, 22223443, 14896287, 30743455, 7116568, -21786507, 5427593}, + FieldElement{696102, 13206899, 27047647, -10632082, 15285305, -9853179, 10798490, -4578720, 19236243, 12477404}, + }, + { + FieldElement{-11229439, 11243796, -17054270, -8040865, -788228, -8167967, -3897669, 11180504, -23169516, 7733644}, + FieldElement{17800790, -14036179, -27000429, -11766671, 23887827, 3149671, 23466177, -10538171, 10322027, 15313801}, + FieldElement{26246234, 11968874, 32263343, -5468728, 6830755, -13323031, -15794704, -101982, -24449242, 10890804}, + }, + { + FieldElement{-31365647, 10271363, -12660625, -6267268, 16690207, -13062544, -14982212, 16484931, 25180797, -5334884}, + FieldElement{-586574, 10376444, -32586414, -11286356, 19801893, 10997610, 2276632, 9482883, 316878, 13820577}, + FieldElement{-9882808, -4510367, -2115506, 16457136, -11100081, 11674996, 30756178, -7515054, 30696930, -3712849}, + }, + { + FieldElement{32988917, -9603412, 12499366, 7910787, -10617257, -11931514, -7342816, -9985397, -32349517, 7392473}, + FieldElement{-8855661, 15927861, 9866406, -3649411, -2396914, -16655781, -30409476, -9134995, 25112947, -2926644}, + FieldElement{-2504044, -436966, 25621774, -5678772, 15085042, -5479877, -24884878, -13526194, 5537438, -13914319}, + }, + }, + { + { + FieldElement{-11225584, 2320285, -9584280, 10149187, -33444663, 5808648, -14876251, -1729667, 31234590, 6090599}, + FieldElement{-9633316, 116426, 26083934, 2897444, -6364437, -2688086, 609721, 15878753, -6970405, -9034768}, + FieldElement{-27757857, 247744, -15194774, -9002551, 23288161, -10011936, -23869595, 6503646, 20650474, 1804084}, + }, + { + FieldElement{-27589786, 15456424, 8972517, 8469608, 15640622, 4439847, 3121995, -10329713, 27842616, -202328}, + FieldElement{-15306973, 2839644, 22530074, 10026331, 4602058, 5048462, 28248656, 5031932, -11375082, 12714369}, + FieldElement{20807691, -7270825, 29286141, 11421711, -27876523, -13868230, -21227475, 1035546, -19733229, 12796920}, + }, + { + FieldElement{12076899, -14301286, -8785001, -11848922, -25012791, 16400684, -17591495, -12899438, 3480665, -15182815}, + FieldElement{-32361549, 5457597, 28548107, 7833186, 7303070, -11953545, -24363064, -15921875, -33374054, 2771025}, + FieldElement{-21389266, 421932, 26597266, 6860826, 22486084, -6737172, -17137485, -4210226, -24552282, 15673397}, + }, + { + FieldElement{-20184622, 2338216, 19788685, -9620956, -4001265, -8740893, -20271184, 4733254, 3727144, -12934448}, + FieldElement{6120119, 814863, -11794402, -622716, 6812205, -15747771, 2019594, 7975683, 31123697, -10958981}, + FieldElement{30069250, -11435332, 30434654, 2958439, 18399564, -976289, 12296869, 9204260, -16432438, 9648165}, + }, + { + FieldElement{32705432, -1550977, 30705658, 7451065, -11805606, 9631813, 3305266, 5248604, -26008332, -11377501}, + FieldElement{17219865, 2375039, -31570947, -5575615, -19459679, 9219903, 294711, 15298639, 2662509, -16297073}, + FieldElement{-1172927, -7558695, -4366770, -4287744, -21346413, -8434326, 32087529, -1222777, 32247248, -14389861}, + }, + { + FieldElement{14312628, 1221556, 17395390, -8700143, -4945741, -8684635, -28197744, -9637817, -16027623, -13378845}, + FieldElement{-1428825, -9678990, -9235681, 6549687, -7383069, -468664, 23046502, 9803137, 17597934, 2346211}, + FieldElement{18510800, 15337574, 26171504, 981392, -22241552, 7827556, -23491134, -11323352, 3059833, -11782870}, + }, + { + FieldElement{10141598, 6082907, 17829293, -1947643, 9830092, 13613136, -25556636, -5544586, -33502212, 3592096}, + FieldElement{33114168, -15889352, -26525686, -13343397, 33076705, 8716171, 1151462, 1521897, -982665, -6837803}, + FieldElement{-32939165, -4255815, 23947181, -324178, -33072974, -12305637, -16637686, 3891704, 26353178, 693168}, + }, + { + FieldElement{30374239, 1595580, -16884039, 13186931, 4600344, 406904, 9585294, -400668, 31375464, 14369965}, + FieldElement{-14370654, -7772529, 1510301, 6434173, -18784789, -6262728, 32732230, -13108839, 17901441, 16011505}, + FieldElement{18171223, -11934626, -12500402, 15197122, -11038147, -15230035, -19172240, -16046376, 8764035, 12309598}, + }, + }, + { + { + FieldElement{5975908, -5243188, -19459362, -9681747, -11541277, 14015782, -23665757, 1228319, 17544096, -10593782}, + FieldElement{5811932, -1715293, 3442887, -2269310, -18367348, -8359541, -18044043, -15410127, -5565381, 12348900}, + FieldElement{-31399660, 11407555, 25755363, 6891399, -3256938, 14872274, -24849353, 8141295, -10632534, -585479}, + }, + { + FieldElement{-12675304, 694026, -5076145, 13300344, 14015258, -14451394, -9698672, -11329050, 30944593, 1130208}, + FieldElement{8247766, -6710942, -26562381, -7709309, -14401939, -14648910, 4652152, 2488540, 23550156, -271232}, + FieldElement{17294316, -3788438, 7026748, 15626851, 22990044, 113481, 2267737, -5908146, -408818, -137719}, + }, + { + FieldElement{16091085, -16253926, 18599252, 7340678, 2137637, -1221657, -3364161, 14550936, 3260525, -7166271}, + FieldElement{-4910104, -13332887, 18550887, 10864893, -16459325, -7291596, -23028869, -13204905, -12748722, 2701326}, + FieldElement{-8574695, 16099415, 4629974, -16340524, -20786213, -6005432, -10018363, 9276971, 11329923, 1862132}, + }, + { + FieldElement{14763076, -15903608, -30918270, 3689867, 3511892, 10313526, -21951088, 12219231, -9037963, -940300}, + FieldElement{8894987, -3446094, 6150753, 3013931, 301220, 15693451, -31981216, -2909717, -15438168, 11595570}, + FieldElement{15214962, 3537601, -26238722, -14058872, 4418657, -15230761, 13947276, 10730794, -13489462, -4363670}, + }, + { + FieldElement{-2538306, 7682793, 32759013, 263109, -29984731, -7955452, -22332124, -10188635, 977108, 699994}, + FieldElement{-12466472, 4195084, -9211532, 550904, -15565337, 12917920, 19118110, -439841, -30534533, -14337913}, + FieldElement{31788461, -14507657, 4799989, 7372237, 8808585, -14747943, 9408237, -10051775, 12493932, -5409317}, + }, + { + FieldElement{-25680606, 5260744, -19235809, -6284470, -3695942, 16566087, 27218280, 2607121, 29375955, 6024730}, + FieldElement{842132, -2794693, -4763381, -8722815, 26332018, -12405641, 11831880, 6985184, -9940361, 2854096}, + FieldElement{-4847262, -7969331, 2516242, -5847713, 9695691, -7221186, 16512645, 960770, 12121869, 16648078}, + }, + { + FieldElement{-15218652, 14667096, -13336229, 2013717, 30598287, -464137, -31504922, -7882064, 20237806, 2838411}, + FieldElement{-19288047, 4453152, 15298546, -16178388, 22115043, -15972604, 12544294, -13470457, 1068881, -12499905}, + FieldElement{-9558883, -16518835, 33238498, 13506958, 30505848, -1114596, -8486907, -2630053, 12521378, 4845654}, + }, + { + FieldElement{-28198521, 10744108, -2958380, 10199664, 7759311, -13088600, 3409348, -873400, -6482306, -12885870}, + FieldElement{-23561822, 6230156, -20382013, 10655314, -24040585, -11621172, 10477734, -1240216, -3113227, 13974498}, + FieldElement{12966261, 15550616, -32038948, -1615346, 21025980, -629444, 5642325, 7188737, 18895762, 12629579}, + }, + }, + { + { + FieldElement{14741879, -14946887, 22177208, -11721237, 1279741, 8058600, 11758140, 789443, 32195181, 3895677}, + FieldElement{10758205, 15755439, -4509950, 9243698, -4879422, 6879879, -2204575, -3566119, -8982069, 4429647}, + FieldElement{-2453894, 15725973, -20436342, -10410672, -5803908, -11040220, -7135870, -11642895, 18047436, -15281743}, + }, + { + FieldElement{-25173001, -11307165, 29759956, 11776784, -22262383, -15820455, 10993114, -12850837, -17620701, -9408468}, + FieldElement{21987233, 700364, -24505048, 14972008, -7774265, -5718395, 32155026, 2581431, -29958985, 8773375}, + FieldElement{-25568350, 454463, -13211935, 16126715, 25240068, 8594567, 20656846, 12017935, -7874389, -13920155}, + }, + { + FieldElement{6028182, 6263078, -31011806, -11301710, -818919, 2461772, -31841174, -5468042, -1721788, -2776725}, + FieldElement{-12278994, 16624277, 987579, -5922598, 32908203, 1248608, 7719845, -4166698, 28408820, 6816612}, + FieldElement{-10358094, -8237829, 19549651, -12169222, 22082623, 16147817, 20613181, 13982702, -10339570, 5067943}, + }, + { + FieldElement{-30505967, -3821767, 12074681, 13582412, -19877972, 2443951, -19719286, 12746132, 5331210, -10105944}, + FieldElement{30528811, 3601899, -1957090, 4619785, -27361822, -15436388, 24180793, -12570394, 27679908, -1648928}, + FieldElement{9402404, -13957065, 32834043, 10838634, -26580150, -13237195, 26653274, -8685565, 22611444, -12715406}, + }, + { + FieldElement{22190590, 1118029, 22736441, 15130463, -30460692, -5991321, 19189625, -4648942, 4854859, 6622139}, + FieldElement{-8310738, -2953450, -8262579, -3388049, -10401731, -271929, 13424426, -3567227, 26404409, 13001963}, + FieldElement{-31241838, -15415700, -2994250, 8939346, 11562230, -12840670, -26064365, -11621720, -15405155, 11020693}, + }, + { + FieldElement{1866042, -7949489, -7898649, -10301010, 12483315, 13477547, 3175636, -12424163, 28761762, 1406734}, + FieldElement{-448555, -1777666, 13018551, 3194501, -9580420, -11161737, 24760585, -4347088, 25577411, -13378680}, + FieldElement{-24290378, 4759345, -690653, -1852816, 2066747, 10693769, -29595790, 9884936, -9368926, 4745410}, + }, + { + FieldElement{-9141284, 6049714, -19531061, -4341411, -31260798, 9944276, -15462008, -11311852, 10931924, -11931931}, + FieldElement{-16561513, 14112680, -8012645, 4817318, -8040464, -11414606, -22853429, 10856641, -20470770, 13434654}, + FieldElement{22759489, -10073434, -16766264, -1871422, 13637442, -10168091, 1765144, -12654326, 28445307, -5364710}, + }, + { + FieldElement{29875063, 12493613, 2795536, -3786330, 1710620, 15181182, -10195717, -8788675, 9074234, 1167180}, + FieldElement{-26205683, 11014233, -9842651, -2635485, -26908120, 7532294, -18716888, -9535498, 3843903, 9367684}, + FieldElement{-10969595, -6403711, 9591134, 9582310, 11349256, 108879, 16235123, 8601684, -139197, 4242895}, + }, + }, + { + { + FieldElement{22092954, -13191123, -2042793, -11968512, 32186753, -11517388, -6574341, 2470660, -27417366, 16625501}, + FieldElement{-11057722, 3042016, 13770083, -9257922, 584236, -544855, -7770857, 2602725, -27351616, 14247413}, + FieldElement{6314175, -10264892, -32772502, 15957557, -10157730, 168750, -8618807, 14290061, 27108877, -1180880}, + }, + { + FieldElement{-8586597, -7170966, 13241782, 10960156, -32991015, -13794596, 33547976, -11058889, -27148451, 981874}, + FieldElement{22833440, 9293594, -32649448, -13618667, -9136966, 14756819, -22928859, -13970780, -10479804, -16197962}, + FieldElement{-7768587, 3326786, -28111797, 10783824, 19178761, 14905060, 22680049, 13906969, -15933690, 3797899}, + }, + { + FieldElement{21721356, -4212746, -12206123, 9310182, -3882239, -13653110, 23740224, -2709232, 20491983, -8042152}, + FieldElement{9209270, -15135055, -13256557, -6167798, -731016, 15289673, 25947805, 15286587, 30997318, -6703063}, + FieldElement{7392032, 16618386, 23946583, -8039892, -13265164, -1533858, -14197445, -2321576, 17649998, -250080}, + }, + { + FieldElement{-9301088, -14193827, 30609526, -3049543, -25175069, -1283752, -15241566, -9525724, -2233253, 7662146}, + FieldElement{-17558673, 1763594, -33114336, 15908610, -30040870, -12174295, 7335080, -8472199, -3174674, 3440183}, + FieldElement{-19889700, -5977008, -24111293, -9688870, 10799743, -16571957, 40450, -4431835, 4862400, 1133}, + }, + { + FieldElement{-32856209, -7873957, -5422389, 14860950, -16319031, 7956142, 7258061, 311861, -30594991, -7379421}, + FieldElement{-3773428, -1565936, 28985340, 7499440, 24445838, 9325937, 29727763, 16527196, 18278453, 15405622}, + FieldElement{-4381906, 8508652, -19898366, -3674424, -5984453, 15149970, -13313598, 843523, -21875062, 13626197}, + }, + { + FieldElement{2281448, -13487055, -10915418, -2609910, 1879358, 16164207, -10783882, 3953792, 13340839, 15928663}, + FieldElement{31727126, -7179855, -18437503, -8283652, 2875793, -16390330, -25269894, -7014826, -23452306, 5964753}, + FieldElement{4100420, -5959452, -17179337, 6017714, -18705837, 12227141, -26684835, 11344144, 2538215, -7570755}, + }, + { + FieldElement{-9433605, 6123113, 11159803, -2156608, 30016280, 14966241, -20474983, 1485421, -629256, -15958862}, + FieldElement{-26804558, 4260919, 11851389, 9658551, -32017107, 16367492, -20205425, -13191288, 11659922, -11115118}, + FieldElement{26180396, 10015009, -30844224, -8581293, 5418197, 9480663, 2231568, -10170080, 33100372, -1306171}, + }, + { + FieldElement{15121113, -5201871, -10389905, 15427821, -27509937, -15992507, 21670947, 4486675, -5931810, -14466380}, + FieldElement{16166486, -9483733, -11104130, 6023908, -31926798, -1364923, 2340060, -16254968, -10735770, -10039824}, + FieldElement{28042865, -3557089, -12126526, 12259706, -3717498, -6945899, 6766453, -8689599, 18036436, 5803270}, + }, + }, + { + { + FieldElement{-817581, 6763912, 11803561, 1585585, 10958447, -2671165, 23855391, 4598332, -6159431, -14117438}, + FieldElement{-31031306, -14256194, 17332029, -2383520, 31312682, -5967183, 696309, 50292, -20095739, 11763584}, + FieldElement{-594563, -2514283, -32234153, 12643980, 12650761, 14811489, 665117, -12613632, -19773211, -10713562}, + }, + { + FieldElement{30464590, -11262872, -4127476, -12734478, 19835327, -7105613, -24396175, 2075773, -17020157, 992471}, + FieldElement{18357185, -6994433, 7766382, 16342475, -29324918, 411174, 14578841, 8080033, -11574335, -10601610}, + FieldElement{19598397, 10334610, 12555054, 2555664, 18821899, -10339780, 21873263, 16014234, 26224780, 16452269}, + }, + { + FieldElement{-30223925, 5145196, 5944548, 16385966, 3976735, 2009897, -11377804, -7618186, -20533829, 3698650}, + FieldElement{14187449, 3448569, -10636236, -10810935, -22663880, -3433596, 7268410, -10890444, 27394301, 12015369}, + FieldElement{19695761, 16087646, 28032085, 12999827, 6817792, 11427614, 20244189, -1312777, -13259127, -3402461}, + }, + { + FieldElement{30860103, 12735208, -1888245, -4699734, -16974906, 2256940, -8166013, 12298312, -8550524, -10393462}, + FieldElement{-5719826, -11245325, -1910649, 15569035, 26642876, -7587760, -5789354, -15118654, -4976164, 12651793}, + FieldElement{-2848395, 9953421, 11531313, -5282879, 26895123, -12697089, -13118820, -16517902, 9768698, -2533218}, + }, + { + FieldElement{-24719459, 1894651, -287698, -4704085, 15348719, -8156530, 32767513, 12765450, 4940095, 10678226}, + FieldElement{18860224, 15980149, -18987240, -1562570, -26233012, -11071856, -7843882, 13944024, -24372348, 16582019}, + FieldElement{-15504260, 4970268, -29893044, 4175593, -20993212, -2199756, -11704054, 15444560, -11003761, 7989037}, + }, + { + FieldElement{31490452, 5568061, -2412803, 2182383, -32336847, 4531686, -32078269, 6200206, -19686113, -14800171}, + FieldElement{-17308668, -15879940, -31522777, -2831, -32887382, 16375549, 8680158, -16371713, 28550068, -6857132}, + FieldElement{-28126887, -5688091, 16837845, -1820458, -6850681, 12700016, -30039981, 4364038, 1155602, 5988841}, + }, + { + FieldElement{21890435, -13272907, -12624011, 12154349, -7831873, 15300496, 23148983, -4470481, 24618407, 8283181}, + FieldElement{-33136107, -10512751, 9975416, 6841041, -31559793, 16356536, 3070187, -7025928, 1466169, 10740210}, + FieldElement{-1509399, -15488185, -13503385, -10655916, 32799044, 909394, -13938903, -5779719, -32164649, -15327040}, + }, + { + FieldElement{3960823, -14267803, -28026090, -15918051, -19404858, 13146868, 15567327, 951507, -3260321, -573935}, + FieldElement{24740841, 5052253, -30094131, 8961361, 25877428, 6165135, -24368180, 14397372, -7380369, -6144105}, + FieldElement{-28888365, 3510803, -28103278, -1158478, -11238128, -10631454, -15441463, -14453128, -1625486, -6494814}, + }, + }, + { + { + FieldElement{793299, -9230478, 8836302, -6235707, -27360908, -2369593, 33152843, -4885251, -9906200, -621852}, + FieldElement{5666233, 525582, 20782575, -8038419, -24538499, 14657740, 16099374, 1468826, -6171428, -15186581}, + FieldElement{-4859255, -3779343, -2917758, -6748019, 7778750, 11688288, -30404353, -9871238, -1558923, -9863646}, + }, + { + FieldElement{10896332, -7719704, 824275, 472601, -19460308, 3009587, 25248958, 14783338, -30581476, -15757844}, + FieldElement{10566929, 12612572, -31944212, 11118703, -12633376, 12362879, 21752402, 8822496, 24003793, 14264025}, + FieldElement{27713862, -7355973, -11008240, 9227530, 27050101, 2504721, 23886875, -13117525, 13958495, -5732453}, + }, + { + FieldElement{-23481610, 4867226, -27247128, 3900521, 29838369, -8212291, -31889399, -10041781, 7340521, -15410068}, + FieldElement{4646514, -8011124, -22766023, -11532654, 23184553, 8566613, 31366726, -1381061, -15066784, -10375192}, + FieldElement{-17270517, 12723032, -16993061, 14878794, 21619651, -6197576, 27584817, 3093888, -8843694, 3849921}, + }, + { + FieldElement{-9064912, 2103172, 25561640, -15125738, -5239824, 9582958, 32477045, -9017955, 5002294, -15550259}, + FieldElement{-12057553, -11177906, 21115585, -13365155, 8808712, -12030708, 16489530, 13378448, -25845716, 12741426}, + FieldElement{-5946367, 10645103, -30911586, 15390284, -3286982, -7118677, 24306472, 15852464, 28834118, -7646072}, + }, + { + FieldElement{-17335748, -9107057, -24531279, 9434953, -8472084, -583362, -13090771, 455841, 20461858, 5491305}, + FieldElement{13669248, -16095482, -12481974, -10203039, -14569770, -11893198, -24995986, 11293807, -28588204, -9421832}, + FieldElement{28497928, 6272777, -33022994, 14470570, 8906179, -1225630, 18504674, -14165166, 29867745, -8795943}, + }, + { + FieldElement{-16207023, 13517196, -27799630, -13697798, 24009064, -6373891, -6367600, -13175392, 22853429, -4012011}, + FieldElement{24191378, 16712145, -13931797, 15217831, 14542237, 1646131, 18603514, -11037887, 12876623, -2112447}, + FieldElement{17902668, 4518229, -411702, -2829247, 26878217, 5258055, -12860753, 608397, 16031844, 3723494}, + }, + { + FieldElement{-28632773, 12763728, -20446446, 7577504, 33001348, -13017745, 17558842, -7872890, 23896954, -4314245}, + FieldElement{-20005381, -12011952, 31520464, 605201, 2543521, 5991821, -2945064, 7229064, -9919646, -8826859}, + FieldElement{28816045, 298879, -28165016, -15920938, 19000928, -1665890, -12680833, -2949325, -18051778, -2082915}, + }, + { + FieldElement{16000882, -344896, 3493092, -11447198, -29504595, -13159789, 12577740, 16041268, -19715240, 7847707}, + FieldElement{10151868, 10572098, 27312476, 7922682, 14825339, 4723128, -32855931, -6519018, -10020567, 3852848}, + FieldElement{-11430470, 15697596, -21121557, -4420647, 5386314, 15063598, 16514493, -15932110, 29330899, -15076224}, + }, + }, + { + { + FieldElement{-25499735, -4378794, -15222908, -6901211, 16615731, 2051784, 3303702, 15490, -27548796, 12314391}, + FieldElement{15683520, -6003043, 18109120, -9980648, 15337968, -5997823, -16717435, 15921866, 16103996, -3731215}, + FieldElement{-23169824, -10781249, 13588192, -1628807, -3798557, -1074929, -19273607, 5402699, -29815713, -9841101}, + }, + { + FieldElement{23190676, 2384583, -32714340, 3462154, -29903655, -1529132, -11266856, 8911517, -25205859, 2739713}, + FieldElement{21374101, -3554250, -33524649, 9874411, 15377179, 11831242, -33529904, 6134907, 4931255, 11987849}, + FieldElement{-7732, -2978858, -16223486, 7277597, 105524, -322051, -31480539, 13861388, -30076310, 10117930}, + }, + { + FieldElement{-29501170, -10744872, -26163768, 13051539, -25625564, 5089643, -6325503, 6704079, 12890019, 15728940}, + FieldElement{-21972360, -11771379, -951059, -4418840, 14704840, 2695116, 903376, -10428139, 12885167, 8311031}, + FieldElement{-17516482, 5352194, 10384213, -13811658, 7506451, 13453191, 26423267, 4384730, 1888765, -5435404}, + }, + { + FieldElement{-25817338, -3107312, -13494599, -3182506, 30896459, -13921729, -32251644, -12707869, -19464434, -3340243}, + FieldElement{-23607977, -2665774, -526091, 4651136, 5765089, 4618330, 6092245, 14845197, 17151279, -9854116}, + FieldElement{-24830458, -12733720, -15165978, 10367250, -29530908, -265356, 22825805, -7087279, -16866484, 16176525}, + }, + { + FieldElement{-23583256, 6564961, 20063689, 3798228, -4740178, 7359225, 2006182, -10363426, -28746253, -10197509}, + FieldElement{-10626600, -4486402, -13320562, -5125317, 3432136, -6393229, 23632037, -1940610, 32808310, 1099883}, + FieldElement{15030977, 5768825, -27451236, -2887299, -6427378, -15361371, -15277896, -6809350, 2051441, -15225865}, + }, + { + FieldElement{-3362323, -7239372, 7517890, 9824992, 23555850, 295369, 5148398, -14154188, -22686354, 16633660}, + FieldElement{4577086, -16752288, 13249841, -15304328, 19958763, -14537274, 18559670, -10759549, 8402478, -9864273}, + FieldElement{-28406330, -1051581, -26790155, -907698, -17212414, -11030789, 9453451, -14980072, 17983010, 9967138}, + }, + { + FieldElement{-25762494, 6524722, 26585488, 9969270, 24709298, 1220360, -1677990, 7806337, 17507396, 3651560}, + FieldElement{-10420457, -4118111, 14584639, 15971087, -15768321, 8861010, 26556809, -5574557, -18553322, -11357135}, + FieldElement{2839101, 14284142, 4029895, 3472686, 14402957, 12689363, -26642121, 8459447, -5605463, -7621941}, + }, + { + FieldElement{-4839289, -3535444, 9744961, 2871048, 25113978, 3187018, -25110813, -849066, 17258084, -7977739}, + FieldElement{18164541, -10595176, -17154882, -1542417, 19237078, -9745295, 23357533, -15217008, 26908270, 12150756}, + FieldElement{-30264870, -7647865, 5112249, -7036672, -1499807, -6974257, 43168, -5537701, -32302074, 16215819}, + }, + }, + { + { + FieldElement{-6898905, 9824394, -12304779, -4401089, -31397141, -6276835, 32574489, 12532905, -7503072, -8675347}, + FieldElement{-27343522, -16515468, -27151524, -10722951, 946346, 16291093, 254968, 7168080, 21676107, -1943028}, + FieldElement{21260961, -8424752, -16831886, -11920822, -23677961, 3968121, -3651949, -6215466, -3556191, -7913075}, + }, + { + FieldElement{16544754, 13250366, -16804428, 15546242, -4583003, 12757258, -2462308, -8680336, -18907032, -9662799}, + FieldElement{-2415239, -15577728, 18312303, 4964443, -15272530, -12653564, 26820651, 16690659, 25459437, -4564609}, + FieldElement{-25144690, 11425020, 28423002, -11020557, -6144921, -15826224, 9142795, -2391602, -6432418, -1644817}, + }, + { + FieldElement{-23104652, 6253476, 16964147, -3768872, -25113972, -12296437, -27457225, -16344658, 6335692, 7249989}, + FieldElement{-30333227, 13979675, 7503222, -12368314, -11956721, -4621693, -30272269, 2682242, 25993170, -12478523}, + FieldElement{4364628, 5930691, 32304656, -10044554, -8054781, 15091131, 22857016, -10598955, 31820368, 15075278}, + }, + { + FieldElement{31879134, -8918693, 17258761, 90626, -8041836, -4917709, 24162788, -9650886, -17970238, 12833045}, + FieldElement{19073683, 14851414, -24403169, -11860168, 7625278, 11091125, -19619190, 2074449, -9413939, 14905377}, + FieldElement{24483667, -11935567, -2518866, -11547418, -1553130, 15355506, -25282080, 9253129, 27628530, -7555480}, + }, + { + FieldElement{17597607, 8340603, 19355617, 552187, 26198470, -3176583, 4593324, -9157582, -14110875, 15297016}, + FieldElement{510886, 14337390, -31785257, 16638632, 6328095, 2713355, -20217417, -11864220, 8683221, 2921426}, + FieldElement{18606791, 11874196, 27155355, -5281482, -24031742, 6265446, -25178240, -1278924, 4674690, 13890525}, + }, + { + FieldElement{13609624, 13069022, -27372361, -13055908, 24360586, 9592974, 14977157, 9835105, 4389687, 288396}, + FieldElement{9922506, -519394, 13613107, 5883594, -18758345, -434263, -12304062, 8317628, 23388070, 16052080}, + FieldElement{12720016, 11937594, -31970060, -5028689, 26900120, 8561328, -20155687, -11632979, -14754271, -10812892}, + }, + { + FieldElement{15961858, 14150409, 26716931, -665832, -22794328, 13603569, 11829573, 7467844, -28822128, 929275}, + FieldElement{11038231, -11582396, -27310482, -7316562, -10498527, -16307831, -23479533, -9371869, -21393143, 2465074}, + FieldElement{20017163, -4323226, 27915242, 1529148, 12396362, 15675764, 13817261, -9658066, 2463391, -4622140}, + }, + { + FieldElement{-16358878, -12663911, -12065183, 4996454, -1256422, 1073572, 9583558, 12851107, 4003896, 12673717}, + FieldElement{-1731589, -15155870, -3262930, 16143082, 19294135, 13385325, 14741514, -9103726, 7903886, 2348101}, + FieldElement{24536016, -16515207, 12715592, -3862155, 1511293, 10047386, -3842346, -7129159, -28377538, 10048127}, + }, + }, + { + { + FieldElement{-12622226, -6204820, 30718825, 2591312, -10617028, 12192840, 18873298, -7297090, -32297756, 15221632}, + FieldElement{-26478122, -11103864, 11546244, -1852483, 9180880, 7656409, -21343950, 2095755, 29769758, 6593415}, + FieldElement{-31994208, -2907461, 4176912, 3264766, 12538965, -868111, 26312345, -6118678, 30958054, 8292160}, + }, + { + FieldElement{31429822, -13959116, 29173532, 15632448, 12174511, -2760094, 32808831, 3977186, 26143136, -3148876}, + FieldElement{22648901, 1402143, -22799984, 13746059, 7936347, 365344, -8668633, -1674433, -3758243, -2304625}, + FieldElement{-15491917, 8012313, -2514730, -12702462, -23965846, -10254029, -1612713, -1535569, -16664475, 8194478}, + }, + { + FieldElement{27338066, -7507420, -7414224, 10140405, -19026427, -6589889, 27277191, 8855376, 28572286, 3005164}, + FieldElement{26287124, 4821776, 25476601, -4145903, -3764513, -15788984, -18008582, 1182479, -26094821, -13079595}, + FieldElement{-7171154, 3178080, 23970071, 6201893, -17195577, -4489192, -21876275, -13982627, 32208683, -1198248}, + }, + { + FieldElement{-16657702, 2817643, -10286362, 14811298, 6024667, 13349505, -27315504, -10497842, -27672585, -11539858}, + FieldElement{15941029, -9405932, -21367050, 8062055, 31876073, -238629, -15278393, -1444429, 15397331, -4130193}, + FieldElement{8934485, -13485467, -23286397, -13423241, -32446090, 14047986, 31170398, -1441021, -27505566, 15087184}, + }, + { + FieldElement{-18357243, -2156491, 24524913, -16677868, 15520427, -6360776, -15502406, 11461896, 16788528, -5868942}, + FieldElement{-1947386, 16013773, 21750665, 3714552, -17401782, -16055433, -3770287, -10323320, 31322514, -11615635}, + FieldElement{21426655, -5650218, -13648287, -5347537, -28812189, -4920970, -18275391, -14621414, 13040862, -12112948}, + }, + { + FieldElement{11293895, 12478086, -27136401, 15083750, -29307421, 14748872, 14555558, -13417103, 1613711, 4896935}, + FieldElement{-25894883, 15323294, -8489791, -8057900, 25967126, -13425460, 2825960, -4897045, -23971776, -11267415}, + FieldElement{-15924766, -5229880, -17443532, 6410664, 3622847, 10243618, 20615400, 12405433, -23753030, -8436416}, + }, + { + FieldElement{-7091295, 12556208, -20191352, 9025187, -17072479, 4333801, 4378436, 2432030, 23097949, -566018}, + FieldElement{4565804, -16025654, 20084412, -7842817, 1724999, 189254, 24767264, 10103221, -18512313, 2424778}, + FieldElement{366633, -11976806, 8173090, -6890119, 30788634, 5745705, -7168678, 1344109, -3642553, 12412659}, + }, + { + FieldElement{-24001791, 7690286, 14929416, -168257, -32210835, -13412986, 24162697, -15326504, -3141501, 11179385}, + FieldElement{18289522, -14724954, 8056945, 16430056, -21729724, 7842514, -6001441, -1486897, -18684645, -11443503}, + FieldElement{476239, 6601091, -6152790, -9723375, 17503545, -4863900, 27672959, 13403813, 11052904, 5219329}, + }, + }, + { + { + FieldElement{20678546, -8375738, -32671898, 8849123, -5009758, 14574752, 31186971, -3973730, 9014762, -8579056}, + FieldElement{-13644050, -10350239, -15962508, 5075808, -1514661, -11534600, -33102500, 9160280, 8473550, -3256838}, + FieldElement{24900749, 14435722, 17209120, -15292541, -22592275, 9878983, -7689309, -16335821, -24568481, 11788948}, + }, + { + FieldElement{-3118155, -11395194, -13802089, 14797441, 9652448, -6845904, -20037437, 10410733, -24568470, -1458691}, + FieldElement{-15659161, 16736706, -22467150, 10215878, -9097177, 7563911, 11871841, -12505194, -18513325, 8464118}, + FieldElement{-23400612, 8348507, -14585951, -861714, -3950205, -6373419, 14325289, 8628612, 33313881, -8370517}, + }, + { + FieldElement{-20186973, -4967935, 22367356, 5271547, -1097117, -4788838, -24805667, -10236854, -8940735, -5818269}, + FieldElement{-6948785, -1795212, -32625683, -16021179, 32635414, -7374245, 15989197, -12838188, 28358192, -4253904}, + FieldElement{-23561781, -2799059, -32351682, -1661963, -9147719, 10429267, -16637684, 4072016, -5351664, 5596589}, + }, + { + FieldElement{-28236598, -3390048, 12312896, 6213178, 3117142, 16078565, 29266239, 2557221, 1768301, 15373193}, + FieldElement{-7243358, -3246960, -4593467, -7553353, -127927, -912245, -1090902, -4504991, -24660491, 3442910}, + FieldElement{-30210571, 5124043, 14181784, 8197961, 18964734, -11939093, 22597931, 7176455, -18585478, 13365930}, + }, + { + FieldElement{-7877390, -1499958, 8324673, 4690079, 6261860, 890446, 24538107, -8570186, -9689599, -3031667}, + FieldElement{25008904, -10771599, -4305031, -9638010, 16265036, 15721635, 683793, -11823784, 15723479, -15163481}, + FieldElement{-9660625, 12374379, -27006999, -7026148, -7724114, -12314514, 11879682, 5400171, 519526, -1235876}, + }, + { + FieldElement{22258397, -16332233, -7869817, 14613016, -22520255, -2950923, -20353881, 7315967, 16648397, 7605640}, + FieldElement{-8081308, -8464597, -8223311, 9719710, 19259459, -15348212, 23994942, -5281555, -9468848, 4763278}, + FieldElement{-21699244, 9220969, -15730624, 1084137, -25476107, -2852390, 31088447, -7764523, -11356529, 728112}, + }, + { + FieldElement{26047220, -11751471, -6900323, -16521798, 24092068, 9158119, -4273545, -12555558, -29365436, -5498272}, + FieldElement{17510331, -322857, 5854289, 8403524, 17133918, -3112612, -28111007, 12327945, 10750447, 10014012}, + FieldElement{-10312768, 3936952, 9156313, -8897683, 16498692, -994647, -27481051, -666732, 3424691, 7540221}, + }, + { + FieldElement{30322361, -6964110, 11361005, -4143317, 7433304, 4989748, -7071422, -16317219, -9244265, 15258046}, + FieldElement{13054562, -2779497, 19155474, 469045, -12482797, 4566042, 5631406, 2711395, 1062915, -5136345}, + FieldElement{-19240248, -11254599, -29509029, -7499965, -5835763, 13005411, -6066489, 12194497, 32960380, 1459310}, + }, + }, + { + { + FieldElement{19852034, 7027924, 23669353, 10020366, 8586503, -6657907, 394197, -6101885, 18638003, -11174937}, + FieldElement{31395534, 15098109, 26581030, 8030562, -16527914, -5007134, 9012486, -7584354, -6643087, -5442636}, + FieldElement{-9192165, -2347377, -1997099, 4529534, 25766844, 607986, -13222, 9677543, -32294889, -6456008}, + }, + { + FieldElement{-2444496, -149937, 29348902, 8186665, 1873760, 12489863, -30934579, -7839692, -7852844, -8138429}, + FieldElement{-15236356, -15433509, 7766470, 746860, 26346930, -10221762, -27333451, 10754588, -9431476, 5203576}, + FieldElement{31834314, 14135496, -770007, 5159118, 20917671, -16768096, -7467973, -7337524, 31809243, 7347066}, + }, + { + FieldElement{-9606723, -11874240, 20414459, 13033986, 13716524, -11691881, 19797970, -12211255, 15192876, -2087490}, + FieldElement{-12663563, -2181719, 1168162, -3804809, 26747877, -14138091, 10609330, 12694420, 33473243, -13382104}, + FieldElement{33184999, 11180355, 15832085, -11385430, -1633671, 225884, 15089336, -11023903, -6135662, 14480053}, + }, + { + FieldElement{31308717, -5619998, 31030840, -1897099, 15674547, -6582883, 5496208, 13685227, 27595050, 8737275}, + FieldElement{-20318852, -15150239, 10933843, -16178022, 8335352, -7546022, -31008351, -12610604, 26498114, 66511}, + FieldElement{22644454, -8761729, -16671776, 4884562, -3105614, -13559366, 30540766, -4286747, -13327787, -7515095}, + }, + { + FieldElement{-28017847, 9834845, 18617207, -2681312, -3401956, -13307506, 8205540, 13585437, -17127465, 15115439}, + FieldElement{23711543, -672915, 31206561, -8362711, 6164647, -9709987, -33535882, -1426096, 8236921, 16492939}, + FieldElement{-23910559, -13515526, -26299483, -4503841, 25005590, -7687270, 19574902, 10071562, 6708380, -6222424}, + }, + { + FieldElement{2101391, -4930054, 19702731, 2367575, -15427167, 1047675, 5301017, 9328700, 29955601, -11678310}, + FieldElement{3096359, 9271816, -21620864, -15521844, -14847996, -7592937, -25892142, -12635595, -9917575, 6216608}, + FieldElement{-32615849, 338663, -25195611, 2510422, -29213566, -13820213, 24822830, -6146567, -26767480, 7525079}, + }, + { + FieldElement{-23066649, -13985623, 16133487, -7896178, -3389565, 778788, -910336, -2782495, -19386633, 11994101}, + FieldElement{21691500, -13624626, -641331, -14367021, 3285881, -3483596, -25064666, 9718258, -7477437, 13381418}, + FieldElement{18445390, -4202236, 14979846, 11622458, -1727110, -3582980, 23111648, -6375247, 28535282, 15779576}, + }, + { + FieldElement{30098053, 3089662, -9234387, 16662135, -21306940, 11308411, -14068454, 12021730, 9955285, -16303356}, + FieldElement{9734894, -14576830, -7473633, -9138735, 2060392, 11313496, -18426029, 9924399, 20194861, 13380996}, + FieldElement{-26378102, -7965207, -22167821, 15789297, -18055342, -6168792, -1984914, 15707771, 26342023, 10146099}, + }, + }, + { + { + FieldElement{-26016874, -219943, 21339191, -41388, 19745256, -2878700, -29637280, 2227040, 21612326, -545728}, + FieldElement{-13077387, 1184228, 23562814, -5970442, -20351244, -6348714, 25764461, 12243797, -20856566, 11649658}, + FieldElement{-10031494, 11262626, 27384172, 2271902, 26947504, -15997771, 39944, 6114064, 33514190, 2333242}, + }, + { + FieldElement{-21433588, -12421821, 8119782, 7219913, -21830522, -9016134, -6679750, -12670638, 24350578, -13450001}, + FieldElement{-4116307, -11271533, -23886186, 4843615, -30088339, 690623, -31536088, -10406836, 8317860, 12352766}, + FieldElement{18200138, -14475911, -33087759, -2696619, -23702521, -9102511, -23552096, -2287550, 20712163, 6719373}, + }, + { + FieldElement{26656208, 6075253, -7858556, 1886072, -28344043, 4262326, 11117530, -3763210, 26224235, -3297458}, + FieldElement{-17168938, -14854097, -3395676, -16369877, -19954045, 14050420, 21728352, 9493610, 18620611, -16428628}, + FieldElement{-13323321, 13325349, 11432106, 5964811, 18609221, 6062965, -5269471, -9725556, -30701573, -16479657}, + }, + { + FieldElement{-23860538, -11233159, 26961357, 1640861, -32413112, -16737940, 12248509, -5240639, 13735342, 1934062}, + FieldElement{25089769, 6742589, 17081145, -13406266, 21909293, -16067981, -15136294, -3765346, -21277997, 5473616}, + FieldElement{31883677, -7961101, 1083432, -11572403, 22828471, 13290673, -7125085, 12469656, 29111212, -5451014}, + }, + { + FieldElement{24244947, -15050407, -26262976, 2791540, -14997599, 16666678, 24367466, 6388839, -10295587, 452383}, + FieldElement{-25640782, -3417841, 5217916, 16224624, 19987036, -4082269, -24236251, -5915248, 15766062, 8407814}, + FieldElement{-20406999, 13990231, 15495425, 16395525, 5377168, 15166495, -8917023, -4388953, -8067909, 2276718}, + }, + { + FieldElement{30157918, 12924066, -17712050, 9245753, 19895028, 3368142, -23827587, 5096219, 22740376, -7303417}, + FieldElement{2041139, -14256350, 7783687, 13876377, -25946985, -13352459, 24051124, 13742383, -15637599, 13295222}, + FieldElement{33338237, -8505733, 12532113, 7977527, 9106186, -1715251, -17720195, -4612972, -4451357, -14669444}, + }, + { + FieldElement{-20045281, 5454097, -14346548, 6447146, 28862071, 1883651, -2469266, -4141880, 7770569, 9620597}, + FieldElement{23208068, 7979712, 33071466, 8149229, 1758231, -10834995, 30945528, -1694323, -33502340, -14767970}, + FieldElement{1439958, -16270480, -1079989, -793782, 4625402, 10647766, -5043801, 1220118, 30494170, -11440799}, + }, + { + FieldElement{-5037580, -13028295, -2970559, -3061767, 15640974, -6701666, -26739026, 926050, -1684339, -13333647}, + FieldElement{13908495, -3549272, 30919928, -6273825, -21521863, 7989039, 9021034, 9078865, 3353509, 4033511}, + FieldElement{-29663431, -15113610, 32259991, -344482, 24295849, -12912123, 23161163, 8839127, 27485041, 7356032}, + }, + }, + { + { + FieldElement{9661027, 705443, 11980065, -5370154, -1628543, 14661173, -6346142, 2625015, 28431036, -16771834}, + FieldElement{-23839233, -8311415, -25945511, 7480958, -17681669, -8354183, -22545972, 14150565, 15970762, 4099461}, + FieldElement{29262576, 16756590, 26350592, -8793563, 8529671, -11208050, 13617293, -9937143, 11465739, 8317062}, + }, + { + FieldElement{-25493081, -6962928, 32500200, -9419051, -23038724, -2302222, 14898637, 3848455, 20969334, -5157516}, + FieldElement{-20384450, -14347713, -18336405, 13884722, -33039454, 2842114, -21610826, -3649888, 11177095, 14989547}, + FieldElement{-24496721, -11716016, 16959896, 2278463, 12066309, 10137771, 13515641, 2581286, -28487508, 9930240}, + }, + { + FieldElement{-17751622, -2097826, 16544300, -13009300, -15914807, -14949081, 18345767, -13403753, 16291481, -5314038}, + FieldElement{-33229194, 2553288, 32678213, 9875984, 8534129, 6889387, -9676774, 6957617, 4368891, 9788741}, + FieldElement{16660756, 7281060, -10830758, 12911820, 20108584, -8101676, -21722536, -8613148, 16250552, -11111103}, + }, + { + FieldElement{-19765507, 2390526, -16551031, 14161980, 1905286, 6414907, 4689584, 10604807, -30190403, 4782747}, + FieldElement{-1354539, 14736941, -7367442, -13292886, 7710542, -14155590, -9981571, 4383045, 22546403, 437323}, + FieldElement{31665577, -12180464, -16186830, 1491339, -18368625, 3294682, 27343084, 2786261, -30633590, -14097016}, + }, + { + FieldElement{-14467279, -683715, -33374107, 7448552, 19294360, 14334329, -19690631, 2355319, -19284671, -6114373}, + FieldElement{15121312, -15796162, 6377020, -6031361, -10798111, -12957845, 18952177, 15496498, -29380133, 11754228}, + FieldElement{-2637277, -13483075, 8488727, -14303896, 12728761, -1622493, 7141596, 11724556, 22761615, -10134141}, + }, + { + FieldElement{16918416, 11729663, -18083579, 3022987, -31015732, -13339659, -28741185, -12227393, 32851222, 11717399}, + FieldElement{11166634, 7338049, -6722523, 4531520, -29468672, -7302055, 31474879, 3483633, -1193175, -4030831}, + FieldElement{-185635, 9921305, 31456609, -13536438, -12013818, 13348923, 33142652, 6546660, -19985279, -3948376}, + }, + { + FieldElement{-32460596, 11266712, -11197107, -7899103, 31703694, 3855903, -8537131, -12833048, -30772034, -15486313}, + FieldElement{-18006477, 12709068, 3991746, -6479188, -21491523, -10550425, -31135347, -16049879, 10928917, 3011958}, + FieldElement{-6957757, -15594337, 31696059, 334240, 29576716, 14796075, -30831056, -12805180, 18008031, 10258577}, + }, + { + FieldElement{-22448644, 15655569, 7018479, -4410003, -30314266, -1201591, -1853465, 1367120, 25127874, 6671743}, + FieldElement{29701166, -14373934, -10878120, 9279288, -17568, 13127210, 21382910, 11042292, 25838796, 4642684}, + FieldElement{-20430234, 14955537, -24126347, 8124619, -5369288, -5990470, 30468147, -13900640, 18423289, 4177476}, + }, + }, +} diff --git a/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/edwards25519.go b/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/edwards25519.go new file mode 100644 index 0000000..fd03c25 --- /dev/null +++ b/vendor/golang.org/x/crypto/ed25519/internal/edwards25519/edwards25519.go @@ -0,0 +1,1793 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package edwards25519 + +import "encoding/binary" + +// This code is a port of the public domain, “ref10” implementation of ed25519 +// from SUPERCOP. + +// FieldElement represents an element of the field GF(2^255 - 19). An element +// t, entries t[0]...t[9], represents the integer t[0]+2^26 t[1]+2^51 t[2]+2^77 +// t[3]+2^102 t[4]+...+2^230 t[9]. Bounds on each t[i] vary depending on +// context. +type FieldElement [10]int32 + +var zero FieldElement + +func FeZero(fe *FieldElement) { + copy(fe[:], zero[:]) +} + +func FeOne(fe *FieldElement) { + FeZero(fe) + fe[0] = 1 +} + +func FeAdd(dst, a, b *FieldElement) { + dst[0] = a[0] + b[0] + dst[1] = a[1] + b[1] + dst[2] = a[2] + b[2] + dst[3] = a[3] + b[3] + dst[4] = a[4] + b[4] + dst[5] = a[5] + b[5] + dst[6] = a[6] + b[6] + dst[7] = a[7] + b[7] + dst[8] = a[8] + b[8] + dst[9] = a[9] + b[9] +} + +func FeSub(dst, a, b *FieldElement) { + dst[0] = a[0] - b[0] + dst[1] = a[1] - b[1] + dst[2] = a[2] - b[2] + dst[3] = a[3] - b[3] + dst[4] = a[4] - b[4] + dst[5] = a[5] - b[5] + dst[6] = a[6] - b[6] + dst[7] = a[7] - b[7] + dst[8] = a[8] - b[8] + dst[9] = a[9] - b[9] +} + +func FeCopy(dst, src *FieldElement) { + copy(dst[:], src[:]) +} + +// Replace (f,g) with (g,g) if b == 1; +// replace (f,g) with (f,g) if b == 0. +// +// Preconditions: b in {0,1}. +func FeCMove(f, g *FieldElement, b int32) { + b = -b + f[0] ^= b & (f[0] ^ g[0]) + f[1] ^= b & (f[1] ^ g[1]) + f[2] ^= b & (f[2] ^ g[2]) + f[3] ^= b & (f[3] ^ g[3]) + f[4] ^= b & (f[4] ^ g[4]) + f[5] ^= b & (f[5] ^ g[5]) + f[6] ^= b & (f[6] ^ g[6]) + f[7] ^= b & (f[7] ^ g[7]) + f[8] ^= b & (f[8] ^ g[8]) + f[9] ^= b & (f[9] ^ g[9]) +} + +func load3(in []byte) int64 { + var r int64 + r = int64(in[0]) + r |= int64(in[1]) << 8 + r |= int64(in[2]) << 16 + return r +} + +func load4(in []byte) int64 { + var r int64 + r = int64(in[0]) + r |= int64(in[1]) << 8 + r |= int64(in[2]) << 16 + r |= int64(in[3]) << 24 + return r +} + +func FeFromBytes(dst *FieldElement, src *[32]byte) { + h0 := load4(src[:]) + h1 := load3(src[4:]) << 6 + h2 := load3(src[7:]) << 5 + h3 := load3(src[10:]) << 3 + h4 := load3(src[13:]) << 2 + h5 := load4(src[16:]) + h6 := load3(src[20:]) << 7 + h7 := load3(src[23:]) << 5 + h8 := load3(src[26:]) << 4 + h9 := (load3(src[29:]) & 8388607) << 2 + + FeCombine(dst, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9) +} + +// FeToBytes marshals h to s. +// Preconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +// +// Write p=2^255-19; q=floor(h/p). +// Basic claim: q = floor(2^(-255)(h + 19 2^(-25)h9 + 2^(-1))). +// +// Proof: +// Have |h|<=p so |q|<=1 so |19^2 2^(-255) q|<1/4. +// Also have |h-2^230 h9|<2^230 so |19 2^(-255)(h-2^230 h9)|<1/4. +// +// Write y=2^(-1)-19^2 2^(-255)q-19 2^(-255)(h-2^230 h9). +// Then 0> 25 + q = (h[0] + q) >> 26 + q = (h[1] + q) >> 25 + q = (h[2] + q) >> 26 + q = (h[3] + q) >> 25 + q = (h[4] + q) >> 26 + q = (h[5] + q) >> 25 + q = (h[6] + q) >> 26 + q = (h[7] + q) >> 25 + q = (h[8] + q) >> 26 + q = (h[9] + q) >> 25 + + // Goal: Output h-(2^255-19)q, which is between 0 and 2^255-20. + h[0] += 19 * q + // Goal: Output h-2^255 q, which is between 0 and 2^255-20. + + carry[0] = h[0] >> 26 + h[1] += carry[0] + h[0] -= carry[0] << 26 + carry[1] = h[1] >> 25 + h[2] += carry[1] + h[1] -= carry[1] << 25 + carry[2] = h[2] >> 26 + h[3] += carry[2] + h[2] -= carry[2] << 26 + carry[3] = h[3] >> 25 + h[4] += carry[3] + h[3] -= carry[3] << 25 + carry[4] = h[4] >> 26 + h[5] += carry[4] + h[4] -= carry[4] << 26 + carry[5] = h[5] >> 25 + h[6] += carry[5] + h[5] -= carry[5] << 25 + carry[6] = h[6] >> 26 + h[7] += carry[6] + h[6] -= carry[6] << 26 + carry[7] = h[7] >> 25 + h[8] += carry[7] + h[7] -= carry[7] << 25 + carry[8] = h[8] >> 26 + h[9] += carry[8] + h[8] -= carry[8] << 26 + carry[9] = h[9] >> 25 + h[9] -= carry[9] << 25 + // h10 = carry9 + + // Goal: Output h[0]+...+2^255 h10-2^255 q, which is between 0 and 2^255-20. + // Have h[0]+...+2^230 h[9] between 0 and 2^255-1; + // evidently 2^255 h10-2^255 q = 0. + // Goal: Output h[0]+...+2^230 h[9]. + + s[0] = byte(h[0] >> 0) + s[1] = byte(h[0] >> 8) + s[2] = byte(h[0] >> 16) + s[3] = byte((h[0] >> 24) | (h[1] << 2)) + s[4] = byte(h[1] >> 6) + s[5] = byte(h[1] >> 14) + s[6] = byte((h[1] >> 22) | (h[2] << 3)) + s[7] = byte(h[2] >> 5) + s[8] = byte(h[2] >> 13) + s[9] = byte((h[2] >> 21) | (h[3] << 5)) + s[10] = byte(h[3] >> 3) + s[11] = byte(h[3] >> 11) + s[12] = byte((h[3] >> 19) | (h[4] << 6)) + s[13] = byte(h[4] >> 2) + s[14] = byte(h[4] >> 10) + s[15] = byte(h[4] >> 18) + s[16] = byte(h[5] >> 0) + s[17] = byte(h[5] >> 8) + s[18] = byte(h[5] >> 16) + s[19] = byte((h[5] >> 24) | (h[6] << 1)) + s[20] = byte(h[6] >> 7) + s[21] = byte(h[6] >> 15) + s[22] = byte((h[6] >> 23) | (h[7] << 3)) + s[23] = byte(h[7] >> 5) + s[24] = byte(h[7] >> 13) + s[25] = byte((h[7] >> 21) | (h[8] << 4)) + s[26] = byte(h[8] >> 4) + s[27] = byte(h[8] >> 12) + s[28] = byte((h[8] >> 20) | (h[9] << 6)) + s[29] = byte(h[9] >> 2) + s[30] = byte(h[9] >> 10) + s[31] = byte(h[9] >> 18) +} + +func FeIsNegative(f *FieldElement) byte { + var s [32]byte + FeToBytes(&s, f) + return s[0] & 1 +} + +func FeIsNonZero(f *FieldElement) int32 { + var s [32]byte + FeToBytes(&s, f) + var x uint8 + for _, b := range s { + x |= b + } + x |= x >> 4 + x |= x >> 2 + x |= x >> 1 + return int32(x & 1) +} + +// FeNeg sets h = -f +// +// Preconditions: +// |f| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +// +// Postconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +func FeNeg(h, f *FieldElement) { + h[0] = -f[0] + h[1] = -f[1] + h[2] = -f[2] + h[3] = -f[3] + h[4] = -f[4] + h[5] = -f[5] + h[6] = -f[6] + h[7] = -f[7] + h[8] = -f[8] + h[9] = -f[9] +} + +func FeCombine(h *FieldElement, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9 int64) { + var c0, c1, c2, c3, c4, c5, c6, c7, c8, c9 int64 + + /* + |h0| <= (1.1*1.1*2^52*(1+19+19+19+19)+1.1*1.1*2^50*(38+38+38+38+38)) + i.e. |h0| <= 1.2*2^59; narrower ranges for h2, h4, h6, h8 + |h1| <= (1.1*1.1*2^51*(1+1+19+19+19+19+19+19+19+19)) + i.e. |h1| <= 1.5*2^58; narrower ranges for h3, h5, h7, h9 + */ + + c0 = (h0 + (1 << 25)) >> 26 + h1 += c0 + h0 -= c0 << 26 + c4 = (h4 + (1 << 25)) >> 26 + h5 += c4 + h4 -= c4 << 26 + /* |h0| <= 2^25 */ + /* |h4| <= 2^25 */ + /* |h1| <= 1.51*2^58 */ + /* |h5| <= 1.51*2^58 */ + + c1 = (h1 + (1 << 24)) >> 25 + h2 += c1 + h1 -= c1 << 25 + c5 = (h5 + (1 << 24)) >> 25 + h6 += c5 + h5 -= c5 << 25 + /* |h1| <= 2^24; from now on fits into int32 */ + /* |h5| <= 2^24; from now on fits into int32 */ + /* |h2| <= 1.21*2^59 */ + /* |h6| <= 1.21*2^59 */ + + c2 = (h2 + (1 << 25)) >> 26 + h3 += c2 + h2 -= c2 << 26 + c6 = (h6 + (1 << 25)) >> 26 + h7 += c6 + h6 -= c6 << 26 + /* |h2| <= 2^25; from now on fits into int32 unchanged */ + /* |h6| <= 2^25; from now on fits into int32 unchanged */ + /* |h3| <= 1.51*2^58 */ + /* |h7| <= 1.51*2^58 */ + + c3 = (h3 + (1 << 24)) >> 25 + h4 += c3 + h3 -= c3 << 25 + c7 = (h7 + (1 << 24)) >> 25 + h8 += c7 + h7 -= c7 << 25 + /* |h3| <= 2^24; from now on fits into int32 unchanged */ + /* |h7| <= 2^24; from now on fits into int32 unchanged */ + /* |h4| <= 1.52*2^33 */ + /* |h8| <= 1.52*2^33 */ + + c4 = (h4 + (1 << 25)) >> 26 + h5 += c4 + h4 -= c4 << 26 + c8 = (h8 + (1 << 25)) >> 26 + h9 += c8 + h8 -= c8 << 26 + /* |h4| <= 2^25; from now on fits into int32 unchanged */ + /* |h8| <= 2^25; from now on fits into int32 unchanged */ + /* |h5| <= 1.01*2^24 */ + /* |h9| <= 1.51*2^58 */ + + c9 = (h9 + (1 << 24)) >> 25 + h0 += c9 * 19 + h9 -= c9 << 25 + /* |h9| <= 2^24; from now on fits into int32 unchanged */ + /* |h0| <= 1.8*2^37 */ + + c0 = (h0 + (1 << 25)) >> 26 + h1 += c0 + h0 -= c0 << 26 + /* |h0| <= 2^25; from now on fits into int32 unchanged */ + /* |h1| <= 1.01*2^24 */ + + h[0] = int32(h0) + h[1] = int32(h1) + h[2] = int32(h2) + h[3] = int32(h3) + h[4] = int32(h4) + h[5] = int32(h5) + h[6] = int32(h6) + h[7] = int32(h7) + h[8] = int32(h8) + h[9] = int32(h9) +} + +// FeMul calculates h = f * g +// Can overlap h with f or g. +// +// Preconditions: +// |f| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// |g| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// +// Postconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +// +// Notes on implementation strategy: +// +// Using schoolbook multiplication. +// Karatsuba would save a little in some cost models. +// +// Most multiplications by 2 and 19 are 32-bit precomputations; +// cheaper than 64-bit postcomputations. +// +// There is one remaining multiplication by 19 in the carry chain; +// one *19 precomputation can be merged into this, +// but the resulting data flow is considerably less clean. +// +// There are 12 carries below. +// 10 of them are 2-way parallelizable and vectorizable. +// Can get away with 11 carries, but then data flow is much deeper. +// +// With tighter constraints on inputs, can squeeze carries into int32. +func FeMul(h, f, g *FieldElement) { + f0 := int64(f[0]) + f1 := int64(f[1]) + f2 := int64(f[2]) + f3 := int64(f[3]) + f4 := int64(f[4]) + f5 := int64(f[5]) + f6 := int64(f[6]) + f7 := int64(f[7]) + f8 := int64(f[8]) + f9 := int64(f[9]) + + f1_2 := int64(2 * f[1]) + f3_2 := int64(2 * f[3]) + f5_2 := int64(2 * f[5]) + f7_2 := int64(2 * f[7]) + f9_2 := int64(2 * f[9]) + + g0 := int64(g[0]) + g1 := int64(g[1]) + g2 := int64(g[2]) + g3 := int64(g[3]) + g4 := int64(g[4]) + g5 := int64(g[5]) + g6 := int64(g[6]) + g7 := int64(g[7]) + g8 := int64(g[8]) + g9 := int64(g[9]) + + g1_19 := int64(19 * g[1]) /* 1.4*2^29 */ + g2_19 := int64(19 * g[2]) /* 1.4*2^30; still ok */ + g3_19 := int64(19 * g[3]) + g4_19 := int64(19 * g[4]) + g5_19 := int64(19 * g[5]) + g6_19 := int64(19 * g[6]) + g7_19 := int64(19 * g[7]) + g8_19 := int64(19 * g[8]) + g9_19 := int64(19 * g[9]) + + h0 := f0*g0 + f1_2*g9_19 + f2*g8_19 + f3_2*g7_19 + f4*g6_19 + f5_2*g5_19 + f6*g4_19 + f7_2*g3_19 + f8*g2_19 + f9_2*g1_19 + h1 := f0*g1 + f1*g0 + f2*g9_19 + f3*g8_19 + f4*g7_19 + f5*g6_19 + f6*g5_19 + f7*g4_19 + f8*g3_19 + f9*g2_19 + h2 := f0*g2 + f1_2*g1 + f2*g0 + f3_2*g9_19 + f4*g8_19 + f5_2*g7_19 + f6*g6_19 + f7_2*g5_19 + f8*g4_19 + f9_2*g3_19 + h3 := f0*g3 + f1*g2 + f2*g1 + f3*g0 + f4*g9_19 + f5*g8_19 + f6*g7_19 + f7*g6_19 + f8*g5_19 + f9*g4_19 + h4 := f0*g4 + f1_2*g3 + f2*g2 + f3_2*g1 + f4*g0 + f5_2*g9_19 + f6*g8_19 + f7_2*g7_19 + f8*g6_19 + f9_2*g5_19 + h5 := f0*g5 + f1*g4 + f2*g3 + f3*g2 + f4*g1 + f5*g0 + f6*g9_19 + f7*g8_19 + f8*g7_19 + f9*g6_19 + h6 := f0*g6 + f1_2*g5 + f2*g4 + f3_2*g3 + f4*g2 + f5_2*g1 + f6*g0 + f7_2*g9_19 + f8*g8_19 + f9_2*g7_19 + h7 := f0*g7 + f1*g6 + f2*g5 + f3*g4 + f4*g3 + f5*g2 + f6*g1 + f7*g0 + f8*g9_19 + f9*g8_19 + h8 := f0*g8 + f1_2*g7 + f2*g6 + f3_2*g5 + f4*g4 + f5_2*g3 + f6*g2 + f7_2*g1 + f8*g0 + f9_2*g9_19 + h9 := f0*g9 + f1*g8 + f2*g7 + f3*g6 + f4*g5 + f5*g4 + f6*g3 + f7*g2 + f8*g1 + f9*g0 + + FeCombine(h, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9) +} + +func feSquare(f *FieldElement) (h0, h1, h2, h3, h4, h5, h6, h7, h8, h9 int64) { + f0 := int64(f[0]) + f1 := int64(f[1]) + f2 := int64(f[2]) + f3 := int64(f[3]) + f4 := int64(f[4]) + f5 := int64(f[5]) + f6 := int64(f[6]) + f7 := int64(f[7]) + f8 := int64(f[8]) + f9 := int64(f[9]) + f0_2 := int64(2 * f[0]) + f1_2 := int64(2 * f[1]) + f2_2 := int64(2 * f[2]) + f3_2 := int64(2 * f[3]) + f4_2 := int64(2 * f[4]) + f5_2 := int64(2 * f[5]) + f6_2 := int64(2 * f[6]) + f7_2 := int64(2 * f[7]) + f5_38 := 38 * f5 // 1.31*2^30 + f6_19 := 19 * f6 // 1.31*2^30 + f7_38 := 38 * f7 // 1.31*2^30 + f8_19 := 19 * f8 // 1.31*2^30 + f9_38 := 38 * f9 // 1.31*2^30 + + h0 = f0*f0 + f1_2*f9_38 + f2_2*f8_19 + f3_2*f7_38 + f4_2*f6_19 + f5*f5_38 + h1 = f0_2*f1 + f2*f9_38 + f3_2*f8_19 + f4*f7_38 + f5_2*f6_19 + h2 = f0_2*f2 + f1_2*f1 + f3_2*f9_38 + f4_2*f8_19 + f5_2*f7_38 + f6*f6_19 + h3 = f0_2*f3 + f1_2*f2 + f4*f9_38 + f5_2*f8_19 + f6*f7_38 + h4 = f0_2*f4 + f1_2*f3_2 + f2*f2 + f5_2*f9_38 + f6_2*f8_19 + f7*f7_38 + h5 = f0_2*f5 + f1_2*f4 + f2_2*f3 + f6*f9_38 + f7_2*f8_19 + h6 = f0_2*f6 + f1_2*f5_2 + f2_2*f4 + f3_2*f3 + f7_2*f9_38 + f8*f8_19 + h7 = f0_2*f7 + f1_2*f6 + f2_2*f5 + f3_2*f4 + f8*f9_38 + h8 = f0_2*f8 + f1_2*f7_2 + f2_2*f6 + f3_2*f5_2 + f4*f4 + f9*f9_38 + h9 = f0_2*f9 + f1_2*f8 + f2_2*f7 + f3_2*f6 + f4_2*f5 + + return +} + +// FeSquare calculates h = f*f. Can overlap h with f. +// +// Preconditions: +// |f| bounded by 1.1*2^26,1.1*2^25,1.1*2^26,1.1*2^25,etc. +// +// Postconditions: +// |h| bounded by 1.1*2^25,1.1*2^24,1.1*2^25,1.1*2^24,etc. +func FeSquare(h, f *FieldElement) { + h0, h1, h2, h3, h4, h5, h6, h7, h8, h9 := feSquare(f) + FeCombine(h, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9) +} + +// FeSquare2 sets h = 2 * f * f +// +// Can overlap h with f. +// +// Preconditions: +// |f| bounded by 1.65*2^26,1.65*2^25,1.65*2^26,1.65*2^25,etc. +// +// Postconditions: +// |h| bounded by 1.01*2^25,1.01*2^24,1.01*2^25,1.01*2^24,etc. +// See fe_mul.c for discussion of implementation strategy. +func FeSquare2(h, f *FieldElement) { + h0, h1, h2, h3, h4, h5, h6, h7, h8, h9 := feSquare(f) + + h0 += h0 + h1 += h1 + h2 += h2 + h3 += h3 + h4 += h4 + h5 += h5 + h6 += h6 + h7 += h7 + h8 += h8 + h9 += h9 + + FeCombine(h, h0, h1, h2, h3, h4, h5, h6, h7, h8, h9) +} + +func FeInvert(out, z *FieldElement) { + var t0, t1, t2, t3 FieldElement + var i int + + FeSquare(&t0, z) // 2^1 + FeSquare(&t1, &t0) // 2^2 + for i = 1; i < 2; i++ { // 2^3 + FeSquare(&t1, &t1) + } + FeMul(&t1, z, &t1) // 2^3 + 2^0 + FeMul(&t0, &t0, &t1) // 2^3 + 2^1 + 2^0 + FeSquare(&t2, &t0) // 2^4 + 2^2 + 2^1 + FeMul(&t1, &t1, &t2) // 2^4 + 2^3 + 2^2 + 2^1 + 2^0 + FeSquare(&t2, &t1) // 5,4,3,2,1 + for i = 1; i < 5; i++ { // 9,8,7,6,5 + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) // 9,8,7,6,5,4,3,2,1,0 + FeSquare(&t2, &t1) // 10..1 + for i = 1; i < 10; i++ { // 19..10 + FeSquare(&t2, &t2) + } + FeMul(&t2, &t2, &t1) // 19..0 + FeSquare(&t3, &t2) // 20..1 + for i = 1; i < 20; i++ { // 39..20 + FeSquare(&t3, &t3) + } + FeMul(&t2, &t3, &t2) // 39..0 + FeSquare(&t2, &t2) // 40..1 + for i = 1; i < 10; i++ { // 49..10 + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) // 49..0 + FeSquare(&t2, &t1) // 50..1 + for i = 1; i < 50; i++ { // 99..50 + FeSquare(&t2, &t2) + } + FeMul(&t2, &t2, &t1) // 99..0 + FeSquare(&t3, &t2) // 100..1 + for i = 1; i < 100; i++ { // 199..100 + FeSquare(&t3, &t3) + } + FeMul(&t2, &t3, &t2) // 199..0 + FeSquare(&t2, &t2) // 200..1 + for i = 1; i < 50; i++ { // 249..50 + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) // 249..0 + FeSquare(&t1, &t1) // 250..1 + for i = 1; i < 5; i++ { // 254..5 + FeSquare(&t1, &t1) + } + FeMul(out, &t1, &t0) // 254..5,3,1,0 +} + +func fePow22523(out, z *FieldElement) { + var t0, t1, t2 FieldElement + var i int + + FeSquare(&t0, z) + for i = 1; i < 1; i++ { + FeSquare(&t0, &t0) + } + FeSquare(&t1, &t0) + for i = 1; i < 2; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t1, z, &t1) + FeMul(&t0, &t0, &t1) + FeSquare(&t0, &t0) + for i = 1; i < 1; i++ { + FeSquare(&t0, &t0) + } + FeMul(&t0, &t1, &t0) + FeSquare(&t1, &t0) + for i = 1; i < 5; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t0, &t1, &t0) + FeSquare(&t1, &t0) + for i = 1; i < 10; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t1, &t1, &t0) + FeSquare(&t2, &t1) + for i = 1; i < 20; i++ { + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) + FeSquare(&t1, &t1) + for i = 1; i < 10; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t0, &t1, &t0) + FeSquare(&t1, &t0) + for i = 1; i < 50; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t1, &t1, &t0) + FeSquare(&t2, &t1) + for i = 1; i < 100; i++ { + FeSquare(&t2, &t2) + } + FeMul(&t1, &t2, &t1) + FeSquare(&t1, &t1) + for i = 1; i < 50; i++ { + FeSquare(&t1, &t1) + } + FeMul(&t0, &t1, &t0) + FeSquare(&t0, &t0) + for i = 1; i < 2; i++ { + FeSquare(&t0, &t0) + } + FeMul(out, &t0, z) +} + +// Group elements are members of the elliptic curve -x^2 + y^2 = 1 + d * x^2 * +// y^2 where d = -121665/121666. +// +// Several representations are used: +// ProjectiveGroupElement: (X:Y:Z) satisfying x=X/Z, y=Y/Z +// ExtendedGroupElement: (X:Y:Z:T) satisfying x=X/Z, y=Y/Z, XY=ZT +// CompletedGroupElement: ((X:Z),(Y:T)) satisfying x=X/Z, y=Y/T +// PreComputedGroupElement: (y+x,y-x,2dxy) + +type ProjectiveGroupElement struct { + X, Y, Z FieldElement +} + +type ExtendedGroupElement struct { + X, Y, Z, T FieldElement +} + +type CompletedGroupElement struct { + X, Y, Z, T FieldElement +} + +type PreComputedGroupElement struct { + yPlusX, yMinusX, xy2d FieldElement +} + +type CachedGroupElement struct { + yPlusX, yMinusX, Z, T2d FieldElement +} + +func (p *ProjectiveGroupElement) Zero() { + FeZero(&p.X) + FeOne(&p.Y) + FeOne(&p.Z) +} + +func (p *ProjectiveGroupElement) Double(r *CompletedGroupElement) { + var t0 FieldElement + + FeSquare(&r.X, &p.X) + FeSquare(&r.Z, &p.Y) + FeSquare2(&r.T, &p.Z) + FeAdd(&r.Y, &p.X, &p.Y) + FeSquare(&t0, &r.Y) + FeAdd(&r.Y, &r.Z, &r.X) + FeSub(&r.Z, &r.Z, &r.X) + FeSub(&r.X, &t0, &r.Y) + FeSub(&r.T, &r.T, &r.Z) +} + +func (p *ProjectiveGroupElement) ToBytes(s *[32]byte) { + var recip, x, y FieldElement + + FeInvert(&recip, &p.Z) + FeMul(&x, &p.X, &recip) + FeMul(&y, &p.Y, &recip) + FeToBytes(s, &y) + s[31] ^= FeIsNegative(&x) << 7 +} + +func (p *ExtendedGroupElement) Zero() { + FeZero(&p.X) + FeOne(&p.Y) + FeOne(&p.Z) + FeZero(&p.T) +} + +func (p *ExtendedGroupElement) Double(r *CompletedGroupElement) { + var q ProjectiveGroupElement + p.ToProjective(&q) + q.Double(r) +} + +func (p *ExtendedGroupElement) ToCached(r *CachedGroupElement) { + FeAdd(&r.yPlusX, &p.Y, &p.X) + FeSub(&r.yMinusX, &p.Y, &p.X) + FeCopy(&r.Z, &p.Z) + FeMul(&r.T2d, &p.T, &d2) +} + +func (p *ExtendedGroupElement) ToProjective(r *ProjectiveGroupElement) { + FeCopy(&r.X, &p.X) + FeCopy(&r.Y, &p.Y) + FeCopy(&r.Z, &p.Z) +} + +func (p *ExtendedGroupElement) ToBytes(s *[32]byte) { + var recip, x, y FieldElement + + FeInvert(&recip, &p.Z) + FeMul(&x, &p.X, &recip) + FeMul(&y, &p.Y, &recip) + FeToBytes(s, &y) + s[31] ^= FeIsNegative(&x) << 7 +} + +func (p *ExtendedGroupElement) FromBytes(s *[32]byte) bool { + var u, v, v3, vxx, check FieldElement + + FeFromBytes(&p.Y, s) + FeOne(&p.Z) + FeSquare(&u, &p.Y) + FeMul(&v, &u, &d) + FeSub(&u, &u, &p.Z) // y = y^2-1 + FeAdd(&v, &v, &p.Z) // v = dy^2+1 + + FeSquare(&v3, &v) + FeMul(&v3, &v3, &v) // v3 = v^3 + FeSquare(&p.X, &v3) + FeMul(&p.X, &p.X, &v) + FeMul(&p.X, &p.X, &u) // x = uv^7 + + fePow22523(&p.X, &p.X) // x = (uv^7)^((q-5)/8) + FeMul(&p.X, &p.X, &v3) + FeMul(&p.X, &p.X, &u) // x = uv^3(uv^7)^((q-5)/8) + + var tmpX, tmp2 [32]byte + + FeSquare(&vxx, &p.X) + FeMul(&vxx, &vxx, &v) + FeSub(&check, &vxx, &u) // vx^2-u + if FeIsNonZero(&check) == 1 { + FeAdd(&check, &vxx, &u) // vx^2+u + if FeIsNonZero(&check) == 1 { + return false + } + FeMul(&p.X, &p.X, &SqrtM1) + + FeToBytes(&tmpX, &p.X) + for i, v := range tmpX { + tmp2[31-i] = v + } + } + + if FeIsNegative(&p.X) != (s[31] >> 7) { + FeNeg(&p.X, &p.X) + } + + FeMul(&p.T, &p.X, &p.Y) + return true +} + +func (p *CompletedGroupElement) ToProjective(r *ProjectiveGroupElement) { + FeMul(&r.X, &p.X, &p.T) + FeMul(&r.Y, &p.Y, &p.Z) + FeMul(&r.Z, &p.Z, &p.T) +} + +func (p *CompletedGroupElement) ToExtended(r *ExtendedGroupElement) { + FeMul(&r.X, &p.X, &p.T) + FeMul(&r.Y, &p.Y, &p.Z) + FeMul(&r.Z, &p.Z, &p.T) + FeMul(&r.T, &p.X, &p.Y) +} + +func (p *PreComputedGroupElement) Zero() { + FeOne(&p.yPlusX) + FeOne(&p.yMinusX) + FeZero(&p.xy2d) +} + +func geAdd(r *CompletedGroupElement, p *ExtendedGroupElement, q *CachedGroupElement) { + var t0 FieldElement + + FeAdd(&r.X, &p.Y, &p.X) + FeSub(&r.Y, &p.Y, &p.X) + FeMul(&r.Z, &r.X, &q.yPlusX) + FeMul(&r.Y, &r.Y, &q.yMinusX) + FeMul(&r.T, &q.T2d, &p.T) + FeMul(&r.X, &p.Z, &q.Z) + FeAdd(&t0, &r.X, &r.X) + FeSub(&r.X, &r.Z, &r.Y) + FeAdd(&r.Y, &r.Z, &r.Y) + FeAdd(&r.Z, &t0, &r.T) + FeSub(&r.T, &t0, &r.T) +} + +func geSub(r *CompletedGroupElement, p *ExtendedGroupElement, q *CachedGroupElement) { + var t0 FieldElement + + FeAdd(&r.X, &p.Y, &p.X) + FeSub(&r.Y, &p.Y, &p.X) + FeMul(&r.Z, &r.X, &q.yMinusX) + FeMul(&r.Y, &r.Y, &q.yPlusX) + FeMul(&r.T, &q.T2d, &p.T) + FeMul(&r.X, &p.Z, &q.Z) + FeAdd(&t0, &r.X, &r.X) + FeSub(&r.X, &r.Z, &r.Y) + FeAdd(&r.Y, &r.Z, &r.Y) + FeSub(&r.Z, &t0, &r.T) + FeAdd(&r.T, &t0, &r.T) +} + +func geMixedAdd(r *CompletedGroupElement, p *ExtendedGroupElement, q *PreComputedGroupElement) { + var t0 FieldElement + + FeAdd(&r.X, &p.Y, &p.X) + FeSub(&r.Y, &p.Y, &p.X) + FeMul(&r.Z, &r.X, &q.yPlusX) + FeMul(&r.Y, &r.Y, &q.yMinusX) + FeMul(&r.T, &q.xy2d, &p.T) + FeAdd(&t0, &p.Z, &p.Z) + FeSub(&r.X, &r.Z, &r.Y) + FeAdd(&r.Y, &r.Z, &r.Y) + FeAdd(&r.Z, &t0, &r.T) + FeSub(&r.T, &t0, &r.T) +} + +func geMixedSub(r *CompletedGroupElement, p *ExtendedGroupElement, q *PreComputedGroupElement) { + var t0 FieldElement + + FeAdd(&r.X, &p.Y, &p.X) + FeSub(&r.Y, &p.Y, &p.X) + FeMul(&r.Z, &r.X, &q.yMinusX) + FeMul(&r.Y, &r.Y, &q.yPlusX) + FeMul(&r.T, &q.xy2d, &p.T) + FeAdd(&t0, &p.Z, &p.Z) + FeSub(&r.X, &r.Z, &r.Y) + FeAdd(&r.Y, &r.Z, &r.Y) + FeSub(&r.Z, &t0, &r.T) + FeAdd(&r.T, &t0, &r.T) +} + +func slide(r *[256]int8, a *[32]byte) { + for i := range r { + r[i] = int8(1 & (a[i>>3] >> uint(i&7))) + } + + for i := range r { + if r[i] != 0 { + for b := 1; b <= 6 && i+b < 256; b++ { + if r[i+b] != 0 { + if r[i]+(r[i+b]<= -15 { + r[i] -= r[i+b] << uint(b) + for k := i + b; k < 256; k++ { + if r[k] == 0 { + r[k] = 1 + break + } + r[k] = 0 + } + } else { + break + } + } + } + } + } +} + +// GeDoubleScalarMultVartime sets r = a*A + b*B +// where a = a[0]+256*a[1]+...+256^31 a[31]. +// and b = b[0]+256*b[1]+...+256^31 b[31]. +// B is the Ed25519 base point (x,4/5) with x positive. +func GeDoubleScalarMultVartime(r *ProjectiveGroupElement, a *[32]byte, A *ExtendedGroupElement, b *[32]byte) { + var aSlide, bSlide [256]int8 + var Ai [8]CachedGroupElement // A,3A,5A,7A,9A,11A,13A,15A + var t CompletedGroupElement + var u, A2 ExtendedGroupElement + var i int + + slide(&aSlide, a) + slide(&bSlide, b) + + A.ToCached(&Ai[0]) + A.Double(&t) + t.ToExtended(&A2) + + for i := 0; i < 7; i++ { + geAdd(&t, &A2, &Ai[i]) + t.ToExtended(&u) + u.ToCached(&Ai[i+1]) + } + + r.Zero() + + for i = 255; i >= 0; i-- { + if aSlide[i] != 0 || bSlide[i] != 0 { + break + } + } + + for ; i >= 0; i-- { + r.Double(&t) + + if aSlide[i] > 0 { + t.ToExtended(&u) + geAdd(&t, &u, &Ai[aSlide[i]/2]) + } else if aSlide[i] < 0 { + t.ToExtended(&u) + geSub(&t, &u, &Ai[(-aSlide[i])/2]) + } + + if bSlide[i] > 0 { + t.ToExtended(&u) + geMixedAdd(&t, &u, &bi[bSlide[i]/2]) + } else if bSlide[i] < 0 { + t.ToExtended(&u) + geMixedSub(&t, &u, &bi[(-bSlide[i])/2]) + } + + t.ToProjective(r) + } +} + +// equal returns 1 if b == c and 0 otherwise, assuming that b and c are +// non-negative. +func equal(b, c int32) int32 { + x := uint32(b ^ c) + x-- + return int32(x >> 31) +} + +// negative returns 1 if b < 0 and 0 otherwise. +func negative(b int32) int32 { + return (b >> 31) & 1 +} + +func PreComputedGroupElementCMove(t, u *PreComputedGroupElement, b int32) { + FeCMove(&t.yPlusX, &u.yPlusX, b) + FeCMove(&t.yMinusX, &u.yMinusX, b) + FeCMove(&t.xy2d, &u.xy2d, b) +} + +func selectPoint(t *PreComputedGroupElement, pos int32, b int32) { + var minusT PreComputedGroupElement + bNegative := negative(b) + bAbs := b - (((-bNegative) & b) << 1) + + t.Zero() + for i := int32(0); i < 8; i++ { + PreComputedGroupElementCMove(t, &base[pos][i], equal(bAbs, i+1)) + } + FeCopy(&minusT.yPlusX, &t.yMinusX) + FeCopy(&minusT.yMinusX, &t.yPlusX) + FeNeg(&minusT.xy2d, &t.xy2d) + PreComputedGroupElementCMove(t, &minusT, bNegative) +} + +// GeScalarMultBase computes h = a*B, where +// a = a[0]+256*a[1]+...+256^31 a[31] +// B is the Ed25519 base point (x,4/5) with x positive. +// +// Preconditions: +// a[31] <= 127 +func GeScalarMultBase(h *ExtendedGroupElement, a *[32]byte) { + var e [64]int8 + + for i, v := range a { + e[2*i] = int8(v & 15) + e[2*i+1] = int8((v >> 4) & 15) + } + + // each e[i] is between 0 and 15 and e[63] is between 0 and 7. + + carry := int8(0) + for i := 0; i < 63; i++ { + e[i] += carry + carry = (e[i] + 8) >> 4 + e[i] -= carry << 4 + } + e[63] += carry + // each e[i] is between -8 and 8. + + h.Zero() + var t PreComputedGroupElement + var r CompletedGroupElement + for i := int32(1); i < 64; i += 2 { + selectPoint(&t, i/2, int32(e[i])) + geMixedAdd(&r, h, &t) + r.ToExtended(h) + } + + var s ProjectiveGroupElement + + h.Double(&r) + r.ToProjective(&s) + s.Double(&r) + r.ToProjective(&s) + s.Double(&r) + r.ToProjective(&s) + s.Double(&r) + r.ToExtended(h) + + for i := int32(0); i < 64; i += 2 { + selectPoint(&t, i/2, int32(e[i])) + geMixedAdd(&r, h, &t) + r.ToExtended(h) + } +} + +// The scalars are GF(2^252 + 27742317777372353535851937790883648493). + +// Input: +// a[0]+256*a[1]+...+256^31*a[31] = a +// b[0]+256*b[1]+...+256^31*b[31] = b +// c[0]+256*c[1]+...+256^31*c[31] = c +// +// Output: +// s[0]+256*s[1]+...+256^31*s[31] = (ab+c) mod l +// where l = 2^252 + 27742317777372353535851937790883648493. +func ScMulAdd(s, a, b, c *[32]byte) { + a0 := 2097151 & load3(a[:]) + a1 := 2097151 & (load4(a[2:]) >> 5) + a2 := 2097151 & (load3(a[5:]) >> 2) + a3 := 2097151 & (load4(a[7:]) >> 7) + a4 := 2097151 & (load4(a[10:]) >> 4) + a5 := 2097151 & (load3(a[13:]) >> 1) + a6 := 2097151 & (load4(a[15:]) >> 6) + a7 := 2097151 & (load3(a[18:]) >> 3) + a8 := 2097151 & load3(a[21:]) + a9 := 2097151 & (load4(a[23:]) >> 5) + a10 := 2097151 & (load3(a[26:]) >> 2) + a11 := (load4(a[28:]) >> 7) + b0 := 2097151 & load3(b[:]) + b1 := 2097151 & (load4(b[2:]) >> 5) + b2 := 2097151 & (load3(b[5:]) >> 2) + b3 := 2097151 & (load4(b[7:]) >> 7) + b4 := 2097151 & (load4(b[10:]) >> 4) + b5 := 2097151 & (load3(b[13:]) >> 1) + b6 := 2097151 & (load4(b[15:]) >> 6) + b7 := 2097151 & (load3(b[18:]) >> 3) + b8 := 2097151 & load3(b[21:]) + b9 := 2097151 & (load4(b[23:]) >> 5) + b10 := 2097151 & (load3(b[26:]) >> 2) + b11 := (load4(b[28:]) >> 7) + c0 := 2097151 & load3(c[:]) + c1 := 2097151 & (load4(c[2:]) >> 5) + c2 := 2097151 & (load3(c[5:]) >> 2) + c3 := 2097151 & (load4(c[7:]) >> 7) + c4 := 2097151 & (load4(c[10:]) >> 4) + c5 := 2097151 & (load3(c[13:]) >> 1) + c6 := 2097151 & (load4(c[15:]) >> 6) + c7 := 2097151 & (load3(c[18:]) >> 3) + c8 := 2097151 & load3(c[21:]) + c9 := 2097151 & (load4(c[23:]) >> 5) + c10 := 2097151 & (load3(c[26:]) >> 2) + c11 := (load4(c[28:]) >> 7) + var carry [23]int64 + + s0 := c0 + a0*b0 + s1 := c1 + a0*b1 + a1*b0 + s2 := c2 + a0*b2 + a1*b1 + a2*b0 + s3 := c3 + a0*b3 + a1*b2 + a2*b1 + a3*b0 + s4 := c4 + a0*b4 + a1*b3 + a2*b2 + a3*b1 + a4*b0 + s5 := c5 + a0*b5 + a1*b4 + a2*b3 + a3*b2 + a4*b1 + a5*b0 + s6 := c6 + a0*b6 + a1*b5 + a2*b4 + a3*b3 + a4*b2 + a5*b1 + a6*b0 + s7 := c7 + a0*b7 + a1*b6 + a2*b5 + a3*b4 + a4*b3 + a5*b2 + a6*b1 + a7*b0 + s8 := c8 + a0*b8 + a1*b7 + a2*b6 + a3*b5 + a4*b4 + a5*b3 + a6*b2 + a7*b1 + a8*b0 + s9 := c9 + a0*b9 + a1*b8 + a2*b7 + a3*b6 + a4*b5 + a5*b4 + a6*b3 + a7*b2 + a8*b1 + a9*b0 + s10 := c10 + a0*b10 + a1*b9 + a2*b8 + a3*b7 + a4*b6 + a5*b5 + a6*b4 + a7*b3 + a8*b2 + a9*b1 + a10*b0 + s11 := c11 + a0*b11 + a1*b10 + a2*b9 + a3*b8 + a4*b7 + a5*b6 + a6*b5 + a7*b4 + a8*b3 + a9*b2 + a10*b1 + a11*b0 + s12 := a1*b11 + a2*b10 + a3*b9 + a4*b8 + a5*b7 + a6*b6 + a7*b5 + a8*b4 + a9*b3 + a10*b2 + a11*b1 + s13 := a2*b11 + a3*b10 + a4*b9 + a5*b8 + a6*b7 + a7*b6 + a8*b5 + a9*b4 + a10*b3 + a11*b2 + s14 := a3*b11 + a4*b10 + a5*b9 + a6*b8 + a7*b7 + a8*b6 + a9*b5 + a10*b4 + a11*b3 + s15 := a4*b11 + a5*b10 + a6*b9 + a7*b8 + a8*b7 + a9*b6 + a10*b5 + a11*b4 + s16 := a5*b11 + a6*b10 + a7*b9 + a8*b8 + a9*b7 + a10*b6 + a11*b5 + s17 := a6*b11 + a7*b10 + a8*b9 + a9*b8 + a10*b7 + a11*b6 + s18 := a7*b11 + a8*b10 + a9*b9 + a10*b8 + a11*b7 + s19 := a8*b11 + a9*b10 + a10*b9 + a11*b8 + s20 := a9*b11 + a10*b10 + a11*b9 + s21 := a10*b11 + a11*b10 + s22 := a11 * b11 + s23 := int64(0) + + carry[0] = (s0 + (1 << 20)) >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[2] = (s2 + (1 << 20)) >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[4] = (s4 + (1 << 20)) >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[12] = (s12 + (1 << 20)) >> 21 + s13 += carry[12] + s12 -= carry[12] << 21 + carry[14] = (s14 + (1 << 20)) >> 21 + s15 += carry[14] + s14 -= carry[14] << 21 + carry[16] = (s16 + (1 << 20)) >> 21 + s17 += carry[16] + s16 -= carry[16] << 21 + carry[18] = (s18 + (1 << 20)) >> 21 + s19 += carry[18] + s18 -= carry[18] << 21 + carry[20] = (s20 + (1 << 20)) >> 21 + s21 += carry[20] + s20 -= carry[20] << 21 + carry[22] = (s22 + (1 << 20)) >> 21 + s23 += carry[22] + s22 -= carry[22] << 21 + + carry[1] = (s1 + (1 << 20)) >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[3] = (s3 + (1 << 20)) >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[5] = (s5 + (1 << 20)) >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + carry[13] = (s13 + (1 << 20)) >> 21 + s14 += carry[13] + s13 -= carry[13] << 21 + carry[15] = (s15 + (1 << 20)) >> 21 + s16 += carry[15] + s15 -= carry[15] << 21 + carry[17] = (s17 + (1 << 20)) >> 21 + s18 += carry[17] + s17 -= carry[17] << 21 + carry[19] = (s19 + (1 << 20)) >> 21 + s20 += carry[19] + s19 -= carry[19] << 21 + carry[21] = (s21 + (1 << 20)) >> 21 + s22 += carry[21] + s21 -= carry[21] << 21 + + s11 += s23 * 666643 + s12 += s23 * 470296 + s13 += s23 * 654183 + s14 -= s23 * 997805 + s15 += s23 * 136657 + s16 -= s23 * 683901 + s23 = 0 + + s10 += s22 * 666643 + s11 += s22 * 470296 + s12 += s22 * 654183 + s13 -= s22 * 997805 + s14 += s22 * 136657 + s15 -= s22 * 683901 + s22 = 0 + + s9 += s21 * 666643 + s10 += s21 * 470296 + s11 += s21 * 654183 + s12 -= s21 * 997805 + s13 += s21 * 136657 + s14 -= s21 * 683901 + s21 = 0 + + s8 += s20 * 666643 + s9 += s20 * 470296 + s10 += s20 * 654183 + s11 -= s20 * 997805 + s12 += s20 * 136657 + s13 -= s20 * 683901 + s20 = 0 + + s7 += s19 * 666643 + s8 += s19 * 470296 + s9 += s19 * 654183 + s10 -= s19 * 997805 + s11 += s19 * 136657 + s12 -= s19 * 683901 + s19 = 0 + + s6 += s18 * 666643 + s7 += s18 * 470296 + s8 += s18 * 654183 + s9 -= s18 * 997805 + s10 += s18 * 136657 + s11 -= s18 * 683901 + s18 = 0 + + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[12] = (s12 + (1 << 20)) >> 21 + s13 += carry[12] + s12 -= carry[12] << 21 + carry[14] = (s14 + (1 << 20)) >> 21 + s15 += carry[14] + s14 -= carry[14] << 21 + carry[16] = (s16 + (1 << 20)) >> 21 + s17 += carry[16] + s16 -= carry[16] << 21 + + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + carry[13] = (s13 + (1 << 20)) >> 21 + s14 += carry[13] + s13 -= carry[13] << 21 + carry[15] = (s15 + (1 << 20)) >> 21 + s16 += carry[15] + s15 -= carry[15] << 21 + + s5 += s17 * 666643 + s6 += s17 * 470296 + s7 += s17 * 654183 + s8 -= s17 * 997805 + s9 += s17 * 136657 + s10 -= s17 * 683901 + s17 = 0 + + s4 += s16 * 666643 + s5 += s16 * 470296 + s6 += s16 * 654183 + s7 -= s16 * 997805 + s8 += s16 * 136657 + s9 -= s16 * 683901 + s16 = 0 + + s3 += s15 * 666643 + s4 += s15 * 470296 + s5 += s15 * 654183 + s6 -= s15 * 997805 + s7 += s15 * 136657 + s8 -= s15 * 683901 + s15 = 0 + + s2 += s14 * 666643 + s3 += s14 * 470296 + s4 += s14 * 654183 + s5 -= s14 * 997805 + s6 += s14 * 136657 + s7 -= s14 * 683901 + s14 = 0 + + s1 += s13 * 666643 + s2 += s13 * 470296 + s3 += s13 * 654183 + s4 -= s13 * 997805 + s5 += s13 * 136657 + s6 -= s13 * 683901 + s13 = 0 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = (s0 + (1 << 20)) >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[2] = (s2 + (1 << 20)) >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[4] = (s4 + (1 << 20)) >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + + carry[1] = (s1 + (1 << 20)) >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[3] = (s3 + (1 << 20)) >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[5] = (s5 + (1 << 20)) >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = s0 >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[1] = s1 >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[2] = s2 >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[3] = s3 >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[4] = s4 >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[5] = s5 >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[6] = s6 >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[7] = s7 >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[8] = s8 >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[9] = s9 >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[10] = s10 >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[11] = s11 >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = s0 >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[1] = s1 >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[2] = s2 >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[3] = s3 >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[4] = s4 >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[5] = s5 >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[6] = s6 >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[7] = s7 >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[8] = s8 >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[9] = s9 >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[10] = s10 >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + + s[0] = byte(s0 >> 0) + s[1] = byte(s0 >> 8) + s[2] = byte((s0 >> 16) | (s1 << 5)) + s[3] = byte(s1 >> 3) + s[4] = byte(s1 >> 11) + s[5] = byte((s1 >> 19) | (s2 << 2)) + s[6] = byte(s2 >> 6) + s[7] = byte((s2 >> 14) | (s3 << 7)) + s[8] = byte(s3 >> 1) + s[9] = byte(s3 >> 9) + s[10] = byte((s3 >> 17) | (s4 << 4)) + s[11] = byte(s4 >> 4) + s[12] = byte(s4 >> 12) + s[13] = byte((s4 >> 20) | (s5 << 1)) + s[14] = byte(s5 >> 7) + s[15] = byte((s5 >> 15) | (s6 << 6)) + s[16] = byte(s6 >> 2) + s[17] = byte(s6 >> 10) + s[18] = byte((s6 >> 18) | (s7 << 3)) + s[19] = byte(s7 >> 5) + s[20] = byte(s7 >> 13) + s[21] = byte(s8 >> 0) + s[22] = byte(s8 >> 8) + s[23] = byte((s8 >> 16) | (s9 << 5)) + s[24] = byte(s9 >> 3) + s[25] = byte(s9 >> 11) + s[26] = byte((s9 >> 19) | (s10 << 2)) + s[27] = byte(s10 >> 6) + s[28] = byte((s10 >> 14) | (s11 << 7)) + s[29] = byte(s11 >> 1) + s[30] = byte(s11 >> 9) + s[31] = byte(s11 >> 17) +} + +// Input: +// s[0]+256*s[1]+...+256^63*s[63] = s +// +// Output: +// s[0]+256*s[1]+...+256^31*s[31] = s mod l +// where l = 2^252 + 27742317777372353535851937790883648493. +func ScReduce(out *[32]byte, s *[64]byte) { + s0 := 2097151 & load3(s[:]) + s1 := 2097151 & (load4(s[2:]) >> 5) + s2 := 2097151 & (load3(s[5:]) >> 2) + s3 := 2097151 & (load4(s[7:]) >> 7) + s4 := 2097151 & (load4(s[10:]) >> 4) + s5 := 2097151 & (load3(s[13:]) >> 1) + s6 := 2097151 & (load4(s[15:]) >> 6) + s7 := 2097151 & (load3(s[18:]) >> 3) + s8 := 2097151 & load3(s[21:]) + s9 := 2097151 & (load4(s[23:]) >> 5) + s10 := 2097151 & (load3(s[26:]) >> 2) + s11 := 2097151 & (load4(s[28:]) >> 7) + s12 := 2097151 & (load4(s[31:]) >> 4) + s13 := 2097151 & (load3(s[34:]) >> 1) + s14 := 2097151 & (load4(s[36:]) >> 6) + s15 := 2097151 & (load3(s[39:]) >> 3) + s16 := 2097151 & load3(s[42:]) + s17 := 2097151 & (load4(s[44:]) >> 5) + s18 := 2097151 & (load3(s[47:]) >> 2) + s19 := 2097151 & (load4(s[49:]) >> 7) + s20 := 2097151 & (load4(s[52:]) >> 4) + s21 := 2097151 & (load3(s[55:]) >> 1) + s22 := 2097151 & (load4(s[57:]) >> 6) + s23 := (load4(s[60:]) >> 3) + + s11 += s23 * 666643 + s12 += s23 * 470296 + s13 += s23 * 654183 + s14 -= s23 * 997805 + s15 += s23 * 136657 + s16 -= s23 * 683901 + s23 = 0 + + s10 += s22 * 666643 + s11 += s22 * 470296 + s12 += s22 * 654183 + s13 -= s22 * 997805 + s14 += s22 * 136657 + s15 -= s22 * 683901 + s22 = 0 + + s9 += s21 * 666643 + s10 += s21 * 470296 + s11 += s21 * 654183 + s12 -= s21 * 997805 + s13 += s21 * 136657 + s14 -= s21 * 683901 + s21 = 0 + + s8 += s20 * 666643 + s9 += s20 * 470296 + s10 += s20 * 654183 + s11 -= s20 * 997805 + s12 += s20 * 136657 + s13 -= s20 * 683901 + s20 = 0 + + s7 += s19 * 666643 + s8 += s19 * 470296 + s9 += s19 * 654183 + s10 -= s19 * 997805 + s11 += s19 * 136657 + s12 -= s19 * 683901 + s19 = 0 + + s6 += s18 * 666643 + s7 += s18 * 470296 + s8 += s18 * 654183 + s9 -= s18 * 997805 + s10 += s18 * 136657 + s11 -= s18 * 683901 + s18 = 0 + + var carry [17]int64 + + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[12] = (s12 + (1 << 20)) >> 21 + s13 += carry[12] + s12 -= carry[12] << 21 + carry[14] = (s14 + (1 << 20)) >> 21 + s15 += carry[14] + s14 -= carry[14] << 21 + carry[16] = (s16 + (1 << 20)) >> 21 + s17 += carry[16] + s16 -= carry[16] << 21 + + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + carry[13] = (s13 + (1 << 20)) >> 21 + s14 += carry[13] + s13 -= carry[13] << 21 + carry[15] = (s15 + (1 << 20)) >> 21 + s16 += carry[15] + s15 -= carry[15] << 21 + + s5 += s17 * 666643 + s6 += s17 * 470296 + s7 += s17 * 654183 + s8 -= s17 * 997805 + s9 += s17 * 136657 + s10 -= s17 * 683901 + s17 = 0 + + s4 += s16 * 666643 + s5 += s16 * 470296 + s6 += s16 * 654183 + s7 -= s16 * 997805 + s8 += s16 * 136657 + s9 -= s16 * 683901 + s16 = 0 + + s3 += s15 * 666643 + s4 += s15 * 470296 + s5 += s15 * 654183 + s6 -= s15 * 997805 + s7 += s15 * 136657 + s8 -= s15 * 683901 + s15 = 0 + + s2 += s14 * 666643 + s3 += s14 * 470296 + s4 += s14 * 654183 + s5 -= s14 * 997805 + s6 += s14 * 136657 + s7 -= s14 * 683901 + s14 = 0 + + s1 += s13 * 666643 + s2 += s13 * 470296 + s3 += s13 * 654183 + s4 -= s13 * 997805 + s5 += s13 * 136657 + s6 -= s13 * 683901 + s13 = 0 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = (s0 + (1 << 20)) >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[2] = (s2 + (1 << 20)) >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[4] = (s4 + (1 << 20)) >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[6] = (s6 + (1 << 20)) >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[8] = (s8 + (1 << 20)) >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[10] = (s10 + (1 << 20)) >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + + carry[1] = (s1 + (1 << 20)) >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[3] = (s3 + (1 << 20)) >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[5] = (s5 + (1 << 20)) >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[7] = (s7 + (1 << 20)) >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[9] = (s9 + (1 << 20)) >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[11] = (s11 + (1 << 20)) >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = s0 >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[1] = s1 >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[2] = s2 >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[3] = s3 >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[4] = s4 >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[5] = s5 >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[6] = s6 >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[7] = s7 >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[8] = s8 >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[9] = s9 >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[10] = s10 >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + carry[11] = s11 >> 21 + s12 += carry[11] + s11 -= carry[11] << 21 + + s0 += s12 * 666643 + s1 += s12 * 470296 + s2 += s12 * 654183 + s3 -= s12 * 997805 + s4 += s12 * 136657 + s5 -= s12 * 683901 + s12 = 0 + + carry[0] = s0 >> 21 + s1 += carry[0] + s0 -= carry[0] << 21 + carry[1] = s1 >> 21 + s2 += carry[1] + s1 -= carry[1] << 21 + carry[2] = s2 >> 21 + s3 += carry[2] + s2 -= carry[2] << 21 + carry[3] = s3 >> 21 + s4 += carry[3] + s3 -= carry[3] << 21 + carry[4] = s4 >> 21 + s5 += carry[4] + s4 -= carry[4] << 21 + carry[5] = s5 >> 21 + s6 += carry[5] + s5 -= carry[5] << 21 + carry[6] = s6 >> 21 + s7 += carry[6] + s6 -= carry[6] << 21 + carry[7] = s7 >> 21 + s8 += carry[7] + s7 -= carry[7] << 21 + carry[8] = s8 >> 21 + s9 += carry[8] + s8 -= carry[8] << 21 + carry[9] = s9 >> 21 + s10 += carry[9] + s9 -= carry[9] << 21 + carry[10] = s10 >> 21 + s11 += carry[10] + s10 -= carry[10] << 21 + + out[0] = byte(s0 >> 0) + out[1] = byte(s0 >> 8) + out[2] = byte((s0 >> 16) | (s1 << 5)) + out[3] = byte(s1 >> 3) + out[4] = byte(s1 >> 11) + out[5] = byte((s1 >> 19) | (s2 << 2)) + out[6] = byte(s2 >> 6) + out[7] = byte((s2 >> 14) | (s3 << 7)) + out[8] = byte(s3 >> 1) + out[9] = byte(s3 >> 9) + out[10] = byte((s3 >> 17) | (s4 << 4)) + out[11] = byte(s4 >> 4) + out[12] = byte(s4 >> 12) + out[13] = byte((s4 >> 20) | (s5 << 1)) + out[14] = byte(s5 >> 7) + out[15] = byte((s5 >> 15) | (s6 << 6)) + out[16] = byte(s6 >> 2) + out[17] = byte(s6 >> 10) + out[18] = byte((s6 >> 18) | (s7 << 3)) + out[19] = byte(s7 >> 5) + out[20] = byte(s7 >> 13) + out[21] = byte(s8 >> 0) + out[22] = byte(s8 >> 8) + out[23] = byte((s8 >> 16) | (s9 << 5)) + out[24] = byte(s9 >> 3) + out[25] = byte(s9 >> 11) + out[26] = byte((s9 >> 19) | (s10 << 2)) + out[27] = byte(s10 >> 6) + out[28] = byte((s10 >> 14) | (s11 << 7)) + out[29] = byte(s11 >> 1) + out[30] = byte(s11 >> 9) + out[31] = byte(s11 >> 17) +} + +// order is the order of Curve25519 in little-endian form. +var order = [4]uint64{0x5812631a5cf5d3ed, 0x14def9dea2f79cd6, 0, 0x1000000000000000} + +// ScMinimal returns true if the given scalar is less than the order of the +// curve. +func ScMinimal(scalar *[32]byte) bool { + for i := 3; ; i-- { + v := binary.LittleEndian.Uint64(scalar[i*8:]) + if v > order[i] { + return false + } else if v < order[i] { + break + } else if i == 0 { + return false + } + } + + return true +} diff --git a/vendor/golang.org/x/crypto/internal/chacha20/asm_arm64.s b/vendor/golang.org/x/crypto/internal/chacha20/asm_arm64.s new file mode 100644 index 0000000..b3a16ef --- /dev/null +++ b/vendor/golang.org/x/crypto/internal/chacha20/asm_arm64.s @@ -0,0 +1,308 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build go1.11 +// +build !gccgo,!appengine + +#include "textflag.h" + +#define NUM_ROUNDS 10 + +// func xorKeyStreamVX(dst, src []byte, key *[8]uint32, nonce *[3]uint32, counter *uint32) +TEXT ·xorKeyStreamVX(SB), NOSPLIT, $0 + MOVD dst+0(FP), R1 + MOVD src+24(FP), R2 + MOVD src_len+32(FP), R3 + MOVD key+48(FP), R4 + MOVD nonce+56(FP), R6 + MOVD counter+64(FP), R7 + + MOVD $·constants(SB), R10 + MOVD $·incRotMatrix(SB), R11 + + MOVW (R7), R20 + + AND $~255, R3, R13 + ADD R2, R13, R12 // R12 for block end + AND $255, R3, R13 +loop: + MOVD $NUM_ROUNDS, R21 + VLD1 (R11), [V30.S4, V31.S4] + + // load contants + // VLD4R (R10), [V0.S4, V1.S4, V2.S4, V3.S4] + WORD $0x4D60E940 + + // load keys + // VLD4R 16(R4), [V4.S4, V5.S4, V6.S4, V7.S4] + WORD $0x4DFFE884 + // VLD4R 16(R4), [V8.S4, V9.S4, V10.S4, V11.S4] + WORD $0x4DFFE888 + SUB $32, R4 + + // load counter + nonce + // VLD1R (R7), [V12.S4] + WORD $0x4D40C8EC + + // VLD3R (R6), [V13.S4, V14.S4, V15.S4] + WORD $0x4D40E8CD + + // update counter + VADD V30.S4, V12.S4, V12.S4 + +chacha: + // V0..V3 += V4..V7 + // V12..V15 <<<= ((V12..V15 XOR V0..V3), 16) + VADD V0.S4, V4.S4, V0.S4 + VADD V1.S4, V5.S4, V1.S4 + VADD V2.S4, V6.S4, V2.S4 + VADD V3.S4, V7.S4, V3.S4 + VEOR V12.B16, V0.B16, V12.B16 + VEOR V13.B16, V1.B16, V13.B16 + VEOR V14.B16, V2.B16, V14.B16 + VEOR V15.B16, V3.B16, V15.B16 + VREV32 V12.H8, V12.H8 + VREV32 V13.H8, V13.H8 + VREV32 V14.H8, V14.H8 + VREV32 V15.H8, V15.H8 + // V8..V11 += V12..V15 + // V4..V7 <<<= ((V4..V7 XOR V8..V11), 12) + VADD V8.S4, V12.S4, V8.S4 + VADD V9.S4, V13.S4, V9.S4 + VADD V10.S4, V14.S4, V10.S4 + VADD V11.S4, V15.S4, V11.S4 + VEOR V8.B16, V4.B16, V16.B16 + VEOR V9.B16, V5.B16, V17.B16 + VEOR V10.B16, V6.B16, V18.B16 + VEOR V11.B16, V7.B16, V19.B16 + VSHL $12, V16.S4, V4.S4 + VSHL $12, V17.S4, V5.S4 + VSHL $12, V18.S4, V6.S4 + VSHL $12, V19.S4, V7.S4 + VSRI $20, V16.S4, V4.S4 + VSRI $20, V17.S4, V5.S4 + VSRI $20, V18.S4, V6.S4 + VSRI $20, V19.S4, V7.S4 + + // V0..V3 += V4..V7 + // V12..V15 <<<= ((V12..V15 XOR V0..V3), 8) + VADD V0.S4, V4.S4, V0.S4 + VADD V1.S4, V5.S4, V1.S4 + VADD V2.S4, V6.S4, V2.S4 + VADD V3.S4, V7.S4, V3.S4 + VEOR V12.B16, V0.B16, V12.B16 + VEOR V13.B16, V1.B16, V13.B16 + VEOR V14.B16, V2.B16, V14.B16 + VEOR V15.B16, V3.B16, V15.B16 + VTBL V31.B16, [V12.B16], V12.B16 + VTBL V31.B16, [V13.B16], V13.B16 + VTBL V31.B16, [V14.B16], V14.B16 + VTBL V31.B16, [V15.B16], V15.B16 + + // V8..V11 += V12..V15 + // V4..V7 <<<= ((V4..V7 XOR V8..V11), 7) + VADD V12.S4, V8.S4, V8.S4 + VADD V13.S4, V9.S4, V9.S4 + VADD V14.S4, V10.S4, V10.S4 + VADD V15.S4, V11.S4, V11.S4 + VEOR V8.B16, V4.B16, V16.B16 + VEOR V9.B16, V5.B16, V17.B16 + VEOR V10.B16, V6.B16, V18.B16 + VEOR V11.B16, V7.B16, V19.B16 + VSHL $7, V16.S4, V4.S4 + VSHL $7, V17.S4, V5.S4 + VSHL $7, V18.S4, V6.S4 + VSHL $7, V19.S4, V7.S4 + VSRI $25, V16.S4, V4.S4 + VSRI $25, V17.S4, V5.S4 + VSRI $25, V18.S4, V6.S4 + VSRI $25, V19.S4, V7.S4 + + // V0..V3 += V5..V7, V4 + // V15,V12-V14 <<<= ((V15,V12-V14 XOR V0..V3), 16) + VADD V0.S4, V5.S4, V0.S4 + VADD V1.S4, V6.S4, V1.S4 + VADD V2.S4, V7.S4, V2.S4 + VADD V3.S4, V4.S4, V3.S4 + VEOR V15.B16, V0.B16, V15.B16 + VEOR V12.B16, V1.B16, V12.B16 + VEOR V13.B16, V2.B16, V13.B16 + VEOR V14.B16, V3.B16, V14.B16 + VREV32 V12.H8, V12.H8 + VREV32 V13.H8, V13.H8 + VREV32 V14.H8, V14.H8 + VREV32 V15.H8, V15.H8 + + // V10 += V15; V5 <<<= ((V10 XOR V5), 12) + // ... + VADD V15.S4, V10.S4, V10.S4 + VADD V12.S4, V11.S4, V11.S4 + VADD V13.S4, V8.S4, V8.S4 + VADD V14.S4, V9.S4, V9.S4 + VEOR V10.B16, V5.B16, V16.B16 + VEOR V11.B16, V6.B16, V17.B16 + VEOR V8.B16, V7.B16, V18.B16 + VEOR V9.B16, V4.B16, V19.B16 + VSHL $12, V16.S4, V5.S4 + VSHL $12, V17.S4, V6.S4 + VSHL $12, V18.S4, V7.S4 + VSHL $12, V19.S4, V4.S4 + VSRI $20, V16.S4, V5.S4 + VSRI $20, V17.S4, V6.S4 + VSRI $20, V18.S4, V7.S4 + VSRI $20, V19.S4, V4.S4 + + // V0 += V5; V15 <<<= ((V0 XOR V15), 8) + // ... + VADD V5.S4, V0.S4, V0.S4 + VADD V6.S4, V1.S4, V1.S4 + VADD V7.S4, V2.S4, V2.S4 + VADD V4.S4, V3.S4, V3.S4 + VEOR V0.B16, V15.B16, V15.B16 + VEOR V1.B16, V12.B16, V12.B16 + VEOR V2.B16, V13.B16, V13.B16 + VEOR V3.B16, V14.B16, V14.B16 + VTBL V31.B16, [V12.B16], V12.B16 + VTBL V31.B16, [V13.B16], V13.B16 + VTBL V31.B16, [V14.B16], V14.B16 + VTBL V31.B16, [V15.B16], V15.B16 + + // V10 += V15; V5 <<<= ((V10 XOR V5), 7) + // ... + VADD V15.S4, V10.S4, V10.S4 + VADD V12.S4, V11.S4, V11.S4 + VADD V13.S4, V8.S4, V8.S4 + VADD V14.S4, V9.S4, V9.S4 + VEOR V10.B16, V5.B16, V16.B16 + VEOR V11.B16, V6.B16, V17.B16 + VEOR V8.B16, V7.B16, V18.B16 + VEOR V9.B16, V4.B16, V19.B16 + VSHL $7, V16.S4, V5.S4 + VSHL $7, V17.S4, V6.S4 + VSHL $7, V18.S4, V7.S4 + VSHL $7, V19.S4, V4.S4 + VSRI $25, V16.S4, V5.S4 + VSRI $25, V17.S4, V6.S4 + VSRI $25, V18.S4, V7.S4 + VSRI $25, V19.S4, V4.S4 + + SUB $1, R21 + CBNZ R21, chacha + + // VLD4R (R10), [V16.S4, V17.S4, V18.S4, V19.S4] + WORD $0x4D60E950 + + // VLD4R 16(R4), [V20.S4, V21.S4, V22.S4, V23.S4] + WORD $0x4DFFE894 + VADD V30.S4, V12.S4, V12.S4 + VADD V16.S4, V0.S4, V0.S4 + VADD V17.S4, V1.S4, V1.S4 + VADD V18.S4, V2.S4, V2.S4 + VADD V19.S4, V3.S4, V3.S4 + // VLD4R 16(R4), [V24.S4, V25.S4, V26.S4, V27.S4] + WORD $0x4DFFE898 + // restore R4 + SUB $32, R4 + + // load counter + nonce + // VLD1R (R7), [V28.S4] + WORD $0x4D40C8FC + // VLD3R (R6), [V29.S4, V30.S4, V31.S4] + WORD $0x4D40E8DD + + VADD V20.S4, V4.S4, V4.S4 + VADD V21.S4, V5.S4, V5.S4 + VADD V22.S4, V6.S4, V6.S4 + VADD V23.S4, V7.S4, V7.S4 + VADD V24.S4, V8.S4, V8.S4 + VADD V25.S4, V9.S4, V9.S4 + VADD V26.S4, V10.S4, V10.S4 + VADD V27.S4, V11.S4, V11.S4 + VADD V28.S4, V12.S4, V12.S4 + VADD V29.S4, V13.S4, V13.S4 + VADD V30.S4, V14.S4, V14.S4 + VADD V31.S4, V15.S4, V15.S4 + + VZIP1 V1.S4, V0.S4, V16.S4 + VZIP2 V1.S4, V0.S4, V17.S4 + VZIP1 V3.S4, V2.S4, V18.S4 + VZIP2 V3.S4, V2.S4, V19.S4 + VZIP1 V5.S4, V4.S4, V20.S4 + VZIP2 V5.S4, V4.S4, V21.S4 + VZIP1 V7.S4, V6.S4, V22.S4 + VZIP2 V7.S4, V6.S4, V23.S4 + VZIP1 V9.S4, V8.S4, V24.S4 + VZIP2 V9.S4, V8.S4, V25.S4 + VZIP1 V11.S4, V10.S4, V26.S4 + VZIP2 V11.S4, V10.S4, V27.S4 + VZIP1 V13.S4, V12.S4, V28.S4 + VZIP2 V13.S4, V12.S4, V29.S4 + VZIP1 V15.S4, V14.S4, V30.S4 + VZIP2 V15.S4, V14.S4, V31.S4 + VZIP1 V18.D2, V16.D2, V0.D2 + VZIP2 V18.D2, V16.D2, V4.D2 + VZIP1 V19.D2, V17.D2, V8.D2 + VZIP2 V19.D2, V17.D2, V12.D2 + VLD1.P 64(R2), [V16.B16, V17.B16, V18.B16, V19.B16] + + VZIP1 V22.D2, V20.D2, V1.D2 + VZIP2 V22.D2, V20.D2, V5.D2 + VZIP1 V23.D2, V21.D2, V9.D2 + VZIP2 V23.D2, V21.D2, V13.D2 + VLD1.P 64(R2), [V20.B16, V21.B16, V22.B16, V23.B16] + VZIP1 V26.D2, V24.D2, V2.D2 + VZIP2 V26.D2, V24.D2, V6.D2 + VZIP1 V27.D2, V25.D2, V10.D2 + VZIP2 V27.D2, V25.D2, V14.D2 + VLD1.P 64(R2), [V24.B16, V25.B16, V26.B16, V27.B16] + VZIP1 V30.D2, V28.D2, V3.D2 + VZIP2 V30.D2, V28.D2, V7.D2 + VZIP1 V31.D2, V29.D2, V11.D2 + VZIP2 V31.D2, V29.D2, V15.D2 + VLD1.P 64(R2), [V28.B16, V29.B16, V30.B16, V31.B16] + VEOR V0.B16, V16.B16, V16.B16 + VEOR V1.B16, V17.B16, V17.B16 + VEOR V2.B16, V18.B16, V18.B16 + VEOR V3.B16, V19.B16, V19.B16 + VST1.P [V16.B16, V17.B16, V18.B16, V19.B16], 64(R1) + VEOR V4.B16, V20.B16, V20.B16 + VEOR V5.B16, V21.B16, V21.B16 + VEOR V6.B16, V22.B16, V22.B16 + VEOR V7.B16, V23.B16, V23.B16 + VST1.P [V20.B16, V21.B16, V22.B16, V23.B16], 64(R1) + VEOR V8.B16, V24.B16, V24.B16 + VEOR V9.B16, V25.B16, V25.B16 + VEOR V10.B16, V26.B16, V26.B16 + VEOR V11.B16, V27.B16, V27.B16 + VST1.P [V24.B16, V25.B16, V26.B16, V27.B16], 64(R1) + VEOR V12.B16, V28.B16, V28.B16 + VEOR V13.B16, V29.B16, V29.B16 + VEOR V14.B16, V30.B16, V30.B16 + VEOR V15.B16, V31.B16, V31.B16 + VST1.P [V28.B16, V29.B16, V30.B16, V31.B16], 64(R1) + + ADD $4, R20 + MOVW R20, (R7) // update counter + + CMP R2, R12 + BGT loop + + RET + + +DATA ·constants+0x00(SB)/4, $0x61707865 +DATA ·constants+0x04(SB)/4, $0x3320646e +DATA ·constants+0x08(SB)/4, $0x79622d32 +DATA ·constants+0x0c(SB)/4, $0x6b206574 +GLOBL ·constants(SB), NOPTR|RODATA, $32 + +DATA ·incRotMatrix+0x00(SB)/4, $0x00000000 +DATA ·incRotMatrix+0x04(SB)/4, $0x00000001 +DATA ·incRotMatrix+0x08(SB)/4, $0x00000002 +DATA ·incRotMatrix+0x0c(SB)/4, $0x00000003 +DATA ·incRotMatrix+0x10(SB)/4, $0x02010003 +DATA ·incRotMatrix+0x14(SB)/4, $0x06050407 +DATA ·incRotMatrix+0x18(SB)/4, $0x0A09080B +DATA ·incRotMatrix+0x1c(SB)/4, $0x0E0D0C0F +GLOBL ·incRotMatrix(SB), NOPTR|RODATA, $32 diff --git a/vendor/golang.org/x/crypto/internal/chacha20/chacha_arm64.go b/vendor/golang.org/x/crypto/internal/chacha20/chacha_arm64.go new file mode 100644 index 0000000..ad74e23 --- /dev/null +++ b/vendor/golang.org/x/crypto/internal/chacha20/chacha_arm64.go @@ -0,0 +1,31 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build go1.11 +// +build !gccgo + +package chacha20 + +const ( + haveAsm = true + bufSize = 256 +) + +//go:noescape +func xorKeyStreamVX(dst, src []byte, key *[8]uint32, nonce *[3]uint32, counter *uint32) + +func (c *Cipher) xorKeyStreamAsm(dst, src []byte) { + + if len(src) >= bufSize { + xorKeyStreamVX(dst, src, &c.key, &c.nonce, &c.counter) + } + + if len(src)%bufSize != 0 { + i := len(src) - len(src)%bufSize + c.buf = [bufSize]byte{} + copy(c.buf[:], src[i:]) + xorKeyStreamVX(c.buf[:], c.buf[:], &c.key, &c.nonce, &c.counter) + c.len = bufSize - copy(dst[i:], c.buf[:len(src)%bufSize]) + } +} diff --git a/vendor/golang.org/x/crypto/internal/chacha20/chacha_generic.go b/vendor/golang.org/x/crypto/internal/chacha20/chacha_generic.go new file mode 100644 index 0000000..6570847 --- /dev/null +++ b/vendor/golang.org/x/crypto/internal/chacha20/chacha_generic.go @@ -0,0 +1,264 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package ChaCha20 implements the core ChaCha20 function as specified +// in https://tools.ietf.org/html/rfc7539#section-2.3. +package chacha20 + +import ( + "crypto/cipher" + "encoding/binary" + + "golang.org/x/crypto/internal/subtle" +) + +// assert that *Cipher implements cipher.Stream +var _ cipher.Stream = (*Cipher)(nil) + +// Cipher is a stateful instance of ChaCha20 using a particular key +// and nonce. A *Cipher implements the cipher.Stream interface. +type Cipher struct { + key [8]uint32 + counter uint32 // incremented after each block + nonce [3]uint32 + buf [bufSize]byte // buffer for unused keystream bytes + len int // number of unused keystream bytes at end of buf +} + +// New creates a new ChaCha20 stream cipher with the given key and nonce. +// The initial counter value is set to 0. +func New(key [8]uint32, nonce [3]uint32) *Cipher { + return &Cipher{key: key, nonce: nonce} +} + +// ChaCha20 constants spelling "expand 32-byte k" +const ( + j0 uint32 = 0x61707865 + j1 uint32 = 0x3320646e + j2 uint32 = 0x79622d32 + j3 uint32 = 0x6b206574 +) + +func quarterRound(a, b, c, d uint32) (uint32, uint32, uint32, uint32) { + a += b + d ^= a + d = (d << 16) | (d >> 16) + c += d + b ^= c + b = (b << 12) | (b >> 20) + a += b + d ^= a + d = (d << 8) | (d >> 24) + c += d + b ^= c + b = (b << 7) | (b >> 25) + return a, b, c, d +} + +// XORKeyStream XORs each byte in the given slice with a byte from the +// cipher's key stream. Dst and src must overlap entirely or not at all. +// +// If len(dst) < len(src), XORKeyStream will panic. It is acceptable +// to pass a dst bigger than src, and in that case, XORKeyStream will +// only update dst[:len(src)] and will not touch the rest of dst. +// +// Multiple calls to XORKeyStream behave as if the concatenation of +// the src buffers was passed in a single run. That is, Cipher +// maintains state and does not reset at each XORKeyStream call. +func (s *Cipher) XORKeyStream(dst, src []byte) { + if len(dst) < len(src) { + panic("chacha20: output smaller than input") + } + if subtle.InexactOverlap(dst[:len(src)], src) { + panic("chacha20: invalid buffer overlap") + } + + // xor src with buffered keystream first + if s.len != 0 { + buf := s.buf[len(s.buf)-s.len:] + if len(src) < len(buf) { + buf = buf[:len(src)] + } + td, ts := dst[:len(buf)], src[:len(buf)] // BCE hint + for i, b := range buf { + td[i] = ts[i] ^ b + } + s.len -= len(buf) + if s.len != 0 { + return + } + s.buf = [len(s.buf)]byte{} // zero the empty buffer + src = src[len(buf):] + dst = dst[len(buf):] + } + + if len(src) == 0 { + return + } + if haveAsm { + if uint64(len(src))+uint64(s.counter)*64 > (1<<38)-64 { + panic("chacha20: counter overflow") + } + s.xorKeyStreamAsm(dst, src) + return + } + + // set up a 64-byte buffer to pad out the final block if needed + // (hoisted out of the main loop to avoid spills) + rem := len(src) % 64 // length of final block + fin := len(src) - rem // index of final block + if rem > 0 { + copy(s.buf[len(s.buf)-64:], src[fin:]) + } + + // pre-calculate most of the first round + s1, s5, s9, s13 := quarterRound(j1, s.key[1], s.key[5], s.nonce[0]) + s2, s6, s10, s14 := quarterRound(j2, s.key[2], s.key[6], s.nonce[1]) + s3, s7, s11, s15 := quarterRound(j3, s.key[3], s.key[7], s.nonce[2]) + + n := len(src) + src, dst = src[:n:n], dst[:n:n] // BCE hint + for i := 0; i < n; i += 64 { + // calculate the remainder of the first round + s0, s4, s8, s12 := quarterRound(j0, s.key[0], s.key[4], s.counter) + + // execute the second round + x0, x5, x10, x15 := quarterRound(s0, s5, s10, s15) + x1, x6, x11, x12 := quarterRound(s1, s6, s11, s12) + x2, x7, x8, x13 := quarterRound(s2, s7, s8, s13) + x3, x4, x9, x14 := quarterRound(s3, s4, s9, s14) + + // execute the remaining 18 rounds + for i := 0; i < 9; i++ { + x0, x4, x8, x12 = quarterRound(x0, x4, x8, x12) + x1, x5, x9, x13 = quarterRound(x1, x5, x9, x13) + x2, x6, x10, x14 = quarterRound(x2, x6, x10, x14) + x3, x7, x11, x15 = quarterRound(x3, x7, x11, x15) + + x0, x5, x10, x15 = quarterRound(x0, x5, x10, x15) + x1, x6, x11, x12 = quarterRound(x1, x6, x11, x12) + x2, x7, x8, x13 = quarterRound(x2, x7, x8, x13) + x3, x4, x9, x14 = quarterRound(x3, x4, x9, x14) + } + + x0 += j0 + x1 += j1 + x2 += j2 + x3 += j3 + + x4 += s.key[0] + x5 += s.key[1] + x6 += s.key[2] + x7 += s.key[3] + x8 += s.key[4] + x9 += s.key[5] + x10 += s.key[6] + x11 += s.key[7] + + x12 += s.counter + x13 += s.nonce[0] + x14 += s.nonce[1] + x15 += s.nonce[2] + + // increment the counter + s.counter += 1 + if s.counter == 0 { + panic("chacha20: counter overflow") + } + + // pad to 64 bytes if needed + in, out := src[i:], dst[i:] + if i == fin { + // src[fin:] has already been copied into s.buf before + // the main loop + in, out = s.buf[len(s.buf)-64:], s.buf[len(s.buf)-64:] + } + in, out = in[:64], out[:64] // BCE hint + + // XOR the key stream with the source and write out the result + xor(out[0:], in[0:], x0) + xor(out[4:], in[4:], x1) + xor(out[8:], in[8:], x2) + xor(out[12:], in[12:], x3) + xor(out[16:], in[16:], x4) + xor(out[20:], in[20:], x5) + xor(out[24:], in[24:], x6) + xor(out[28:], in[28:], x7) + xor(out[32:], in[32:], x8) + xor(out[36:], in[36:], x9) + xor(out[40:], in[40:], x10) + xor(out[44:], in[44:], x11) + xor(out[48:], in[48:], x12) + xor(out[52:], in[52:], x13) + xor(out[56:], in[56:], x14) + xor(out[60:], in[60:], x15) + } + // copy any trailing bytes out of the buffer and into dst + if rem != 0 { + s.len = 64 - rem + copy(dst[fin:], s.buf[len(s.buf)-64:]) + } +} + +// Advance discards bytes in the key stream until the next 64 byte block +// boundary is reached and updates the counter accordingly. If the key +// stream is already at a block boundary no bytes will be discarded and +// the counter will be unchanged. +func (s *Cipher) Advance() { + s.len -= s.len % 64 + if s.len == 0 { + s.buf = [len(s.buf)]byte{} + } +} + +// XORKeyStream crypts bytes from in to out using the given key and counters. +// In and out must overlap entirely or not at all. Counter contains the raw +// ChaCha20 counter bytes (i.e. block counter followed by nonce). +func XORKeyStream(out, in []byte, counter *[16]byte, key *[32]byte) { + s := Cipher{ + key: [8]uint32{ + binary.LittleEndian.Uint32(key[0:4]), + binary.LittleEndian.Uint32(key[4:8]), + binary.LittleEndian.Uint32(key[8:12]), + binary.LittleEndian.Uint32(key[12:16]), + binary.LittleEndian.Uint32(key[16:20]), + binary.LittleEndian.Uint32(key[20:24]), + binary.LittleEndian.Uint32(key[24:28]), + binary.LittleEndian.Uint32(key[28:32]), + }, + nonce: [3]uint32{ + binary.LittleEndian.Uint32(counter[4:8]), + binary.LittleEndian.Uint32(counter[8:12]), + binary.LittleEndian.Uint32(counter[12:16]), + }, + counter: binary.LittleEndian.Uint32(counter[0:4]), + } + s.XORKeyStream(out, in) +} + +// HChaCha20 uses the ChaCha20 core to generate a derived key from a key and a +// nonce. It should only be used as part of the XChaCha20 construction. +func HChaCha20(key *[8]uint32, nonce *[4]uint32) [8]uint32 { + x0, x1, x2, x3 := j0, j1, j2, j3 + x4, x5, x6, x7 := key[0], key[1], key[2], key[3] + x8, x9, x10, x11 := key[4], key[5], key[6], key[7] + x12, x13, x14, x15 := nonce[0], nonce[1], nonce[2], nonce[3] + + for i := 0; i < 10; i++ { + x0, x4, x8, x12 = quarterRound(x0, x4, x8, x12) + x1, x5, x9, x13 = quarterRound(x1, x5, x9, x13) + x2, x6, x10, x14 = quarterRound(x2, x6, x10, x14) + x3, x7, x11, x15 = quarterRound(x3, x7, x11, x15) + + x0, x5, x10, x15 = quarterRound(x0, x5, x10, x15) + x1, x6, x11, x12 = quarterRound(x1, x6, x11, x12) + x2, x7, x8, x13 = quarterRound(x2, x7, x8, x13) + x3, x4, x9, x14 = quarterRound(x3, x4, x9, x14) + } + + var out [8]uint32 + out[0], out[1], out[2], out[3] = x0, x1, x2, x3 + out[4], out[5], out[6], out[7] = x12, x13, x14, x15 + return out +} diff --git a/vendor/golang.org/x/crypto/internal/chacha20/chacha_noasm.go b/vendor/golang.org/x/crypto/internal/chacha20/chacha_noasm.go new file mode 100644 index 0000000..47eac03 --- /dev/null +++ b/vendor/golang.org/x/crypto/internal/chacha20/chacha_noasm.go @@ -0,0 +1,16 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build !arm64,!s390x arm64,!go1.11 gccgo appengine + +package chacha20 + +const ( + bufSize = 64 + haveAsm = false +) + +func (*Cipher) xorKeyStreamAsm(dst, src []byte) { + panic("not implemented") +} diff --git a/vendor/golang.org/x/crypto/internal/chacha20/chacha_s390x.go b/vendor/golang.org/x/crypto/internal/chacha20/chacha_s390x.go new file mode 100644 index 0000000..aad645b --- /dev/null +++ b/vendor/golang.org/x/crypto/internal/chacha20/chacha_s390x.go @@ -0,0 +1,29 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build s390x,!gccgo,!appengine + +package chacha20 + +import ( + "golang.org/x/sys/cpu" +) + +var haveAsm = cpu.S390X.HasVX + +const bufSize = 256 + +// xorKeyStreamVX is an assembly implementation of XORKeyStream. It must only +// be called when the vector facility is available. +// Implementation in asm_s390x.s. +//go:noescape +func xorKeyStreamVX(dst, src []byte, key *[8]uint32, nonce *[3]uint32, counter *uint32, buf *[256]byte, len *int) + +func (c *Cipher) xorKeyStreamAsm(dst, src []byte) { + xorKeyStreamVX(dst, src, &c.key, &c.nonce, &c.counter, &c.buf, &c.len) +} + +// EXRL targets, DO NOT CALL! +func mvcSrcToBuf() +func mvcBufToDst() diff --git a/vendor/golang.org/x/crypto/internal/chacha20/chacha_s390x.s b/vendor/golang.org/x/crypto/internal/chacha20/chacha_s390x.s new file mode 100644 index 0000000..57df404 --- /dev/null +++ b/vendor/golang.org/x/crypto/internal/chacha20/chacha_s390x.s @@ -0,0 +1,260 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build s390x,!gccgo,!appengine + +#include "go_asm.h" +#include "textflag.h" + +// This is an implementation of the ChaCha20 encryption algorithm as +// specified in RFC 7539. It uses vector instructions to compute +// 4 keystream blocks in parallel (256 bytes) which are then XORed +// with the bytes in the input slice. + +GLOBL ·constants<>(SB), RODATA|NOPTR, $32 +// BSWAP: swap bytes in each 4-byte element +DATA ·constants<>+0x00(SB)/4, $0x03020100 +DATA ·constants<>+0x04(SB)/4, $0x07060504 +DATA ·constants<>+0x08(SB)/4, $0x0b0a0908 +DATA ·constants<>+0x0c(SB)/4, $0x0f0e0d0c +// J0: [j0, j1, j2, j3] +DATA ·constants<>+0x10(SB)/4, $0x61707865 +DATA ·constants<>+0x14(SB)/4, $0x3320646e +DATA ·constants<>+0x18(SB)/4, $0x79622d32 +DATA ·constants<>+0x1c(SB)/4, $0x6b206574 + +// EXRL targets: +TEXT ·mvcSrcToBuf(SB), NOFRAME|NOSPLIT, $0 + MVC $1, (R1), (R8) + RET + +TEXT ·mvcBufToDst(SB), NOFRAME|NOSPLIT, $0 + MVC $1, (R8), (R9) + RET + +#define BSWAP V5 +#define J0 V6 +#define KEY0 V7 +#define KEY1 V8 +#define NONCE V9 +#define CTR V10 +#define M0 V11 +#define M1 V12 +#define M2 V13 +#define M3 V14 +#define INC V15 +#define X0 V16 +#define X1 V17 +#define X2 V18 +#define X3 V19 +#define X4 V20 +#define X5 V21 +#define X6 V22 +#define X7 V23 +#define X8 V24 +#define X9 V25 +#define X10 V26 +#define X11 V27 +#define X12 V28 +#define X13 V29 +#define X14 V30 +#define X15 V31 + +#define NUM_ROUNDS 20 + +#define ROUND4(a0, a1, a2, a3, b0, b1, b2, b3, c0, c1, c2, c3, d0, d1, d2, d3) \ + VAF a1, a0, a0 \ + VAF b1, b0, b0 \ + VAF c1, c0, c0 \ + VAF d1, d0, d0 \ + VX a0, a2, a2 \ + VX b0, b2, b2 \ + VX c0, c2, c2 \ + VX d0, d2, d2 \ + VERLLF $16, a2, a2 \ + VERLLF $16, b2, b2 \ + VERLLF $16, c2, c2 \ + VERLLF $16, d2, d2 \ + VAF a2, a3, a3 \ + VAF b2, b3, b3 \ + VAF c2, c3, c3 \ + VAF d2, d3, d3 \ + VX a3, a1, a1 \ + VX b3, b1, b1 \ + VX c3, c1, c1 \ + VX d3, d1, d1 \ + VERLLF $12, a1, a1 \ + VERLLF $12, b1, b1 \ + VERLLF $12, c1, c1 \ + VERLLF $12, d1, d1 \ + VAF a1, a0, a0 \ + VAF b1, b0, b0 \ + VAF c1, c0, c0 \ + VAF d1, d0, d0 \ + VX a0, a2, a2 \ + VX b0, b2, b2 \ + VX c0, c2, c2 \ + VX d0, d2, d2 \ + VERLLF $8, a2, a2 \ + VERLLF $8, b2, b2 \ + VERLLF $8, c2, c2 \ + VERLLF $8, d2, d2 \ + VAF a2, a3, a3 \ + VAF b2, b3, b3 \ + VAF c2, c3, c3 \ + VAF d2, d3, d3 \ + VX a3, a1, a1 \ + VX b3, b1, b1 \ + VX c3, c1, c1 \ + VX d3, d1, d1 \ + VERLLF $7, a1, a1 \ + VERLLF $7, b1, b1 \ + VERLLF $7, c1, c1 \ + VERLLF $7, d1, d1 + +#define PERMUTE(mask, v0, v1, v2, v3) \ + VPERM v0, v0, mask, v0 \ + VPERM v1, v1, mask, v1 \ + VPERM v2, v2, mask, v2 \ + VPERM v3, v3, mask, v3 + +#define ADDV(x, v0, v1, v2, v3) \ + VAF x, v0, v0 \ + VAF x, v1, v1 \ + VAF x, v2, v2 \ + VAF x, v3, v3 + +#define XORV(off, dst, src, v0, v1, v2, v3) \ + VLM off(src), M0, M3 \ + PERMUTE(BSWAP, v0, v1, v2, v3) \ + VX v0, M0, M0 \ + VX v1, M1, M1 \ + VX v2, M2, M2 \ + VX v3, M3, M3 \ + VSTM M0, M3, off(dst) + +#define SHUFFLE(a, b, c, d, t, u, v, w) \ + VMRHF a, c, t \ // t = {a[0], c[0], a[1], c[1]} + VMRHF b, d, u \ // u = {b[0], d[0], b[1], d[1]} + VMRLF a, c, v \ // v = {a[2], c[2], a[3], c[3]} + VMRLF b, d, w \ // w = {b[2], d[2], b[3], d[3]} + VMRHF t, u, a \ // a = {a[0], b[0], c[0], d[0]} + VMRLF t, u, b \ // b = {a[1], b[1], c[1], d[1]} + VMRHF v, w, c \ // c = {a[2], b[2], c[2], d[2]} + VMRLF v, w, d // d = {a[3], b[3], c[3], d[3]} + +// func xorKeyStreamVX(dst, src []byte, key *[8]uint32, nonce *[3]uint32, counter *uint32, buf *[256]byte, len *int) +TEXT ·xorKeyStreamVX(SB), NOSPLIT, $0 + MOVD $·constants<>(SB), R1 + MOVD dst+0(FP), R2 // R2=&dst[0] + LMG src+24(FP), R3, R4 // R3=&src[0] R4=len(src) + MOVD key+48(FP), R5 // R5=key + MOVD nonce+56(FP), R6 // R6=nonce + MOVD counter+64(FP), R7 // R7=counter + MOVD buf+72(FP), R8 // R8=buf + MOVD len+80(FP), R9 // R9=len + + // load BSWAP and J0 + VLM (R1), BSWAP, J0 + + // set up tail buffer + ADD $-1, R4, R12 + MOVBZ R12, R12 + CMPUBEQ R12, $255, aligned + MOVD R4, R1 + AND $~255, R1 + MOVD $(R3)(R1*1), R1 + EXRL $·mvcSrcToBuf(SB), R12 + MOVD $255, R0 + SUB R12, R0 + MOVD R0, (R9) // update len + +aligned: + // setup + MOVD $95, R0 + VLM (R5), KEY0, KEY1 + VLL R0, (R6), NONCE + VZERO M0 + VLEIB $7, $32, M0 + VSRLB M0, NONCE, NONCE + + // initialize counter values + VLREPF (R7), CTR + VZERO INC + VLEIF $1, $1, INC + VLEIF $2, $2, INC + VLEIF $3, $3, INC + VAF INC, CTR, CTR + VREPIF $4, INC + +chacha: + VREPF $0, J0, X0 + VREPF $1, J0, X1 + VREPF $2, J0, X2 + VREPF $3, J0, X3 + VREPF $0, KEY0, X4 + VREPF $1, KEY0, X5 + VREPF $2, KEY0, X6 + VREPF $3, KEY0, X7 + VREPF $0, KEY1, X8 + VREPF $1, KEY1, X9 + VREPF $2, KEY1, X10 + VREPF $3, KEY1, X11 + VLR CTR, X12 + VREPF $1, NONCE, X13 + VREPF $2, NONCE, X14 + VREPF $3, NONCE, X15 + + MOVD $(NUM_ROUNDS/2), R1 + +loop: + ROUND4(X0, X4, X12, X8, X1, X5, X13, X9, X2, X6, X14, X10, X3, X7, X15, X11) + ROUND4(X0, X5, X15, X10, X1, X6, X12, X11, X2, X7, X13, X8, X3, X4, X14, X9) + + ADD $-1, R1 + BNE loop + + // decrement length + ADD $-256, R4 + BLT tail + +continue: + // rearrange vectors + SHUFFLE(X0, X1, X2, X3, M0, M1, M2, M3) + ADDV(J0, X0, X1, X2, X3) + SHUFFLE(X4, X5, X6, X7, M0, M1, M2, M3) + ADDV(KEY0, X4, X5, X6, X7) + SHUFFLE(X8, X9, X10, X11, M0, M1, M2, M3) + ADDV(KEY1, X8, X9, X10, X11) + VAF CTR, X12, X12 + SHUFFLE(X12, X13, X14, X15, M0, M1, M2, M3) + ADDV(NONCE, X12, X13, X14, X15) + + // increment counters + VAF INC, CTR, CTR + + // xor keystream with plaintext + XORV(0*64, R2, R3, X0, X4, X8, X12) + XORV(1*64, R2, R3, X1, X5, X9, X13) + XORV(2*64, R2, R3, X2, X6, X10, X14) + XORV(3*64, R2, R3, X3, X7, X11, X15) + + // increment pointers + MOVD $256(R2), R2 + MOVD $256(R3), R3 + + CMPBNE R4, $0, chacha + CMPUBEQ R12, $255, return + EXRL $·mvcBufToDst(SB), R12 // len was updated during setup + +return: + VSTEF $0, CTR, (R7) + RET + +tail: + MOVD R2, R9 + MOVD R8, R2 + MOVD R8, R3 + MOVD $0, R4 + JMP continue diff --git a/vendor/golang.org/x/crypto/internal/chacha20/xor.go b/vendor/golang.org/x/crypto/internal/chacha20/xor.go new file mode 100644 index 0000000..9c5ba0b --- /dev/null +++ b/vendor/golang.org/x/crypto/internal/chacha20/xor.go @@ -0,0 +1,43 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found src the LICENSE file. + +package chacha20 + +import ( + "runtime" +) + +// Platforms that have fast unaligned 32-bit little endian accesses. +const unaligned = runtime.GOARCH == "386" || + runtime.GOARCH == "amd64" || + runtime.GOARCH == "arm64" || + runtime.GOARCH == "ppc64le" || + runtime.GOARCH == "s390x" + +// xor reads a little endian uint32 from src, XORs it with u and +// places the result in little endian byte order in dst. +func xor(dst, src []byte, u uint32) { + _, _ = src[3], dst[3] // eliminate bounds checks + if unaligned { + // The compiler should optimize this code into + // 32-bit unaligned little endian loads and stores. + // TODO: delete once the compiler does a reliably + // good job with the generic code below. + // See issue #25111 for more details. + v := uint32(src[0]) + v |= uint32(src[1]) << 8 + v |= uint32(src[2]) << 16 + v |= uint32(src[3]) << 24 + v ^= u + dst[0] = byte(v) + dst[1] = byte(v >> 8) + dst[2] = byte(v >> 16) + dst[3] = byte(v >> 24) + } else { + dst[0] = src[0] ^ byte(u) + dst[1] = src[1] ^ byte(u>>8) + dst[2] = src[2] ^ byte(u>>16) + dst[3] = src[3] ^ byte(u>>24) + } +} diff --git a/vendor/golang.org/x/crypto/internal/subtle/aliasing.go b/vendor/golang.org/x/crypto/internal/subtle/aliasing.go new file mode 100644 index 0000000..f38797b --- /dev/null +++ b/vendor/golang.org/x/crypto/internal/subtle/aliasing.go @@ -0,0 +1,32 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build !appengine + +// Package subtle implements functions that are often useful in cryptographic +// code but require careful thought to use correctly. +package subtle // import "golang.org/x/crypto/internal/subtle" + +import "unsafe" + +// AnyOverlap reports whether x and y share memory at any (not necessarily +// corresponding) index. The memory beyond the slice length is ignored. +func AnyOverlap(x, y []byte) bool { + return len(x) > 0 && len(y) > 0 && + uintptr(unsafe.Pointer(&x[0])) <= uintptr(unsafe.Pointer(&y[len(y)-1])) && + uintptr(unsafe.Pointer(&y[0])) <= uintptr(unsafe.Pointer(&x[len(x)-1])) +} + +// InexactOverlap reports whether x and y share memory at any non-corresponding +// index. The memory beyond the slice length is ignored. Note that x and y can +// have different lengths and still not have any inexact overlap. +// +// InexactOverlap can be used to implement the requirements of the crypto/cipher +// AEAD, Block, BlockMode and Stream interfaces. +func InexactOverlap(x, y []byte) bool { + if len(x) == 0 || len(y) == 0 || &x[0] == &y[0] { + return false + } + return AnyOverlap(x, y) +} diff --git a/vendor/golang.org/x/crypto/internal/subtle/aliasing_appengine.go b/vendor/golang.org/x/crypto/internal/subtle/aliasing_appengine.go new file mode 100644 index 0000000..0cc4a8a --- /dev/null +++ b/vendor/golang.org/x/crypto/internal/subtle/aliasing_appengine.go @@ -0,0 +1,35 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build appengine + +// Package subtle implements functions that are often useful in cryptographic +// code but require careful thought to use correctly. +package subtle // import "golang.org/x/crypto/internal/subtle" + +// This is the Google App Engine standard variant based on reflect +// because the unsafe package and cgo are disallowed. + +import "reflect" + +// AnyOverlap reports whether x and y share memory at any (not necessarily +// corresponding) index. The memory beyond the slice length is ignored. +func AnyOverlap(x, y []byte) bool { + return len(x) > 0 && len(y) > 0 && + reflect.ValueOf(&x[0]).Pointer() <= reflect.ValueOf(&y[len(y)-1]).Pointer() && + reflect.ValueOf(&y[0]).Pointer() <= reflect.ValueOf(&x[len(x)-1]).Pointer() +} + +// InexactOverlap reports whether x and y share memory at any non-corresponding +// index. The memory beyond the slice length is ignored. Note that x and y can +// have different lengths and still not have any inexact overlap. +// +// InexactOverlap can be used to implement the requirements of the crypto/cipher +// AEAD, Block, BlockMode and Stream interfaces. +func InexactOverlap(x, y []byte) bool { + if len(x) == 0 || len(y) == 0 || &x[0] == &y[0] { + return false + } + return AnyOverlap(x, y) +} diff --git a/vendor/golang.org/x/crypto/poly1305/poly1305.go b/vendor/golang.org/x/crypto/poly1305/poly1305.go new file mode 100644 index 0000000..f562fa5 --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/poly1305.go @@ -0,0 +1,33 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +/* +Package poly1305 implements Poly1305 one-time message authentication code as +specified in https://cr.yp.to/mac/poly1305-20050329.pdf. + +Poly1305 is a fast, one-time authentication function. It is infeasible for an +attacker to generate an authenticator for a message without the key. However, a +key must only be used for a single message. Authenticating two different +messages with the same key allows an attacker to forge authenticators for other +messages with the same key. + +Poly1305 was originally coupled with AES in order to make Poly1305-AES. AES was +used with a fixed key in order to generate one-time keys from an nonce. +However, in this package AES isn't used and the one-time key is specified +directly. +*/ +package poly1305 // import "golang.org/x/crypto/poly1305" + +import "crypto/subtle" + +// TagSize is the size, in bytes, of a poly1305 authenticator. +const TagSize = 16 + +// Verify returns true if mac is a valid authenticator for m with the given +// key. +func Verify(mac *[16]byte, m []byte, key *[32]byte) bool { + var tmp [16]byte + Sum(&tmp, m, key) + return subtle.ConstantTimeCompare(tmp[:], mac[:]) == 1 +} diff --git a/vendor/golang.org/x/crypto/poly1305/sum_amd64.go b/vendor/golang.org/x/crypto/poly1305/sum_amd64.go new file mode 100644 index 0000000..4dd72fe --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/sum_amd64.go @@ -0,0 +1,22 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build amd64,!gccgo,!appengine + +package poly1305 + +// This function is implemented in sum_amd64.s +//go:noescape +func poly1305(out *[16]byte, m *byte, mlen uint64, key *[32]byte) + +// Sum generates an authenticator for m using a one-time key and puts the +// 16-byte result into out. Authenticating two different messages with the same +// key allows an attacker to forge messages at will. +func Sum(out *[16]byte, m []byte, key *[32]byte) { + var mPtr *byte + if len(m) > 0 { + mPtr = &m[0] + } + poly1305(out, mPtr, uint64(len(m)), key) +} diff --git a/vendor/golang.org/x/crypto/poly1305/sum_amd64.s b/vendor/golang.org/x/crypto/poly1305/sum_amd64.s new file mode 100644 index 0000000..2edae63 --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/sum_amd64.s @@ -0,0 +1,125 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build amd64,!gccgo,!appengine + +#include "textflag.h" + +#define POLY1305_ADD(msg, h0, h1, h2) \ + ADDQ 0(msg), h0; \ + ADCQ 8(msg), h1; \ + ADCQ $1, h2; \ + LEAQ 16(msg), msg + +#define POLY1305_MUL(h0, h1, h2, r0, r1, t0, t1, t2, t3) \ + MOVQ r0, AX; \ + MULQ h0; \ + MOVQ AX, t0; \ + MOVQ DX, t1; \ + MOVQ r0, AX; \ + MULQ h1; \ + ADDQ AX, t1; \ + ADCQ $0, DX; \ + MOVQ r0, t2; \ + IMULQ h2, t2; \ + ADDQ DX, t2; \ + \ + MOVQ r1, AX; \ + MULQ h0; \ + ADDQ AX, t1; \ + ADCQ $0, DX; \ + MOVQ DX, h0; \ + MOVQ r1, t3; \ + IMULQ h2, t3; \ + MOVQ r1, AX; \ + MULQ h1; \ + ADDQ AX, t2; \ + ADCQ DX, t3; \ + ADDQ h0, t2; \ + ADCQ $0, t3; \ + \ + MOVQ t0, h0; \ + MOVQ t1, h1; \ + MOVQ t2, h2; \ + ANDQ $3, h2; \ + MOVQ t2, t0; \ + ANDQ $0xFFFFFFFFFFFFFFFC, t0; \ + ADDQ t0, h0; \ + ADCQ t3, h1; \ + ADCQ $0, h2; \ + SHRQ $2, t3, t2; \ + SHRQ $2, t3; \ + ADDQ t2, h0; \ + ADCQ t3, h1; \ + ADCQ $0, h2 + +DATA ·poly1305Mask<>+0x00(SB)/8, $0x0FFFFFFC0FFFFFFF +DATA ·poly1305Mask<>+0x08(SB)/8, $0x0FFFFFFC0FFFFFFC +GLOBL ·poly1305Mask<>(SB), RODATA, $16 + +// func poly1305(out *[16]byte, m *byte, mlen uint64, key *[32]key) +TEXT ·poly1305(SB), $0-32 + MOVQ out+0(FP), DI + MOVQ m+8(FP), SI + MOVQ mlen+16(FP), R15 + MOVQ key+24(FP), AX + + MOVQ 0(AX), R11 + MOVQ 8(AX), R12 + ANDQ ·poly1305Mask<>(SB), R11 // r0 + ANDQ ·poly1305Mask<>+8(SB), R12 // r1 + XORQ R8, R8 // h0 + XORQ R9, R9 // h1 + XORQ R10, R10 // h2 + + CMPQ R15, $16 + JB bytes_between_0_and_15 + +loop: + POLY1305_ADD(SI, R8, R9, R10) + +multiply: + POLY1305_MUL(R8, R9, R10, R11, R12, BX, CX, R13, R14) + SUBQ $16, R15 + CMPQ R15, $16 + JAE loop + +bytes_between_0_and_15: + TESTQ R15, R15 + JZ done + MOVQ $1, BX + XORQ CX, CX + XORQ R13, R13 + ADDQ R15, SI + +flush_buffer: + SHLQ $8, BX, CX + SHLQ $8, BX + MOVB -1(SI), R13 + XORQ R13, BX + DECQ SI + DECQ R15 + JNZ flush_buffer + + ADDQ BX, R8 + ADCQ CX, R9 + ADCQ $0, R10 + MOVQ $16, R15 + JMP multiply + +done: + MOVQ R8, AX + MOVQ R9, BX + SUBQ $0xFFFFFFFFFFFFFFFB, AX + SBBQ $0xFFFFFFFFFFFFFFFF, BX + SBBQ $3, R10 + CMOVQCS R8, AX + CMOVQCS R9, BX + MOVQ key+24(FP), R8 + ADDQ 16(R8), AX + ADCQ 24(R8), BX + + MOVQ AX, 0(DI) + MOVQ BX, 8(DI) + RET diff --git a/vendor/golang.org/x/crypto/poly1305/sum_arm.go b/vendor/golang.org/x/crypto/poly1305/sum_arm.go new file mode 100644 index 0000000..5dc321c --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/sum_arm.go @@ -0,0 +1,22 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build arm,!gccgo,!appengine,!nacl + +package poly1305 + +// This function is implemented in sum_arm.s +//go:noescape +func poly1305_auth_armv6(out *[16]byte, m *byte, mlen uint32, key *[32]byte) + +// Sum generates an authenticator for m using a one-time key and puts the +// 16-byte result into out. Authenticating two different messages with the same +// key allows an attacker to forge messages at will. +func Sum(out *[16]byte, m []byte, key *[32]byte) { + var mPtr *byte + if len(m) > 0 { + mPtr = &m[0] + } + poly1305_auth_armv6(out, mPtr, uint32(len(m)), key) +} diff --git a/vendor/golang.org/x/crypto/poly1305/sum_arm.s b/vendor/golang.org/x/crypto/poly1305/sum_arm.s new file mode 100644 index 0000000..f70b4ac --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/sum_arm.s @@ -0,0 +1,427 @@ +// Copyright 2015 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build arm,!gccgo,!appengine,!nacl + +#include "textflag.h" + +// This code was translated into a form compatible with 5a from the public +// domain source by Andrew Moon: github.com/floodyberry/poly1305-opt/blob/master/app/extensions/poly1305. + +DATA ·poly1305_init_constants_armv6<>+0x00(SB)/4, $0x3ffffff +DATA ·poly1305_init_constants_armv6<>+0x04(SB)/4, $0x3ffff03 +DATA ·poly1305_init_constants_armv6<>+0x08(SB)/4, $0x3ffc0ff +DATA ·poly1305_init_constants_armv6<>+0x0c(SB)/4, $0x3f03fff +DATA ·poly1305_init_constants_armv6<>+0x10(SB)/4, $0x00fffff +GLOBL ·poly1305_init_constants_armv6<>(SB), 8, $20 + +// Warning: the linker may use R11 to synthesize certain instructions. Please +// take care and verify that no synthetic instructions use it. + +TEXT poly1305_init_ext_armv6<>(SB), NOSPLIT, $0 + // Needs 16 bytes of stack and 64 bytes of space pointed to by R0. (It + // might look like it's only 60 bytes of space but the final four bytes + // will be written by another function.) We need to skip over four + // bytes of stack because that's saving the value of 'g'. + ADD $4, R13, R8 + MOVM.IB [R4-R7], (R8) + MOVM.IA.W (R1), [R2-R5] + MOVW $·poly1305_init_constants_armv6<>(SB), R7 + MOVW R2, R8 + MOVW R2>>26, R9 + MOVW R3>>20, g + MOVW R4>>14, R11 + MOVW R5>>8, R12 + ORR R3<<6, R9, R9 + ORR R4<<12, g, g + ORR R5<<18, R11, R11 + MOVM.IA (R7), [R2-R6] + AND R8, R2, R2 + AND R9, R3, R3 + AND g, R4, R4 + AND R11, R5, R5 + AND R12, R6, R6 + MOVM.IA.W [R2-R6], (R0) + EOR R2, R2, R2 + EOR R3, R3, R3 + EOR R4, R4, R4 + EOR R5, R5, R5 + EOR R6, R6, R6 + MOVM.IA.W [R2-R6], (R0) + MOVM.IA.W (R1), [R2-R5] + MOVM.IA [R2-R6], (R0) + ADD $20, R13, R0 + MOVM.DA (R0), [R4-R7] + RET + +#define MOVW_UNALIGNED(Rsrc, Rdst, Rtmp, offset) \ + MOVBU (offset+0)(Rsrc), Rtmp; \ + MOVBU Rtmp, (offset+0)(Rdst); \ + MOVBU (offset+1)(Rsrc), Rtmp; \ + MOVBU Rtmp, (offset+1)(Rdst); \ + MOVBU (offset+2)(Rsrc), Rtmp; \ + MOVBU Rtmp, (offset+2)(Rdst); \ + MOVBU (offset+3)(Rsrc), Rtmp; \ + MOVBU Rtmp, (offset+3)(Rdst) + +TEXT poly1305_blocks_armv6<>(SB), NOSPLIT, $0 + // Needs 24 bytes of stack for saved registers and then 88 bytes of + // scratch space after that. We assume that 24 bytes at (R13) have + // already been used: four bytes for the link register saved in the + // prelude of poly1305_auth_armv6, four bytes for saving the value of g + // in that function and 16 bytes of scratch space used around + // poly1305_finish_ext_armv6_skip1. + ADD $24, R13, R12 + MOVM.IB [R4-R8, R14], (R12) + MOVW R0, 88(R13) + MOVW R1, 92(R13) + MOVW R2, 96(R13) + MOVW R1, R14 + MOVW R2, R12 + MOVW 56(R0), R8 + WORD $0xe1180008 // TST R8, R8 not working see issue 5921 + EOR R6, R6, R6 + MOVW.EQ $(1<<24), R6 + MOVW R6, 84(R13) + ADD $116, R13, g + MOVM.IA (R0), [R0-R9] + MOVM.IA [R0-R4], (g) + CMP $16, R12 + BLO poly1305_blocks_armv6_done + +poly1305_blocks_armv6_mainloop: + WORD $0xe31e0003 // TST R14, #3 not working see issue 5921 + BEQ poly1305_blocks_armv6_mainloop_aligned + ADD $100, R13, g + MOVW_UNALIGNED(R14, g, R0, 0) + MOVW_UNALIGNED(R14, g, R0, 4) + MOVW_UNALIGNED(R14, g, R0, 8) + MOVW_UNALIGNED(R14, g, R0, 12) + MOVM.IA (g), [R0-R3] + ADD $16, R14 + B poly1305_blocks_armv6_mainloop_loaded + +poly1305_blocks_armv6_mainloop_aligned: + MOVM.IA.W (R14), [R0-R3] + +poly1305_blocks_armv6_mainloop_loaded: + MOVW R0>>26, g + MOVW R1>>20, R11 + MOVW R2>>14, R12 + MOVW R14, 92(R13) + MOVW R3>>8, R4 + ORR R1<<6, g, g + ORR R2<<12, R11, R11 + ORR R3<<18, R12, R12 + BIC $0xfc000000, R0, R0 + BIC $0xfc000000, g, g + MOVW 84(R13), R3 + BIC $0xfc000000, R11, R11 + BIC $0xfc000000, R12, R12 + ADD R0, R5, R5 + ADD g, R6, R6 + ORR R3, R4, R4 + ADD R11, R7, R7 + ADD $116, R13, R14 + ADD R12, R8, R8 + ADD R4, R9, R9 + MOVM.IA (R14), [R0-R4] + MULLU R4, R5, (R11, g) + MULLU R3, R5, (R14, R12) + MULALU R3, R6, (R11, g) + MULALU R2, R6, (R14, R12) + MULALU R2, R7, (R11, g) + MULALU R1, R7, (R14, R12) + ADD R4<<2, R4, R4 + ADD R3<<2, R3, R3 + MULALU R1, R8, (R11, g) + MULALU R0, R8, (R14, R12) + MULALU R0, R9, (R11, g) + MULALU R4, R9, (R14, R12) + MOVW g, 76(R13) + MOVW R11, 80(R13) + MOVW R12, 68(R13) + MOVW R14, 72(R13) + MULLU R2, R5, (R11, g) + MULLU R1, R5, (R14, R12) + MULALU R1, R6, (R11, g) + MULALU R0, R6, (R14, R12) + MULALU R0, R7, (R11, g) + MULALU R4, R7, (R14, R12) + ADD R2<<2, R2, R2 + ADD R1<<2, R1, R1 + MULALU R4, R8, (R11, g) + MULALU R3, R8, (R14, R12) + MULALU R3, R9, (R11, g) + MULALU R2, R9, (R14, R12) + MOVW g, 60(R13) + MOVW R11, 64(R13) + MOVW R12, 52(R13) + MOVW R14, 56(R13) + MULLU R0, R5, (R11, g) + MULALU R4, R6, (R11, g) + MULALU R3, R7, (R11, g) + MULALU R2, R8, (R11, g) + MULALU R1, R9, (R11, g) + ADD $52, R13, R0 + MOVM.IA (R0), [R0-R7] + MOVW g>>26, R12 + MOVW R4>>26, R14 + ORR R11<<6, R12, R12 + ORR R5<<6, R14, R14 + BIC $0xfc000000, g, g + BIC $0xfc000000, R4, R4 + ADD.S R12, R0, R0 + ADC $0, R1, R1 + ADD.S R14, R6, R6 + ADC $0, R7, R7 + MOVW R0>>26, R12 + MOVW R6>>26, R14 + ORR R1<<6, R12, R12 + ORR R7<<6, R14, R14 + BIC $0xfc000000, R0, R0 + BIC $0xfc000000, R6, R6 + ADD R14<<2, R14, R14 + ADD.S R12, R2, R2 + ADC $0, R3, R3 + ADD R14, g, g + MOVW R2>>26, R12 + MOVW g>>26, R14 + ORR R3<<6, R12, R12 + BIC $0xfc000000, g, R5 + BIC $0xfc000000, R2, R7 + ADD R12, R4, R4 + ADD R14, R0, R0 + MOVW R4>>26, R12 + BIC $0xfc000000, R4, R8 + ADD R12, R6, R9 + MOVW 96(R13), R12 + MOVW 92(R13), R14 + MOVW R0, R6 + CMP $32, R12 + SUB $16, R12, R12 + MOVW R12, 96(R13) + BHS poly1305_blocks_armv6_mainloop + +poly1305_blocks_armv6_done: + MOVW 88(R13), R12 + MOVW R5, 20(R12) + MOVW R6, 24(R12) + MOVW R7, 28(R12) + MOVW R8, 32(R12) + MOVW R9, 36(R12) + ADD $48, R13, R0 + MOVM.DA (R0), [R4-R8, R14] + RET + +#define MOVHUP_UNALIGNED(Rsrc, Rdst, Rtmp) \ + MOVBU.P 1(Rsrc), Rtmp; \ + MOVBU.P Rtmp, 1(Rdst); \ + MOVBU.P 1(Rsrc), Rtmp; \ + MOVBU.P Rtmp, 1(Rdst) + +#define MOVWP_UNALIGNED(Rsrc, Rdst, Rtmp) \ + MOVHUP_UNALIGNED(Rsrc, Rdst, Rtmp); \ + MOVHUP_UNALIGNED(Rsrc, Rdst, Rtmp) + +// func poly1305_auth_armv6(out *[16]byte, m *byte, mlen uint32, key *[32]key) +TEXT ·poly1305_auth_armv6(SB), $196-16 + // The value 196, just above, is the sum of 64 (the size of the context + // structure) and 132 (the amount of stack needed). + // + // At this point, the stack pointer (R13) has been moved down. It + // points to the saved link register and there's 196 bytes of free + // space above it. + // + // The stack for this function looks like: + // + // +--------------------- + // | + // | 64 bytes of context structure + // | + // +--------------------- + // | + // | 112 bytes for poly1305_blocks_armv6 + // | + // +--------------------- + // | 16 bytes of final block, constructed at + // | poly1305_finish_ext_armv6_skip8 + // +--------------------- + // | four bytes of saved 'g' + // +--------------------- + // | lr, saved by prelude <- R13 points here + // +--------------------- + MOVW g, 4(R13) + + MOVW out+0(FP), R4 + MOVW m+4(FP), R5 + MOVW mlen+8(FP), R6 + MOVW key+12(FP), R7 + + ADD $136, R13, R0 // 136 = 4 + 4 + 16 + 112 + MOVW R7, R1 + + // poly1305_init_ext_armv6 will write to the stack from R13+4, but + // that's ok because none of the other values have been written yet. + BL poly1305_init_ext_armv6<>(SB) + BIC.S $15, R6, R2 + BEQ poly1305_auth_armv6_noblocks + ADD $136, R13, R0 + MOVW R5, R1 + ADD R2, R5, R5 + SUB R2, R6, R6 + BL poly1305_blocks_armv6<>(SB) + +poly1305_auth_armv6_noblocks: + ADD $136, R13, R0 + MOVW R5, R1 + MOVW R6, R2 + MOVW R4, R3 + + MOVW R0, R5 + MOVW R1, R6 + MOVW R2, R7 + MOVW R3, R8 + AND.S R2, R2, R2 + BEQ poly1305_finish_ext_armv6_noremaining + EOR R0, R0 + ADD $8, R13, R9 // 8 = offset to 16 byte scratch space + MOVW R0, (R9) + MOVW R0, 4(R9) + MOVW R0, 8(R9) + MOVW R0, 12(R9) + WORD $0xe3110003 // TST R1, #3 not working see issue 5921 + BEQ poly1305_finish_ext_armv6_aligned + WORD $0xe3120008 // TST R2, #8 not working see issue 5921 + BEQ poly1305_finish_ext_armv6_skip8 + MOVWP_UNALIGNED(R1, R9, g) + MOVWP_UNALIGNED(R1, R9, g) + +poly1305_finish_ext_armv6_skip8: + WORD $0xe3120004 // TST $4, R2 not working see issue 5921 + BEQ poly1305_finish_ext_armv6_skip4 + MOVWP_UNALIGNED(R1, R9, g) + +poly1305_finish_ext_armv6_skip4: + WORD $0xe3120002 // TST $2, R2 not working see issue 5921 + BEQ poly1305_finish_ext_armv6_skip2 + MOVHUP_UNALIGNED(R1, R9, g) + B poly1305_finish_ext_armv6_skip2 + +poly1305_finish_ext_armv6_aligned: + WORD $0xe3120008 // TST R2, #8 not working see issue 5921 + BEQ poly1305_finish_ext_armv6_skip8_aligned + MOVM.IA.W (R1), [g-R11] + MOVM.IA.W [g-R11], (R9) + +poly1305_finish_ext_armv6_skip8_aligned: + WORD $0xe3120004 // TST $4, R2 not working see issue 5921 + BEQ poly1305_finish_ext_armv6_skip4_aligned + MOVW.P 4(R1), g + MOVW.P g, 4(R9) + +poly1305_finish_ext_armv6_skip4_aligned: + WORD $0xe3120002 // TST $2, R2 not working see issue 5921 + BEQ poly1305_finish_ext_armv6_skip2 + MOVHU.P 2(R1), g + MOVH.P g, 2(R9) + +poly1305_finish_ext_armv6_skip2: + WORD $0xe3120001 // TST $1, R2 not working see issue 5921 + BEQ poly1305_finish_ext_armv6_skip1 + MOVBU.P 1(R1), g + MOVBU.P g, 1(R9) + +poly1305_finish_ext_armv6_skip1: + MOVW $1, R11 + MOVBU R11, 0(R9) + MOVW R11, 56(R5) + MOVW R5, R0 + ADD $8, R13, R1 + MOVW $16, R2 + BL poly1305_blocks_armv6<>(SB) + +poly1305_finish_ext_armv6_noremaining: + MOVW 20(R5), R0 + MOVW 24(R5), R1 + MOVW 28(R5), R2 + MOVW 32(R5), R3 + MOVW 36(R5), R4 + MOVW R4>>26, R12 + BIC $0xfc000000, R4, R4 + ADD R12<<2, R12, R12 + ADD R12, R0, R0 + MOVW R0>>26, R12 + BIC $0xfc000000, R0, R0 + ADD R12, R1, R1 + MOVW R1>>26, R12 + BIC $0xfc000000, R1, R1 + ADD R12, R2, R2 + MOVW R2>>26, R12 + BIC $0xfc000000, R2, R2 + ADD R12, R3, R3 + MOVW R3>>26, R12 + BIC $0xfc000000, R3, R3 + ADD R12, R4, R4 + ADD $5, R0, R6 + MOVW R6>>26, R12 + BIC $0xfc000000, R6, R6 + ADD R12, R1, R7 + MOVW R7>>26, R12 + BIC $0xfc000000, R7, R7 + ADD R12, R2, g + MOVW g>>26, R12 + BIC $0xfc000000, g, g + ADD R12, R3, R11 + MOVW $-(1<<26), R12 + ADD R11>>26, R12, R12 + BIC $0xfc000000, R11, R11 + ADD R12, R4, R9 + MOVW R9>>31, R12 + SUB $1, R12 + AND R12, R6, R6 + AND R12, R7, R7 + AND R12, g, g + AND R12, R11, R11 + AND R12, R9, R9 + MVN R12, R12 + AND R12, R0, R0 + AND R12, R1, R1 + AND R12, R2, R2 + AND R12, R3, R3 + AND R12, R4, R4 + ORR R6, R0, R0 + ORR R7, R1, R1 + ORR g, R2, R2 + ORR R11, R3, R3 + ORR R9, R4, R4 + ORR R1<<26, R0, R0 + MOVW R1>>6, R1 + ORR R2<<20, R1, R1 + MOVW R2>>12, R2 + ORR R3<<14, R2, R2 + MOVW R3>>18, R3 + ORR R4<<8, R3, R3 + MOVW 40(R5), R6 + MOVW 44(R5), R7 + MOVW 48(R5), g + MOVW 52(R5), R11 + ADD.S R6, R0, R0 + ADC.S R7, R1, R1 + ADC.S g, R2, R2 + ADC.S R11, R3, R3 + MOVM.IA [R0-R3], (R8) + MOVW R5, R12 + EOR R0, R0, R0 + EOR R1, R1, R1 + EOR R2, R2, R2 + EOR R3, R3, R3 + EOR R4, R4, R4 + EOR R5, R5, R5 + EOR R6, R6, R6 + EOR R7, R7, R7 + MOVM.IA.W [R0-R7], (R12) + MOVM.IA [R0-R7], (R12) + MOVW 4(R13), g + RET diff --git a/vendor/golang.org/x/crypto/poly1305/sum_noasm.go b/vendor/golang.org/x/crypto/poly1305/sum_noasm.go new file mode 100644 index 0000000..751eec5 --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/sum_noasm.go @@ -0,0 +1,14 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build s390x,!go1.11 !arm,!amd64,!s390x gccgo appengine nacl + +package poly1305 + +// Sum generates an authenticator for msg using a one-time key and puts the +// 16-byte result into out. Authenticating two different messages with the same +// key allows an attacker to forge messages at will. +func Sum(out *[TagSize]byte, msg []byte, key *[32]byte) { + sumGeneric(out, msg, key) +} diff --git a/vendor/golang.org/x/crypto/poly1305/sum_ref.go b/vendor/golang.org/x/crypto/poly1305/sum_ref.go new file mode 100644 index 0000000..c4d59bd --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/sum_ref.go @@ -0,0 +1,139 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package poly1305 + +import "encoding/binary" + +// sumGeneric generates an authenticator for msg using a one-time key and +// puts the 16-byte result into out. This is the generic implementation of +// Sum and should be called if no assembly implementation is available. +func sumGeneric(out *[TagSize]byte, msg []byte, key *[32]byte) { + var ( + h0, h1, h2, h3, h4 uint32 // the hash accumulators + r0, r1, r2, r3, r4 uint64 // the r part of the key + ) + + r0 = uint64(binary.LittleEndian.Uint32(key[0:]) & 0x3ffffff) + r1 = uint64((binary.LittleEndian.Uint32(key[3:]) >> 2) & 0x3ffff03) + r2 = uint64((binary.LittleEndian.Uint32(key[6:]) >> 4) & 0x3ffc0ff) + r3 = uint64((binary.LittleEndian.Uint32(key[9:]) >> 6) & 0x3f03fff) + r4 = uint64((binary.LittleEndian.Uint32(key[12:]) >> 8) & 0x00fffff) + + R1, R2, R3, R4 := r1*5, r2*5, r3*5, r4*5 + + for len(msg) >= TagSize { + // h += msg + h0 += binary.LittleEndian.Uint32(msg[0:]) & 0x3ffffff + h1 += (binary.LittleEndian.Uint32(msg[3:]) >> 2) & 0x3ffffff + h2 += (binary.LittleEndian.Uint32(msg[6:]) >> 4) & 0x3ffffff + h3 += (binary.LittleEndian.Uint32(msg[9:]) >> 6) & 0x3ffffff + h4 += (binary.LittleEndian.Uint32(msg[12:]) >> 8) | (1 << 24) + + // h *= r + d0 := (uint64(h0) * r0) + (uint64(h1) * R4) + (uint64(h2) * R3) + (uint64(h3) * R2) + (uint64(h4) * R1) + d1 := (d0 >> 26) + (uint64(h0) * r1) + (uint64(h1) * r0) + (uint64(h2) * R4) + (uint64(h3) * R3) + (uint64(h4) * R2) + d2 := (d1 >> 26) + (uint64(h0) * r2) + (uint64(h1) * r1) + (uint64(h2) * r0) + (uint64(h3) * R4) + (uint64(h4) * R3) + d3 := (d2 >> 26) + (uint64(h0) * r3) + (uint64(h1) * r2) + (uint64(h2) * r1) + (uint64(h3) * r0) + (uint64(h4) * R4) + d4 := (d3 >> 26) + (uint64(h0) * r4) + (uint64(h1) * r3) + (uint64(h2) * r2) + (uint64(h3) * r1) + (uint64(h4) * r0) + + // h %= p + h0 = uint32(d0) & 0x3ffffff + h1 = uint32(d1) & 0x3ffffff + h2 = uint32(d2) & 0x3ffffff + h3 = uint32(d3) & 0x3ffffff + h4 = uint32(d4) & 0x3ffffff + + h0 += uint32(d4>>26) * 5 + h1 += h0 >> 26 + h0 = h0 & 0x3ffffff + + msg = msg[TagSize:] + } + + if len(msg) > 0 { + var block [TagSize]byte + off := copy(block[:], msg) + block[off] = 0x01 + + // h += msg + h0 += binary.LittleEndian.Uint32(block[0:]) & 0x3ffffff + h1 += (binary.LittleEndian.Uint32(block[3:]) >> 2) & 0x3ffffff + h2 += (binary.LittleEndian.Uint32(block[6:]) >> 4) & 0x3ffffff + h3 += (binary.LittleEndian.Uint32(block[9:]) >> 6) & 0x3ffffff + h4 += (binary.LittleEndian.Uint32(block[12:]) >> 8) + + // h *= r + d0 := (uint64(h0) * r0) + (uint64(h1) * R4) + (uint64(h2) * R3) + (uint64(h3) * R2) + (uint64(h4) * R1) + d1 := (d0 >> 26) + (uint64(h0) * r1) + (uint64(h1) * r0) + (uint64(h2) * R4) + (uint64(h3) * R3) + (uint64(h4) * R2) + d2 := (d1 >> 26) + (uint64(h0) * r2) + (uint64(h1) * r1) + (uint64(h2) * r0) + (uint64(h3) * R4) + (uint64(h4) * R3) + d3 := (d2 >> 26) + (uint64(h0) * r3) + (uint64(h1) * r2) + (uint64(h2) * r1) + (uint64(h3) * r0) + (uint64(h4) * R4) + d4 := (d3 >> 26) + (uint64(h0) * r4) + (uint64(h1) * r3) + (uint64(h2) * r2) + (uint64(h3) * r1) + (uint64(h4) * r0) + + // h %= p + h0 = uint32(d0) & 0x3ffffff + h1 = uint32(d1) & 0x3ffffff + h2 = uint32(d2) & 0x3ffffff + h3 = uint32(d3) & 0x3ffffff + h4 = uint32(d4) & 0x3ffffff + + h0 += uint32(d4>>26) * 5 + h1 += h0 >> 26 + h0 = h0 & 0x3ffffff + } + + // h %= p reduction + h2 += h1 >> 26 + h1 &= 0x3ffffff + h3 += h2 >> 26 + h2 &= 0x3ffffff + h4 += h3 >> 26 + h3 &= 0x3ffffff + h0 += 5 * (h4 >> 26) + h4 &= 0x3ffffff + h1 += h0 >> 26 + h0 &= 0x3ffffff + + // h - p + t0 := h0 + 5 + t1 := h1 + (t0 >> 26) + t2 := h2 + (t1 >> 26) + t3 := h3 + (t2 >> 26) + t4 := h4 + (t3 >> 26) - (1 << 26) + t0 &= 0x3ffffff + t1 &= 0x3ffffff + t2 &= 0x3ffffff + t3 &= 0x3ffffff + + // select h if h < p else h - p + t_mask := (t4 >> 31) - 1 + h_mask := ^t_mask + h0 = (h0 & h_mask) | (t0 & t_mask) + h1 = (h1 & h_mask) | (t1 & t_mask) + h2 = (h2 & h_mask) | (t2 & t_mask) + h3 = (h3 & h_mask) | (t3 & t_mask) + h4 = (h4 & h_mask) | (t4 & t_mask) + + // h %= 2^128 + h0 |= h1 << 26 + h1 = ((h1 >> 6) | (h2 << 20)) + h2 = ((h2 >> 12) | (h3 << 14)) + h3 = ((h3 >> 18) | (h4 << 8)) + + // s: the s part of the key + // tag = (h + s) % (2^128) + t := uint64(h0) + uint64(binary.LittleEndian.Uint32(key[16:])) + h0 = uint32(t) + t = uint64(h1) + uint64(binary.LittleEndian.Uint32(key[20:])) + (t >> 32) + h1 = uint32(t) + t = uint64(h2) + uint64(binary.LittleEndian.Uint32(key[24:])) + (t >> 32) + h2 = uint32(t) + t = uint64(h3) + uint64(binary.LittleEndian.Uint32(key[28:])) + (t >> 32) + h3 = uint32(t) + + binary.LittleEndian.PutUint32(out[0:], h0) + binary.LittleEndian.PutUint32(out[4:], h1) + binary.LittleEndian.PutUint32(out[8:], h2) + binary.LittleEndian.PutUint32(out[12:], h3) +} diff --git a/vendor/golang.org/x/crypto/poly1305/sum_s390x.go b/vendor/golang.org/x/crypto/poly1305/sum_s390x.go new file mode 100644 index 0000000..ec99e07 --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/sum_s390x.go @@ -0,0 +1,42 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build s390x,go1.11,!gccgo,!appengine + +package poly1305 + +import ( + "golang.org/x/sys/cpu" +) + +// poly1305vx is an assembly implementation of Poly1305 that uses vector +// instructions. It must only be called if the vector facility (vx) is +// available. +//go:noescape +func poly1305vx(out *[16]byte, m *byte, mlen uint64, key *[32]byte) + +// poly1305vmsl is an assembly implementation of Poly1305 that uses vector +// instructions, including VMSL. It must only be called if the vector facility (vx) is +// available and if VMSL is supported. +//go:noescape +func poly1305vmsl(out *[16]byte, m *byte, mlen uint64, key *[32]byte) + +// Sum generates an authenticator for m using a one-time key and puts the +// 16-byte result into out. Authenticating two different messages with the same +// key allows an attacker to forge messages at will. +func Sum(out *[16]byte, m []byte, key *[32]byte) { + if cpu.S390X.HasVX { + var mPtr *byte + if len(m) > 0 { + mPtr = &m[0] + } + if cpu.S390X.HasVXE && len(m) > 256 { + poly1305vmsl(out, mPtr, uint64(len(m)), key) + } else { + poly1305vx(out, mPtr, uint64(len(m)), key) + } + } else { + sumGeneric(out, m, key) + } +} diff --git a/vendor/golang.org/x/crypto/poly1305/sum_s390x.s b/vendor/golang.org/x/crypto/poly1305/sum_s390x.s new file mode 100644 index 0000000..ca5a309 --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/sum_s390x.s @@ -0,0 +1,378 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build s390x,go1.11,!gccgo,!appengine + +#include "textflag.h" + +// Implementation of Poly1305 using the vector facility (vx). + +// constants +#define MOD26 V0 +#define EX0 V1 +#define EX1 V2 +#define EX2 V3 + +// temporaries +#define T_0 V4 +#define T_1 V5 +#define T_2 V6 +#define T_3 V7 +#define T_4 V8 + +// key (r) +#define R_0 V9 +#define R_1 V10 +#define R_2 V11 +#define R_3 V12 +#define R_4 V13 +#define R5_1 V14 +#define R5_2 V15 +#define R5_3 V16 +#define R5_4 V17 +#define RSAVE_0 R5 +#define RSAVE_1 R6 +#define RSAVE_2 R7 +#define RSAVE_3 R8 +#define RSAVE_4 R9 +#define R5SAVE_1 V28 +#define R5SAVE_2 V29 +#define R5SAVE_3 V30 +#define R5SAVE_4 V31 + +// message block +#define F_0 V18 +#define F_1 V19 +#define F_2 V20 +#define F_3 V21 +#define F_4 V22 + +// accumulator +#define H_0 V23 +#define H_1 V24 +#define H_2 V25 +#define H_3 V26 +#define H_4 V27 + +GLOBL ·keyMask<>(SB), RODATA, $16 +DATA ·keyMask<>+0(SB)/8, $0xffffff0ffcffff0f +DATA ·keyMask<>+8(SB)/8, $0xfcffff0ffcffff0f + +GLOBL ·bswapMask<>(SB), RODATA, $16 +DATA ·bswapMask<>+0(SB)/8, $0x0f0e0d0c0b0a0908 +DATA ·bswapMask<>+8(SB)/8, $0x0706050403020100 + +GLOBL ·constants<>(SB), RODATA, $64 +// MOD26 +DATA ·constants<>+0(SB)/8, $0x3ffffff +DATA ·constants<>+8(SB)/8, $0x3ffffff +// EX0 +DATA ·constants<>+16(SB)/8, $0x0006050403020100 +DATA ·constants<>+24(SB)/8, $0x1016151413121110 +// EX1 +DATA ·constants<>+32(SB)/8, $0x060c0b0a09080706 +DATA ·constants<>+40(SB)/8, $0x161c1b1a19181716 +// EX2 +DATA ·constants<>+48(SB)/8, $0x0d0d0d0d0d0f0e0d +DATA ·constants<>+56(SB)/8, $0x1d1d1d1d1d1f1e1d + +// h = (f*g) % (2**130-5) [partial reduction] +#define MULTIPLY(f0, f1, f2, f3, f4, g0, g1, g2, g3, g4, g51, g52, g53, g54, h0, h1, h2, h3, h4) \ + VMLOF f0, g0, h0 \ + VMLOF f0, g1, h1 \ + VMLOF f0, g2, h2 \ + VMLOF f0, g3, h3 \ + VMLOF f0, g4, h4 \ + VMLOF f1, g54, T_0 \ + VMLOF f1, g0, T_1 \ + VMLOF f1, g1, T_2 \ + VMLOF f1, g2, T_3 \ + VMLOF f1, g3, T_4 \ + VMALOF f2, g53, h0, h0 \ + VMALOF f2, g54, h1, h1 \ + VMALOF f2, g0, h2, h2 \ + VMALOF f2, g1, h3, h3 \ + VMALOF f2, g2, h4, h4 \ + VMALOF f3, g52, T_0, T_0 \ + VMALOF f3, g53, T_1, T_1 \ + VMALOF f3, g54, T_2, T_2 \ + VMALOF f3, g0, T_3, T_3 \ + VMALOF f3, g1, T_4, T_4 \ + VMALOF f4, g51, h0, h0 \ + VMALOF f4, g52, h1, h1 \ + VMALOF f4, g53, h2, h2 \ + VMALOF f4, g54, h3, h3 \ + VMALOF f4, g0, h4, h4 \ + VAG T_0, h0, h0 \ + VAG T_1, h1, h1 \ + VAG T_2, h2, h2 \ + VAG T_3, h3, h3 \ + VAG T_4, h4, h4 + +// carry h0->h1 h3->h4, h1->h2 h4->h0, h0->h1 h2->h3, h3->h4 +#define REDUCE(h0, h1, h2, h3, h4) \ + VESRLG $26, h0, T_0 \ + VESRLG $26, h3, T_1 \ + VN MOD26, h0, h0 \ + VN MOD26, h3, h3 \ + VAG T_0, h1, h1 \ + VAG T_1, h4, h4 \ + VESRLG $26, h1, T_2 \ + VESRLG $26, h4, T_3 \ + VN MOD26, h1, h1 \ + VN MOD26, h4, h4 \ + VESLG $2, T_3, T_4 \ + VAG T_3, T_4, T_4 \ + VAG T_2, h2, h2 \ + VAG T_4, h0, h0 \ + VESRLG $26, h2, T_0 \ + VESRLG $26, h0, T_1 \ + VN MOD26, h2, h2 \ + VN MOD26, h0, h0 \ + VAG T_0, h3, h3 \ + VAG T_1, h1, h1 \ + VESRLG $26, h3, T_2 \ + VN MOD26, h3, h3 \ + VAG T_2, h4, h4 + +// expand in0 into d[0] and in1 into d[1] +#define EXPAND(in0, in1, d0, d1, d2, d3, d4) \ + VGBM $0x0707, d1 \ // d1=tmp + VPERM in0, in1, EX2, d4 \ + VPERM in0, in1, EX0, d0 \ + VPERM in0, in1, EX1, d2 \ + VN d1, d4, d4 \ + VESRLG $26, d0, d1 \ + VESRLG $30, d2, d3 \ + VESRLG $4, d2, d2 \ + VN MOD26, d0, d0 \ + VN MOD26, d1, d1 \ + VN MOD26, d2, d2 \ + VN MOD26, d3, d3 + +// pack h4:h0 into h1:h0 (no carry) +#define PACK(h0, h1, h2, h3, h4) \ + VESLG $26, h1, h1 \ + VESLG $26, h3, h3 \ + VO h0, h1, h0 \ + VO h2, h3, h2 \ + VESLG $4, h2, h2 \ + VLEIB $7, $48, h1 \ + VSLB h1, h2, h2 \ + VO h0, h2, h0 \ + VLEIB $7, $104, h1 \ + VSLB h1, h4, h3 \ + VO h3, h0, h0 \ + VLEIB $7, $24, h1 \ + VSRLB h1, h4, h1 + +// if h > 2**130-5 then h -= 2**130-5 +#define MOD(h0, h1, t0, t1, t2) \ + VZERO t0 \ + VLEIG $1, $5, t0 \ + VACCQ h0, t0, t1 \ + VAQ h0, t0, t0 \ + VONE t2 \ + VLEIG $1, $-4, t2 \ + VAQ t2, t1, t1 \ + VACCQ h1, t1, t1 \ + VONE t2 \ + VAQ t2, t1, t1 \ + VN h0, t1, t2 \ + VNC t0, t1, t1 \ + VO t1, t2, h0 + +// func poly1305vx(out *[16]byte, m *byte, mlen uint64, key *[32]key) +TEXT ·poly1305vx(SB), $0-32 + // This code processes up to 2 blocks (32 bytes) per iteration + // using the algorithm described in: + // NEON crypto, Daniel J. Bernstein & Peter Schwabe + // https://cryptojedi.org/papers/neoncrypto-20120320.pdf + LMG out+0(FP), R1, R4 // R1=out, R2=m, R3=mlen, R4=key + + // load MOD26, EX0, EX1 and EX2 + MOVD $·constants<>(SB), R5 + VLM (R5), MOD26, EX2 + + // setup r + VL (R4), T_0 + MOVD $·keyMask<>(SB), R6 + VL (R6), T_1 + VN T_0, T_1, T_0 + EXPAND(T_0, T_0, R_0, R_1, R_2, R_3, R_4) + + // setup r*5 + VLEIG $0, $5, T_0 + VLEIG $1, $5, T_0 + + // store r (for final block) + VMLOF T_0, R_1, R5SAVE_1 + VMLOF T_0, R_2, R5SAVE_2 + VMLOF T_0, R_3, R5SAVE_3 + VMLOF T_0, R_4, R5SAVE_4 + VLGVG $0, R_0, RSAVE_0 + VLGVG $0, R_1, RSAVE_1 + VLGVG $0, R_2, RSAVE_2 + VLGVG $0, R_3, RSAVE_3 + VLGVG $0, R_4, RSAVE_4 + + // skip r**2 calculation + CMPBLE R3, $16, skip + + // calculate r**2 + MULTIPLY(R_0, R_1, R_2, R_3, R_4, R_0, R_1, R_2, R_3, R_4, R5SAVE_1, R5SAVE_2, R5SAVE_3, R5SAVE_4, H_0, H_1, H_2, H_3, H_4) + REDUCE(H_0, H_1, H_2, H_3, H_4) + VLEIG $0, $5, T_0 + VLEIG $1, $5, T_0 + VMLOF T_0, H_1, R5_1 + VMLOF T_0, H_2, R5_2 + VMLOF T_0, H_3, R5_3 + VMLOF T_0, H_4, R5_4 + VLR H_0, R_0 + VLR H_1, R_1 + VLR H_2, R_2 + VLR H_3, R_3 + VLR H_4, R_4 + + // initialize h + VZERO H_0 + VZERO H_1 + VZERO H_2 + VZERO H_3 + VZERO H_4 + +loop: + CMPBLE R3, $32, b2 + VLM (R2), T_0, T_1 + SUB $32, R3 + MOVD $32(R2), R2 + EXPAND(T_0, T_1, F_0, F_1, F_2, F_3, F_4) + VLEIB $4, $1, F_4 + VLEIB $12, $1, F_4 + +multiply: + VAG H_0, F_0, F_0 + VAG H_1, F_1, F_1 + VAG H_2, F_2, F_2 + VAG H_3, F_3, F_3 + VAG H_4, F_4, F_4 + MULTIPLY(F_0, F_1, F_2, F_3, F_4, R_0, R_1, R_2, R_3, R_4, R5_1, R5_2, R5_3, R5_4, H_0, H_1, H_2, H_3, H_4) + REDUCE(H_0, H_1, H_2, H_3, H_4) + CMPBNE R3, $0, loop + +finish: + // sum vectors + VZERO T_0 + VSUMQG H_0, T_0, H_0 + VSUMQG H_1, T_0, H_1 + VSUMQG H_2, T_0, H_2 + VSUMQG H_3, T_0, H_3 + VSUMQG H_4, T_0, H_4 + + // h may be >= 2*(2**130-5) so we need to reduce it again + REDUCE(H_0, H_1, H_2, H_3, H_4) + + // carry h1->h4 + VESRLG $26, H_1, T_1 + VN MOD26, H_1, H_1 + VAQ T_1, H_2, H_2 + VESRLG $26, H_2, T_2 + VN MOD26, H_2, H_2 + VAQ T_2, H_3, H_3 + VESRLG $26, H_3, T_3 + VN MOD26, H_3, H_3 + VAQ T_3, H_4, H_4 + + // h is now < 2*(2**130-5) + // pack h into h1 (hi) and h0 (lo) + PACK(H_0, H_1, H_2, H_3, H_4) + + // if h > 2**130-5 then h -= 2**130-5 + MOD(H_0, H_1, T_0, T_1, T_2) + + // h += s + MOVD $·bswapMask<>(SB), R5 + VL (R5), T_1 + VL 16(R4), T_0 + VPERM T_0, T_0, T_1, T_0 // reverse bytes (to big) + VAQ T_0, H_0, H_0 + VPERM H_0, H_0, T_1, H_0 // reverse bytes (to little) + VST H_0, (R1) + + RET + +b2: + CMPBLE R3, $16, b1 + + // 2 blocks remaining + SUB $17, R3 + VL (R2), T_0 + VLL R3, 16(R2), T_1 + ADD $1, R3 + MOVBZ $1, R0 + CMPBEQ R3, $16, 2(PC) + VLVGB R3, R0, T_1 + EXPAND(T_0, T_1, F_0, F_1, F_2, F_3, F_4) + CMPBNE R3, $16, 2(PC) + VLEIB $12, $1, F_4 + VLEIB $4, $1, F_4 + + // setup [r²,r] + VLVGG $1, RSAVE_0, R_0 + VLVGG $1, RSAVE_1, R_1 + VLVGG $1, RSAVE_2, R_2 + VLVGG $1, RSAVE_3, R_3 + VLVGG $1, RSAVE_4, R_4 + VPDI $0, R5_1, R5SAVE_1, R5_1 + VPDI $0, R5_2, R5SAVE_2, R5_2 + VPDI $0, R5_3, R5SAVE_3, R5_3 + VPDI $0, R5_4, R5SAVE_4, R5_4 + + MOVD $0, R3 + BR multiply + +skip: + VZERO H_0 + VZERO H_1 + VZERO H_2 + VZERO H_3 + VZERO H_4 + + CMPBEQ R3, $0, finish + +b1: + // 1 block remaining + SUB $1, R3 + VLL R3, (R2), T_0 + ADD $1, R3 + MOVBZ $1, R0 + CMPBEQ R3, $16, 2(PC) + VLVGB R3, R0, T_0 + VZERO T_1 + EXPAND(T_0, T_1, F_0, F_1, F_2, F_3, F_4) + CMPBNE R3, $16, 2(PC) + VLEIB $4, $1, F_4 + VLEIG $1, $1, R_0 + VZERO R_1 + VZERO R_2 + VZERO R_3 + VZERO R_4 + VZERO R5_1 + VZERO R5_2 + VZERO R5_3 + VZERO R5_4 + + // setup [r, 1] + VLVGG $0, RSAVE_0, R_0 + VLVGG $0, RSAVE_1, R_1 + VLVGG $0, RSAVE_2, R_2 + VLVGG $0, RSAVE_3, R_3 + VLVGG $0, RSAVE_4, R_4 + VPDI $0, R5SAVE_1, R5_1, R5_1 + VPDI $0, R5SAVE_2, R5_2, R5_2 + VPDI $0, R5SAVE_3, R5_3, R5_3 + VPDI $0, R5SAVE_4, R5_4, R5_4 + + MOVD $0, R3 + BR multiply diff --git a/vendor/golang.org/x/crypto/poly1305/sum_vmsl_s390x.s b/vendor/golang.org/x/crypto/poly1305/sum_vmsl_s390x.s new file mode 100644 index 0000000..e60bbc1 --- /dev/null +++ b/vendor/golang.org/x/crypto/poly1305/sum_vmsl_s390x.s @@ -0,0 +1,909 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build s390x,go1.11,!gccgo,!appengine + +#include "textflag.h" + +// Implementation of Poly1305 using the vector facility (vx) and the VMSL instruction. + +// constants +#define EX0 V1 +#define EX1 V2 +#define EX2 V3 + +// temporaries +#define T_0 V4 +#define T_1 V5 +#define T_2 V6 +#define T_3 V7 +#define T_4 V8 +#define T_5 V9 +#define T_6 V10 +#define T_7 V11 +#define T_8 V12 +#define T_9 V13 +#define T_10 V14 + +// r**2 & r**4 +#define R_0 V15 +#define R_1 V16 +#define R_2 V17 +#define R5_1 V18 +#define R5_2 V19 +// key (r) +#define RSAVE_0 R7 +#define RSAVE_1 R8 +#define RSAVE_2 R9 +#define R5SAVE_1 R10 +#define R5SAVE_2 R11 + +// message block +#define M0 V20 +#define M1 V21 +#define M2 V22 +#define M3 V23 +#define M4 V24 +#define M5 V25 + +// accumulator +#define H0_0 V26 +#define H1_0 V27 +#define H2_0 V28 +#define H0_1 V29 +#define H1_1 V30 +#define H2_1 V31 + +GLOBL ·keyMask<>(SB), RODATA, $16 +DATA ·keyMask<>+0(SB)/8, $0xffffff0ffcffff0f +DATA ·keyMask<>+8(SB)/8, $0xfcffff0ffcffff0f + +GLOBL ·bswapMask<>(SB), RODATA, $16 +DATA ·bswapMask<>+0(SB)/8, $0x0f0e0d0c0b0a0908 +DATA ·bswapMask<>+8(SB)/8, $0x0706050403020100 + +GLOBL ·constants<>(SB), RODATA, $48 +// EX0 +DATA ·constants<>+0(SB)/8, $0x18191a1b1c1d1e1f +DATA ·constants<>+8(SB)/8, $0x0000050403020100 +// EX1 +DATA ·constants<>+16(SB)/8, $0x18191a1b1c1d1e1f +DATA ·constants<>+24(SB)/8, $0x00000a0908070605 +// EX2 +DATA ·constants<>+32(SB)/8, $0x18191a1b1c1d1e1f +DATA ·constants<>+40(SB)/8, $0x0000000f0e0d0c0b + +GLOBL ·c<>(SB), RODATA, $48 +// EX0 +DATA ·c<>+0(SB)/8, $0x0000050403020100 +DATA ·c<>+8(SB)/8, $0x0000151413121110 +// EX1 +DATA ·c<>+16(SB)/8, $0x00000a0908070605 +DATA ·c<>+24(SB)/8, $0x00001a1918171615 +// EX2 +DATA ·c<>+32(SB)/8, $0x0000000f0e0d0c0b +DATA ·c<>+40(SB)/8, $0x0000001f1e1d1c1b + +GLOBL ·reduce<>(SB), RODATA, $32 +// 44 bit +DATA ·reduce<>+0(SB)/8, $0x0 +DATA ·reduce<>+8(SB)/8, $0xfffffffffff +// 42 bit +DATA ·reduce<>+16(SB)/8, $0x0 +DATA ·reduce<>+24(SB)/8, $0x3ffffffffff + +// h = (f*g) % (2**130-5) [partial reduction] +// uses T_0...T_9 temporary registers +// input: m02_0, m02_1, m02_2, m13_0, m13_1, m13_2, r_0, r_1, r_2, r5_1, r5_2, m4_0, m4_1, m4_2, m5_0, m5_1, m5_2 +// temp: t0, t1, t2, t3, t4, t5, t6, t7, t8, t9 +// output: m02_0, m02_1, m02_2, m13_0, m13_1, m13_2 +#define MULTIPLY(m02_0, m02_1, m02_2, m13_0, m13_1, m13_2, r_0, r_1, r_2, r5_1, r5_2, m4_0, m4_1, m4_2, m5_0, m5_1, m5_2, t0, t1, t2, t3, t4, t5, t6, t7, t8, t9) \ + \ // Eliminate the dependency for the last 2 VMSLs + VMSLG m02_0, r_2, m4_2, m4_2 \ + VMSLG m13_0, r_2, m5_2, m5_2 \ // 8 VMSLs pipelined + VMSLG m02_0, r_0, m4_0, m4_0 \ + VMSLG m02_1, r5_2, V0, T_0 \ + VMSLG m02_0, r_1, m4_1, m4_1 \ + VMSLG m02_1, r_0, V0, T_1 \ + VMSLG m02_1, r_1, V0, T_2 \ + VMSLG m02_2, r5_1, V0, T_3 \ + VMSLG m02_2, r5_2, V0, T_4 \ + VMSLG m13_0, r_0, m5_0, m5_0 \ + VMSLG m13_1, r5_2, V0, T_5 \ + VMSLG m13_0, r_1, m5_1, m5_1 \ + VMSLG m13_1, r_0, V0, T_6 \ + VMSLG m13_1, r_1, V0, T_7 \ + VMSLG m13_2, r5_1, V0, T_8 \ + VMSLG m13_2, r5_2, V0, T_9 \ + VMSLG m02_2, r_0, m4_2, m4_2 \ + VMSLG m13_2, r_0, m5_2, m5_2 \ + VAQ m4_0, T_0, m02_0 \ + VAQ m4_1, T_1, m02_1 \ + VAQ m5_0, T_5, m13_0 \ + VAQ m5_1, T_6, m13_1 \ + VAQ m02_0, T_3, m02_0 \ + VAQ m02_1, T_4, m02_1 \ + VAQ m13_0, T_8, m13_0 \ + VAQ m13_1, T_9, m13_1 \ + VAQ m4_2, T_2, m02_2 \ + VAQ m5_2, T_7, m13_2 \ + +// SQUARE uses three limbs of r and r_2*5 to output square of r +// uses T_1, T_5 and T_7 temporary registers +// input: r_0, r_1, r_2, r5_2 +// temp: TEMP0, TEMP1, TEMP2 +// output: p0, p1, p2 +#define SQUARE(r_0, r_1, r_2, r5_2, p0, p1, p2, TEMP0, TEMP1, TEMP2) \ + VMSLG r_0, r_0, p0, p0 \ + VMSLG r_1, r5_2, V0, TEMP0 \ + VMSLG r_2, r5_2, p1, p1 \ + VMSLG r_0, r_1, V0, TEMP1 \ + VMSLG r_1, r_1, p2, p2 \ + VMSLG r_0, r_2, V0, TEMP2 \ + VAQ TEMP0, p0, p0 \ + VAQ TEMP1, p1, p1 \ + VAQ TEMP2, p2, p2 \ + VAQ TEMP0, p0, p0 \ + VAQ TEMP1, p1, p1 \ + VAQ TEMP2, p2, p2 \ + +// carry h0->h1->h2->h0 || h3->h4->h5->h3 +// uses T_2, T_4, T_5, T_7, T_8, T_9 +// t6, t7, t8, t9, t10, t11 +// input: h0, h1, h2, h3, h4, h5 +// temp: t0, t1, t2, t3, t4, t5, t6, t7, t8, t9, t10, t11 +// output: h0, h1, h2, h3, h4, h5 +#define REDUCE(h0, h1, h2, h3, h4, h5, t0, t1, t2, t3, t4, t5, t6, t7, t8, t9, t10, t11) \ + VLM (R12), t6, t7 \ // 44 and 42 bit clear mask + VLEIB $7, $0x28, t10 \ // 5 byte shift mask + VREPIB $4, t8 \ // 4 bit shift mask + VREPIB $2, t11 \ // 2 bit shift mask + VSRLB t10, h0, t0 \ // h0 byte shift + VSRLB t10, h1, t1 \ // h1 byte shift + VSRLB t10, h2, t2 \ // h2 byte shift + VSRLB t10, h3, t3 \ // h3 byte shift + VSRLB t10, h4, t4 \ // h4 byte shift + VSRLB t10, h5, t5 \ // h5 byte shift + VSRL t8, t0, t0 \ // h0 bit shift + VSRL t8, t1, t1 \ // h2 bit shift + VSRL t11, t2, t2 \ // h2 bit shift + VSRL t8, t3, t3 \ // h3 bit shift + VSRL t8, t4, t4 \ // h4 bit shift + VESLG $2, t2, t9 \ // h2 carry x5 + VSRL t11, t5, t5 \ // h5 bit shift + VN t6, h0, h0 \ // h0 clear carry + VAQ t2, t9, t2 \ // h2 carry x5 + VESLG $2, t5, t9 \ // h5 carry x5 + VN t6, h1, h1 \ // h1 clear carry + VN t7, h2, h2 \ // h2 clear carry + VAQ t5, t9, t5 \ // h5 carry x5 + VN t6, h3, h3 \ // h3 clear carry + VN t6, h4, h4 \ // h4 clear carry + VN t7, h5, h5 \ // h5 clear carry + VAQ t0, h1, h1 \ // h0->h1 + VAQ t3, h4, h4 \ // h3->h4 + VAQ t1, h2, h2 \ // h1->h2 + VAQ t4, h5, h5 \ // h4->h5 + VAQ t2, h0, h0 \ // h2->h0 + VAQ t5, h3, h3 \ // h5->h3 + VREPG $1, t6, t6 \ // 44 and 42 bit masks across both halves + VREPG $1, t7, t7 \ + VSLDB $8, h0, h0, h0 \ // set up [h0/1/2, h3/4/5] + VSLDB $8, h1, h1, h1 \ + VSLDB $8, h2, h2, h2 \ + VO h0, h3, h3 \ + VO h1, h4, h4 \ + VO h2, h5, h5 \ + VESRLG $44, h3, t0 \ // 44 bit shift right + VESRLG $44, h4, t1 \ + VESRLG $42, h5, t2 \ + VN t6, h3, h3 \ // clear carry bits + VN t6, h4, h4 \ + VN t7, h5, h5 \ + VESLG $2, t2, t9 \ // multiply carry by 5 + VAQ t9, t2, t2 \ + VAQ t0, h4, h4 \ + VAQ t1, h5, h5 \ + VAQ t2, h3, h3 \ + +// carry h0->h1->h2->h0 +// input: h0, h1, h2 +// temp: t0, t1, t2, t3, t4, t5, t6, t7, t8 +// output: h0, h1, h2 +#define REDUCE2(h0, h1, h2, t0, t1, t2, t3, t4, t5, t6, t7, t8) \ + VLEIB $7, $0x28, t3 \ // 5 byte shift mask + VREPIB $4, t4 \ // 4 bit shift mask + VREPIB $2, t7 \ // 2 bit shift mask + VGBM $0x003F, t5 \ // mask to clear carry bits + VSRLB t3, h0, t0 \ + VSRLB t3, h1, t1 \ + VSRLB t3, h2, t2 \ + VESRLG $4, t5, t5 \ // 44 bit clear mask + VSRL t4, t0, t0 \ + VSRL t4, t1, t1 \ + VSRL t7, t2, t2 \ + VESRLG $2, t5, t6 \ // 42 bit clear mask + VESLG $2, t2, t8 \ + VAQ t8, t2, t2 \ + VN t5, h0, h0 \ + VN t5, h1, h1 \ + VN t6, h2, h2 \ + VAQ t0, h1, h1 \ + VAQ t1, h2, h2 \ + VAQ t2, h0, h0 \ + VSRLB t3, h0, t0 \ + VSRLB t3, h1, t1 \ + VSRLB t3, h2, t2 \ + VSRL t4, t0, t0 \ + VSRL t4, t1, t1 \ + VSRL t7, t2, t2 \ + VN t5, h0, h0 \ + VN t5, h1, h1 \ + VESLG $2, t2, t8 \ + VN t6, h2, h2 \ + VAQ t0, h1, h1 \ + VAQ t8, t2, t2 \ + VAQ t1, h2, h2 \ + VAQ t2, h0, h0 \ + +// expands two message blocks into the lower halfs of the d registers +// moves the contents of the d registers into upper halfs +// input: in1, in2, d0, d1, d2, d3, d4, d5 +// temp: TEMP0, TEMP1, TEMP2, TEMP3 +// output: d0, d1, d2, d3, d4, d5 +#define EXPACC(in1, in2, d0, d1, d2, d3, d4, d5, TEMP0, TEMP1, TEMP2, TEMP3) \ + VGBM $0xff3f, TEMP0 \ + VGBM $0xff1f, TEMP1 \ + VESLG $4, d1, TEMP2 \ + VESLG $4, d4, TEMP3 \ + VESRLG $4, TEMP0, TEMP0 \ + VPERM in1, d0, EX0, d0 \ + VPERM in2, d3, EX0, d3 \ + VPERM in1, d2, EX2, d2 \ + VPERM in2, d5, EX2, d5 \ + VPERM in1, TEMP2, EX1, d1 \ + VPERM in2, TEMP3, EX1, d4 \ + VN TEMP0, d0, d0 \ + VN TEMP0, d3, d3 \ + VESRLG $4, d1, d1 \ + VESRLG $4, d4, d4 \ + VN TEMP1, d2, d2 \ + VN TEMP1, d5, d5 \ + VN TEMP0, d1, d1 \ + VN TEMP0, d4, d4 \ + +// expands one message block into the lower halfs of the d registers +// moves the contents of the d registers into upper halfs +// input: in, d0, d1, d2 +// temp: TEMP0, TEMP1, TEMP2 +// output: d0, d1, d2 +#define EXPACC2(in, d0, d1, d2, TEMP0, TEMP1, TEMP2) \ + VGBM $0xff3f, TEMP0 \ + VESLG $4, d1, TEMP2 \ + VGBM $0xff1f, TEMP1 \ + VPERM in, d0, EX0, d0 \ + VESRLG $4, TEMP0, TEMP0 \ + VPERM in, d2, EX2, d2 \ + VPERM in, TEMP2, EX1, d1 \ + VN TEMP0, d0, d0 \ + VN TEMP1, d2, d2 \ + VESRLG $4, d1, d1 \ + VN TEMP0, d1, d1 \ + +// pack h2:h0 into h1:h0 (no carry) +// input: h0, h1, h2 +// output: h0, h1, h2 +#define PACK(h0, h1, h2) \ + VMRLG h1, h2, h2 \ // copy h1 to upper half h2 + VESLG $44, h1, h1 \ // shift limb 1 44 bits, leaving 20 + VO h0, h1, h0 \ // combine h0 with 20 bits from limb 1 + VESRLG $20, h2, h1 \ // put top 24 bits of limb 1 into h1 + VLEIG $1, $0, h1 \ // clear h2 stuff from lower half of h1 + VO h0, h1, h0 \ // h0 now has 88 bits (limb 0 and 1) + VLEIG $0, $0, h2 \ // clear upper half of h2 + VESRLG $40, h2, h1 \ // h1 now has upper two bits of result + VLEIB $7, $88, h1 \ // for byte shift (11 bytes) + VSLB h1, h2, h2 \ // shift h2 11 bytes to the left + VO h0, h2, h0 \ // combine h0 with 20 bits from limb 1 + VLEIG $0, $0, h1 \ // clear upper half of h1 + +// if h > 2**130-5 then h -= 2**130-5 +// input: h0, h1 +// temp: t0, t1, t2 +// output: h0 +#define MOD(h0, h1, t0, t1, t2) \ + VZERO t0 \ + VLEIG $1, $5, t0 \ + VACCQ h0, t0, t1 \ + VAQ h0, t0, t0 \ + VONE t2 \ + VLEIG $1, $-4, t2 \ + VAQ t2, t1, t1 \ + VACCQ h1, t1, t1 \ + VONE t2 \ + VAQ t2, t1, t1 \ + VN h0, t1, t2 \ + VNC t0, t1, t1 \ + VO t1, t2, h0 \ + +// func poly1305vmsl(out *[16]byte, m *byte, mlen uint64, key *[32]key) +TEXT ·poly1305vmsl(SB), $0-32 + // This code processes 6 + up to 4 blocks (32 bytes) per iteration + // using the algorithm described in: + // NEON crypto, Daniel J. Bernstein & Peter Schwabe + // https://cryptojedi.org/papers/neoncrypto-20120320.pdf + // And as moddified for VMSL as described in + // Accelerating Poly1305 Cryptographic Message Authentication on the z14 + // O'Farrell et al, CASCON 2017, p48-55 + // https://ibm.ent.box.com/s/jf9gedj0e9d2vjctfyh186shaztavnht + + LMG out+0(FP), R1, R4 // R1=out, R2=m, R3=mlen, R4=key + VZERO V0 // c + + // load EX0, EX1 and EX2 + MOVD $·constants<>(SB), R5 + VLM (R5), EX0, EX2 // c + + // setup r + VL (R4), T_0 + MOVD $·keyMask<>(SB), R6 + VL (R6), T_1 + VN T_0, T_1, T_0 + VZERO T_2 // limbs for r + VZERO T_3 + VZERO T_4 + EXPACC2(T_0, T_2, T_3, T_4, T_1, T_5, T_7) + + // T_2, T_3, T_4: [0, r] + + // setup r*20 + VLEIG $0, $0, T_0 + VLEIG $1, $20, T_0 // T_0: [0, 20] + VZERO T_5 + VZERO T_6 + VMSLG T_0, T_3, T_5, T_5 + VMSLG T_0, T_4, T_6, T_6 + + // store r for final block in GR + VLGVG $1, T_2, RSAVE_0 // c + VLGVG $1, T_3, RSAVE_1 // c + VLGVG $1, T_4, RSAVE_2 // c + VLGVG $1, T_5, R5SAVE_1 // c + VLGVG $1, T_6, R5SAVE_2 // c + + // initialize h + VZERO H0_0 + VZERO H1_0 + VZERO H2_0 + VZERO H0_1 + VZERO H1_1 + VZERO H2_1 + + // initialize pointer for reduce constants + MOVD $·reduce<>(SB), R12 + + // calculate r**2 and 20*(r**2) + VZERO R_0 + VZERO R_1 + VZERO R_2 + SQUARE(T_2, T_3, T_4, T_6, R_0, R_1, R_2, T_1, T_5, T_7) + REDUCE2(R_0, R_1, R_2, M0, M1, M2, M3, M4, R5_1, R5_2, M5, T_1) + VZERO R5_1 + VZERO R5_2 + VMSLG T_0, R_1, R5_1, R5_1 + VMSLG T_0, R_2, R5_2, R5_2 + + // skip r**4 calculation if 3 blocks or less + CMPBLE R3, $48, b4 + + // calculate r**4 and 20*(r**4) + VZERO T_8 + VZERO T_9 + VZERO T_10 + SQUARE(R_0, R_1, R_2, R5_2, T_8, T_9, T_10, T_1, T_5, T_7) + REDUCE2(T_8, T_9, T_10, M0, M1, M2, M3, M4, T_2, T_3, M5, T_1) + VZERO T_2 + VZERO T_3 + VMSLG T_0, T_9, T_2, T_2 + VMSLG T_0, T_10, T_3, T_3 + + // put r**2 to the right and r**4 to the left of R_0, R_1, R_2 + VSLDB $8, T_8, T_8, T_8 + VSLDB $8, T_9, T_9, T_9 + VSLDB $8, T_10, T_10, T_10 + VSLDB $8, T_2, T_2, T_2 + VSLDB $8, T_3, T_3, T_3 + + VO T_8, R_0, R_0 + VO T_9, R_1, R_1 + VO T_10, R_2, R_2 + VO T_2, R5_1, R5_1 + VO T_3, R5_2, R5_2 + + CMPBLE R3, $80, load // less than or equal to 5 blocks in message + + // 6(or 5+1) blocks + SUB $81, R3 + VLM (R2), M0, M4 + VLL R3, 80(R2), M5 + ADD $1, R3 + MOVBZ $1, R0 + CMPBGE R3, $16, 2(PC) + VLVGB R3, R0, M5 + MOVD $96(R2), R2 + EXPACC(M0, M1, H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, T_0, T_1, T_2, T_3) + EXPACC(M2, M3, H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, T_0, T_1, T_2, T_3) + VLEIB $2, $1, H2_0 + VLEIB $2, $1, H2_1 + VLEIB $10, $1, H2_0 + VLEIB $10, $1, H2_1 + + VZERO M0 + VZERO M1 + VZERO M2 + VZERO M3 + VZERO T_4 + VZERO T_10 + EXPACC(M4, M5, M0, M1, M2, M3, T_4, T_10, T_0, T_1, T_2, T_3) + VLR T_4, M4 + VLEIB $10, $1, M2 + CMPBLT R3, $16, 2(PC) + VLEIB $10, $1, T_10 + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M1, M2, M3, M4, T_10, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, T_10, M0, M1, M2, M3, M4, T_4, T_5, T_2, T_7, T_8, T_9) + VMRHG V0, H0_1, H0_0 + VMRHG V0, H1_1, H1_0 + VMRHG V0, H2_1, H2_0 + VMRLG V0, H0_1, H0_1 + VMRLG V0, H1_1, H1_1 + VMRLG V0, H2_1, H2_1 + + SUB $16, R3 + CMPBLE R3, $0, square + +load: + // load EX0, EX1 and EX2 + MOVD $·c<>(SB), R5 + VLM (R5), EX0, EX2 + +loop: + CMPBLE R3, $64, add // b4 // last 4 or less blocks left + + // next 4 full blocks + VLM (R2), M2, M5 + SUB $64, R3 + MOVD $64(R2), R2 + REDUCE(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, T_10, M0, M1, T_0, T_1, T_3, T_4, T_5, T_2, T_7, T_8, T_9) + + // expacc in-lined to create [m2, m3] limbs + VGBM $0x3f3f, T_0 // 44 bit clear mask + VGBM $0x1f1f, T_1 // 40 bit clear mask + VPERM M2, M3, EX0, T_3 + VESRLG $4, T_0, T_0 // 44 bit clear mask ready + VPERM M2, M3, EX1, T_4 + VPERM M2, M3, EX2, T_5 + VN T_0, T_3, T_3 + VESRLG $4, T_4, T_4 + VN T_1, T_5, T_5 + VN T_0, T_4, T_4 + VMRHG H0_1, T_3, H0_0 + VMRHG H1_1, T_4, H1_0 + VMRHG H2_1, T_5, H2_0 + VMRLG H0_1, T_3, H0_1 + VMRLG H1_1, T_4, H1_1 + VMRLG H2_1, T_5, H2_1 + VLEIB $10, $1, H2_0 + VLEIB $10, $1, H2_1 + VPERM M4, M5, EX0, T_3 + VPERM M4, M5, EX1, T_4 + VPERM M4, M5, EX2, T_5 + VN T_0, T_3, T_3 + VESRLG $4, T_4, T_4 + VN T_1, T_5, T_5 + VN T_0, T_4, T_4 + VMRHG V0, T_3, M0 + VMRHG V0, T_4, M1 + VMRHG V0, T_5, M2 + VMRLG V0, T_3, M3 + VMRLG V0, T_4, M4 + VMRLG V0, T_5, M5 + VLEIB $10, $1, M2 + VLEIB $10, $1, M5 + + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M1, M2, M3, M4, M5, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + CMPBNE R3, $0, loop + REDUCE(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, T_10, M0, M1, M3, M4, M5, T_4, T_5, T_2, T_7, T_8, T_9) + VMRHG V0, H0_1, H0_0 + VMRHG V0, H1_1, H1_0 + VMRHG V0, H2_1, H2_0 + VMRLG V0, H0_1, H0_1 + VMRLG V0, H1_1, H1_1 + VMRLG V0, H2_1, H2_1 + + // load EX0, EX1, EX2 + MOVD $·constants<>(SB), R5 + VLM (R5), EX0, EX2 + + // sum vectors + VAQ H0_0, H0_1, H0_0 + VAQ H1_0, H1_1, H1_0 + VAQ H2_0, H2_1, H2_0 + + // h may be >= 2*(2**130-5) so we need to reduce it again + // M0...M4 are used as temps here + REDUCE2(H0_0, H1_0, H2_0, M0, M1, M2, M3, M4, T_9, T_10, H0_1, M5) + +next: // carry h1->h2 + VLEIB $7, $0x28, T_1 + VREPIB $4, T_2 + VGBM $0x003F, T_3 + VESRLG $4, T_3 + + // byte shift + VSRLB T_1, H1_0, T_4 + + // bit shift + VSRL T_2, T_4, T_4 + + // clear h1 carry bits + VN T_3, H1_0, H1_0 + + // add carry + VAQ T_4, H2_0, H2_0 + + // h is now < 2*(2**130-5) + // pack h into h1 (hi) and h0 (lo) + PACK(H0_0, H1_0, H2_0) + + // if h > 2**130-5 then h -= 2**130-5 + MOD(H0_0, H1_0, T_0, T_1, T_2) + + // h += s + MOVD $·bswapMask<>(SB), R5 + VL (R5), T_1 + VL 16(R4), T_0 + VPERM T_0, T_0, T_1, T_0 // reverse bytes (to big) + VAQ T_0, H0_0, H0_0 + VPERM H0_0, H0_0, T_1, H0_0 // reverse bytes (to little) + VST H0_0, (R1) + RET + +add: + // load EX0, EX1, EX2 + MOVD $·constants<>(SB), R5 + VLM (R5), EX0, EX2 + + REDUCE(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, T_10, M0, M1, M3, M4, M5, T_4, T_5, T_2, T_7, T_8, T_9) + VMRHG V0, H0_1, H0_0 + VMRHG V0, H1_1, H1_0 + VMRHG V0, H2_1, H2_0 + VMRLG V0, H0_1, H0_1 + VMRLG V0, H1_1, H1_1 + VMRLG V0, H2_1, H2_1 + CMPBLE R3, $64, b4 + +b4: + CMPBLE R3, $48, b3 // 3 blocks or less + + // 4(3+1) blocks remaining + SUB $49, R3 + VLM (R2), M0, M2 + VLL R3, 48(R2), M3 + ADD $1, R3 + MOVBZ $1, R0 + CMPBEQ R3, $16, 2(PC) + VLVGB R3, R0, M3 + MOVD $64(R2), R2 + EXPACC(M0, M1, H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, T_0, T_1, T_2, T_3) + VLEIB $10, $1, H2_0 + VLEIB $10, $1, H2_1 + VZERO M0 + VZERO M1 + VZERO M4 + VZERO M5 + VZERO T_4 + VZERO T_10 + EXPACC(M2, M3, M0, M1, M4, M5, T_4, T_10, T_0, T_1, T_2, T_3) + VLR T_4, M2 + VLEIB $10, $1, M4 + CMPBNE R3, $16, 2(PC) + VLEIB $10, $1, T_10 + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M1, M4, M5, M2, T_10, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, T_10, M0, M1, M3, M4, M5, T_4, T_5, T_2, T_7, T_8, T_9) + VMRHG V0, H0_1, H0_0 + VMRHG V0, H1_1, H1_0 + VMRHG V0, H2_1, H2_0 + VMRLG V0, H0_1, H0_1 + VMRLG V0, H1_1, H1_1 + VMRLG V0, H2_1, H2_1 + SUB $16, R3 + CMPBLE R3, $0, square // this condition must always hold true! + +b3: + CMPBLE R3, $32, b2 + + // 3 blocks remaining + + // setup [r²,r] + VSLDB $8, R_0, R_0, R_0 + VSLDB $8, R_1, R_1, R_1 + VSLDB $8, R_2, R_2, R_2 + VSLDB $8, R5_1, R5_1, R5_1 + VSLDB $8, R5_2, R5_2, R5_2 + + VLVGG $1, RSAVE_0, R_0 + VLVGG $1, RSAVE_1, R_1 + VLVGG $1, RSAVE_2, R_2 + VLVGG $1, R5SAVE_1, R5_1 + VLVGG $1, R5SAVE_2, R5_2 + + // setup [h0, h1] + VSLDB $8, H0_0, H0_0, H0_0 + VSLDB $8, H1_0, H1_0, H1_0 + VSLDB $8, H2_0, H2_0, H2_0 + VO H0_1, H0_0, H0_0 + VO H1_1, H1_0, H1_0 + VO H2_1, H2_0, H2_0 + VZERO H0_1 + VZERO H1_1 + VZERO H2_1 + + VZERO M0 + VZERO M1 + VZERO M2 + VZERO M3 + VZERO M4 + VZERO M5 + + // H*[r**2, r] + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M1, M2, M3, M4, M5, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE2(H0_0, H1_0, H2_0, M0, M1, M2, M3, M4, H0_1, H1_1, T_10, M5) + + SUB $33, R3 + VLM (R2), M0, M1 + VLL R3, 32(R2), M2 + ADD $1, R3 + MOVBZ $1, R0 + CMPBEQ R3, $16, 2(PC) + VLVGB R3, R0, M2 + + // H += m0 + VZERO T_1 + VZERO T_2 + VZERO T_3 + EXPACC2(M0, T_1, T_2, T_3, T_4, T_5, T_6) + VLEIB $10, $1, T_3 + VAG H0_0, T_1, H0_0 + VAG H1_0, T_2, H1_0 + VAG H2_0, T_3, H2_0 + + VZERO M0 + VZERO M3 + VZERO M4 + VZERO M5 + VZERO T_10 + + // (H+m0)*r + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M3, M4, M5, V0, T_10, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE2(H0_0, H1_0, H2_0, M0, M3, M4, M5, T_10, H0_1, H1_1, H2_1, T_9) + + // H += m1 + VZERO V0 + VZERO T_1 + VZERO T_2 + VZERO T_3 + EXPACC2(M1, T_1, T_2, T_3, T_4, T_5, T_6) + VLEIB $10, $1, T_3 + VAQ H0_0, T_1, H0_0 + VAQ H1_0, T_2, H1_0 + VAQ H2_0, T_3, H2_0 + REDUCE2(H0_0, H1_0, H2_0, M0, M3, M4, M5, T_9, H0_1, H1_1, H2_1, T_10) + + // [H, m2] * [r**2, r] + EXPACC2(M2, H0_0, H1_0, H2_0, T_1, T_2, T_3) + CMPBNE R3, $16, 2(PC) + VLEIB $10, $1, H2_0 + VZERO M0 + VZERO M1 + VZERO M2 + VZERO M3 + VZERO M4 + VZERO M5 + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M1, M2, M3, M4, M5, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE2(H0_0, H1_0, H2_0, M0, M1, M2, M3, M4, H0_1, H1_1, M5, T_10) + SUB $16, R3 + CMPBLE R3, $0, next // this condition must always hold true! + +b2: + CMPBLE R3, $16, b1 + + // 2 blocks remaining + + // setup [r²,r] + VSLDB $8, R_0, R_0, R_0 + VSLDB $8, R_1, R_1, R_1 + VSLDB $8, R_2, R_2, R_2 + VSLDB $8, R5_1, R5_1, R5_1 + VSLDB $8, R5_2, R5_2, R5_2 + + VLVGG $1, RSAVE_0, R_0 + VLVGG $1, RSAVE_1, R_1 + VLVGG $1, RSAVE_2, R_2 + VLVGG $1, R5SAVE_1, R5_1 + VLVGG $1, R5SAVE_2, R5_2 + + // setup [h0, h1] + VSLDB $8, H0_0, H0_0, H0_0 + VSLDB $8, H1_0, H1_0, H1_0 + VSLDB $8, H2_0, H2_0, H2_0 + VO H0_1, H0_0, H0_0 + VO H1_1, H1_0, H1_0 + VO H2_1, H2_0, H2_0 + VZERO H0_1 + VZERO H1_1 + VZERO H2_1 + + VZERO M0 + VZERO M1 + VZERO M2 + VZERO M3 + VZERO M4 + VZERO M5 + + // H*[r**2, r] + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M1, M2, M3, M4, M5, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, T_10, M0, M1, M2, M3, M4, T_4, T_5, T_2, T_7, T_8, T_9) + VMRHG V0, H0_1, H0_0 + VMRHG V0, H1_1, H1_0 + VMRHG V0, H2_1, H2_0 + VMRLG V0, H0_1, H0_1 + VMRLG V0, H1_1, H1_1 + VMRLG V0, H2_1, H2_1 + + // move h to the left and 0s at the right + VSLDB $8, H0_0, H0_0, H0_0 + VSLDB $8, H1_0, H1_0, H1_0 + VSLDB $8, H2_0, H2_0, H2_0 + + // get message blocks and append 1 to start + SUB $17, R3 + VL (R2), M0 + VLL R3, 16(R2), M1 + ADD $1, R3 + MOVBZ $1, R0 + CMPBEQ R3, $16, 2(PC) + VLVGB R3, R0, M1 + VZERO T_6 + VZERO T_7 + VZERO T_8 + EXPACC2(M0, T_6, T_7, T_8, T_1, T_2, T_3) + EXPACC2(M1, T_6, T_7, T_8, T_1, T_2, T_3) + VLEIB $2, $1, T_8 + CMPBNE R3, $16, 2(PC) + VLEIB $10, $1, T_8 + + // add [m0, m1] to h + VAG H0_0, T_6, H0_0 + VAG H1_0, T_7, H1_0 + VAG H2_0, T_8, H2_0 + + VZERO M2 + VZERO M3 + VZERO M4 + VZERO M5 + VZERO T_10 + VZERO M0 + + // at this point R_0 .. R5_2 look like [r**2, r] + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M2, M3, M4, M5, T_10, M0, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE2(H0_0, H1_0, H2_0, M2, M3, M4, M5, T_9, H0_1, H1_1, H2_1, T_10) + SUB $16, R3, R3 + CMPBLE R3, $0, next + +b1: + CMPBLE R3, $0, next + + // 1 block remaining + + // setup [r²,r] + VSLDB $8, R_0, R_0, R_0 + VSLDB $8, R_1, R_1, R_1 + VSLDB $8, R_2, R_2, R_2 + VSLDB $8, R5_1, R5_1, R5_1 + VSLDB $8, R5_2, R5_2, R5_2 + + VLVGG $1, RSAVE_0, R_0 + VLVGG $1, RSAVE_1, R_1 + VLVGG $1, RSAVE_2, R_2 + VLVGG $1, R5SAVE_1, R5_1 + VLVGG $1, R5SAVE_2, R5_2 + + // setup [h0, h1] + VSLDB $8, H0_0, H0_0, H0_0 + VSLDB $8, H1_0, H1_0, H1_0 + VSLDB $8, H2_0, H2_0, H2_0 + VO H0_1, H0_0, H0_0 + VO H1_1, H1_0, H1_0 + VO H2_1, H2_0, H2_0 + VZERO H0_1 + VZERO H1_1 + VZERO H2_1 + + VZERO M0 + VZERO M1 + VZERO M2 + VZERO M3 + VZERO M4 + VZERO M5 + + // H*[r**2, r] + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M1, M2, M3, M4, M5, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE2(H0_0, H1_0, H2_0, M0, M1, M2, M3, M4, T_9, T_10, H0_1, M5) + + // set up [0, m0] limbs + SUB $1, R3 + VLL R3, (R2), M0 + ADD $1, R3 + MOVBZ $1, R0 + CMPBEQ R3, $16, 2(PC) + VLVGB R3, R0, M0 + VZERO T_1 + VZERO T_2 + VZERO T_3 + EXPACC2(M0, T_1, T_2, T_3, T_4, T_5, T_6)// limbs: [0, m] + CMPBNE R3, $16, 2(PC) + VLEIB $10, $1, T_3 + + // h+m0 + VAQ H0_0, T_1, H0_0 + VAQ H1_0, T_2, H1_0 + VAQ H2_0, T_3, H2_0 + + VZERO M0 + VZERO M1 + VZERO M2 + VZERO M3 + VZERO M4 + VZERO M5 + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M1, M2, M3, M4, M5, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE2(H0_0, H1_0, H2_0, M0, M1, M2, M3, M4, T_9, T_10, H0_1, M5) + + BR next + +square: + // setup [r²,r] + VSLDB $8, R_0, R_0, R_0 + VSLDB $8, R_1, R_1, R_1 + VSLDB $8, R_2, R_2, R_2 + VSLDB $8, R5_1, R5_1, R5_1 + VSLDB $8, R5_2, R5_2, R5_2 + + VLVGG $1, RSAVE_0, R_0 + VLVGG $1, RSAVE_1, R_1 + VLVGG $1, RSAVE_2, R_2 + VLVGG $1, R5SAVE_1, R5_1 + VLVGG $1, R5SAVE_2, R5_2 + + // setup [h0, h1] + VSLDB $8, H0_0, H0_0, H0_0 + VSLDB $8, H1_0, H1_0, H1_0 + VSLDB $8, H2_0, H2_0, H2_0 + VO H0_1, H0_0, H0_0 + VO H1_1, H1_0, H1_0 + VO H2_1, H2_0, H2_0 + VZERO H0_1 + VZERO H1_1 + VZERO H2_1 + + VZERO M0 + VZERO M1 + VZERO M2 + VZERO M3 + VZERO M4 + VZERO M5 + + // (h0*r**2) + (h1*r) + MULTIPLY(H0_0, H1_0, H2_0, H0_1, H1_1, H2_1, R_0, R_1, R_2, R5_1, R5_2, M0, M1, M2, M3, M4, M5, T_0, T_1, T_2, T_3, T_4, T_5, T_6, T_7, T_8, T_9) + REDUCE2(H0_0, H1_0, H2_0, M0, M1, M2, M3, M4, T_9, T_10, H0_1, M5) + BR next diff --git a/vendor/golang.org/x/crypto/ssh/agent/client.go b/vendor/golang.org/x/crypto/ssh/agent/client.go new file mode 100644 index 0000000..51f7405 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/agent/client.go @@ -0,0 +1,789 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package agent implements the ssh-agent protocol, and provides both +// a client and a server. The client can talk to a standard ssh-agent +// that uses UNIX sockets, and one could implement an alternative +// ssh-agent process using the sample server. +// +// References: +// [PROTOCOL.agent]: https://tools.ietf.org/html/draft-miller-ssh-agent-00 +package agent // import "golang.org/x/crypto/ssh/agent" + +import ( + "bytes" + "crypto/dsa" + "crypto/ecdsa" + "crypto/elliptic" + "crypto/rsa" + "encoding/base64" + "encoding/binary" + "errors" + "fmt" + "io" + "math/big" + "sync" + + "crypto" + "golang.org/x/crypto/ed25519" + "golang.org/x/crypto/ssh" +) + +// SignatureFlags represent additional flags that can be passed to the signature +// requests an defined in [PROTOCOL.agent] section 4.5.1. +type SignatureFlags uint32 + +// SignatureFlag values as defined in [PROTOCOL.agent] section 5.3. +const ( + SignatureFlagReserved SignatureFlags = 1 << iota + SignatureFlagRsaSha256 + SignatureFlagRsaSha512 +) + +// Agent represents the capabilities of an ssh-agent. +type Agent interface { + // List returns the identities known to the agent. + List() ([]*Key, error) + + // Sign has the agent sign the data using a protocol 2 key as defined + // in [PROTOCOL.agent] section 2.6.2. + Sign(key ssh.PublicKey, data []byte) (*ssh.Signature, error) + + // Add adds a private key to the agent. + Add(key AddedKey) error + + // Remove removes all identities with the given public key. + Remove(key ssh.PublicKey) error + + // RemoveAll removes all identities. + RemoveAll() error + + // Lock locks the agent. Sign and Remove will fail, and List will empty an empty list. + Lock(passphrase []byte) error + + // Unlock undoes the effect of Lock + Unlock(passphrase []byte) error + + // Signers returns signers for all the known keys. + Signers() ([]ssh.Signer, error) +} + +type ExtendedAgent interface { + Agent + + // SignWithFlags signs like Sign, but allows for additional flags to be sent/received + SignWithFlags(key ssh.PublicKey, data []byte, flags SignatureFlags) (*ssh.Signature, error) + + // Extension processes a custom extension request. Standard-compliant agents are not + // required to support any extensions, but this method allows agents to implement + // vendor-specific methods or add experimental features. See [PROTOCOL.agent] section 4.7. + // If agent extensions are unsupported entirely this method MUST return an + // ErrExtensionUnsupported error. Similarly, if just the specific extensionType in + // the request is unsupported by the agent then ErrExtensionUnsupported MUST be + // returned. + // + // In the case of success, since [PROTOCOL.agent] section 4.7 specifies that the contents + // of the response are unspecified (including the type of the message), the complete + // response will be returned as a []byte slice, including the "type" byte of the message. + Extension(extensionType string, contents []byte) ([]byte, error) +} + +// ConstraintExtension describes an optional constraint defined by users. +type ConstraintExtension struct { + // ExtensionName consist of a UTF-8 string suffixed by the + // implementation domain following the naming scheme defined + // in Section 4.2 of [RFC4251], e.g. "foo@example.com". + ExtensionName string + // ExtensionDetails contains the actual content of the extended + // constraint. + ExtensionDetails []byte +} + +// AddedKey describes an SSH key to be added to an Agent. +type AddedKey struct { + // PrivateKey must be a *rsa.PrivateKey, *dsa.PrivateKey or + // *ecdsa.PrivateKey, which will be inserted into the agent. + PrivateKey interface{} + // Certificate, if not nil, is communicated to the agent and will be + // stored with the key. + Certificate *ssh.Certificate + // Comment is an optional, free-form string. + Comment string + // LifetimeSecs, if not zero, is the number of seconds that the + // agent will store the key for. + LifetimeSecs uint32 + // ConfirmBeforeUse, if true, requests that the agent confirm with the + // user before each use of this key. + ConfirmBeforeUse bool + // ConstraintExtensions are the experimental or private-use constraints + // defined by users. + ConstraintExtensions []ConstraintExtension +} + +// See [PROTOCOL.agent], section 3. +const ( + agentRequestV1Identities = 1 + agentRemoveAllV1Identities = 9 + + // 3.2 Requests from client to agent for protocol 2 key operations + agentAddIdentity = 17 + agentRemoveIdentity = 18 + agentRemoveAllIdentities = 19 + agentAddIDConstrained = 25 + + // 3.3 Key-type independent requests from client to agent + agentAddSmartcardKey = 20 + agentRemoveSmartcardKey = 21 + agentLock = 22 + agentUnlock = 23 + agentAddSmartcardKeyConstrained = 26 + + // 3.7 Key constraint identifiers + agentConstrainLifetime = 1 + agentConstrainConfirm = 2 + agentConstrainExtension = 3 +) + +// maxAgentResponseBytes is the maximum agent reply size that is accepted. This +// is a sanity check, not a limit in the spec. +const maxAgentResponseBytes = 16 << 20 + +// Agent messages: +// These structures mirror the wire format of the corresponding ssh agent +// messages found in [PROTOCOL.agent]. + +// 3.4 Generic replies from agent to client +const agentFailure = 5 + +type failureAgentMsg struct{} + +const agentSuccess = 6 + +type successAgentMsg struct{} + +// See [PROTOCOL.agent], section 2.5.2. +const agentRequestIdentities = 11 + +type requestIdentitiesAgentMsg struct{} + +// See [PROTOCOL.agent], section 2.5.2. +const agentIdentitiesAnswer = 12 + +type identitiesAnswerAgentMsg struct { + NumKeys uint32 `sshtype:"12"` + Keys []byte `ssh:"rest"` +} + +// See [PROTOCOL.agent], section 2.6.2. +const agentSignRequest = 13 + +type signRequestAgentMsg struct { + KeyBlob []byte `sshtype:"13"` + Data []byte + Flags uint32 +} + +// See [PROTOCOL.agent], section 2.6.2. + +// 3.6 Replies from agent to client for protocol 2 key operations +const agentSignResponse = 14 + +type signResponseAgentMsg struct { + SigBlob []byte `sshtype:"14"` +} + +type publicKey struct { + Format string + Rest []byte `ssh:"rest"` +} + +// 3.7 Key constraint identifiers +type constrainLifetimeAgentMsg struct { + LifetimeSecs uint32 `sshtype:"1"` +} + +type constrainExtensionAgentMsg struct { + ExtensionName string `sshtype:"3"` + ExtensionDetails []byte + + // Rest is a field used for parsing, not part of message + Rest []byte `ssh:"rest"` +} + +// See [PROTOCOL.agent], section 4.7 +const agentExtension = 27 +const agentExtensionFailure = 28 + +// ErrExtensionUnsupported indicates that an extension defined in +// [PROTOCOL.agent] section 4.7 is unsupported by the agent. Specifically this +// error indicates that the agent returned a standard SSH_AGENT_FAILURE message +// as the result of a SSH_AGENTC_EXTENSION request. Note that the protocol +// specification (and therefore this error) does not distinguish between a +// specific extension being unsupported and extensions being unsupported entirely. +var ErrExtensionUnsupported = errors.New("agent: extension unsupported") + +type extensionAgentMsg struct { + ExtensionType string `sshtype:"27"` + Contents []byte +} + +// Key represents a protocol 2 public key as defined in +// [PROTOCOL.agent], section 2.5.2. +type Key struct { + Format string + Blob []byte + Comment string +} + +func clientErr(err error) error { + return fmt.Errorf("agent: client error: %v", err) +} + +// String returns the storage form of an agent key with the format, base64 +// encoded serialized key, and the comment if it is not empty. +func (k *Key) String() string { + s := string(k.Format) + " " + base64.StdEncoding.EncodeToString(k.Blob) + + if k.Comment != "" { + s += " " + k.Comment + } + + return s +} + +// Type returns the public key type. +func (k *Key) Type() string { + return k.Format +} + +// Marshal returns key blob to satisfy the ssh.PublicKey interface. +func (k *Key) Marshal() []byte { + return k.Blob +} + +// Verify satisfies the ssh.PublicKey interface. +func (k *Key) Verify(data []byte, sig *ssh.Signature) error { + pubKey, err := ssh.ParsePublicKey(k.Blob) + if err != nil { + return fmt.Errorf("agent: bad public key: %v", err) + } + return pubKey.Verify(data, sig) +} + +type wireKey struct { + Format string + Rest []byte `ssh:"rest"` +} + +func parseKey(in []byte) (out *Key, rest []byte, err error) { + var record struct { + Blob []byte + Comment string + Rest []byte `ssh:"rest"` + } + + if err := ssh.Unmarshal(in, &record); err != nil { + return nil, nil, err + } + + var wk wireKey + if err := ssh.Unmarshal(record.Blob, &wk); err != nil { + return nil, nil, err + } + + return &Key{ + Format: wk.Format, + Blob: record.Blob, + Comment: record.Comment, + }, record.Rest, nil +} + +// client is a client for an ssh-agent process. +type client struct { + // conn is typically a *net.UnixConn + conn io.ReadWriter + // mu is used to prevent concurrent access to the agent + mu sync.Mutex +} + +// NewClient returns an Agent that talks to an ssh-agent process over +// the given connection. +func NewClient(rw io.ReadWriter) ExtendedAgent { + return &client{conn: rw} +} + +// call sends an RPC to the agent. On success, the reply is +// unmarshaled into reply and replyType is set to the first byte of +// the reply, which contains the type of the message. +func (c *client) call(req []byte) (reply interface{}, err error) { + buf, err := c.callRaw(req) + if err != nil { + return nil, err + } + reply, err = unmarshal(buf) + if err != nil { + return nil, clientErr(err) + } + return reply, nil +} + +// callRaw sends an RPC to the agent. On success, the raw +// bytes of the response are returned; no unmarshalling is +// performed on the response. +func (c *client) callRaw(req []byte) (reply []byte, err error) { + c.mu.Lock() + defer c.mu.Unlock() + + msg := make([]byte, 4+len(req)) + binary.BigEndian.PutUint32(msg, uint32(len(req))) + copy(msg[4:], req) + if _, err = c.conn.Write(msg); err != nil { + return nil, clientErr(err) + } + + var respSizeBuf [4]byte + if _, err = io.ReadFull(c.conn, respSizeBuf[:]); err != nil { + return nil, clientErr(err) + } + respSize := binary.BigEndian.Uint32(respSizeBuf[:]) + if respSize > maxAgentResponseBytes { + return nil, clientErr(errors.New("response too large")) + } + + buf := make([]byte, respSize) + if _, err = io.ReadFull(c.conn, buf); err != nil { + return nil, clientErr(err) + } + return buf, nil +} + +func (c *client) simpleCall(req []byte) error { + resp, err := c.call(req) + if err != nil { + return err + } + if _, ok := resp.(*successAgentMsg); ok { + return nil + } + return errors.New("agent: failure") +} + +func (c *client) RemoveAll() error { + return c.simpleCall([]byte{agentRemoveAllIdentities}) +} + +func (c *client) Remove(key ssh.PublicKey) error { + req := ssh.Marshal(&agentRemoveIdentityMsg{ + KeyBlob: key.Marshal(), + }) + return c.simpleCall(req) +} + +func (c *client) Lock(passphrase []byte) error { + req := ssh.Marshal(&agentLockMsg{ + Passphrase: passphrase, + }) + return c.simpleCall(req) +} + +func (c *client) Unlock(passphrase []byte) error { + req := ssh.Marshal(&agentUnlockMsg{ + Passphrase: passphrase, + }) + return c.simpleCall(req) +} + +// List returns the identities known to the agent. +func (c *client) List() ([]*Key, error) { + // see [PROTOCOL.agent] section 2.5.2. + req := []byte{agentRequestIdentities} + + msg, err := c.call(req) + if err != nil { + return nil, err + } + + switch msg := msg.(type) { + case *identitiesAnswerAgentMsg: + if msg.NumKeys > maxAgentResponseBytes/8 { + return nil, errors.New("agent: too many keys in agent reply") + } + keys := make([]*Key, msg.NumKeys) + data := msg.Keys + for i := uint32(0); i < msg.NumKeys; i++ { + var key *Key + var err error + if key, data, err = parseKey(data); err != nil { + return nil, err + } + keys[i] = key + } + return keys, nil + case *failureAgentMsg: + return nil, errors.New("agent: failed to list keys") + } + panic("unreachable") +} + +// Sign has the agent sign the data using a protocol 2 key as defined +// in [PROTOCOL.agent] section 2.6.2. +func (c *client) Sign(key ssh.PublicKey, data []byte) (*ssh.Signature, error) { + return c.SignWithFlags(key, data, 0) +} + +func (c *client) SignWithFlags(key ssh.PublicKey, data []byte, flags SignatureFlags) (*ssh.Signature, error) { + req := ssh.Marshal(signRequestAgentMsg{ + KeyBlob: key.Marshal(), + Data: data, + Flags: uint32(flags), + }) + + msg, err := c.call(req) + if err != nil { + return nil, err + } + + switch msg := msg.(type) { + case *signResponseAgentMsg: + var sig ssh.Signature + if err := ssh.Unmarshal(msg.SigBlob, &sig); err != nil { + return nil, err + } + + return &sig, nil + case *failureAgentMsg: + return nil, errors.New("agent: failed to sign challenge") + } + panic("unreachable") +} + +// unmarshal parses an agent message in packet, returning the parsed +// form and the message type of packet. +func unmarshal(packet []byte) (interface{}, error) { + if len(packet) < 1 { + return nil, errors.New("agent: empty packet") + } + var msg interface{} + switch packet[0] { + case agentFailure: + return new(failureAgentMsg), nil + case agentSuccess: + return new(successAgentMsg), nil + case agentIdentitiesAnswer: + msg = new(identitiesAnswerAgentMsg) + case agentSignResponse: + msg = new(signResponseAgentMsg) + case agentV1IdentitiesAnswer: + msg = new(agentV1IdentityMsg) + default: + return nil, fmt.Errorf("agent: unknown type tag %d", packet[0]) + } + if err := ssh.Unmarshal(packet, msg); err != nil { + return nil, err + } + return msg, nil +} + +type rsaKeyMsg struct { + Type string `sshtype:"17|25"` + N *big.Int + E *big.Int + D *big.Int + Iqmp *big.Int // IQMP = Inverse Q Mod P + P *big.Int + Q *big.Int + Comments string + Constraints []byte `ssh:"rest"` +} + +type dsaKeyMsg struct { + Type string `sshtype:"17|25"` + P *big.Int + Q *big.Int + G *big.Int + Y *big.Int + X *big.Int + Comments string + Constraints []byte `ssh:"rest"` +} + +type ecdsaKeyMsg struct { + Type string `sshtype:"17|25"` + Curve string + KeyBytes []byte + D *big.Int + Comments string + Constraints []byte `ssh:"rest"` +} + +type ed25519KeyMsg struct { + Type string `sshtype:"17|25"` + Pub []byte + Priv []byte + Comments string + Constraints []byte `ssh:"rest"` +} + +// Insert adds a private key to the agent. +func (c *client) insertKey(s interface{}, comment string, constraints []byte) error { + var req []byte + switch k := s.(type) { + case *rsa.PrivateKey: + if len(k.Primes) != 2 { + return fmt.Errorf("agent: unsupported RSA key with %d primes", len(k.Primes)) + } + k.Precompute() + req = ssh.Marshal(rsaKeyMsg{ + Type: ssh.KeyAlgoRSA, + N: k.N, + E: big.NewInt(int64(k.E)), + D: k.D, + Iqmp: k.Precomputed.Qinv, + P: k.Primes[0], + Q: k.Primes[1], + Comments: comment, + Constraints: constraints, + }) + case *dsa.PrivateKey: + req = ssh.Marshal(dsaKeyMsg{ + Type: ssh.KeyAlgoDSA, + P: k.P, + Q: k.Q, + G: k.G, + Y: k.Y, + X: k.X, + Comments: comment, + Constraints: constraints, + }) + case *ecdsa.PrivateKey: + nistID := fmt.Sprintf("nistp%d", k.Params().BitSize) + req = ssh.Marshal(ecdsaKeyMsg{ + Type: "ecdsa-sha2-" + nistID, + Curve: nistID, + KeyBytes: elliptic.Marshal(k.Curve, k.X, k.Y), + D: k.D, + Comments: comment, + Constraints: constraints, + }) + case *ed25519.PrivateKey: + req = ssh.Marshal(ed25519KeyMsg{ + Type: ssh.KeyAlgoED25519, + Pub: []byte(*k)[32:], + Priv: []byte(*k), + Comments: comment, + Constraints: constraints, + }) + default: + return fmt.Errorf("agent: unsupported key type %T", s) + } + + // if constraints are present then the message type needs to be changed. + if len(constraints) != 0 { + req[0] = agentAddIDConstrained + } + + resp, err := c.call(req) + if err != nil { + return err + } + if _, ok := resp.(*successAgentMsg); ok { + return nil + } + return errors.New("agent: failure") +} + +type rsaCertMsg struct { + Type string `sshtype:"17|25"` + CertBytes []byte + D *big.Int + Iqmp *big.Int // IQMP = Inverse Q Mod P + P *big.Int + Q *big.Int + Comments string + Constraints []byte `ssh:"rest"` +} + +type dsaCertMsg struct { + Type string `sshtype:"17|25"` + CertBytes []byte + X *big.Int + Comments string + Constraints []byte `ssh:"rest"` +} + +type ecdsaCertMsg struct { + Type string `sshtype:"17|25"` + CertBytes []byte + D *big.Int + Comments string + Constraints []byte `ssh:"rest"` +} + +type ed25519CertMsg struct { + Type string `sshtype:"17|25"` + CertBytes []byte + Pub []byte + Priv []byte + Comments string + Constraints []byte `ssh:"rest"` +} + +// Add adds a private key to the agent. If a certificate is given, +// that certificate is added instead as public key. +func (c *client) Add(key AddedKey) error { + var constraints []byte + + if secs := key.LifetimeSecs; secs != 0 { + constraints = append(constraints, ssh.Marshal(constrainLifetimeAgentMsg{secs})...) + } + + if key.ConfirmBeforeUse { + constraints = append(constraints, agentConstrainConfirm) + } + + cert := key.Certificate + if cert == nil { + return c.insertKey(key.PrivateKey, key.Comment, constraints) + } + return c.insertCert(key.PrivateKey, cert, key.Comment, constraints) +} + +func (c *client) insertCert(s interface{}, cert *ssh.Certificate, comment string, constraints []byte) error { + var req []byte + switch k := s.(type) { + case *rsa.PrivateKey: + if len(k.Primes) != 2 { + return fmt.Errorf("agent: unsupported RSA key with %d primes", len(k.Primes)) + } + k.Precompute() + req = ssh.Marshal(rsaCertMsg{ + Type: cert.Type(), + CertBytes: cert.Marshal(), + D: k.D, + Iqmp: k.Precomputed.Qinv, + P: k.Primes[0], + Q: k.Primes[1], + Comments: comment, + Constraints: constraints, + }) + case *dsa.PrivateKey: + req = ssh.Marshal(dsaCertMsg{ + Type: cert.Type(), + CertBytes: cert.Marshal(), + X: k.X, + Comments: comment, + Constraints: constraints, + }) + case *ecdsa.PrivateKey: + req = ssh.Marshal(ecdsaCertMsg{ + Type: cert.Type(), + CertBytes: cert.Marshal(), + D: k.D, + Comments: comment, + Constraints: constraints, + }) + case *ed25519.PrivateKey: + req = ssh.Marshal(ed25519CertMsg{ + Type: cert.Type(), + CertBytes: cert.Marshal(), + Pub: []byte(*k)[32:], + Priv: []byte(*k), + Comments: comment, + Constraints: constraints, + }) + default: + return fmt.Errorf("agent: unsupported key type %T", s) + } + + // if constraints are present then the message type needs to be changed. + if len(constraints) != 0 { + req[0] = agentAddIDConstrained + } + + signer, err := ssh.NewSignerFromKey(s) + if err != nil { + return err + } + if bytes.Compare(cert.Key.Marshal(), signer.PublicKey().Marshal()) != 0 { + return errors.New("agent: signer and cert have different public key") + } + + resp, err := c.call(req) + if err != nil { + return err + } + if _, ok := resp.(*successAgentMsg); ok { + return nil + } + return errors.New("agent: failure") +} + +// Signers provides a callback for client authentication. +func (c *client) Signers() ([]ssh.Signer, error) { + keys, err := c.List() + if err != nil { + return nil, err + } + + var result []ssh.Signer + for _, k := range keys { + result = append(result, &agentKeyringSigner{c, k}) + } + return result, nil +} + +type agentKeyringSigner struct { + agent *client + pub ssh.PublicKey +} + +func (s *agentKeyringSigner) PublicKey() ssh.PublicKey { + return s.pub +} + +func (s *agentKeyringSigner) Sign(rand io.Reader, data []byte) (*ssh.Signature, error) { + // The agent has its own entropy source, so the rand argument is ignored. + return s.agent.Sign(s.pub, data) +} + +func (s *agentKeyringSigner) SignWithOpts(rand io.Reader, data []byte, opts crypto.SignerOpts) (*ssh.Signature, error) { + var flags SignatureFlags + if opts != nil { + switch opts.HashFunc() { + case crypto.SHA256: + flags = SignatureFlagRsaSha256 + case crypto.SHA512: + flags = SignatureFlagRsaSha512 + } + } + return s.agent.SignWithFlags(s.pub, data, flags) +} + +// Calls an extension method. It is up to the agent implementation as to whether or not +// any particular extension is supported and may always return an error. Because the +// type of the response is up to the implementation, this returns the bytes of the +// response and does not attempt any type of unmarshalling. +func (c *client) Extension(extensionType string, contents []byte) ([]byte, error) { + req := ssh.Marshal(extensionAgentMsg{ + ExtensionType: extensionType, + Contents: contents, + }) + buf, err := c.callRaw(req) + if err != nil { + return nil, err + } + if len(buf) == 0 { + return nil, errors.New("agent: failure; empty response") + } + // [PROTOCOL.agent] section 4.7 indicates that an SSH_AGENT_FAILURE message + // represents an agent that does not support the extension + if buf[0] == agentFailure { + return nil, ErrExtensionUnsupported + } + if buf[0] == agentExtensionFailure { + return nil, errors.New("agent: generic extension failure") + } + + return buf, nil +} diff --git a/vendor/golang.org/x/crypto/ssh/agent/forward.go b/vendor/golang.org/x/crypto/ssh/agent/forward.go new file mode 100644 index 0000000..fd24ba9 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/agent/forward.go @@ -0,0 +1,103 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package agent + +import ( + "errors" + "io" + "net" + "sync" + + "golang.org/x/crypto/ssh" +) + +// RequestAgentForwarding sets up agent forwarding for the session. +// ForwardToAgent or ForwardToRemote should be called to route +// the authentication requests. +func RequestAgentForwarding(session *ssh.Session) error { + ok, err := session.SendRequest("auth-agent-req@openssh.com", true, nil) + if err != nil { + return err + } + if !ok { + return errors.New("forwarding request denied") + } + return nil +} + +// ForwardToAgent routes authentication requests to the given keyring. +func ForwardToAgent(client *ssh.Client, keyring Agent) error { + channels := client.HandleChannelOpen(channelType) + if channels == nil { + return errors.New("agent: already have handler for " + channelType) + } + + go func() { + for ch := range channels { + channel, reqs, err := ch.Accept() + if err != nil { + continue + } + go ssh.DiscardRequests(reqs) + go func() { + ServeAgent(keyring, channel) + channel.Close() + }() + } + }() + return nil +} + +const channelType = "auth-agent@openssh.com" + +// ForwardToRemote routes authentication requests to the ssh-agent +// process serving on the given unix socket. +func ForwardToRemote(client *ssh.Client, addr string) error { + channels := client.HandleChannelOpen(channelType) + if channels == nil { + return errors.New("agent: already have handler for " + channelType) + } + conn, err := net.Dial("unix", addr) + if err != nil { + return err + } + conn.Close() + + go func() { + for ch := range channels { + channel, reqs, err := ch.Accept() + if err != nil { + continue + } + go ssh.DiscardRequests(reqs) + go forwardUnixSocket(channel, addr) + } + }() + return nil +} + +func forwardUnixSocket(channel ssh.Channel, addr string) { + conn, err := net.Dial("unix", addr) + if err != nil { + return + } + + var wg sync.WaitGroup + wg.Add(2) + go func() { + io.Copy(conn, channel) + conn.(*net.UnixConn).CloseWrite() + wg.Done() + }() + go func() { + io.Copy(channel, conn) + channel.CloseWrite() + wg.Done() + }() + + wg.Wait() + conn.Close() + channel.Close() +} diff --git a/vendor/golang.org/x/crypto/ssh/agent/keyring.go b/vendor/golang.org/x/crypto/ssh/agent/keyring.go new file mode 100644 index 0000000..c9d9794 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/agent/keyring.go @@ -0,0 +1,241 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package agent + +import ( + "bytes" + "crypto/rand" + "crypto/subtle" + "errors" + "fmt" + "sync" + "time" + + "golang.org/x/crypto/ssh" +) + +type privKey struct { + signer ssh.Signer + comment string + expire *time.Time +} + +type keyring struct { + mu sync.Mutex + keys []privKey + + locked bool + passphrase []byte +} + +var errLocked = errors.New("agent: locked") + +// NewKeyring returns an Agent that holds keys in memory. It is safe +// for concurrent use by multiple goroutines. +func NewKeyring() Agent { + return &keyring{} +} + +// RemoveAll removes all identities. +func (r *keyring) RemoveAll() error { + r.mu.Lock() + defer r.mu.Unlock() + if r.locked { + return errLocked + } + + r.keys = nil + return nil +} + +// removeLocked does the actual key removal. The caller must already be holding the +// keyring mutex. +func (r *keyring) removeLocked(want []byte) error { + found := false + for i := 0; i < len(r.keys); { + if bytes.Equal(r.keys[i].signer.PublicKey().Marshal(), want) { + found = true + r.keys[i] = r.keys[len(r.keys)-1] + r.keys = r.keys[:len(r.keys)-1] + continue + } else { + i++ + } + } + + if !found { + return errors.New("agent: key not found") + } + return nil +} + +// Remove removes all identities with the given public key. +func (r *keyring) Remove(key ssh.PublicKey) error { + r.mu.Lock() + defer r.mu.Unlock() + if r.locked { + return errLocked + } + + return r.removeLocked(key.Marshal()) +} + +// Lock locks the agent. Sign and Remove will fail, and List will return an empty list. +func (r *keyring) Lock(passphrase []byte) error { + r.mu.Lock() + defer r.mu.Unlock() + if r.locked { + return errLocked + } + + r.locked = true + r.passphrase = passphrase + return nil +} + +// Unlock undoes the effect of Lock +func (r *keyring) Unlock(passphrase []byte) error { + r.mu.Lock() + defer r.mu.Unlock() + if !r.locked { + return errors.New("agent: not locked") + } + if 1 != subtle.ConstantTimeCompare(passphrase, r.passphrase) { + return fmt.Errorf("agent: incorrect passphrase") + } + + r.locked = false + r.passphrase = nil + return nil +} + +// expireKeysLocked removes expired keys from the keyring. If a key was added +// with a lifetimesecs contraint and seconds >= lifetimesecs seconds have +// ellapsed, it is removed. The caller *must* be holding the keyring mutex. +func (r *keyring) expireKeysLocked() { + for _, k := range r.keys { + if k.expire != nil && time.Now().After(*k.expire) { + r.removeLocked(k.signer.PublicKey().Marshal()) + } + } +} + +// List returns the identities known to the agent. +func (r *keyring) List() ([]*Key, error) { + r.mu.Lock() + defer r.mu.Unlock() + if r.locked { + // section 2.7: locked agents return empty. + return nil, nil + } + + r.expireKeysLocked() + var ids []*Key + for _, k := range r.keys { + pub := k.signer.PublicKey() + ids = append(ids, &Key{ + Format: pub.Type(), + Blob: pub.Marshal(), + Comment: k.comment}) + } + return ids, nil +} + +// Insert adds a private key to the keyring. If a certificate +// is given, that certificate is added as public key. Note that +// any constraints given are ignored. +func (r *keyring) Add(key AddedKey) error { + r.mu.Lock() + defer r.mu.Unlock() + if r.locked { + return errLocked + } + signer, err := ssh.NewSignerFromKey(key.PrivateKey) + + if err != nil { + return err + } + + if cert := key.Certificate; cert != nil { + signer, err = ssh.NewCertSigner(cert, signer) + if err != nil { + return err + } + } + + p := privKey{ + signer: signer, + comment: key.Comment, + } + + if key.LifetimeSecs > 0 { + t := time.Now().Add(time.Duration(key.LifetimeSecs) * time.Second) + p.expire = &t + } + + r.keys = append(r.keys, p) + + return nil +} + +// Sign returns a signature for the data. +func (r *keyring) Sign(key ssh.PublicKey, data []byte) (*ssh.Signature, error) { + return r.SignWithFlags(key, data, 0) +} + +func (r *keyring) SignWithFlags(key ssh.PublicKey, data []byte, flags SignatureFlags) (*ssh.Signature, error) { + r.mu.Lock() + defer r.mu.Unlock() + if r.locked { + return nil, errLocked + } + + r.expireKeysLocked() + wanted := key.Marshal() + for _, k := range r.keys { + if bytes.Equal(k.signer.PublicKey().Marshal(), wanted) { + if flags == 0 { + return k.signer.Sign(rand.Reader, data) + } else { + if algorithmSigner, ok := k.signer.(ssh.AlgorithmSigner); !ok { + return nil, fmt.Errorf("agent: signature does not support non-default signature algorithm: %T", k.signer) + } else { + var algorithm string + switch flags { + case SignatureFlagRsaSha256: + algorithm = ssh.SigAlgoRSASHA2256 + case SignatureFlagRsaSha512: + algorithm = ssh.SigAlgoRSASHA2512 + default: + return nil, fmt.Errorf("agent: unsupported signature flags: %d", flags) + } + return algorithmSigner.SignWithAlgorithm(rand.Reader, data, algorithm) + } + } + } + } + return nil, errors.New("not found") +} + +// Signers returns signers for all the known keys. +func (r *keyring) Signers() ([]ssh.Signer, error) { + r.mu.Lock() + defer r.mu.Unlock() + if r.locked { + return nil, errLocked + } + + r.expireKeysLocked() + s := make([]ssh.Signer, 0, len(r.keys)) + for _, k := range r.keys { + s = append(s, k.signer) + } + return s, nil +} + +// The keyring does not support any extensions +func (r *keyring) Extension(extensionType string, contents []byte) ([]byte, error) { + return nil, ErrExtensionUnsupported +} diff --git a/vendor/golang.org/x/crypto/ssh/agent/server.go b/vendor/golang.org/x/crypto/ssh/agent/server.go new file mode 100644 index 0000000..6e7a1e0 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/agent/server.go @@ -0,0 +1,570 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package agent + +import ( + "crypto/dsa" + "crypto/ecdsa" + "crypto/elliptic" + "crypto/rsa" + "encoding/binary" + "errors" + "fmt" + "io" + "log" + "math/big" + + "golang.org/x/crypto/ed25519" + "golang.org/x/crypto/ssh" +) + +// Server wraps an Agent and uses it to implement the agent side of +// the SSH-agent, wire protocol. +type server struct { + agent Agent +} + +func (s *server) processRequestBytes(reqData []byte) []byte { + rep, err := s.processRequest(reqData) + if err != nil { + if err != errLocked { + // TODO(hanwen): provide better logging interface? + log.Printf("agent %d: %v", reqData[0], err) + } + return []byte{agentFailure} + } + + if err == nil && rep == nil { + return []byte{agentSuccess} + } + + return ssh.Marshal(rep) +} + +func marshalKey(k *Key) []byte { + var record struct { + Blob []byte + Comment string + } + record.Blob = k.Marshal() + record.Comment = k.Comment + + return ssh.Marshal(&record) +} + +// See [PROTOCOL.agent], section 2.5.1. +const agentV1IdentitiesAnswer = 2 + +type agentV1IdentityMsg struct { + Numkeys uint32 `sshtype:"2"` +} + +type agentRemoveIdentityMsg struct { + KeyBlob []byte `sshtype:"18"` +} + +type agentLockMsg struct { + Passphrase []byte `sshtype:"22"` +} + +type agentUnlockMsg struct { + Passphrase []byte `sshtype:"23"` +} + +func (s *server) processRequest(data []byte) (interface{}, error) { + switch data[0] { + case agentRequestV1Identities: + return &agentV1IdentityMsg{0}, nil + + case agentRemoveAllV1Identities: + return nil, nil + + case agentRemoveIdentity: + var req agentRemoveIdentityMsg + if err := ssh.Unmarshal(data, &req); err != nil { + return nil, err + } + + var wk wireKey + if err := ssh.Unmarshal(req.KeyBlob, &wk); err != nil { + return nil, err + } + + return nil, s.agent.Remove(&Key{Format: wk.Format, Blob: req.KeyBlob}) + + case agentRemoveAllIdentities: + return nil, s.agent.RemoveAll() + + case agentLock: + var req agentLockMsg + if err := ssh.Unmarshal(data, &req); err != nil { + return nil, err + } + + return nil, s.agent.Lock(req.Passphrase) + + case agentUnlock: + var req agentUnlockMsg + if err := ssh.Unmarshal(data, &req); err != nil { + return nil, err + } + return nil, s.agent.Unlock(req.Passphrase) + + case agentSignRequest: + var req signRequestAgentMsg + if err := ssh.Unmarshal(data, &req); err != nil { + return nil, err + } + + var wk wireKey + if err := ssh.Unmarshal(req.KeyBlob, &wk); err != nil { + return nil, err + } + + k := &Key{ + Format: wk.Format, + Blob: req.KeyBlob, + } + + var sig *ssh.Signature + var err error + if extendedAgent, ok := s.agent.(ExtendedAgent); ok { + sig, err = extendedAgent.SignWithFlags(k, req.Data, SignatureFlags(req.Flags)) + } else { + sig, err = s.agent.Sign(k, req.Data) + } + + if err != nil { + return nil, err + } + return &signResponseAgentMsg{SigBlob: ssh.Marshal(sig)}, nil + + case agentRequestIdentities: + keys, err := s.agent.List() + if err != nil { + return nil, err + } + + rep := identitiesAnswerAgentMsg{ + NumKeys: uint32(len(keys)), + } + for _, k := range keys { + rep.Keys = append(rep.Keys, marshalKey(k)...) + } + return rep, nil + + case agentAddIDConstrained, agentAddIdentity: + return nil, s.insertIdentity(data) + + case agentExtension: + // Return a stub object where the whole contents of the response gets marshaled. + var responseStub struct { + Rest []byte `ssh:"rest"` + } + + if extendedAgent, ok := s.agent.(ExtendedAgent); !ok { + // If this agent doesn't implement extensions, [PROTOCOL.agent] section 4.7 + // requires that we return a standard SSH_AGENT_FAILURE message. + responseStub.Rest = []byte{agentFailure} + } else { + var req extensionAgentMsg + if err := ssh.Unmarshal(data, &req); err != nil { + return nil, err + } + res, err := extendedAgent.Extension(req.ExtensionType, req.Contents) + if err != nil { + // If agent extensions are unsupported, return a standard SSH_AGENT_FAILURE + // message as required by [PROTOCOL.agent] section 4.7. + if err == ErrExtensionUnsupported { + responseStub.Rest = []byte{agentFailure} + } else { + // As the result of any other error processing an extension request, + // [PROTOCOL.agent] section 4.7 requires that we return a + // SSH_AGENT_EXTENSION_FAILURE code. + responseStub.Rest = []byte{agentExtensionFailure} + } + } else { + if len(res) == 0 { + return nil, nil + } + responseStub.Rest = res + } + } + + return responseStub, nil + } + + return nil, fmt.Errorf("unknown opcode %d", data[0]) +} + +func parseConstraints(constraints []byte) (lifetimeSecs uint32, confirmBeforeUse bool, extensions []ConstraintExtension, err error) { + for len(constraints) != 0 { + switch constraints[0] { + case agentConstrainLifetime: + lifetimeSecs = binary.BigEndian.Uint32(constraints[1:5]) + constraints = constraints[5:] + case agentConstrainConfirm: + confirmBeforeUse = true + constraints = constraints[1:] + case agentConstrainExtension: + var msg constrainExtensionAgentMsg + if err = ssh.Unmarshal(constraints, &msg); err != nil { + return 0, false, nil, err + } + extensions = append(extensions, ConstraintExtension{ + ExtensionName: msg.ExtensionName, + ExtensionDetails: msg.ExtensionDetails, + }) + constraints = msg.Rest + default: + return 0, false, nil, fmt.Errorf("unknown constraint type: %d", constraints[0]) + } + } + return +} + +func setConstraints(key *AddedKey, constraintBytes []byte) error { + lifetimeSecs, confirmBeforeUse, constraintExtensions, err := parseConstraints(constraintBytes) + if err != nil { + return err + } + + key.LifetimeSecs = lifetimeSecs + key.ConfirmBeforeUse = confirmBeforeUse + key.ConstraintExtensions = constraintExtensions + return nil +} + +func parseRSAKey(req []byte) (*AddedKey, error) { + var k rsaKeyMsg + if err := ssh.Unmarshal(req, &k); err != nil { + return nil, err + } + if k.E.BitLen() > 30 { + return nil, errors.New("agent: RSA public exponent too large") + } + priv := &rsa.PrivateKey{ + PublicKey: rsa.PublicKey{ + E: int(k.E.Int64()), + N: k.N, + }, + D: k.D, + Primes: []*big.Int{k.P, k.Q}, + } + priv.Precompute() + + addedKey := &AddedKey{PrivateKey: priv, Comment: k.Comments} + if err := setConstraints(addedKey, k.Constraints); err != nil { + return nil, err + } + return addedKey, nil +} + +func parseEd25519Key(req []byte) (*AddedKey, error) { + var k ed25519KeyMsg + if err := ssh.Unmarshal(req, &k); err != nil { + return nil, err + } + priv := ed25519.PrivateKey(k.Priv) + + addedKey := &AddedKey{PrivateKey: &priv, Comment: k.Comments} + if err := setConstraints(addedKey, k.Constraints); err != nil { + return nil, err + } + return addedKey, nil +} + +func parseDSAKey(req []byte) (*AddedKey, error) { + var k dsaKeyMsg + if err := ssh.Unmarshal(req, &k); err != nil { + return nil, err + } + priv := &dsa.PrivateKey{ + PublicKey: dsa.PublicKey{ + Parameters: dsa.Parameters{ + P: k.P, + Q: k.Q, + G: k.G, + }, + Y: k.Y, + }, + X: k.X, + } + + addedKey := &AddedKey{PrivateKey: priv, Comment: k.Comments} + if err := setConstraints(addedKey, k.Constraints); err != nil { + return nil, err + } + return addedKey, nil +} + +func unmarshalECDSA(curveName string, keyBytes []byte, privScalar *big.Int) (priv *ecdsa.PrivateKey, err error) { + priv = &ecdsa.PrivateKey{ + D: privScalar, + } + + switch curveName { + case "nistp256": + priv.Curve = elliptic.P256() + case "nistp384": + priv.Curve = elliptic.P384() + case "nistp521": + priv.Curve = elliptic.P521() + default: + return nil, fmt.Errorf("agent: unknown curve %q", curveName) + } + + priv.X, priv.Y = elliptic.Unmarshal(priv.Curve, keyBytes) + if priv.X == nil || priv.Y == nil { + return nil, errors.New("agent: point not on curve") + } + + return priv, nil +} + +func parseEd25519Cert(req []byte) (*AddedKey, error) { + var k ed25519CertMsg + if err := ssh.Unmarshal(req, &k); err != nil { + return nil, err + } + pubKey, err := ssh.ParsePublicKey(k.CertBytes) + if err != nil { + return nil, err + } + priv := ed25519.PrivateKey(k.Priv) + cert, ok := pubKey.(*ssh.Certificate) + if !ok { + return nil, errors.New("agent: bad ED25519 certificate") + } + + addedKey := &AddedKey{PrivateKey: &priv, Certificate: cert, Comment: k.Comments} + if err := setConstraints(addedKey, k.Constraints); err != nil { + return nil, err + } + return addedKey, nil +} + +func parseECDSAKey(req []byte) (*AddedKey, error) { + var k ecdsaKeyMsg + if err := ssh.Unmarshal(req, &k); err != nil { + return nil, err + } + + priv, err := unmarshalECDSA(k.Curve, k.KeyBytes, k.D) + if err != nil { + return nil, err + } + + addedKey := &AddedKey{PrivateKey: priv, Comment: k.Comments} + if err := setConstraints(addedKey, k.Constraints); err != nil { + return nil, err + } + return addedKey, nil +} + +func parseRSACert(req []byte) (*AddedKey, error) { + var k rsaCertMsg + if err := ssh.Unmarshal(req, &k); err != nil { + return nil, err + } + + pubKey, err := ssh.ParsePublicKey(k.CertBytes) + if err != nil { + return nil, err + } + + cert, ok := pubKey.(*ssh.Certificate) + if !ok { + return nil, errors.New("agent: bad RSA certificate") + } + + // An RSA publickey as marshaled by rsaPublicKey.Marshal() in keys.go + var rsaPub struct { + Name string + E *big.Int + N *big.Int + } + if err := ssh.Unmarshal(cert.Key.Marshal(), &rsaPub); err != nil { + return nil, fmt.Errorf("agent: Unmarshal failed to parse public key: %v", err) + } + + if rsaPub.E.BitLen() > 30 { + return nil, errors.New("agent: RSA public exponent too large") + } + + priv := rsa.PrivateKey{ + PublicKey: rsa.PublicKey{ + E: int(rsaPub.E.Int64()), + N: rsaPub.N, + }, + D: k.D, + Primes: []*big.Int{k.Q, k.P}, + } + priv.Precompute() + + addedKey := &AddedKey{PrivateKey: &priv, Certificate: cert, Comment: k.Comments} + if err := setConstraints(addedKey, k.Constraints); err != nil { + return nil, err + } + return addedKey, nil +} + +func parseDSACert(req []byte) (*AddedKey, error) { + var k dsaCertMsg + if err := ssh.Unmarshal(req, &k); err != nil { + return nil, err + } + pubKey, err := ssh.ParsePublicKey(k.CertBytes) + if err != nil { + return nil, err + } + cert, ok := pubKey.(*ssh.Certificate) + if !ok { + return nil, errors.New("agent: bad DSA certificate") + } + + // A DSA publickey as marshaled by dsaPublicKey.Marshal() in keys.go + var w struct { + Name string + P, Q, G, Y *big.Int + } + if err := ssh.Unmarshal(cert.Key.Marshal(), &w); err != nil { + return nil, fmt.Errorf("agent: Unmarshal failed to parse public key: %v", err) + } + + priv := &dsa.PrivateKey{ + PublicKey: dsa.PublicKey{ + Parameters: dsa.Parameters{ + P: w.P, + Q: w.Q, + G: w.G, + }, + Y: w.Y, + }, + X: k.X, + } + + addedKey := &AddedKey{PrivateKey: priv, Certificate: cert, Comment: k.Comments} + if err := setConstraints(addedKey, k.Constraints); err != nil { + return nil, err + } + return addedKey, nil +} + +func parseECDSACert(req []byte) (*AddedKey, error) { + var k ecdsaCertMsg + if err := ssh.Unmarshal(req, &k); err != nil { + return nil, err + } + + pubKey, err := ssh.ParsePublicKey(k.CertBytes) + if err != nil { + return nil, err + } + cert, ok := pubKey.(*ssh.Certificate) + if !ok { + return nil, errors.New("agent: bad ECDSA certificate") + } + + // An ECDSA publickey as marshaled by ecdsaPublicKey.Marshal() in keys.go + var ecdsaPub struct { + Name string + ID string + Key []byte + } + if err := ssh.Unmarshal(cert.Key.Marshal(), &ecdsaPub); err != nil { + return nil, err + } + + priv, err := unmarshalECDSA(ecdsaPub.ID, ecdsaPub.Key, k.D) + if err != nil { + return nil, err + } + + addedKey := &AddedKey{PrivateKey: priv, Certificate: cert, Comment: k.Comments} + if err := setConstraints(addedKey, k.Constraints); err != nil { + return nil, err + } + return addedKey, nil +} + +func (s *server) insertIdentity(req []byte) error { + var record struct { + Type string `sshtype:"17|25"` + Rest []byte `ssh:"rest"` + } + + if err := ssh.Unmarshal(req, &record); err != nil { + return err + } + + var addedKey *AddedKey + var err error + + switch record.Type { + case ssh.KeyAlgoRSA: + addedKey, err = parseRSAKey(req) + case ssh.KeyAlgoDSA: + addedKey, err = parseDSAKey(req) + case ssh.KeyAlgoECDSA256, ssh.KeyAlgoECDSA384, ssh.KeyAlgoECDSA521: + addedKey, err = parseECDSAKey(req) + case ssh.KeyAlgoED25519: + addedKey, err = parseEd25519Key(req) + case ssh.CertAlgoRSAv01: + addedKey, err = parseRSACert(req) + case ssh.CertAlgoDSAv01: + addedKey, err = parseDSACert(req) + case ssh.CertAlgoECDSA256v01, ssh.CertAlgoECDSA384v01, ssh.CertAlgoECDSA521v01: + addedKey, err = parseECDSACert(req) + case ssh.CertAlgoED25519v01: + addedKey, err = parseEd25519Cert(req) + default: + return fmt.Errorf("agent: not implemented: %q", record.Type) + } + + if err != nil { + return err + } + return s.agent.Add(*addedKey) +} + +// ServeAgent serves the agent protocol on the given connection. It +// returns when an I/O error occurs. +func ServeAgent(agent Agent, c io.ReadWriter) error { + s := &server{agent} + + var length [4]byte + for { + if _, err := io.ReadFull(c, length[:]); err != nil { + return err + } + l := binary.BigEndian.Uint32(length[:]) + if l == 0 { + return fmt.Errorf("agent: request size is 0") + } + if l > maxAgentResponseBytes { + // We also cap requests. + return fmt.Errorf("agent: request too large: %d", l) + } + + req := make([]byte, l) + if _, err := io.ReadFull(c, req); err != nil { + return err + } + + repData := s.processRequestBytes(req) + if len(repData) > maxAgentResponseBytes { + return fmt.Errorf("agent: reply too large: %d bytes", len(repData)) + } + + binary.BigEndian.PutUint32(length[:], uint32(len(repData))) + if _, err := c.Write(length[:]); err != nil { + return err + } + if _, err := c.Write(repData); err != nil { + return err + } + } +} diff --git a/vendor/golang.org/x/crypto/ssh/buffer.go b/vendor/golang.org/x/crypto/ssh/buffer.go new file mode 100644 index 0000000..1ab07d0 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/buffer.go @@ -0,0 +1,97 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "io" + "sync" +) + +// buffer provides a linked list buffer for data exchange +// between producer and consumer. Theoretically the buffer is +// of unlimited capacity as it does no allocation of its own. +type buffer struct { + // protects concurrent access to head, tail and closed + *sync.Cond + + head *element // the buffer that will be read first + tail *element // the buffer that will be read last + + closed bool +} + +// An element represents a single link in a linked list. +type element struct { + buf []byte + next *element +} + +// newBuffer returns an empty buffer that is not closed. +func newBuffer() *buffer { + e := new(element) + b := &buffer{ + Cond: newCond(), + head: e, + tail: e, + } + return b +} + +// write makes buf available for Read to receive. +// buf must not be modified after the call to write. +func (b *buffer) write(buf []byte) { + b.Cond.L.Lock() + e := &element{buf: buf} + b.tail.next = e + b.tail = e + b.Cond.Signal() + b.Cond.L.Unlock() +} + +// eof closes the buffer. Reads from the buffer once all +// the data has been consumed will receive io.EOF. +func (b *buffer) eof() { + b.Cond.L.Lock() + b.closed = true + b.Cond.Signal() + b.Cond.L.Unlock() +} + +// Read reads data from the internal buffer in buf. Reads will block +// if no data is available, or until the buffer is closed. +func (b *buffer) Read(buf []byte) (n int, err error) { + b.Cond.L.Lock() + defer b.Cond.L.Unlock() + + for len(buf) > 0 { + // if there is data in b.head, copy it + if len(b.head.buf) > 0 { + r := copy(buf, b.head.buf) + buf, b.head.buf = buf[r:], b.head.buf[r:] + n += r + continue + } + // if there is a next buffer, make it the head + if len(b.head.buf) == 0 && b.head != b.tail { + b.head = b.head.next + continue + } + + // if at least one byte has been copied, return + if n > 0 { + break + } + + // if nothing was read, and there is nothing outstanding + // check to see if the buffer is closed. + if b.closed { + err = io.EOF + break + } + // out of buffers, wait for producer + b.Cond.Wait() + } + return +} diff --git a/vendor/golang.org/x/crypto/ssh/certs.go b/vendor/golang.org/x/crypto/ssh/certs.go new file mode 100644 index 0000000..00ed992 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/certs.go @@ -0,0 +1,535 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "bytes" + "errors" + "fmt" + "io" + "net" + "sort" + "time" +) + +// These constants from [PROTOCOL.certkeys] represent the algorithm names +// for certificate types supported by this package. +const ( + CertAlgoRSAv01 = "ssh-rsa-cert-v01@openssh.com" + CertAlgoDSAv01 = "ssh-dss-cert-v01@openssh.com" + CertAlgoECDSA256v01 = "ecdsa-sha2-nistp256-cert-v01@openssh.com" + CertAlgoECDSA384v01 = "ecdsa-sha2-nistp384-cert-v01@openssh.com" + CertAlgoECDSA521v01 = "ecdsa-sha2-nistp521-cert-v01@openssh.com" + CertAlgoED25519v01 = "ssh-ed25519-cert-v01@openssh.com" +) + +// Certificate types distinguish between host and user +// certificates. The values can be set in the CertType field of +// Certificate. +const ( + UserCert = 1 + HostCert = 2 +) + +// Signature represents a cryptographic signature. +type Signature struct { + Format string + Blob []byte +} + +// CertTimeInfinity can be used for OpenSSHCertV01.ValidBefore to indicate that +// a certificate does not expire. +const CertTimeInfinity = 1<<64 - 1 + +// An Certificate represents an OpenSSH certificate as defined in +// [PROTOCOL.certkeys]?rev=1.8. The Certificate type implements the +// PublicKey interface, so it can be unmarshaled using +// ParsePublicKey. +type Certificate struct { + Nonce []byte + Key PublicKey + Serial uint64 + CertType uint32 + KeyId string + ValidPrincipals []string + ValidAfter uint64 + ValidBefore uint64 + Permissions + Reserved []byte + SignatureKey PublicKey + Signature *Signature +} + +// genericCertData holds the key-independent part of the certificate data. +// Overall, certificates contain an nonce, public key fields and +// key-independent fields. +type genericCertData struct { + Serial uint64 + CertType uint32 + KeyId string + ValidPrincipals []byte + ValidAfter uint64 + ValidBefore uint64 + CriticalOptions []byte + Extensions []byte + Reserved []byte + SignatureKey []byte + Signature []byte +} + +func marshalStringList(namelist []string) []byte { + var to []byte + for _, name := range namelist { + s := struct{ N string }{name} + to = append(to, Marshal(&s)...) + } + return to +} + +type optionsTuple struct { + Key string + Value []byte +} + +type optionsTupleValue struct { + Value string +} + +// serialize a map of critical options or extensions +// issue #10569 - per [PROTOCOL.certkeys] and SSH implementation, +// we need two length prefixes for a non-empty string value +func marshalTuples(tups map[string]string) []byte { + keys := make([]string, 0, len(tups)) + for key := range tups { + keys = append(keys, key) + } + sort.Strings(keys) + + var ret []byte + for _, key := range keys { + s := optionsTuple{Key: key} + if value := tups[key]; len(value) > 0 { + s.Value = Marshal(&optionsTupleValue{value}) + } + ret = append(ret, Marshal(&s)...) + } + return ret +} + +// issue #10569 - per [PROTOCOL.certkeys] and SSH implementation, +// we need two length prefixes for a non-empty option value +func parseTuples(in []byte) (map[string]string, error) { + tups := map[string]string{} + var lastKey string + var haveLastKey bool + + for len(in) > 0 { + var key, val, extra []byte + var ok bool + + if key, in, ok = parseString(in); !ok { + return nil, errShortRead + } + keyStr := string(key) + // according to [PROTOCOL.certkeys], the names must be in + // lexical order. + if haveLastKey && keyStr <= lastKey { + return nil, fmt.Errorf("ssh: certificate options are not in lexical order") + } + lastKey, haveLastKey = keyStr, true + // the next field is a data field, which if non-empty has a string embedded + if val, in, ok = parseString(in); !ok { + return nil, errShortRead + } + if len(val) > 0 { + val, extra, ok = parseString(val) + if !ok { + return nil, errShortRead + } + if len(extra) > 0 { + return nil, fmt.Errorf("ssh: unexpected trailing data after certificate option value") + } + tups[keyStr] = string(val) + } else { + tups[keyStr] = "" + } + } + return tups, nil +} + +func parseCert(in []byte, privAlgo string) (*Certificate, error) { + nonce, rest, ok := parseString(in) + if !ok { + return nil, errShortRead + } + + key, rest, err := parsePubKey(rest, privAlgo) + if err != nil { + return nil, err + } + + var g genericCertData + if err := Unmarshal(rest, &g); err != nil { + return nil, err + } + + c := &Certificate{ + Nonce: nonce, + Key: key, + Serial: g.Serial, + CertType: g.CertType, + KeyId: g.KeyId, + ValidAfter: g.ValidAfter, + ValidBefore: g.ValidBefore, + } + + for principals := g.ValidPrincipals; len(principals) > 0; { + principal, rest, ok := parseString(principals) + if !ok { + return nil, errShortRead + } + c.ValidPrincipals = append(c.ValidPrincipals, string(principal)) + principals = rest + } + + c.CriticalOptions, err = parseTuples(g.CriticalOptions) + if err != nil { + return nil, err + } + c.Extensions, err = parseTuples(g.Extensions) + if err != nil { + return nil, err + } + c.Reserved = g.Reserved + k, err := ParsePublicKey(g.SignatureKey) + if err != nil { + return nil, err + } + + c.SignatureKey = k + c.Signature, rest, ok = parseSignatureBody(g.Signature) + if !ok || len(rest) > 0 { + return nil, errors.New("ssh: signature parse error") + } + + return c, nil +} + +type openSSHCertSigner struct { + pub *Certificate + signer Signer +} + +type algorithmOpenSSHCertSigner struct { + *openSSHCertSigner + algorithmSigner AlgorithmSigner +} + +// NewCertSigner returns a Signer that signs with the given Certificate, whose +// private key is held by signer. It returns an error if the public key in cert +// doesn't match the key used by signer. +func NewCertSigner(cert *Certificate, signer Signer) (Signer, error) { + if bytes.Compare(cert.Key.Marshal(), signer.PublicKey().Marshal()) != 0 { + return nil, errors.New("ssh: signer and cert have different public key") + } + + if algorithmSigner, ok := signer.(AlgorithmSigner); ok { + return &algorithmOpenSSHCertSigner{ + &openSSHCertSigner{cert, signer}, algorithmSigner}, nil + } else { + return &openSSHCertSigner{cert, signer}, nil + } +} + +func (s *openSSHCertSigner) Sign(rand io.Reader, data []byte) (*Signature, error) { + return s.signer.Sign(rand, data) +} + +func (s *openSSHCertSigner) PublicKey() PublicKey { + return s.pub +} + +func (s *algorithmOpenSSHCertSigner) SignWithAlgorithm(rand io.Reader, data []byte, algorithm string) (*Signature, error) { + return s.algorithmSigner.SignWithAlgorithm(rand, data, algorithm) +} + +const sourceAddressCriticalOption = "source-address" + +// CertChecker does the work of verifying a certificate. Its methods +// can be plugged into ClientConfig.HostKeyCallback and +// ServerConfig.PublicKeyCallback. For the CertChecker to work, +// minimally, the IsAuthority callback should be set. +type CertChecker struct { + // SupportedCriticalOptions lists the CriticalOptions that the + // server application layer understands. These are only used + // for user certificates. + SupportedCriticalOptions []string + + // IsUserAuthority should return true if the key is recognized as an + // authority for the given user certificate. This allows for + // certificates to be signed by other certificates. This must be set + // if this CertChecker will be checking user certificates. + IsUserAuthority func(auth PublicKey) bool + + // IsHostAuthority should report whether the key is recognized as + // an authority for this host. This allows for certificates to be + // signed by other keys, and for those other keys to only be valid + // signers for particular hostnames. This must be set if this + // CertChecker will be checking host certificates. + IsHostAuthority func(auth PublicKey, address string) bool + + // Clock is used for verifying time stamps. If nil, time.Now + // is used. + Clock func() time.Time + + // UserKeyFallback is called when CertChecker.Authenticate encounters a + // public key that is not a certificate. It must implement validation + // of user keys or else, if nil, all such keys are rejected. + UserKeyFallback func(conn ConnMetadata, key PublicKey) (*Permissions, error) + + // HostKeyFallback is called when CertChecker.CheckHostKey encounters a + // public key that is not a certificate. It must implement host key + // validation or else, if nil, all such keys are rejected. + HostKeyFallback HostKeyCallback + + // IsRevoked is called for each certificate so that revocation checking + // can be implemented. It should return true if the given certificate + // is revoked and false otherwise. If nil, no certificates are + // considered to have been revoked. + IsRevoked func(cert *Certificate) bool +} + +// CheckHostKey checks a host key certificate. This method can be +// plugged into ClientConfig.HostKeyCallback. +func (c *CertChecker) CheckHostKey(addr string, remote net.Addr, key PublicKey) error { + cert, ok := key.(*Certificate) + if !ok { + if c.HostKeyFallback != nil { + return c.HostKeyFallback(addr, remote, key) + } + return errors.New("ssh: non-certificate host key") + } + if cert.CertType != HostCert { + return fmt.Errorf("ssh: certificate presented as a host key has type %d", cert.CertType) + } + if !c.IsHostAuthority(cert.SignatureKey, addr) { + return fmt.Errorf("ssh: no authorities for hostname: %v", addr) + } + + hostname, _, err := net.SplitHostPort(addr) + if err != nil { + return err + } + + // Pass hostname only as principal for host certificates (consistent with OpenSSH) + return c.CheckCert(hostname, cert) +} + +// Authenticate checks a user certificate. Authenticate can be used as +// a value for ServerConfig.PublicKeyCallback. +func (c *CertChecker) Authenticate(conn ConnMetadata, pubKey PublicKey) (*Permissions, error) { + cert, ok := pubKey.(*Certificate) + if !ok { + if c.UserKeyFallback != nil { + return c.UserKeyFallback(conn, pubKey) + } + return nil, errors.New("ssh: normal key pairs not accepted") + } + + if cert.CertType != UserCert { + return nil, fmt.Errorf("ssh: cert has type %d", cert.CertType) + } + if !c.IsUserAuthority(cert.SignatureKey) { + return nil, fmt.Errorf("ssh: certificate signed by unrecognized authority") + } + + if err := c.CheckCert(conn.User(), cert); err != nil { + return nil, err + } + + return &cert.Permissions, nil +} + +// CheckCert checks CriticalOptions, ValidPrincipals, revocation, timestamp and +// the signature of the certificate. +func (c *CertChecker) CheckCert(principal string, cert *Certificate) error { + if c.IsRevoked != nil && c.IsRevoked(cert) { + return fmt.Errorf("ssh: certificate serial %d revoked", cert.Serial) + } + + for opt := range cert.CriticalOptions { + // sourceAddressCriticalOption will be enforced by + // serverAuthenticate + if opt == sourceAddressCriticalOption { + continue + } + + found := false + for _, supp := range c.SupportedCriticalOptions { + if supp == opt { + found = true + break + } + } + if !found { + return fmt.Errorf("ssh: unsupported critical option %q in certificate", opt) + } + } + + if len(cert.ValidPrincipals) > 0 { + // By default, certs are valid for all users/hosts. + found := false + for _, p := range cert.ValidPrincipals { + if p == principal { + found = true + break + } + } + if !found { + return fmt.Errorf("ssh: principal %q not in the set of valid principals for given certificate: %q", principal, cert.ValidPrincipals) + } + } + + clock := c.Clock + if clock == nil { + clock = time.Now + } + + unixNow := clock().Unix() + if after := int64(cert.ValidAfter); after < 0 || unixNow < int64(cert.ValidAfter) { + return fmt.Errorf("ssh: cert is not yet valid") + } + if before := int64(cert.ValidBefore); cert.ValidBefore != uint64(CertTimeInfinity) && (unixNow >= before || before < 0) { + return fmt.Errorf("ssh: cert has expired") + } + if err := cert.SignatureKey.Verify(cert.bytesForSigning(), cert.Signature); err != nil { + return fmt.Errorf("ssh: certificate signature does not verify") + } + + return nil +} + +// SignCert sets c.SignatureKey to the authority's public key and stores a +// Signature, by authority, in the certificate. +func (c *Certificate) SignCert(rand io.Reader, authority Signer) error { + c.Nonce = make([]byte, 32) + if _, err := io.ReadFull(rand, c.Nonce); err != nil { + return err + } + c.SignatureKey = authority.PublicKey() + + sig, err := authority.Sign(rand, c.bytesForSigning()) + if err != nil { + return err + } + c.Signature = sig + return nil +} + +var certAlgoNames = map[string]string{ + KeyAlgoRSA: CertAlgoRSAv01, + KeyAlgoDSA: CertAlgoDSAv01, + KeyAlgoECDSA256: CertAlgoECDSA256v01, + KeyAlgoECDSA384: CertAlgoECDSA384v01, + KeyAlgoECDSA521: CertAlgoECDSA521v01, + KeyAlgoED25519: CertAlgoED25519v01, +} + +// certToPrivAlgo returns the underlying algorithm for a certificate algorithm. +// Panics if a non-certificate algorithm is passed. +func certToPrivAlgo(algo string) string { + for privAlgo, pubAlgo := range certAlgoNames { + if pubAlgo == algo { + return privAlgo + } + } + panic("unknown cert algorithm") +} + +func (cert *Certificate) bytesForSigning() []byte { + c2 := *cert + c2.Signature = nil + out := c2.Marshal() + // Drop trailing signature length. + return out[:len(out)-4] +} + +// Marshal serializes c into OpenSSH's wire format. It is part of the +// PublicKey interface. +func (c *Certificate) Marshal() []byte { + generic := genericCertData{ + Serial: c.Serial, + CertType: c.CertType, + KeyId: c.KeyId, + ValidPrincipals: marshalStringList(c.ValidPrincipals), + ValidAfter: uint64(c.ValidAfter), + ValidBefore: uint64(c.ValidBefore), + CriticalOptions: marshalTuples(c.CriticalOptions), + Extensions: marshalTuples(c.Extensions), + Reserved: c.Reserved, + SignatureKey: c.SignatureKey.Marshal(), + } + if c.Signature != nil { + generic.Signature = Marshal(c.Signature) + } + genericBytes := Marshal(&generic) + keyBytes := c.Key.Marshal() + _, keyBytes, _ = parseString(keyBytes) + prefix := Marshal(&struct { + Name string + Nonce []byte + Key []byte `ssh:"rest"` + }{c.Type(), c.Nonce, keyBytes}) + + result := make([]byte, 0, len(prefix)+len(genericBytes)) + result = append(result, prefix...) + result = append(result, genericBytes...) + return result +} + +// Type returns the key name. It is part of the PublicKey interface. +func (c *Certificate) Type() string { + algo, ok := certAlgoNames[c.Key.Type()] + if !ok { + panic("unknown cert key type " + c.Key.Type()) + } + return algo +} + +// Verify verifies a signature against the certificate's public +// key. It is part of the PublicKey interface. +func (c *Certificate) Verify(data []byte, sig *Signature) error { + return c.Key.Verify(data, sig) +} + +func parseSignatureBody(in []byte) (out *Signature, rest []byte, ok bool) { + format, in, ok := parseString(in) + if !ok { + return + } + + out = &Signature{ + Format: string(format), + } + + if out.Blob, in, ok = parseString(in); !ok { + return + } + + return out, in, ok +} + +func parseSignature(in []byte) (out *Signature, rest []byte, ok bool) { + sigBytes, rest, ok := parseString(in) + if !ok { + return + } + + out, trailing, ok := parseSignatureBody(sigBytes) + if !ok || len(trailing) > 0 { + return nil, nil, false + } + return +} diff --git a/vendor/golang.org/x/crypto/ssh/channel.go b/vendor/golang.org/x/crypto/ssh/channel.go new file mode 100644 index 0000000..c0834c0 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/channel.go @@ -0,0 +1,633 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "encoding/binary" + "errors" + "fmt" + "io" + "log" + "sync" +) + +const ( + minPacketLength = 9 + // channelMaxPacket contains the maximum number of bytes that will be + // sent in a single packet. As per RFC 4253, section 6.1, 32k is also + // the minimum. + channelMaxPacket = 1 << 15 + // We follow OpenSSH here. + channelWindowSize = 64 * channelMaxPacket +) + +// NewChannel represents an incoming request to a channel. It must either be +// accepted for use by calling Accept, or rejected by calling Reject. +type NewChannel interface { + // Accept accepts the channel creation request. It returns the Channel + // and a Go channel containing SSH requests. The Go channel must be + // serviced otherwise the Channel will hang. + Accept() (Channel, <-chan *Request, error) + + // Reject rejects the channel creation request. After calling + // this, no other methods on the Channel may be called. + Reject(reason RejectionReason, message string) error + + // ChannelType returns the type of the channel, as supplied by the + // client. + ChannelType() string + + // ExtraData returns the arbitrary payload for this channel, as supplied + // by the client. This data is specific to the channel type. + ExtraData() []byte +} + +// A Channel is an ordered, reliable, flow-controlled, duplex stream +// that is multiplexed over an SSH connection. +type Channel interface { + // Read reads up to len(data) bytes from the channel. + Read(data []byte) (int, error) + + // Write writes len(data) bytes to the channel. + Write(data []byte) (int, error) + + // Close signals end of channel use. No data may be sent after this + // call. + Close() error + + // CloseWrite signals the end of sending in-band + // data. Requests may still be sent, and the other side may + // still send data + CloseWrite() error + + // SendRequest sends a channel request. If wantReply is true, + // it will wait for a reply and return the result as a + // boolean, otherwise the return value will be false. Channel + // requests are out-of-band messages so they may be sent even + // if the data stream is closed or blocked by flow control. + // If the channel is closed before a reply is returned, io.EOF + // is returned. + SendRequest(name string, wantReply bool, payload []byte) (bool, error) + + // Stderr returns an io.ReadWriter that writes to this channel + // with the extended data type set to stderr. Stderr may + // safely be read and written from a different goroutine than + // Read and Write respectively. + Stderr() io.ReadWriter +} + +// Request is a request sent outside of the normal stream of +// data. Requests can either be specific to an SSH channel, or they +// can be global. +type Request struct { + Type string + WantReply bool + Payload []byte + + ch *channel + mux *mux +} + +// Reply sends a response to a request. It must be called for all requests +// where WantReply is true and is a no-op otherwise. The payload argument is +// ignored for replies to channel-specific requests. +func (r *Request) Reply(ok bool, payload []byte) error { + if !r.WantReply { + return nil + } + + if r.ch == nil { + return r.mux.ackRequest(ok, payload) + } + + return r.ch.ackRequest(ok) +} + +// RejectionReason is an enumeration used when rejecting channel creation +// requests. See RFC 4254, section 5.1. +type RejectionReason uint32 + +const ( + Prohibited RejectionReason = iota + 1 + ConnectionFailed + UnknownChannelType + ResourceShortage +) + +// String converts the rejection reason to human readable form. +func (r RejectionReason) String() string { + switch r { + case Prohibited: + return "administratively prohibited" + case ConnectionFailed: + return "connect failed" + case UnknownChannelType: + return "unknown channel type" + case ResourceShortage: + return "resource shortage" + } + return fmt.Sprintf("unknown reason %d", int(r)) +} + +func min(a uint32, b int) uint32 { + if a < uint32(b) { + return a + } + return uint32(b) +} + +type channelDirection uint8 + +const ( + channelInbound channelDirection = iota + channelOutbound +) + +// channel is an implementation of the Channel interface that works +// with the mux class. +type channel struct { + // R/O after creation + chanType string + extraData []byte + localId, remoteId uint32 + + // maxIncomingPayload and maxRemotePayload are the maximum + // payload sizes of normal and extended data packets for + // receiving and sending, respectively. The wire packet will + // be 9 or 13 bytes larger (excluding encryption overhead). + maxIncomingPayload uint32 + maxRemotePayload uint32 + + mux *mux + + // decided is set to true if an accept or reject message has been sent + // (for outbound channels) or received (for inbound channels). + decided bool + + // direction contains either channelOutbound, for channels created + // locally, or channelInbound, for channels created by the peer. + direction channelDirection + + // Pending internal channel messages. + msg chan interface{} + + // Since requests have no ID, there can be only one request + // with WantReply=true outstanding. This lock is held by a + // goroutine that has such an outgoing request pending. + sentRequestMu sync.Mutex + + incomingRequests chan *Request + + sentEOF bool + + // thread-safe data + remoteWin window + pending *buffer + extPending *buffer + + // windowMu protects myWindow, the flow-control window. + windowMu sync.Mutex + myWindow uint32 + + // writeMu serializes calls to mux.conn.writePacket() and + // protects sentClose and packetPool. This mutex must be + // different from windowMu, as writePacket can block if there + // is a key exchange pending. + writeMu sync.Mutex + sentClose bool + + // packetPool has a buffer for each extended channel ID to + // save allocations during writes. + packetPool map[uint32][]byte +} + +// writePacket sends a packet. If the packet is a channel close, it updates +// sentClose. This method takes the lock c.writeMu. +func (ch *channel) writePacket(packet []byte) error { + ch.writeMu.Lock() + if ch.sentClose { + ch.writeMu.Unlock() + return io.EOF + } + ch.sentClose = (packet[0] == msgChannelClose) + err := ch.mux.conn.writePacket(packet) + ch.writeMu.Unlock() + return err +} + +func (ch *channel) sendMessage(msg interface{}) error { + if debugMux { + log.Printf("send(%d): %#v", ch.mux.chanList.offset, msg) + } + + p := Marshal(msg) + binary.BigEndian.PutUint32(p[1:], ch.remoteId) + return ch.writePacket(p) +} + +// WriteExtended writes data to a specific extended stream. These streams are +// used, for example, for stderr. +func (ch *channel) WriteExtended(data []byte, extendedCode uint32) (n int, err error) { + if ch.sentEOF { + return 0, io.EOF + } + // 1 byte message type, 4 bytes remoteId, 4 bytes data length + opCode := byte(msgChannelData) + headerLength := uint32(9) + if extendedCode > 0 { + headerLength += 4 + opCode = msgChannelExtendedData + } + + ch.writeMu.Lock() + packet := ch.packetPool[extendedCode] + // We don't remove the buffer from packetPool, so + // WriteExtended calls from different goroutines will be + // flagged as errors by the race detector. + ch.writeMu.Unlock() + + for len(data) > 0 { + space := min(ch.maxRemotePayload, len(data)) + if space, err = ch.remoteWin.reserve(space); err != nil { + return n, err + } + if want := headerLength + space; uint32(cap(packet)) < want { + packet = make([]byte, want) + } else { + packet = packet[:want] + } + + todo := data[:space] + + packet[0] = opCode + binary.BigEndian.PutUint32(packet[1:], ch.remoteId) + if extendedCode > 0 { + binary.BigEndian.PutUint32(packet[5:], uint32(extendedCode)) + } + binary.BigEndian.PutUint32(packet[headerLength-4:], uint32(len(todo))) + copy(packet[headerLength:], todo) + if err = ch.writePacket(packet); err != nil { + return n, err + } + + n += len(todo) + data = data[len(todo):] + } + + ch.writeMu.Lock() + ch.packetPool[extendedCode] = packet + ch.writeMu.Unlock() + + return n, err +} + +func (ch *channel) handleData(packet []byte) error { + headerLen := 9 + isExtendedData := packet[0] == msgChannelExtendedData + if isExtendedData { + headerLen = 13 + } + if len(packet) < headerLen { + // malformed data packet + return parseError(packet[0]) + } + + var extended uint32 + if isExtendedData { + extended = binary.BigEndian.Uint32(packet[5:]) + } + + length := binary.BigEndian.Uint32(packet[headerLen-4 : headerLen]) + if length == 0 { + return nil + } + if length > ch.maxIncomingPayload { + // TODO(hanwen): should send Disconnect? + return errors.New("ssh: incoming packet exceeds maximum payload size") + } + + data := packet[headerLen:] + if length != uint32(len(data)) { + return errors.New("ssh: wrong packet length") + } + + ch.windowMu.Lock() + if ch.myWindow < length { + ch.windowMu.Unlock() + // TODO(hanwen): should send Disconnect with reason? + return errors.New("ssh: remote side wrote too much") + } + ch.myWindow -= length + ch.windowMu.Unlock() + + if extended == 1 { + ch.extPending.write(data) + } else if extended > 0 { + // discard other extended data. + } else { + ch.pending.write(data) + } + return nil +} + +func (c *channel) adjustWindow(n uint32) error { + c.windowMu.Lock() + // Since myWindow is managed on our side, and can never exceed + // the initial window setting, we don't worry about overflow. + c.myWindow += uint32(n) + c.windowMu.Unlock() + return c.sendMessage(windowAdjustMsg{ + AdditionalBytes: uint32(n), + }) +} + +func (c *channel) ReadExtended(data []byte, extended uint32) (n int, err error) { + switch extended { + case 1: + n, err = c.extPending.Read(data) + case 0: + n, err = c.pending.Read(data) + default: + return 0, fmt.Errorf("ssh: extended code %d unimplemented", extended) + } + + if n > 0 { + err = c.adjustWindow(uint32(n)) + // sendWindowAdjust can return io.EOF if the remote + // peer has closed the connection, however we want to + // defer forwarding io.EOF to the caller of Read until + // the buffer has been drained. + if n > 0 && err == io.EOF { + err = nil + } + } + + return n, err +} + +func (c *channel) close() { + c.pending.eof() + c.extPending.eof() + close(c.msg) + close(c.incomingRequests) + c.writeMu.Lock() + // This is not necessary for a normal channel teardown, but if + // there was another error, it is. + c.sentClose = true + c.writeMu.Unlock() + // Unblock writers. + c.remoteWin.close() +} + +// responseMessageReceived is called when a success or failure message is +// received on a channel to check that such a message is reasonable for the +// given channel. +func (ch *channel) responseMessageReceived() error { + if ch.direction == channelInbound { + return errors.New("ssh: channel response message received on inbound channel") + } + if ch.decided { + return errors.New("ssh: duplicate response received for channel") + } + ch.decided = true + return nil +} + +func (ch *channel) handlePacket(packet []byte) error { + switch packet[0] { + case msgChannelData, msgChannelExtendedData: + return ch.handleData(packet) + case msgChannelClose: + ch.sendMessage(channelCloseMsg{PeersID: ch.remoteId}) + ch.mux.chanList.remove(ch.localId) + ch.close() + return nil + case msgChannelEOF: + // RFC 4254 is mute on how EOF affects dataExt messages but + // it is logical to signal EOF at the same time. + ch.extPending.eof() + ch.pending.eof() + return nil + } + + decoded, err := decode(packet) + if err != nil { + return err + } + + switch msg := decoded.(type) { + case *channelOpenFailureMsg: + if err := ch.responseMessageReceived(); err != nil { + return err + } + ch.mux.chanList.remove(msg.PeersID) + ch.msg <- msg + case *channelOpenConfirmMsg: + if err := ch.responseMessageReceived(); err != nil { + return err + } + if msg.MaxPacketSize < minPacketLength || msg.MaxPacketSize > 1<<31 { + return fmt.Errorf("ssh: invalid MaxPacketSize %d from peer", msg.MaxPacketSize) + } + ch.remoteId = msg.MyID + ch.maxRemotePayload = msg.MaxPacketSize + ch.remoteWin.add(msg.MyWindow) + ch.msg <- msg + case *windowAdjustMsg: + if !ch.remoteWin.add(msg.AdditionalBytes) { + return fmt.Errorf("ssh: invalid window update for %d bytes", msg.AdditionalBytes) + } + case *channelRequestMsg: + req := Request{ + Type: msg.Request, + WantReply: msg.WantReply, + Payload: msg.RequestSpecificData, + ch: ch, + } + + ch.incomingRequests <- &req + default: + ch.msg <- msg + } + return nil +} + +func (m *mux) newChannel(chanType string, direction channelDirection, extraData []byte) *channel { + ch := &channel{ + remoteWin: window{Cond: newCond()}, + myWindow: channelWindowSize, + pending: newBuffer(), + extPending: newBuffer(), + direction: direction, + incomingRequests: make(chan *Request, chanSize), + msg: make(chan interface{}, chanSize), + chanType: chanType, + extraData: extraData, + mux: m, + packetPool: make(map[uint32][]byte), + } + ch.localId = m.chanList.add(ch) + return ch +} + +var errUndecided = errors.New("ssh: must Accept or Reject channel") +var errDecidedAlready = errors.New("ssh: can call Accept or Reject only once") + +type extChannel struct { + code uint32 + ch *channel +} + +func (e *extChannel) Write(data []byte) (n int, err error) { + return e.ch.WriteExtended(data, e.code) +} + +func (e *extChannel) Read(data []byte) (n int, err error) { + return e.ch.ReadExtended(data, e.code) +} + +func (ch *channel) Accept() (Channel, <-chan *Request, error) { + if ch.decided { + return nil, nil, errDecidedAlready + } + ch.maxIncomingPayload = channelMaxPacket + confirm := channelOpenConfirmMsg{ + PeersID: ch.remoteId, + MyID: ch.localId, + MyWindow: ch.myWindow, + MaxPacketSize: ch.maxIncomingPayload, + } + ch.decided = true + if err := ch.sendMessage(confirm); err != nil { + return nil, nil, err + } + + return ch, ch.incomingRequests, nil +} + +func (ch *channel) Reject(reason RejectionReason, message string) error { + if ch.decided { + return errDecidedAlready + } + reject := channelOpenFailureMsg{ + PeersID: ch.remoteId, + Reason: reason, + Message: message, + Language: "en", + } + ch.decided = true + return ch.sendMessage(reject) +} + +func (ch *channel) Read(data []byte) (int, error) { + if !ch.decided { + return 0, errUndecided + } + return ch.ReadExtended(data, 0) +} + +func (ch *channel) Write(data []byte) (int, error) { + if !ch.decided { + return 0, errUndecided + } + return ch.WriteExtended(data, 0) +} + +func (ch *channel) CloseWrite() error { + if !ch.decided { + return errUndecided + } + ch.sentEOF = true + return ch.sendMessage(channelEOFMsg{ + PeersID: ch.remoteId}) +} + +func (ch *channel) Close() error { + if !ch.decided { + return errUndecided + } + + return ch.sendMessage(channelCloseMsg{ + PeersID: ch.remoteId}) +} + +// Extended returns an io.ReadWriter that sends and receives data on the given, +// SSH extended stream. Such streams are used, for example, for stderr. +func (ch *channel) Extended(code uint32) io.ReadWriter { + if !ch.decided { + return nil + } + return &extChannel{code, ch} +} + +func (ch *channel) Stderr() io.ReadWriter { + return ch.Extended(1) +} + +func (ch *channel) SendRequest(name string, wantReply bool, payload []byte) (bool, error) { + if !ch.decided { + return false, errUndecided + } + + if wantReply { + ch.sentRequestMu.Lock() + defer ch.sentRequestMu.Unlock() + } + + msg := channelRequestMsg{ + PeersID: ch.remoteId, + Request: name, + WantReply: wantReply, + RequestSpecificData: payload, + } + + if err := ch.sendMessage(msg); err != nil { + return false, err + } + + if wantReply { + m, ok := (<-ch.msg) + if !ok { + return false, io.EOF + } + switch m.(type) { + case *channelRequestFailureMsg: + return false, nil + case *channelRequestSuccessMsg: + return true, nil + default: + return false, fmt.Errorf("ssh: unexpected response to channel request: %#v", m) + } + } + + return false, nil +} + +// ackRequest either sends an ack or nack to the channel request. +func (ch *channel) ackRequest(ok bool) error { + if !ch.decided { + return errUndecided + } + + var msg interface{} + if !ok { + msg = channelRequestFailureMsg{ + PeersID: ch.remoteId, + } + } else { + msg = channelRequestSuccessMsg{ + PeersID: ch.remoteId, + } + } + return ch.sendMessage(msg) +} + +func (ch *channel) ChannelType() string { + return ch.chanType +} + +func (ch *channel) ExtraData() []byte { + return ch.extraData +} diff --git a/vendor/golang.org/x/crypto/ssh/cipher.go b/vendor/golang.org/x/crypto/ssh/cipher.go new file mode 100644 index 0000000..67b0126 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/cipher.go @@ -0,0 +1,770 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "crypto/aes" + "crypto/cipher" + "crypto/des" + "crypto/rc4" + "crypto/subtle" + "encoding/binary" + "errors" + "fmt" + "hash" + "io" + "io/ioutil" + "math/bits" + + "golang.org/x/crypto/internal/chacha20" + "golang.org/x/crypto/poly1305" +) + +const ( + packetSizeMultiple = 16 // TODO(huin) this should be determined by the cipher. + + // RFC 4253 section 6.1 defines a minimum packet size of 32768 that implementations + // MUST be able to process (plus a few more kilobytes for padding and mac). The RFC + // indicates implementations SHOULD be able to handle larger packet sizes, but then + // waffles on about reasonable limits. + // + // OpenSSH caps their maxPacket at 256kB so we choose to do + // the same. maxPacket is also used to ensure that uint32 + // length fields do not overflow, so it should remain well + // below 4G. + maxPacket = 256 * 1024 +) + +// noneCipher implements cipher.Stream and provides no encryption. It is used +// by the transport before the first key-exchange. +type noneCipher struct{} + +func (c noneCipher) XORKeyStream(dst, src []byte) { + copy(dst, src) +} + +func newAESCTR(key, iv []byte) (cipher.Stream, error) { + c, err := aes.NewCipher(key) + if err != nil { + return nil, err + } + return cipher.NewCTR(c, iv), nil +} + +func newRC4(key, iv []byte) (cipher.Stream, error) { + return rc4.NewCipher(key) +} + +type cipherMode struct { + keySize int + ivSize int + create func(key, iv []byte, macKey []byte, algs directionAlgorithms) (packetCipher, error) +} + +func streamCipherMode(skip int, createFunc func(key, iv []byte) (cipher.Stream, error)) func(key, iv []byte, macKey []byte, algs directionAlgorithms) (packetCipher, error) { + return func(key, iv, macKey []byte, algs directionAlgorithms) (packetCipher, error) { + stream, err := createFunc(key, iv) + if err != nil { + return nil, err + } + + var streamDump []byte + if skip > 0 { + streamDump = make([]byte, 512) + } + + for remainingToDump := skip; remainingToDump > 0; { + dumpThisTime := remainingToDump + if dumpThisTime > len(streamDump) { + dumpThisTime = len(streamDump) + } + stream.XORKeyStream(streamDump[:dumpThisTime], streamDump[:dumpThisTime]) + remainingToDump -= dumpThisTime + } + + mac := macModes[algs.MAC].new(macKey) + return &streamPacketCipher{ + mac: mac, + etm: macModes[algs.MAC].etm, + macResult: make([]byte, mac.Size()), + cipher: stream, + }, nil + } +} + +// cipherModes documents properties of supported ciphers. Ciphers not included +// are not supported and will not be negotiated, even if explicitly requested in +// ClientConfig.Crypto.Ciphers. +var cipherModes = map[string]*cipherMode{ + // Ciphers from RFC4344, which introduced many CTR-based ciphers. Algorithms + // are defined in the order specified in the RFC. + "aes128-ctr": {16, aes.BlockSize, streamCipherMode(0, newAESCTR)}, + "aes192-ctr": {24, aes.BlockSize, streamCipherMode(0, newAESCTR)}, + "aes256-ctr": {32, aes.BlockSize, streamCipherMode(0, newAESCTR)}, + + // Ciphers from RFC4345, which introduces security-improved arcfour ciphers. + // They are defined in the order specified in the RFC. + "arcfour128": {16, 0, streamCipherMode(1536, newRC4)}, + "arcfour256": {32, 0, streamCipherMode(1536, newRC4)}, + + // Cipher defined in RFC 4253, which describes SSH Transport Layer Protocol. + // Note that this cipher is not safe, as stated in RFC 4253: "Arcfour (and + // RC4) has problems with weak keys, and should be used with caution." + // RFC4345 introduces improved versions of Arcfour. + "arcfour": {16, 0, streamCipherMode(0, newRC4)}, + + // AEAD ciphers + gcmCipherID: {16, 12, newGCMCipher}, + chacha20Poly1305ID: {64, 0, newChaCha20Cipher}, + + // CBC mode is insecure and so is not included in the default config. + // (See http://www.isg.rhul.ac.uk/~kp/SandPfinal.pdf). If absolutely + // needed, it's possible to specify a custom Config to enable it. + // You should expect that an active attacker can recover plaintext if + // you do. + aes128cbcID: {16, aes.BlockSize, newAESCBCCipher}, + + // 3des-cbc is insecure and is not included in the default + // config. + tripledescbcID: {24, des.BlockSize, newTripleDESCBCCipher}, +} + +// prefixLen is the length of the packet prefix that contains the packet length +// and number of padding bytes. +const prefixLen = 5 + +// streamPacketCipher is a packetCipher using a stream cipher. +type streamPacketCipher struct { + mac hash.Hash + cipher cipher.Stream + etm bool + + // The following members are to avoid per-packet allocations. + prefix [prefixLen]byte + seqNumBytes [4]byte + padding [2 * packetSizeMultiple]byte + packetData []byte + macResult []byte +} + +// readPacket reads and decrypt a single packet from the reader argument. +func (s *streamPacketCipher) readPacket(seqNum uint32, r io.Reader) ([]byte, error) { + if _, err := io.ReadFull(r, s.prefix[:]); err != nil { + return nil, err + } + + var encryptedPaddingLength [1]byte + if s.mac != nil && s.etm { + copy(encryptedPaddingLength[:], s.prefix[4:5]) + s.cipher.XORKeyStream(s.prefix[4:5], s.prefix[4:5]) + } else { + s.cipher.XORKeyStream(s.prefix[:], s.prefix[:]) + } + + length := binary.BigEndian.Uint32(s.prefix[0:4]) + paddingLength := uint32(s.prefix[4]) + + var macSize uint32 + if s.mac != nil { + s.mac.Reset() + binary.BigEndian.PutUint32(s.seqNumBytes[:], seqNum) + s.mac.Write(s.seqNumBytes[:]) + if s.etm { + s.mac.Write(s.prefix[:4]) + s.mac.Write(encryptedPaddingLength[:]) + } else { + s.mac.Write(s.prefix[:]) + } + macSize = uint32(s.mac.Size()) + } + + if length <= paddingLength+1 { + return nil, errors.New("ssh: invalid packet length, packet too small") + } + + if length > maxPacket { + return nil, errors.New("ssh: invalid packet length, packet too large") + } + + // the maxPacket check above ensures that length-1+macSize + // does not overflow. + if uint32(cap(s.packetData)) < length-1+macSize { + s.packetData = make([]byte, length-1+macSize) + } else { + s.packetData = s.packetData[:length-1+macSize] + } + + if _, err := io.ReadFull(r, s.packetData); err != nil { + return nil, err + } + mac := s.packetData[length-1:] + data := s.packetData[:length-1] + + if s.mac != nil && s.etm { + s.mac.Write(data) + } + + s.cipher.XORKeyStream(data, data) + + if s.mac != nil { + if !s.etm { + s.mac.Write(data) + } + s.macResult = s.mac.Sum(s.macResult[:0]) + if subtle.ConstantTimeCompare(s.macResult, mac) != 1 { + return nil, errors.New("ssh: MAC failure") + } + } + + return s.packetData[:length-paddingLength-1], nil +} + +// writePacket encrypts and sends a packet of data to the writer argument +func (s *streamPacketCipher) writePacket(seqNum uint32, w io.Writer, rand io.Reader, packet []byte) error { + if len(packet) > maxPacket { + return errors.New("ssh: packet too large") + } + + aadlen := 0 + if s.mac != nil && s.etm { + // packet length is not encrypted for EtM modes + aadlen = 4 + } + + paddingLength := packetSizeMultiple - (prefixLen+len(packet)-aadlen)%packetSizeMultiple + if paddingLength < 4 { + paddingLength += packetSizeMultiple + } + + length := len(packet) + 1 + paddingLength + binary.BigEndian.PutUint32(s.prefix[:], uint32(length)) + s.prefix[4] = byte(paddingLength) + padding := s.padding[:paddingLength] + if _, err := io.ReadFull(rand, padding); err != nil { + return err + } + + if s.mac != nil { + s.mac.Reset() + binary.BigEndian.PutUint32(s.seqNumBytes[:], seqNum) + s.mac.Write(s.seqNumBytes[:]) + + if s.etm { + // For EtM algorithms, the packet length must stay unencrypted, + // but the following data (padding length) must be encrypted + s.cipher.XORKeyStream(s.prefix[4:5], s.prefix[4:5]) + } + + s.mac.Write(s.prefix[:]) + + if !s.etm { + // For non-EtM algorithms, the algorithm is applied on unencrypted data + s.mac.Write(packet) + s.mac.Write(padding) + } + } + + if !(s.mac != nil && s.etm) { + // For EtM algorithms, the padding length has already been encrypted + // and the packet length must remain unencrypted + s.cipher.XORKeyStream(s.prefix[:], s.prefix[:]) + } + + s.cipher.XORKeyStream(packet, packet) + s.cipher.XORKeyStream(padding, padding) + + if s.mac != nil && s.etm { + // For EtM algorithms, packet and padding must be encrypted + s.mac.Write(packet) + s.mac.Write(padding) + } + + if _, err := w.Write(s.prefix[:]); err != nil { + return err + } + if _, err := w.Write(packet); err != nil { + return err + } + if _, err := w.Write(padding); err != nil { + return err + } + + if s.mac != nil { + s.macResult = s.mac.Sum(s.macResult[:0]) + if _, err := w.Write(s.macResult); err != nil { + return err + } + } + + return nil +} + +type gcmCipher struct { + aead cipher.AEAD + prefix [4]byte + iv []byte + buf []byte +} + +func newGCMCipher(key, iv, unusedMacKey []byte, unusedAlgs directionAlgorithms) (packetCipher, error) { + c, err := aes.NewCipher(key) + if err != nil { + return nil, err + } + + aead, err := cipher.NewGCM(c) + if err != nil { + return nil, err + } + + return &gcmCipher{ + aead: aead, + iv: iv, + }, nil +} + +const gcmTagSize = 16 + +func (c *gcmCipher) writePacket(seqNum uint32, w io.Writer, rand io.Reader, packet []byte) error { + // Pad out to multiple of 16 bytes. This is different from the + // stream cipher because that encrypts the length too. + padding := byte(packetSizeMultiple - (1+len(packet))%packetSizeMultiple) + if padding < 4 { + padding += packetSizeMultiple + } + + length := uint32(len(packet) + int(padding) + 1) + binary.BigEndian.PutUint32(c.prefix[:], length) + if _, err := w.Write(c.prefix[:]); err != nil { + return err + } + + if cap(c.buf) < int(length) { + c.buf = make([]byte, length) + } else { + c.buf = c.buf[:length] + } + + c.buf[0] = padding + copy(c.buf[1:], packet) + if _, err := io.ReadFull(rand, c.buf[1+len(packet):]); err != nil { + return err + } + c.buf = c.aead.Seal(c.buf[:0], c.iv, c.buf, c.prefix[:]) + if _, err := w.Write(c.buf); err != nil { + return err + } + c.incIV() + + return nil +} + +func (c *gcmCipher) incIV() { + for i := 4 + 7; i >= 4; i-- { + c.iv[i]++ + if c.iv[i] != 0 { + break + } + } +} + +func (c *gcmCipher) readPacket(seqNum uint32, r io.Reader) ([]byte, error) { + if _, err := io.ReadFull(r, c.prefix[:]); err != nil { + return nil, err + } + length := binary.BigEndian.Uint32(c.prefix[:]) + if length > maxPacket { + return nil, errors.New("ssh: max packet length exceeded") + } + + if cap(c.buf) < int(length+gcmTagSize) { + c.buf = make([]byte, length+gcmTagSize) + } else { + c.buf = c.buf[:length+gcmTagSize] + } + + if _, err := io.ReadFull(r, c.buf); err != nil { + return nil, err + } + + plain, err := c.aead.Open(c.buf[:0], c.iv, c.buf, c.prefix[:]) + if err != nil { + return nil, err + } + c.incIV() + + padding := plain[0] + if padding < 4 { + // padding is a byte, so it automatically satisfies + // the maximum size, which is 255. + return nil, fmt.Errorf("ssh: illegal padding %d", padding) + } + + if int(padding+1) >= len(plain) { + return nil, fmt.Errorf("ssh: padding %d too large", padding) + } + plain = plain[1 : length-uint32(padding)] + return plain, nil +} + +// cbcCipher implements aes128-cbc cipher defined in RFC 4253 section 6.1 +type cbcCipher struct { + mac hash.Hash + macSize uint32 + decrypter cipher.BlockMode + encrypter cipher.BlockMode + + // The following members are to avoid per-packet allocations. + seqNumBytes [4]byte + packetData []byte + macResult []byte + + // Amount of data we should still read to hide which + // verification error triggered. + oracleCamouflage uint32 +} + +func newCBCCipher(c cipher.Block, key, iv, macKey []byte, algs directionAlgorithms) (packetCipher, error) { + cbc := &cbcCipher{ + mac: macModes[algs.MAC].new(macKey), + decrypter: cipher.NewCBCDecrypter(c, iv), + encrypter: cipher.NewCBCEncrypter(c, iv), + packetData: make([]byte, 1024), + } + if cbc.mac != nil { + cbc.macSize = uint32(cbc.mac.Size()) + } + + return cbc, nil +} + +func newAESCBCCipher(key, iv, macKey []byte, algs directionAlgorithms) (packetCipher, error) { + c, err := aes.NewCipher(key) + if err != nil { + return nil, err + } + + cbc, err := newCBCCipher(c, key, iv, macKey, algs) + if err != nil { + return nil, err + } + + return cbc, nil +} + +func newTripleDESCBCCipher(key, iv, macKey []byte, algs directionAlgorithms) (packetCipher, error) { + c, err := des.NewTripleDESCipher(key) + if err != nil { + return nil, err + } + + cbc, err := newCBCCipher(c, key, iv, macKey, algs) + if err != nil { + return nil, err + } + + return cbc, nil +} + +func maxUInt32(a, b int) uint32 { + if a > b { + return uint32(a) + } + return uint32(b) +} + +const ( + cbcMinPacketSizeMultiple = 8 + cbcMinPacketSize = 16 + cbcMinPaddingSize = 4 +) + +// cbcError represents a verification error that may leak information. +type cbcError string + +func (e cbcError) Error() string { return string(e) } + +func (c *cbcCipher) readPacket(seqNum uint32, r io.Reader) ([]byte, error) { + p, err := c.readPacketLeaky(seqNum, r) + if err != nil { + if _, ok := err.(cbcError); ok { + // Verification error: read a fixed amount of + // data, to make distinguishing between + // failing MAC and failing length check more + // difficult. + io.CopyN(ioutil.Discard, r, int64(c.oracleCamouflage)) + } + } + return p, err +} + +func (c *cbcCipher) readPacketLeaky(seqNum uint32, r io.Reader) ([]byte, error) { + blockSize := c.decrypter.BlockSize() + + // Read the header, which will include some of the subsequent data in the + // case of block ciphers - this is copied back to the payload later. + // How many bytes of payload/padding will be read with this first read. + firstBlockLength := uint32((prefixLen + blockSize - 1) / blockSize * blockSize) + firstBlock := c.packetData[:firstBlockLength] + if _, err := io.ReadFull(r, firstBlock); err != nil { + return nil, err + } + + c.oracleCamouflage = maxPacket + 4 + c.macSize - firstBlockLength + + c.decrypter.CryptBlocks(firstBlock, firstBlock) + length := binary.BigEndian.Uint32(firstBlock[:4]) + if length > maxPacket { + return nil, cbcError("ssh: packet too large") + } + if length+4 < maxUInt32(cbcMinPacketSize, blockSize) { + // The minimum size of a packet is 16 (or the cipher block size, whichever + // is larger) bytes. + return nil, cbcError("ssh: packet too small") + } + // The length of the packet (including the length field but not the MAC) must + // be a multiple of the block size or 8, whichever is larger. + if (length+4)%maxUInt32(cbcMinPacketSizeMultiple, blockSize) != 0 { + return nil, cbcError("ssh: invalid packet length multiple") + } + + paddingLength := uint32(firstBlock[4]) + if paddingLength < cbcMinPaddingSize || length <= paddingLength+1 { + return nil, cbcError("ssh: invalid packet length") + } + + // Positions within the c.packetData buffer: + macStart := 4 + length + paddingStart := macStart - paddingLength + + // Entire packet size, starting before length, ending at end of mac. + entirePacketSize := macStart + c.macSize + + // Ensure c.packetData is large enough for the entire packet data. + if uint32(cap(c.packetData)) < entirePacketSize { + // Still need to upsize and copy, but this should be rare at runtime, only + // on upsizing the packetData buffer. + c.packetData = make([]byte, entirePacketSize) + copy(c.packetData, firstBlock) + } else { + c.packetData = c.packetData[:entirePacketSize] + } + + n, err := io.ReadFull(r, c.packetData[firstBlockLength:]) + if err != nil { + return nil, err + } + c.oracleCamouflage -= uint32(n) + + remainingCrypted := c.packetData[firstBlockLength:macStart] + c.decrypter.CryptBlocks(remainingCrypted, remainingCrypted) + + mac := c.packetData[macStart:] + if c.mac != nil { + c.mac.Reset() + binary.BigEndian.PutUint32(c.seqNumBytes[:], seqNum) + c.mac.Write(c.seqNumBytes[:]) + c.mac.Write(c.packetData[:macStart]) + c.macResult = c.mac.Sum(c.macResult[:0]) + if subtle.ConstantTimeCompare(c.macResult, mac) != 1 { + return nil, cbcError("ssh: MAC failure") + } + } + + return c.packetData[prefixLen:paddingStart], nil +} + +func (c *cbcCipher) writePacket(seqNum uint32, w io.Writer, rand io.Reader, packet []byte) error { + effectiveBlockSize := maxUInt32(cbcMinPacketSizeMultiple, c.encrypter.BlockSize()) + + // Length of encrypted portion of the packet (header, payload, padding). + // Enforce minimum padding and packet size. + encLength := maxUInt32(prefixLen+len(packet)+cbcMinPaddingSize, cbcMinPaddingSize) + // Enforce block size. + encLength = (encLength + effectiveBlockSize - 1) / effectiveBlockSize * effectiveBlockSize + + length := encLength - 4 + paddingLength := int(length) - (1 + len(packet)) + + // Overall buffer contains: header, payload, padding, mac. + // Space for the MAC is reserved in the capacity but not the slice length. + bufferSize := encLength + c.macSize + if uint32(cap(c.packetData)) < bufferSize { + c.packetData = make([]byte, encLength, bufferSize) + } else { + c.packetData = c.packetData[:encLength] + } + + p := c.packetData + + // Packet header. + binary.BigEndian.PutUint32(p, length) + p = p[4:] + p[0] = byte(paddingLength) + + // Payload. + p = p[1:] + copy(p, packet) + + // Padding. + p = p[len(packet):] + if _, err := io.ReadFull(rand, p); err != nil { + return err + } + + if c.mac != nil { + c.mac.Reset() + binary.BigEndian.PutUint32(c.seqNumBytes[:], seqNum) + c.mac.Write(c.seqNumBytes[:]) + c.mac.Write(c.packetData) + // The MAC is now appended into the capacity reserved for it earlier. + c.packetData = c.mac.Sum(c.packetData) + } + + c.encrypter.CryptBlocks(c.packetData[:encLength], c.packetData[:encLength]) + + if _, err := w.Write(c.packetData); err != nil { + return err + } + + return nil +} + +const chacha20Poly1305ID = "chacha20-poly1305@openssh.com" + +// chacha20Poly1305Cipher implements the chacha20-poly1305@openssh.com +// AEAD, which is described here: +// +// https://tools.ietf.org/html/draft-josefsson-ssh-chacha20-poly1305-openssh-00 +// +// the methods here also implement padding, which RFC4253 Section 6 +// also requires of stream ciphers. +type chacha20Poly1305Cipher struct { + lengthKey [8]uint32 + contentKey [8]uint32 + buf []byte +} + +func newChaCha20Cipher(key, unusedIV, unusedMACKey []byte, unusedAlgs directionAlgorithms) (packetCipher, error) { + if len(key) != 64 { + panic(len(key)) + } + + c := &chacha20Poly1305Cipher{ + buf: make([]byte, 256), + } + + for i := range c.contentKey { + c.contentKey[i] = binary.LittleEndian.Uint32(key[i*4 : (i+1)*4]) + } + for i := range c.lengthKey { + c.lengthKey[i] = binary.LittleEndian.Uint32(key[(i+8)*4 : (i+9)*4]) + } + return c, nil +} + +func (c *chacha20Poly1305Cipher) readPacket(seqNum uint32, r io.Reader) ([]byte, error) { + nonce := [3]uint32{0, 0, bits.ReverseBytes32(seqNum)} + s := chacha20.New(c.contentKey, nonce) + var polyKey [32]byte + s.XORKeyStream(polyKey[:], polyKey[:]) + s.Advance() // skip next 32 bytes + + encryptedLength := c.buf[:4] + if _, err := io.ReadFull(r, encryptedLength); err != nil { + return nil, err + } + + var lenBytes [4]byte + chacha20.New(c.lengthKey, nonce).XORKeyStream(lenBytes[:], encryptedLength) + + length := binary.BigEndian.Uint32(lenBytes[:]) + if length > maxPacket { + return nil, errors.New("ssh: invalid packet length, packet too large") + } + + contentEnd := 4 + length + packetEnd := contentEnd + poly1305.TagSize + if uint32(cap(c.buf)) < packetEnd { + c.buf = make([]byte, packetEnd) + copy(c.buf[:], encryptedLength) + } else { + c.buf = c.buf[:packetEnd] + } + + if _, err := io.ReadFull(r, c.buf[4:packetEnd]); err != nil { + return nil, err + } + + var mac [poly1305.TagSize]byte + copy(mac[:], c.buf[contentEnd:packetEnd]) + if !poly1305.Verify(&mac, c.buf[:contentEnd], &polyKey) { + return nil, errors.New("ssh: MAC failure") + } + + plain := c.buf[4:contentEnd] + s.XORKeyStream(plain, plain) + + padding := plain[0] + if padding < 4 { + // padding is a byte, so it automatically satisfies + // the maximum size, which is 255. + return nil, fmt.Errorf("ssh: illegal padding %d", padding) + } + + if int(padding)+1 >= len(plain) { + return nil, fmt.Errorf("ssh: padding %d too large", padding) + } + + plain = plain[1 : len(plain)-int(padding)] + + return plain, nil +} + +func (c *chacha20Poly1305Cipher) writePacket(seqNum uint32, w io.Writer, rand io.Reader, payload []byte) error { + nonce := [3]uint32{0, 0, bits.ReverseBytes32(seqNum)} + s := chacha20.New(c.contentKey, nonce) + var polyKey [32]byte + s.XORKeyStream(polyKey[:], polyKey[:]) + s.Advance() // skip next 32 bytes + + // There is no blocksize, so fall back to multiple of 8 byte + // padding, as described in RFC 4253, Sec 6. + const packetSizeMultiple = 8 + + padding := packetSizeMultiple - (1+len(payload))%packetSizeMultiple + if padding < 4 { + padding += packetSizeMultiple + } + + // size (4 bytes), padding (1), payload, padding, tag. + totalLength := 4 + 1 + len(payload) + padding + poly1305.TagSize + if cap(c.buf) < totalLength { + c.buf = make([]byte, totalLength) + } else { + c.buf = c.buf[:totalLength] + } + + binary.BigEndian.PutUint32(c.buf, uint32(1+len(payload)+padding)) + chacha20.New(c.lengthKey, nonce).XORKeyStream(c.buf, c.buf[:4]) + c.buf[4] = byte(padding) + copy(c.buf[5:], payload) + packetEnd := 5 + len(payload) + padding + if _, err := io.ReadFull(rand, c.buf[5+len(payload):packetEnd]); err != nil { + return err + } + + s.XORKeyStream(c.buf[4:], c.buf[4:packetEnd]) + + var mac [poly1305.TagSize]byte + poly1305.Sum(&mac, c.buf[:packetEnd], &polyKey) + + copy(c.buf[packetEnd:], mac[:]) + + if _, err := w.Write(c.buf); err != nil { + return err + } + return nil +} diff --git a/vendor/golang.org/x/crypto/ssh/client.go b/vendor/golang.org/x/crypto/ssh/client.go new file mode 100644 index 0000000..7b00bff --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/client.go @@ -0,0 +1,278 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "bytes" + "errors" + "fmt" + "net" + "os" + "sync" + "time" +) + +// Client implements a traditional SSH client that supports shells, +// subprocesses, TCP port/streamlocal forwarding and tunneled dialing. +type Client struct { + Conn + + handleForwardsOnce sync.Once // guards calling (*Client).handleForwards + + forwards forwardList // forwarded tcpip connections from the remote side + mu sync.Mutex + channelHandlers map[string]chan NewChannel +} + +// HandleChannelOpen returns a channel on which NewChannel requests +// for the given type are sent. If the type already is being handled, +// nil is returned. The channel is closed when the connection is closed. +func (c *Client) HandleChannelOpen(channelType string) <-chan NewChannel { + c.mu.Lock() + defer c.mu.Unlock() + if c.channelHandlers == nil { + // The SSH channel has been closed. + c := make(chan NewChannel) + close(c) + return c + } + + ch := c.channelHandlers[channelType] + if ch != nil { + return nil + } + + ch = make(chan NewChannel, chanSize) + c.channelHandlers[channelType] = ch + return ch +} + +// NewClient creates a Client on top of the given connection. +func NewClient(c Conn, chans <-chan NewChannel, reqs <-chan *Request) *Client { + conn := &Client{ + Conn: c, + channelHandlers: make(map[string]chan NewChannel, 1), + } + + go conn.handleGlobalRequests(reqs) + go conn.handleChannelOpens(chans) + go func() { + conn.Wait() + conn.forwards.closeAll() + }() + return conn +} + +// NewClientConn establishes an authenticated SSH connection using c +// as the underlying transport. The Request and NewChannel channels +// must be serviced or the connection will hang. +func NewClientConn(c net.Conn, addr string, config *ClientConfig) (Conn, <-chan NewChannel, <-chan *Request, error) { + fullConf := *config + fullConf.SetDefaults() + if fullConf.HostKeyCallback == nil { + c.Close() + return nil, nil, nil, errors.New("ssh: must specify HostKeyCallback") + } + + conn := &connection{ + sshConn: sshConn{conn: c}, + } + + if err := conn.clientHandshake(addr, &fullConf); err != nil { + c.Close() + return nil, nil, nil, fmt.Errorf("ssh: handshake failed: %v", err) + } + conn.mux = newMux(conn.transport) + return conn, conn.mux.incomingChannels, conn.mux.incomingRequests, nil +} + +// clientHandshake performs the client side key exchange. See RFC 4253 Section +// 7. +func (c *connection) clientHandshake(dialAddress string, config *ClientConfig) error { + if config.ClientVersion != "" { + c.clientVersion = []byte(config.ClientVersion) + } else { + c.clientVersion = []byte(packageVersion) + } + var err error + c.serverVersion, err = exchangeVersions(c.sshConn.conn, c.clientVersion) + if err != nil { + return err + } + + c.transport = newClientTransport( + newTransport(c.sshConn.conn, config.Rand, true /* is client */), + c.clientVersion, c.serverVersion, config, dialAddress, c.sshConn.RemoteAddr()) + if err := c.transport.waitSession(); err != nil { + return err + } + + c.sessionID = c.transport.getSessionID() + return c.clientAuthenticate(config) +} + +// verifyHostKeySignature verifies the host key obtained in the key +// exchange. +func verifyHostKeySignature(hostKey PublicKey, result *kexResult) error { + sig, rest, ok := parseSignatureBody(result.Signature) + if len(rest) > 0 || !ok { + return errors.New("ssh: signature parse error") + } + + return hostKey.Verify(result.H, sig) +} + +// NewSession opens a new Session for this client. (A session is a remote +// execution of a program.) +func (c *Client) NewSession() (*Session, error) { + ch, in, err := c.OpenChannel("session", nil) + if err != nil { + return nil, err + } + return newSession(ch, in) +} + +func (c *Client) handleGlobalRequests(incoming <-chan *Request) { + for r := range incoming { + // This handles keepalive messages and matches + // the behaviour of OpenSSH. + r.Reply(false, nil) + } +} + +// handleChannelOpens channel open messages from the remote side. +func (c *Client) handleChannelOpens(in <-chan NewChannel) { + for ch := range in { + c.mu.Lock() + handler := c.channelHandlers[ch.ChannelType()] + c.mu.Unlock() + + if handler != nil { + handler <- ch + } else { + ch.Reject(UnknownChannelType, fmt.Sprintf("unknown channel type: %v", ch.ChannelType())) + } + } + + c.mu.Lock() + for _, ch := range c.channelHandlers { + close(ch) + } + c.channelHandlers = nil + c.mu.Unlock() +} + +// Dial starts a client connection to the given SSH server. It is a +// convenience function that connects to the given network address, +// initiates the SSH handshake, and then sets up a Client. For access +// to incoming channels and requests, use net.Dial with NewClientConn +// instead. +func Dial(network, addr string, config *ClientConfig) (*Client, error) { + conn, err := net.DialTimeout(network, addr, config.Timeout) + if err != nil { + return nil, err + } + c, chans, reqs, err := NewClientConn(conn, addr, config) + if err != nil { + return nil, err + } + return NewClient(c, chans, reqs), nil +} + +// HostKeyCallback is the function type used for verifying server +// keys. A HostKeyCallback must return nil if the host key is OK, or +// an error to reject it. It receives the hostname as passed to Dial +// or NewClientConn. The remote address is the RemoteAddr of the +// net.Conn underlying the SSH connection. +type HostKeyCallback func(hostname string, remote net.Addr, key PublicKey) error + +// BannerCallback is the function type used for treat the banner sent by +// the server. A BannerCallback receives the message sent by the remote server. +type BannerCallback func(message string) error + +// A ClientConfig structure is used to configure a Client. It must not be +// modified after having been passed to an SSH function. +type ClientConfig struct { + // Config contains configuration that is shared between clients and + // servers. + Config + + // User contains the username to authenticate as. + User string + + // Auth contains possible authentication methods to use with the + // server. Only the first instance of a particular RFC 4252 method will + // be used during authentication. + Auth []AuthMethod + + // HostKeyCallback is called during the cryptographic + // handshake to validate the server's host key. The client + // configuration must supply this callback for the connection + // to succeed. The functions InsecureIgnoreHostKey or + // FixedHostKey can be used for simplistic host key checks. + HostKeyCallback HostKeyCallback + + // BannerCallback is called during the SSH dance to display a custom + // server's message. The client configuration can supply this callback to + // handle it as wished. The function BannerDisplayStderr can be used for + // simplistic display on Stderr. + BannerCallback BannerCallback + + // ClientVersion contains the version identification string that will + // be used for the connection. If empty, a reasonable default is used. + ClientVersion string + + // HostKeyAlgorithms lists the key types that the client will + // accept from the server as host key, in order of + // preference. If empty, a reasonable default is used. Any + // string returned from PublicKey.Type method may be used, or + // any of the CertAlgoXxxx and KeyAlgoXxxx constants. + HostKeyAlgorithms []string + + // Timeout is the maximum amount of time for the TCP connection to establish. + // + // A Timeout of zero means no timeout. + Timeout time.Duration +} + +// InsecureIgnoreHostKey returns a function that can be used for +// ClientConfig.HostKeyCallback to accept any host key. It should +// not be used for production code. +func InsecureIgnoreHostKey() HostKeyCallback { + return func(hostname string, remote net.Addr, key PublicKey) error { + return nil + } +} + +type fixedHostKey struct { + key PublicKey +} + +func (f *fixedHostKey) check(hostname string, remote net.Addr, key PublicKey) error { + if f.key == nil { + return fmt.Errorf("ssh: required host key was nil") + } + if !bytes.Equal(key.Marshal(), f.key.Marshal()) { + return fmt.Errorf("ssh: host key mismatch") + } + return nil +} + +// FixedHostKey returns a function for use in +// ClientConfig.HostKeyCallback to accept only a specific host key. +func FixedHostKey(key PublicKey) HostKeyCallback { + hk := &fixedHostKey{key} + return hk.check +} + +// BannerDisplayStderr returns a function that can be used for +// ClientConfig.BannerCallback to display banners on os.Stderr. +func BannerDisplayStderr() BannerCallback { + return func(banner string) error { + _, err := os.Stderr.WriteString(banner) + + return err + } +} diff --git a/vendor/golang.org/x/crypto/ssh/client_auth.go b/vendor/golang.org/x/crypto/ssh/client_auth.go new file mode 100644 index 0000000..5f44b77 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/client_auth.go @@ -0,0 +1,525 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "bytes" + "errors" + "fmt" + "io" +) + +type authResult int + +const ( + authFailure authResult = iota + authPartialSuccess + authSuccess +) + +// clientAuthenticate authenticates with the remote server. See RFC 4252. +func (c *connection) clientAuthenticate(config *ClientConfig) error { + // initiate user auth session + if err := c.transport.writePacket(Marshal(&serviceRequestMsg{serviceUserAuth})); err != nil { + return err + } + packet, err := c.transport.readPacket() + if err != nil { + return err + } + var serviceAccept serviceAcceptMsg + if err := Unmarshal(packet, &serviceAccept); err != nil { + return err + } + + // during the authentication phase the client first attempts the "none" method + // then any untried methods suggested by the server. + tried := make(map[string]bool) + var lastMethods []string + + sessionID := c.transport.getSessionID() + for auth := AuthMethod(new(noneAuth)); auth != nil; { + ok, methods, err := auth.auth(sessionID, config.User, c.transport, config.Rand) + if err != nil { + return err + } + if ok == authSuccess { + // success + return nil + } else if ok == authFailure { + tried[auth.method()] = true + } + if methods == nil { + methods = lastMethods + } + lastMethods = methods + + auth = nil + + findNext: + for _, a := range config.Auth { + candidateMethod := a.method() + if tried[candidateMethod] { + continue + } + for _, meth := range methods { + if meth == candidateMethod { + auth = a + break findNext + } + } + } + } + return fmt.Errorf("ssh: unable to authenticate, attempted methods %v, no supported methods remain", keys(tried)) +} + +func keys(m map[string]bool) []string { + s := make([]string, 0, len(m)) + + for key := range m { + s = append(s, key) + } + return s +} + +// An AuthMethod represents an instance of an RFC 4252 authentication method. +type AuthMethod interface { + // auth authenticates user over transport t. + // Returns true if authentication is successful. + // If authentication is not successful, a []string of alternative + // method names is returned. If the slice is nil, it will be ignored + // and the previous set of possible methods will be reused. + auth(session []byte, user string, p packetConn, rand io.Reader) (authResult, []string, error) + + // method returns the RFC 4252 method name. + method() string +} + +// "none" authentication, RFC 4252 section 5.2. +type noneAuth int + +func (n *noneAuth) auth(session []byte, user string, c packetConn, rand io.Reader) (authResult, []string, error) { + if err := c.writePacket(Marshal(&userAuthRequestMsg{ + User: user, + Service: serviceSSH, + Method: "none", + })); err != nil { + return authFailure, nil, err + } + + return handleAuthResponse(c) +} + +func (n *noneAuth) method() string { + return "none" +} + +// passwordCallback is an AuthMethod that fetches the password through +// a function call, e.g. by prompting the user. +type passwordCallback func() (password string, err error) + +func (cb passwordCallback) auth(session []byte, user string, c packetConn, rand io.Reader) (authResult, []string, error) { + type passwordAuthMsg struct { + User string `sshtype:"50"` + Service string + Method string + Reply bool + Password string + } + + pw, err := cb() + // REVIEW NOTE: is there a need to support skipping a password attempt? + // The program may only find out that the user doesn't have a password + // when prompting. + if err != nil { + return authFailure, nil, err + } + + if err := c.writePacket(Marshal(&passwordAuthMsg{ + User: user, + Service: serviceSSH, + Method: cb.method(), + Reply: false, + Password: pw, + })); err != nil { + return authFailure, nil, err + } + + return handleAuthResponse(c) +} + +func (cb passwordCallback) method() string { + return "password" +} + +// Password returns an AuthMethod using the given password. +func Password(secret string) AuthMethod { + return passwordCallback(func() (string, error) { return secret, nil }) +} + +// PasswordCallback returns an AuthMethod that uses a callback for +// fetching a password. +func PasswordCallback(prompt func() (secret string, err error)) AuthMethod { + return passwordCallback(prompt) +} + +type publickeyAuthMsg struct { + User string `sshtype:"50"` + Service string + Method string + // HasSig indicates to the receiver packet that the auth request is signed and + // should be used for authentication of the request. + HasSig bool + Algoname string + PubKey []byte + // Sig is tagged with "rest" so Marshal will exclude it during + // validateKey + Sig []byte `ssh:"rest"` +} + +// publicKeyCallback is an AuthMethod that uses a set of key +// pairs for authentication. +type publicKeyCallback func() ([]Signer, error) + +func (cb publicKeyCallback) method() string { + return "publickey" +} + +func (cb publicKeyCallback) auth(session []byte, user string, c packetConn, rand io.Reader) (authResult, []string, error) { + // Authentication is performed by sending an enquiry to test if a key is + // acceptable to the remote. If the key is acceptable, the client will + // attempt to authenticate with the valid key. If not the client will repeat + // the process with the remaining keys. + + signers, err := cb() + if err != nil { + return authFailure, nil, err + } + var methods []string + for _, signer := range signers { + ok, err := validateKey(signer.PublicKey(), user, c) + if err != nil { + return authFailure, nil, err + } + if !ok { + continue + } + + pub := signer.PublicKey() + pubKey := pub.Marshal() + sign, err := signer.Sign(rand, buildDataSignedForAuth(session, userAuthRequestMsg{ + User: user, + Service: serviceSSH, + Method: cb.method(), + }, []byte(pub.Type()), pubKey)) + if err != nil { + return authFailure, nil, err + } + + // manually wrap the serialized signature in a string + s := Marshal(sign) + sig := make([]byte, stringLength(len(s))) + marshalString(sig, s) + msg := publickeyAuthMsg{ + User: user, + Service: serviceSSH, + Method: cb.method(), + HasSig: true, + Algoname: pub.Type(), + PubKey: pubKey, + Sig: sig, + } + p := Marshal(&msg) + if err := c.writePacket(p); err != nil { + return authFailure, nil, err + } + var success authResult + success, methods, err = handleAuthResponse(c) + if err != nil { + return authFailure, nil, err + } + + // If authentication succeeds or the list of available methods does not + // contain the "publickey" method, do not attempt to authenticate with any + // other keys. According to RFC 4252 Section 7, the latter can occur when + // additional authentication methods are required. + if success == authSuccess || !containsMethod(methods, cb.method()) { + return success, methods, err + } + } + + return authFailure, methods, nil +} + +func containsMethod(methods []string, method string) bool { + for _, m := range methods { + if m == method { + return true + } + } + + return false +} + +// validateKey validates the key provided is acceptable to the server. +func validateKey(key PublicKey, user string, c packetConn) (bool, error) { + pubKey := key.Marshal() + msg := publickeyAuthMsg{ + User: user, + Service: serviceSSH, + Method: "publickey", + HasSig: false, + Algoname: key.Type(), + PubKey: pubKey, + } + if err := c.writePacket(Marshal(&msg)); err != nil { + return false, err + } + + return confirmKeyAck(key, c) +} + +func confirmKeyAck(key PublicKey, c packetConn) (bool, error) { + pubKey := key.Marshal() + algoname := key.Type() + + for { + packet, err := c.readPacket() + if err != nil { + return false, err + } + switch packet[0] { + case msgUserAuthBanner: + if err := handleBannerResponse(c, packet); err != nil { + return false, err + } + case msgUserAuthPubKeyOk: + var msg userAuthPubKeyOkMsg + if err := Unmarshal(packet, &msg); err != nil { + return false, err + } + if msg.Algo != algoname || !bytes.Equal(msg.PubKey, pubKey) { + return false, nil + } + return true, nil + case msgUserAuthFailure: + return false, nil + default: + return false, unexpectedMessageError(msgUserAuthSuccess, packet[0]) + } + } +} + +// PublicKeys returns an AuthMethod that uses the given key +// pairs. +func PublicKeys(signers ...Signer) AuthMethod { + return publicKeyCallback(func() ([]Signer, error) { return signers, nil }) +} + +// PublicKeysCallback returns an AuthMethod that runs the given +// function to obtain a list of key pairs. +func PublicKeysCallback(getSigners func() (signers []Signer, err error)) AuthMethod { + return publicKeyCallback(getSigners) +} + +// handleAuthResponse returns whether the preceding authentication request succeeded +// along with a list of remaining authentication methods to try next and +// an error if an unexpected response was received. +func handleAuthResponse(c packetConn) (authResult, []string, error) { + for { + packet, err := c.readPacket() + if err != nil { + return authFailure, nil, err + } + + switch packet[0] { + case msgUserAuthBanner: + if err := handleBannerResponse(c, packet); err != nil { + return authFailure, nil, err + } + case msgUserAuthFailure: + var msg userAuthFailureMsg + if err := Unmarshal(packet, &msg); err != nil { + return authFailure, nil, err + } + if msg.PartialSuccess { + return authPartialSuccess, msg.Methods, nil + } + return authFailure, msg.Methods, nil + case msgUserAuthSuccess: + return authSuccess, nil, nil + default: + return authFailure, nil, unexpectedMessageError(msgUserAuthSuccess, packet[0]) + } + } +} + +func handleBannerResponse(c packetConn, packet []byte) error { + var msg userAuthBannerMsg + if err := Unmarshal(packet, &msg); err != nil { + return err + } + + transport, ok := c.(*handshakeTransport) + if !ok { + return nil + } + + if transport.bannerCallback != nil { + return transport.bannerCallback(msg.Message) + } + + return nil +} + +// KeyboardInteractiveChallenge should print questions, optionally +// disabling echoing (e.g. for passwords), and return all the answers. +// Challenge may be called multiple times in a single session. After +// successful authentication, the server may send a challenge with no +// questions, for which the user and instruction messages should be +// printed. RFC 4256 section 3.3 details how the UI should behave for +// both CLI and GUI environments. +type KeyboardInteractiveChallenge func(user, instruction string, questions []string, echos []bool) (answers []string, err error) + +// KeyboardInteractive returns an AuthMethod using a prompt/response +// sequence controlled by the server. +func KeyboardInteractive(challenge KeyboardInteractiveChallenge) AuthMethod { + return challenge +} + +func (cb KeyboardInteractiveChallenge) method() string { + return "keyboard-interactive" +} + +func (cb KeyboardInteractiveChallenge) auth(session []byte, user string, c packetConn, rand io.Reader) (authResult, []string, error) { + type initiateMsg struct { + User string `sshtype:"50"` + Service string + Method string + Language string + Submethods string + } + + if err := c.writePacket(Marshal(&initiateMsg{ + User: user, + Service: serviceSSH, + Method: "keyboard-interactive", + })); err != nil { + return authFailure, nil, err + } + + for { + packet, err := c.readPacket() + if err != nil { + return authFailure, nil, err + } + + // like handleAuthResponse, but with less options. + switch packet[0] { + case msgUserAuthBanner: + if err := handleBannerResponse(c, packet); err != nil { + return authFailure, nil, err + } + continue + case msgUserAuthInfoRequest: + // OK + case msgUserAuthFailure: + var msg userAuthFailureMsg + if err := Unmarshal(packet, &msg); err != nil { + return authFailure, nil, err + } + if msg.PartialSuccess { + return authPartialSuccess, msg.Methods, nil + } + return authFailure, msg.Methods, nil + case msgUserAuthSuccess: + return authSuccess, nil, nil + default: + return authFailure, nil, unexpectedMessageError(msgUserAuthInfoRequest, packet[0]) + } + + var msg userAuthInfoRequestMsg + if err := Unmarshal(packet, &msg); err != nil { + return authFailure, nil, err + } + + // Manually unpack the prompt/echo pairs. + rest := msg.Prompts + var prompts []string + var echos []bool + for i := 0; i < int(msg.NumPrompts); i++ { + prompt, r, ok := parseString(rest) + if !ok || len(r) == 0 { + return authFailure, nil, errors.New("ssh: prompt format error") + } + prompts = append(prompts, string(prompt)) + echos = append(echos, r[0] != 0) + rest = r[1:] + } + + if len(rest) != 0 { + return authFailure, nil, errors.New("ssh: extra data following keyboard-interactive pairs") + } + + answers, err := cb(msg.User, msg.Instruction, prompts, echos) + if err != nil { + return authFailure, nil, err + } + + if len(answers) != len(prompts) { + return authFailure, nil, errors.New("ssh: not enough answers from keyboard-interactive callback") + } + responseLength := 1 + 4 + for _, a := range answers { + responseLength += stringLength(len(a)) + } + serialized := make([]byte, responseLength) + p := serialized + p[0] = msgUserAuthInfoResponse + p = p[1:] + p = marshalUint32(p, uint32(len(answers))) + for _, a := range answers { + p = marshalString(p, []byte(a)) + } + + if err := c.writePacket(serialized); err != nil { + return authFailure, nil, err + } + } +} + +type retryableAuthMethod struct { + authMethod AuthMethod + maxTries int +} + +func (r *retryableAuthMethod) auth(session []byte, user string, c packetConn, rand io.Reader) (ok authResult, methods []string, err error) { + for i := 0; r.maxTries <= 0 || i < r.maxTries; i++ { + ok, methods, err = r.authMethod.auth(session, user, c, rand) + if ok != authFailure || err != nil { // either success, partial success or error terminate + return ok, methods, err + } + } + return ok, methods, err +} + +func (r *retryableAuthMethod) method() string { + return r.authMethod.method() +} + +// RetryableAuthMethod is a decorator for other auth methods enabling them to +// be retried up to maxTries before considering that AuthMethod itself failed. +// If maxTries is <= 0, will retry indefinitely +// +// This is useful for interactive clients using challenge/response type +// authentication (e.g. Keyboard-Interactive, Password, etc) where the user +// could mistype their response resulting in the server issuing a +// SSH_MSG_USERAUTH_FAILURE (rfc4252 #8 [password] and rfc4256 #3.4 +// [keyboard-interactive]); Without this decorator, the non-retryable +// AuthMethod would be removed from future consideration, and never tried again +// (and so the user would never be able to retry their entry). +func RetryableAuthMethod(auth AuthMethod, maxTries int) AuthMethod { + return &retryableAuthMethod{authMethod: auth, maxTries: maxTries} +} diff --git a/vendor/golang.org/x/crypto/ssh/common.go b/vendor/golang.org/x/crypto/ssh/common.go new file mode 100644 index 0000000..04f3620 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/common.go @@ -0,0 +1,383 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "crypto" + "crypto/rand" + "fmt" + "io" + "math" + "sync" + + _ "crypto/sha1" + _ "crypto/sha256" + _ "crypto/sha512" +) + +// These are string constants in the SSH protocol. +const ( + compressionNone = "none" + serviceUserAuth = "ssh-userauth" + serviceSSH = "ssh-connection" +) + +// supportedCiphers lists ciphers we support but might not recommend. +var supportedCiphers = []string{ + "aes128-ctr", "aes192-ctr", "aes256-ctr", + "aes128-gcm@openssh.com", + chacha20Poly1305ID, + "arcfour256", "arcfour128", "arcfour", + aes128cbcID, + tripledescbcID, +} + +// preferredCiphers specifies the default preference for ciphers. +var preferredCiphers = []string{ + "aes128-gcm@openssh.com", + chacha20Poly1305ID, + "aes128-ctr", "aes192-ctr", "aes256-ctr", +} + +// supportedKexAlgos specifies the supported key-exchange algorithms in +// preference order. +var supportedKexAlgos = []string{ + kexAlgoCurve25519SHA256, + // P384 and P521 are not constant-time yet, but since we don't + // reuse ephemeral keys, using them for ECDH should be OK. + kexAlgoECDH256, kexAlgoECDH384, kexAlgoECDH521, + kexAlgoDH14SHA1, kexAlgoDH1SHA1, +} + +// supportedHostKeyAlgos specifies the supported host-key algorithms (i.e. methods +// of authenticating servers) in preference order. +var supportedHostKeyAlgos = []string{ + CertAlgoRSAv01, CertAlgoDSAv01, CertAlgoECDSA256v01, + CertAlgoECDSA384v01, CertAlgoECDSA521v01, CertAlgoED25519v01, + + KeyAlgoECDSA256, KeyAlgoECDSA384, KeyAlgoECDSA521, + KeyAlgoRSA, KeyAlgoDSA, + + KeyAlgoED25519, +} + +// supportedMACs specifies a default set of MAC algorithms in preference order. +// This is based on RFC 4253, section 6.4, but with hmac-md5 variants removed +// because they have reached the end of their useful life. +var supportedMACs = []string{ + "hmac-sha2-256-etm@openssh.com", "hmac-sha2-256", "hmac-sha1", "hmac-sha1-96", +} + +var supportedCompressions = []string{compressionNone} + +// hashFuncs keeps the mapping of supported algorithms to their respective +// hashes needed for signature verification. +var hashFuncs = map[string]crypto.Hash{ + KeyAlgoRSA: crypto.SHA1, + KeyAlgoDSA: crypto.SHA1, + KeyAlgoECDSA256: crypto.SHA256, + KeyAlgoECDSA384: crypto.SHA384, + KeyAlgoECDSA521: crypto.SHA512, + CertAlgoRSAv01: crypto.SHA1, + CertAlgoDSAv01: crypto.SHA1, + CertAlgoECDSA256v01: crypto.SHA256, + CertAlgoECDSA384v01: crypto.SHA384, + CertAlgoECDSA521v01: crypto.SHA512, +} + +// unexpectedMessageError results when the SSH message that we received didn't +// match what we wanted. +func unexpectedMessageError(expected, got uint8) error { + return fmt.Errorf("ssh: unexpected message type %d (expected %d)", got, expected) +} + +// parseError results from a malformed SSH message. +func parseError(tag uint8) error { + return fmt.Errorf("ssh: parse error in message type %d", tag) +} + +func findCommon(what string, client []string, server []string) (common string, err error) { + for _, c := range client { + for _, s := range server { + if c == s { + return c, nil + } + } + } + return "", fmt.Errorf("ssh: no common algorithm for %s; client offered: %v, server offered: %v", what, client, server) +} + +type directionAlgorithms struct { + Cipher string + MAC string + Compression string +} + +// rekeyBytes returns a rekeying intervals in bytes. +func (a *directionAlgorithms) rekeyBytes() int64 { + // According to RFC4344 block ciphers should rekey after + // 2^(BLOCKSIZE/4) blocks. For all AES flavors BLOCKSIZE is + // 128. + switch a.Cipher { + case "aes128-ctr", "aes192-ctr", "aes256-ctr", gcmCipherID, aes128cbcID: + return 16 * (1 << 32) + + } + + // For others, stick with RFC4253 recommendation to rekey after 1 Gb of data. + return 1 << 30 +} + +type algorithms struct { + kex string + hostKey string + w directionAlgorithms + r directionAlgorithms +} + +func findAgreedAlgorithms(clientKexInit, serverKexInit *kexInitMsg) (algs *algorithms, err error) { + result := &algorithms{} + + result.kex, err = findCommon("key exchange", clientKexInit.KexAlgos, serverKexInit.KexAlgos) + if err != nil { + return + } + + result.hostKey, err = findCommon("host key", clientKexInit.ServerHostKeyAlgos, serverKexInit.ServerHostKeyAlgos) + if err != nil { + return + } + + result.w.Cipher, err = findCommon("client to server cipher", clientKexInit.CiphersClientServer, serverKexInit.CiphersClientServer) + if err != nil { + return + } + + result.r.Cipher, err = findCommon("server to client cipher", clientKexInit.CiphersServerClient, serverKexInit.CiphersServerClient) + if err != nil { + return + } + + result.w.MAC, err = findCommon("client to server MAC", clientKexInit.MACsClientServer, serverKexInit.MACsClientServer) + if err != nil { + return + } + + result.r.MAC, err = findCommon("server to client MAC", clientKexInit.MACsServerClient, serverKexInit.MACsServerClient) + if err != nil { + return + } + + result.w.Compression, err = findCommon("client to server compression", clientKexInit.CompressionClientServer, serverKexInit.CompressionClientServer) + if err != nil { + return + } + + result.r.Compression, err = findCommon("server to client compression", clientKexInit.CompressionServerClient, serverKexInit.CompressionServerClient) + if err != nil { + return + } + + return result, nil +} + +// If rekeythreshold is too small, we can't make any progress sending +// stuff. +const minRekeyThreshold uint64 = 256 + +// Config contains configuration data common to both ServerConfig and +// ClientConfig. +type Config struct { + // Rand provides the source of entropy for cryptographic + // primitives. If Rand is nil, the cryptographic random reader + // in package crypto/rand will be used. + Rand io.Reader + + // The maximum number of bytes sent or received after which a + // new key is negotiated. It must be at least 256. If + // unspecified, a size suitable for the chosen cipher is used. + RekeyThreshold uint64 + + // The allowed key exchanges algorithms. If unspecified then a + // default set of algorithms is used. + KeyExchanges []string + + // The allowed cipher algorithms. If unspecified then a sensible + // default is used. + Ciphers []string + + // The allowed MAC algorithms. If unspecified then a sensible default + // is used. + MACs []string +} + +// SetDefaults sets sensible values for unset fields in config. This is +// exported for testing: Configs passed to SSH functions are copied and have +// default values set automatically. +func (c *Config) SetDefaults() { + if c.Rand == nil { + c.Rand = rand.Reader + } + if c.Ciphers == nil { + c.Ciphers = preferredCiphers + } + var ciphers []string + for _, c := range c.Ciphers { + if cipherModes[c] != nil { + // reject the cipher if we have no cipherModes definition + ciphers = append(ciphers, c) + } + } + c.Ciphers = ciphers + + if c.KeyExchanges == nil { + c.KeyExchanges = supportedKexAlgos + } + + if c.MACs == nil { + c.MACs = supportedMACs + } + + if c.RekeyThreshold == 0 { + // cipher specific default + } else if c.RekeyThreshold < minRekeyThreshold { + c.RekeyThreshold = minRekeyThreshold + } else if c.RekeyThreshold >= math.MaxInt64 { + // Avoid weirdness if somebody uses -1 as a threshold. + c.RekeyThreshold = math.MaxInt64 + } +} + +// buildDataSignedForAuth returns the data that is signed in order to prove +// possession of a private key. See RFC 4252, section 7. +func buildDataSignedForAuth(sessionID []byte, req userAuthRequestMsg, algo, pubKey []byte) []byte { + data := struct { + Session []byte + Type byte + User string + Service string + Method string + Sign bool + Algo []byte + PubKey []byte + }{ + sessionID, + msgUserAuthRequest, + req.User, + req.Service, + req.Method, + true, + algo, + pubKey, + } + return Marshal(data) +} + +func appendU16(buf []byte, n uint16) []byte { + return append(buf, byte(n>>8), byte(n)) +} + +func appendU32(buf []byte, n uint32) []byte { + return append(buf, byte(n>>24), byte(n>>16), byte(n>>8), byte(n)) +} + +func appendU64(buf []byte, n uint64) []byte { + return append(buf, + byte(n>>56), byte(n>>48), byte(n>>40), byte(n>>32), + byte(n>>24), byte(n>>16), byte(n>>8), byte(n)) +} + +func appendInt(buf []byte, n int) []byte { + return appendU32(buf, uint32(n)) +} + +func appendString(buf []byte, s string) []byte { + buf = appendU32(buf, uint32(len(s))) + buf = append(buf, s...) + return buf +} + +func appendBool(buf []byte, b bool) []byte { + if b { + return append(buf, 1) + } + return append(buf, 0) +} + +// newCond is a helper to hide the fact that there is no usable zero +// value for sync.Cond. +func newCond() *sync.Cond { return sync.NewCond(new(sync.Mutex)) } + +// window represents the buffer available to clients +// wishing to write to a channel. +type window struct { + *sync.Cond + win uint32 // RFC 4254 5.2 says the window size can grow to 2^32-1 + writeWaiters int + closed bool +} + +// add adds win to the amount of window available +// for consumers. +func (w *window) add(win uint32) bool { + // a zero sized window adjust is a noop. + if win == 0 { + return true + } + w.L.Lock() + if w.win+win < win { + w.L.Unlock() + return false + } + w.win += win + // It is unusual that multiple goroutines would be attempting to reserve + // window space, but not guaranteed. Use broadcast to notify all waiters + // that additional window is available. + w.Broadcast() + w.L.Unlock() + return true +} + +// close sets the window to closed, so all reservations fail +// immediately. +func (w *window) close() { + w.L.Lock() + w.closed = true + w.Broadcast() + w.L.Unlock() +} + +// reserve reserves win from the available window capacity. +// If no capacity remains, reserve will block. reserve may +// return less than requested. +func (w *window) reserve(win uint32) (uint32, error) { + var err error + w.L.Lock() + w.writeWaiters++ + w.Broadcast() + for w.win == 0 && !w.closed { + w.Wait() + } + w.writeWaiters-- + if w.win < win { + win = w.win + } + w.win -= win + if w.closed { + err = io.EOF + } + w.L.Unlock() + return win, err +} + +// waitWriterBlocked waits until some goroutine is blocked for further +// writes. It is used in tests only. +func (w *window) waitWriterBlocked() { + w.Cond.L.Lock() + for w.writeWaiters == 0 { + w.Cond.Wait() + } + w.Cond.L.Unlock() +} diff --git a/vendor/golang.org/x/crypto/ssh/connection.go b/vendor/golang.org/x/crypto/ssh/connection.go new file mode 100644 index 0000000..fd6b068 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/connection.go @@ -0,0 +1,143 @@ +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "fmt" + "net" +) + +// OpenChannelError is returned if the other side rejects an +// OpenChannel request. +type OpenChannelError struct { + Reason RejectionReason + Message string +} + +func (e *OpenChannelError) Error() string { + return fmt.Sprintf("ssh: rejected: %s (%s)", e.Reason, e.Message) +} + +// ConnMetadata holds metadata for the connection. +type ConnMetadata interface { + // User returns the user ID for this connection. + User() string + + // SessionID returns the session hash, also denoted by H. + SessionID() []byte + + // ClientVersion returns the client's version string as hashed + // into the session ID. + ClientVersion() []byte + + // ServerVersion returns the server's version string as hashed + // into the session ID. + ServerVersion() []byte + + // RemoteAddr returns the remote address for this connection. + RemoteAddr() net.Addr + + // LocalAddr returns the local address for this connection. + LocalAddr() net.Addr +} + +// Conn represents an SSH connection for both server and client roles. +// Conn is the basis for implementing an application layer, such +// as ClientConn, which implements the traditional shell access for +// clients. +type Conn interface { + ConnMetadata + + // SendRequest sends a global request, and returns the + // reply. If wantReply is true, it returns the response status + // and payload. See also RFC4254, section 4. + SendRequest(name string, wantReply bool, payload []byte) (bool, []byte, error) + + // OpenChannel tries to open an channel. If the request is + // rejected, it returns *OpenChannelError. On success it returns + // the SSH Channel and a Go channel for incoming, out-of-band + // requests. The Go channel must be serviced, or the + // connection will hang. + OpenChannel(name string, data []byte) (Channel, <-chan *Request, error) + + // Close closes the underlying network connection + Close() error + + // Wait blocks until the connection has shut down, and returns the + // error causing the shutdown. + Wait() error + + // TODO(hanwen): consider exposing: + // RequestKeyChange + // Disconnect +} + +// DiscardRequests consumes and rejects all requests from the +// passed-in channel. +func DiscardRequests(in <-chan *Request) { + for req := range in { + if req.WantReply { + req.Reply(false, nil) + } + } +} + +// A connection represents an incoming connection. +type connection struct { + transport *handshakeTransport + sshConn + + // The connection protocol. + *mux +} + +func (c *connection) Close() error { + return c.sshConn.conn.Close() +} + +// sshconn provides net.Conn metadata, but disallows direct reads and +// writes. +type sshConn struct { + conn net.Conn + + user string + sessionID []byte + clientVersion []byte + serverVersion []byte +} + +func dup(src []byte) []byte { + dst := make([]byte, len(src)) + copy(dst, src) + return dst +} + +func (c *sshConn) User() string { + return c.user +} + +func (c *sshConn) RemoteAddr() net.Addr { + return c.conn.RemoteAddr() +} + +func (c *sshConn) Close() error { + return c.conn.Close() +} + +func (c *sshConn) LocalAddr() net.Addr { + return c.conn.LocalAddr() +} + +func (c *sshConn) SessionID() []byte { + return dup(c.sessionID) +} + +func (c *sshConn) ClientVersion() []byte { + return dup(c.clientVersion) +} + +func (c *sshConn) ServerVersion() []byte { + return dup(c.serverVersion) +} diff --git a/vendor/golang.org/x/crypto/ssh/doc.go b/vendor/golang.org/x/crypto/ssh/doc.go new file mode 100644 index 0000000..67b7322 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/doc.go @@ -0,0 +1,21 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +/* +Package ssh implements an SSH client and server. + +SSH is a transport security protocol, an authentication protocol and a +family of application protocols. The most typical application level +protocol is a remote shell and this is specifically implemented. However, +the multiplexed nature of SSH is exposed to users that wish to support +others. + +References: + [PROTOCOL.certkeys]: http://cvsweb.openbsd.org/cgi-bin/cvsweb/src/usr.bin/ssh/PROTOCOL.certkeys?rev=HEAD + [SSH-PARAMETERS]: http://www.iana.org/assignments/ssh-parameters/ssh-parameters.xml#ssh-parameters-1 + +This package does not fall under the stability promise of the Go language itself, +so its API may be changed when pressing needs arise. +*/ +package ssh // import "golang.org/x/crypto/ssh" diff --git a/vendor/golang.org/x/crypto/ssh/handshake.go b/vendor/golang.org/x/crypto/ssh/handshake.go new file mode 100644 index 0000000..4f7912e --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/handshake.go @@ -0,0 +1,646 @@ +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "crypto/rand" + "errors" + "fmt" + "io" + "log" + "net" + "sync" +) + +// debugHandshake, if set, prints messages sent and received. Key +// exchange messages are printed as if DH were used, so the debug +// messages are wrong when using ECDH. +const debugHandshake = false + +// chanSize sets the amount of buffering SSH connections. This is +// primarily for testing: setting chanSize=0 uncovers deadlocks more +// quickly. +const chanSize = 16 + +// keyingTransport is a packet based transport that supports key +// changes. It need not be thread-safe. It should pass through +// msgNewKeys in both directions. +type keyingTransport interface { + packetConn + + // prepareKeyChange sets up a key change. The key change for a + // direction will be effected if a msgNewKeys message is sent + // or received. + prepareKeyChange(*algorithms, *kexResult) error +} + +// handshakeTransport implements rekeying on top of a keyingTransport +// and offers a thread-safe writePacket() interface. +type handshakeTransport struct { + conn keyingTransport + config *Config + + serverVersion []byte + clientVersion []byte + + // hostKeys is non-empty if we are the server. In that case, + // it contains all host keys that can be used to sign the + // connection. + hostKeys []Signer + + // hostKeyAlgorithms is non-empty if we are the client. In that case, + // we accept these key types from the server as host key. + hostKeyAlgorithms []string + + // On read error, incoming is closed, and readError is set. + incoming chan []byte + readError error + + mu sync.Mutex + writeError error + sentInitPacket []byte + sentInitMsg *kexInitMsg + pendingPackets [][]byte // Used when a key exchange is in progress. + + // If the read loop wants to schedule a kex, it pings this + // channel, and the write loop will send out a kex + // message. + requestKex chan struct{} + + // If the other side requests or confirms a kex, its kexInit + // packet is sent here for the write loop to find it. + startKex chan *pendingKex + + // data for host key checking + hostKeyCallback HostKeyCallback + dialAddress string + remoteAddr net.Addr + + // bannerCallback is non-empty if we are the client and it has been set in + // ClientConfig. In that case it is called during the user authentication + // dance to handle a custom server's message. + bannerCallback BannerCallback + + // Algorithms agreed in the last key exchange. + algorithms *algorithms + + readPacketsLeft uint32 + readBytesLeft int64 + + writePacketsLeft uint32 + writeBytesLeft int64 + + // The session ID or nil if first kex did not complete yet. + sessionID []byte +} + +type pendingKex struct { + otherInit []byte + done chan error +} + +func newHandshakeTransport(conn keyingTransport, config *Config, clientVersion, serverVersion []byte) *handshakeTransport { + t := &handshakeTransport{ + conn: conn, + serverVersion: serverVersion, + clientVersion: clientVersion, + incoming: make(chan []byte, chanSize), + requestKex: make(chan struct{}, 1), + startKex: make(chan *pendingKex, 1), + + config: config, + } + t.resetReadThresholds() + t.resetWriteThresholds() + + // We always start with a mandatory key exchange. + t.requestKex <- struct{}{} + return t +} + +func newClientTransport(conn keyingTransport, clientVersion, serverVersion []byte, config *ClientConfig, dialAddr string, addr net.Addr) *handshakeTransport { + t := newHandshakeTransport(conn, &config.Config, clientVersion, serverVersion) + t.dialAddress = dialAddr + t.remoteAddr = addr + t.hostKeyCallback = config.HostKeyCallback + t.bannerCallback = config.BannerCallback + if config.HostKeyAlgorithms != nil { + t.hostKeyAlgorithms = config.HostKeyAlgorithms + } else { + t.hostKeyAlgorithms = supportedHostKeyAlgos + } + go t.readLoop() + go t.kexLoop() + return t +} + +func newServerTransport(conn keyingTransport, clientVersion, serverVersion []byte, config *ServerConfig) *handshakeTransport { + t := newHandshakeTransport(conn, &config.Config, clientVersion, serverVersion) + t.hostKeys = config.hostKeys + go t.readLoop() + go t.kexLoop() + return t +} + +func (t *handshakeTransport) getSessionID() []byte { + return t.sessionID +} + +// waitSession waits for the session to be established. This should be +// the first thing to call after instantiating handshakeTransport. +func (t *handshakeTransport) waitSession() error { + p, err := t.readPacket() + if err != nil { + return err + } + if p[0] != msgNewKeys { + return fmt.Errorf("ssh: first packet should be msgNewKeys") + } + + return nil +} + +func (t *handshakeTransport) id() string { + if len(t.hostKeys) > 0 { + return "server" + } + return "client" +} + +func (t *handshakeTransport) printPacket(p []byte, write bool) { + action := "got" + if write { + action = "sent" + } + + if p[0] == msgChannelData || p[0] == msgChannelExtendedData { + log.Printf("%s %s data (packet %d bytes)", t.id(), action, len(p)) + } else { + msg, err := decode(p) + log.Printf("%s %s %T %v (%v)", t.id(), action, msg, msg, err) + } +} + +func (t *handshakeTransport) readPacket() ([]byte, error) { + p, ok := <-t.incoming + if !ok { + return nil, t.readError + } + return p, nil +} + +func (t *handshakeTransport) readLoop() { + first := true + for { + p, err := t.readOnePacket(first) + first = false + if err != nil { + t.readError = err + close(t.incoming) + break + } + if p[0] == msgIgnore || p[0] == msgDebug { + continue + } + t.incoming <- p + } + + // Stop writers too. + t.recordWriteError(t.readError) + + // Unblock the writer should it wait for this. + close(t.startKex) + + // Don't close t.requestKex; it's also written to from writePacket. +} + +func (t *handshakeTransport) pushPacket(p []byte) error { + if debugHandshake { + t.printPacket(p, true) + } + return t.conn.writePacket(p) +} + +func (t *handshakeTransport) getWriteError() error { + t.mu.Lock() + defer t.mu.Unlock() + return t.writeError +} + +func (t *handshakeTransport) recordWriteError(err error) { + t.mu.Lock() + defer t.mu.Unlock() + if t.writeError == nil && err != nil { + t.writeError = err + } +} + +func (t *handshakeTransport) requestKeyExchange() { + select { + case t.requestKex <- struct{}{}: + default: + // something already requested a kex, so do nothing. + } +} + +func (t *handshakeTransport) resetWriteThresholds() { + t.writePacketsLeft = packetRekeyThreshold + if t.config.RekeyThreshold > 0 { + t.writeBytesLeft = int64(t.config.RekeyThreshold) + } else if t.algorithms != nil { + t.writeBytesLeft = t.algorithms.w.rekeyBytes() + } else { + t.writeBytesLeft = 1 << 30 + } +} + +func (t *handshakeTransport) kexLoop() { + +write: + for t.getWriteError() == nil { + var request *pendingKex + var sent bool + + for request == nil || !sent { + var ok bool + select { + case request, ok = <-t.startKex: + if !ok { + break write + } + case <-t.requestKex: + break + } + + if !sent { + if err := t.sendKexInit(); err != nil { + t.recordWriteError(err) + break + } + sent = true + } + } + + if err := t.getWriteError(); err != nil { + if request != nil { + request.done <- err + } + break + } + + // We're not servicing t.requestKex, but that is OK: + // we never block on sending to t.requestKex. + + // We're not servicing t.startKex, but the remote end + // has just sent us a kexInitMsg, so it can't send + // another key change request, until we close the done + // channel on the pendingKex request. + + err := t.enterKeyExchange(request.otherInit) + + t.mu.Lock() + t.writeError = err + t.sentInitPacket = nil + t.sentInitMsg = nil + + t.resetWriteThresholds() + + // we have completed the key exchange. Since the + // reader is still blocked, it is safe to clear out + // the requestKex channel. This avoids the situation + // where: 1) we consumed our own request for the + // initial kex, and 2) the kex from the remote side + // caused another send on the requestKex channel, + clear: + for { + select { + case <-t.requestKex: + // + default: + break clear + } + } + + request.done <- t.writeError + + // kex finished. Push packets that we received while + // the kex was in progress. Don't look at t.startKex + // and don't increment writtenSinceKex: if we trigger + // another kex while we are still busy with the last + // one, things will become very confusing. + for _, p := range t.pendingPackets { + t.writeError = t.pushPacket(p) + if t.writeError != nil { + break + } + } + t.pendingPackets = t.pendingPackets[:0] + t.mu.Unlock() + } + + // drain startKex channel. We don't service t.requestKex + // because nobody does blocking sends there. + go func() { + for init := range t.startKex { + init.done <- t.writeError + } + }() + + // Unblock reader. + t.conn.Close() +} + +// The protocol uses uint32 for packet counters, so we can't let them +// reach 1<<32. We will actually read and write more packets than +// this, though: the other side may send more packets, and after we +// hit this limit on writing we will send a few more packets for the +// key exchange itself. +const packetRekeyThreshold = (1 << 31) + +func (t *handshakeTransport) resetReadThresholds() { + t.readPacketsLeft = packetRekeyThreshold + if t.config.RekeyThreshold > 0 { + t.readBytesLeft = int64(t.config.RekeyThreshold) + } else if t.algorithms != nil { + t.readBytesLeft = t.algorithms.r.rekeyBytes() + } else { + t.readBytesLeft = 1 << 30 + } +} + +func (t *handshakeTransport) readOnePacket(first bool) ([]byte, error) { + p, err := t.conn.readPacket() + if err != nil { + return nil, err + } + + if t.readPacketsLeft > 0 { + t.readPacketsLeft-- + } else { + t.requestKeyExchange() + } + + if t.readBytesLeft > 0 { + t.readBytesLeft -= int64(len(p)) + } else { + t.requestKeyExchange() + } + + if debugHandshake { + t.printPacket(p, false) + } + + if first && p[0] != msgKexInit { + return nil, fmt.Errorf("ssh: first packet should be msgKexInit") + } + + if p[0] != msgKexInit { + return p, nil + } + + firstKex := t.sessionID == nil + + kex := pendingKex{ + done: make(chan error, 1), + otherInit: p, + } + t.startKex <- &kex + err = <-kex.done + + if debugHandshake { + log.Printf("%s exited key exchange (first %v), err %v", t.id(), firstKex, err) + } + + if err != nil { + return nil, err + } + + t.resetReadThresholds() + + // By default, a key exchange is hidden from higher layers by + // translating it into msgIgnore. + successPacket := []byte{msgIgnore} + if firstKex { + // sendKexInit() for the first kex waits for + // msgNewKeys so the authentication process is + // guaranteed to happen over an encrypted transport. + successPacket = []byte{msgNewKeys} + } + + return successPacket, nil +} + +// sendKexInit sends a key change message. +func (t *handshakeTransport) sendKexInit() error { + t.mu.Lock() + defer t.mu.Unlock() + if t.sentInitMsg != nil { + // kexInits may be sent either in response to the other side, + // or because our side wants to initiate a key change, so we + // may have already sent a kexInit. In that case, don't send a + // second kexInit. + return nil + } + + msg := &kexInitMsg{ + KexAlgos: t.config.KeyExchanges, + CiphersClientServer: t.config.Ciphers, + CiphersServerClient: t.config.Ciphers, + MACsClientServer: t.config.MACs, + MACsServerClient: t.config.MACs, + CompressionClientServer: supportedCompressions, + CompressionServerClient: supportedCompressions, + } + io.ReadFull(rand.Reader, msg.Cookie[:]) + + if len(t.hostKeys) > 0 { + for _, k := range t.hostKeys { + msg.ServerHostKeyAlgos = append( + msg.ServerHostKeyAlgos, k.PublicKey().Type()) + } + } else { + msg.ServerHostKeyAlgos = t.hostKeyAlgorithms + } + packet := Marshal(msg) + + // writePacket destroys the contents, so save a copy. + packetCopy := make([]byte, len(packet)) + copy(packetCopy, packet) + + if err := t.pushPacket(packetCopy); err != nil { + return err + } + + t.sentInitMsg = msg + t.sentInitPacket = packet + + return nil +} + +func (t *handshakeTransport) writePacket(p []byte) error { + switch p[0] { + case msgKexInit: + return errors.New("ssh: only handshakeTransport can send kexInit") + case msgNewKeys: + return errors.New("ssh: only handshakeTransport can send newKeys") + } + + t.mu.Lock() + defer t.mu.Unlock() + if t.writeError != nil { + return t.writeError + } + + if t.sentInitMsg != nil { + // Copy the packet so the writer can reuse the buffer. + cp := make([]byte, len(p)) + copy(cp, p) + t.pendingPackets = append(t.pendingPackets, cp) + return nil + } + + if t.writeBytesLeft > 0 { + t.writeBytesLeft -= int64(len(p)) + } else { + t.requestKeyExchange() + } + + if t.writePacketsLeft > 0 { + t.writePacketsLeft-- + } else { + t.requestKeyExchange() + } + + if err := t.pushPacket(p); err != nil { + t.writeError = err + } + + return nil +} + +func (t *handshakeTransport) Close() error { + return t.conn.Close() +} + +func (t *handshakeTransport) enterKeyExchange(otherInitPacket []byte) error { + if debugHandshake { + log.Printf("%s entered key exchange", t.id()) + } + + otherInit := &kexInitMsg{} + if err := Unmarshal(otherInitPacket, otherInit); err != nil { + return err + } + + magics := handshakeMagics{ + clientVersion: t.clientVersion, + serverVersion: t.serverVersion, + clientKexInit: otherInitPacket, + serverKexInit: t.sentInitPacket, + } + + clientInit := otherInit + serverInit := t.sentInitMsg + if len(t.hostKeys) == 0 { + clientInit, serverInit = serverInit, clientInit + + magics.clientKexInit = t.sentInitPacket + magics.serverKexInit = otherInitPacket + } + + var err error + t.algorithms, err = findAgreedAlgorithms(clientInit, serverInit) + if err != nil { + return err + } + + // We don't send FirstKexFollows, but we handle receiving it. + // + // RFC 4253 section 7 defines the kex and the agreement method for + // first_kex_packet_follows. It states that the guessed packet + // should be ignored if the "kex algorithm and/or the host + // key algorithm is guessed wrong (server and client have + // different preferred algorithm), or if any of the other + // algorithms cannot be agreed upon". The other algorithms have + // already been checked above so the kex algorithm and host key + // algorithm are checked here. + if otherInit.FirstKexFollows && (clientInit.KexAlgos[0] != serverInit.KexAlgos[0] || clientInit.ServerHostKeyAlgos[0] != serverInit.ServerHostKeyAlgos[0]) { + // other side sent a kex message for the wrong algorithm, + // which we have to ignore. + if _, err := t.conn.readPacket(); err != nil { + return err + } + } + + kex, ok := kexAlgoMap[t.algorithms.kex] + if !ok { + return fmt.Errorf("ssh: unexpected key exchange algorithm %v", t.algorithms.kex) + } + + var result *kexResult + if len(t.hostKeys) > 0 { + result, err = t.server(kex, t.algorithms, &magics) + } else { + result, err = t.client(kex, t.algorithms, &magics) + } + + if err != nil { + return err + } + + if t.sessionID == nil { + t.sessionID = result.H + } + result.SessionID = t.sessionID + + if err := t.conn.prepareKeyChange(t.algorithms, result); err != nil { + return err + } + if err = t.conn.writePacket([]byte{msgNewKeys}); err != nil { + return err + } + if packet, err := t.conn.readPacket(); err != nil { + return err + } else if packet[0] != msgNewKeys { + return unexpectedMessageError(msgNewKeys, packet[0]) + } + + return nil +} + +func (t *handshakeTransport) server(kex kexAlgorithm, algs *algorithms, magics *handshakeMagics) (*kexResult, error) { + var hostKey Signer + for _, k := range t.hostKeys { + if algs.hostKey == k.PublicKey().Type() { + hostKey = k + } + } + + r, err := kex.Server(t.conn, t.config.Rand, magics, hostKey) + return r, err +} + +func (t *handshakeTransport) client(kex kexAlgorithm, algs *algorithms, magics *handshakeMagics) (*kexResult, error) { + result, err := kex.Client(t.conn, t.config.Rand, magics) + if err != nil { + return nil, err + } + + hostKey, err := ParsePublicKey(result.HostKey) + if err != nil { + return nil, err + } + + if err := verifyHostKeySignature(hostKey, result); err != nil { + return nil, err + } + + err = t.hostKeyCallback(t.dialAddress, t.remoteAddr, hostKey) + if err != nil { + return nil, err + } + + return result, nil +} diff --git a/vendor/golang.org/x/crypto/ssh/kex.go b/vendor/golang.org/x/crypto/ssh/kex.go new file mode 100644 index 0000000..f34bcc0 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/kex.go @@ -0,0 +1,540 @@ +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "crypto" + "crypto/ecdsa" + "crypto/elliptic" + "crypto/rand" + "crypto/subtle" + "errors" + "io" + "math/big" + + "golang.org/x/crypto/curve25519" +) + +const ( + kexAlgoDH1SHA1 = "diffie-hellman-group1-sha1" + kexAlgoDH14SHA1 = "diffie-hellman-group14-sha1" + kexAlgoECDH256 = "ecdh-sha2-nistp256" + kexAlgoECDH384 = "ecdh-sha2-nistp384" + kexAlgoECDH521 = "ecdh-sha2-nistp521" + kexAlgoCurve25519SHA256 = "curve25519-sha256@libssh.org" +) + +// kexResult captures the outcome of a key exchange. +type kexResult struct { + // Session hash. See also RFC 4253, section 8. + H []byte + + // Shared secret. See also RFC 4253, section 8. + K []byte + + // Host key as hashed into H. + HostKey []byte + + // Signature of H. + Signature []byte + + // A cryptographic hash function that matches the security + // level of the key exchange algorithm. It is used for + // calculating H, and for deriving keys from H and K. + Hash crypto.Hash + + // The session ID, which is the first H computed. This is used + // to derive key material inside the transport. + SessionID []byte +} + +// handshakeMagics contains data that is always included in the +// session hash. +type handshakeMagics struct { + clientVersion, serverVersion []byte + clientKexInit, serverKexInit []byte +} + +func (m *handshakeMagics) write(w io.Writer) { + writeString(w, m.clientVersion) + writeString(w, m.serverVersion) + writeString(w, m.clientKexInit) + writeString(w, m.serverKexInit) +} + +// kexAlgorithm abstracts different key exchange algorithms. +type kexAlgorithm interface { + // Server runs server-side key agreement, signing the result + // with a hostkey. + Server(p packetConn, rand io.Reader, magics *handshakeMagics, s Signer) (*kexResult, error) + + // Client runs the client-side key agreement. Caller is + // responsible for verifying the host key signature. + Client(p packetConn, rand io.Reader, magics *handshakeMagics) (*kexResult, error) +} + +// dhGroup is a multiplicative group suitable for implementing Diffie-Hellman key agreement. +type dhGroup struct { + g, p, pMinus1 *big.Int +} + +func (group *dhGroup) diffieHellman(theirPublic, myPrivate *big.Int) (*big.Int, error) { + if theirPublic.Cmp(bigOne) <= 0 || theirPublic.Cmp(group.pMinus1) >= 0 { + return nil, errors.New("ssh: DH parameter out of bounds") + } + return new(big.Int).Exp(theirPublic, myPrivate, group.p), nil +} + +func (group *dhGroup) Client(c packetConn, randSource io.Reader, magics *handshakeMagics) (*kexResult, error) { + hashFunc := crypto.SHA1 + + var x *big.Int + for { + var err error + if x, err = rand.Int(randSource, group.pMinus1); err != nil { + return nil, err + } + if x.Sign() > 0 { + break + } + } + + X := new(big.Int).Exp(group.g, x, group.p) + kexDHInit := kexDHInitMsg{ + X: X, + } + if err := c.writePacket(Marshal(&kexDHInit)); err != nil { + return nil, err + } + + packet, err := c.readPacket() + if err != nil { + return nil, err + } + + var kexDHReply kexDHReplyMsg + if err = Unmarshal(packet, &kexDHReply); err != nil { + return nil, err + } + + ki, err := group.diffieHellman(kexDHReply.Y, x) + if err != nil { + return nil, err + } + + h := hashFunc.New() + magics.write(h) + writeString(h, kexDHReply.HostKey) + writeInt(h, X) + writeInt(h, kexDHReply.Y) + K := make([]byte, intLength(ki)) + marshalInt(K, ki) + h.Write(K) + + return &kexResult{ + H: h.Sum(nil), + K: K, + HostKey: kexDHReply.HostKey, + Signature: kexDHReply.Signature, + Hash: crypto.SHA1, + }, nil +} + +func (group *dhGroup) Server(c packetConn, randSource io.Reader, magics *handshakeMagics, priv Signer) (result *kexResult, err error) { + hashFunc := crypto.SHA1 + packet, err := c.readPacket() + if err != nil { + return + } + var kexDHInit kexDHInitMsg + if err = Unmarshal(packet, &kexDHInit); err != nil { + return + } + + var y *big.Int + for { + if y, err = rand.Int(randSource, group.pMinus1); err != nil { + return + } + if y.Sign() > 0 { + break + } + } + + Y := new(big.Int).Exp(group.g, y, group.p) + ki, err := group.diffieHellman(kexDHInit.X, y) + if err != nil { + return nil, err + } + + hostKeyBytes := priv.PublicKey().Marshal() + + h := hashFunc.New() + magics.write(h) + writeString(h, hostKeyBytes) + writeInt(h, kexDHInit.X) + writeInt(h, Y) + + K := make([]byte, intLength(ki)) + marshalInt(K, ki) + h.Write(K) + + H := h.Sum(nil) + + // H is already a hash, but the hostkey signing will apply its + // own key-specific hash algorithm. + sig, err := signAndMarshal(priv, randSource, H) + if err != nil { + return nil, err + } + + kexDHReply := kexDHReplyMsg{ + HostKey: hostKeyBytes, + Y: Y, + Signature: sig, + } + packet = Marshal(&kexDHReply) + + err = c.writePacket(packet) + return &kexResult{ + H: H, + K: K, + HostKey: hostKeyBytes, + Signature: sig, + Hash: crypto.SHA1, + }, nil +} + +// ecdh performs Elliptic Curve Diffie-Hellman key exchange as +// described in RFC 5656, section 4. +type ecdh struct { + curve elliptic.Curve +} + +func (kex *ecdh) Client(c packetConn, rand io.Reader, magics *handshakeMagics) (*kexResult, error) { + ephKey, err := ecdsa.GenerateKey(kex.curve, rand) + if err != nil { + return nil, err + } + + kexInit := kexECDHInitMsg{ + ClientPubKey: elliptic.Marshal(kex.curve, ephKey.PublicKey.X, ephKey.PublicKey.Y), + } + + serialized := Marshal(&kexInit) + if err := c.writePacket(serialized); err != nil { + return nil, err + } + + packet, err := c.readPacket() + if err != nil { + return nil, err + } + + var reply kexECDHReplyMsg + if err = Unmarshal(packet, &reply); err != nil { + return nil, err + } + + x, y, err := unmarshalECKey(kex.curve, reply.EphemeralPubKey) + if err != nil { + return nil, err + } + + // generate shared secret + secret, _ := kex.curve.ScalarMult(x, y, ephKey.D.Bytes()) + + h := ecHash(kex.curve).New() + magics.write(h) + writeString(h, reply.HostKey) + writeString(h, kexInit.ClientPubKey) + writeString(h, reply.EphemeralPubKey) + K := make([]byte, intLength(secret)) + marshalInt(K, secret) + h.Write(K) + + return &kexResult{ + H: h.Sum(nil), + K: K, + HostKey: reply.HostKey, + Signature: reply.Signature, + Hash: ecHash(kex.curve), + }, nil +} + +// unmarshalECKey parses and checks an EC key. +func unmarshalECKey(curve elliptic.Curve, pubkey []byte) (x, y *big.Int, err error) { + x, y = elliptic.Unmarshal(curve, pubkey) + if x == nil { + return nil, nil, errors.New("ssh: elliptic.Unmarshal failure") + } + if !validateECPublicKey(curve, x, y) { + return nil, nil, errors.New("ssh: public key not on curve") + } + return x, y, nil +} + +// validateECPublicKey checks that the point is a valid public key for +// the given curve. See [SEC1], 3.2.2 +func validateECPublicKey(curve elliptic.Curve, x, y *big.Int) bool { + if x.Sign() == 0 && y.Sign() == 0 { + return false + } + + if x.Cmp(curve.Params().P) >= 0 { + return false + } + + if y.Cmp(curve.Params().P) >= 0 { + return false + } + + if !curve.IsOnCurve(x, y) { + return false + } + + // We don't check if N * PubKey == 0, since + // + // - the NIST curves have cofactor = 1, so this is implicit. + // (We don't foresee an implementation that supports non NIST + // curves) + // + // - for ephemeral keys, we don't need to worry about small + // subgroup attacks. + return true +} + +func (kex *ecdh) Server(c packetConn, rand io.Reader, magics *handshakeMagics, priv Signer) (result *kexResult, err error) { + packet, err := c.readPacket() + if err != nil { + return nil, err + } + + var kexECDHInit kexECDHInitMsg + if err = Unmarshal(packet, &kexECDHInit); err != nil { + return nil, err + } + + clientX, clientY, err := unmarshalECKey(kex.curve, kexECDHInit.ClientPubKey) + if err != nil { + return nil, err + } + + // We could cache this key across multiple users/multiple + // connection attempts, but the benefit is small. OpenSSH + // generates a new key for each incoming connection. + ephKey, err := ecdsa.GenerateKey(kex.curve, rand) + if err != nil { + return nil, err + } + + hostKeyBytes := priv.PublicKey().Marshal() + + serializedEphKey := elliptic.Marshal(kex.curve, ephKey.PublicKey.X, ephKey.PublicKey.Y) + + // generate shared secret + secret, _ := kex.curve.ScalarMult(clientX, clientY, ephKey.D.Bytes()) + + h := ecHash(kex.curve).New() + magics.write(h) + writeString(h, hostKeyBytes) + writeString(h, kexECDHInit.ClientPubKey) + writeString(h, serializedEphKey) + + K := make([]byte, intLength(secret)) + marshalInt(K, secret) + h.Write(K) + + H := h.Sum(nil) + + // H is already a hash, but the hostkey signing will apply its + // own key-specific hash algorithm. + sig, err := signAndMarshal(priv, rand, H) + if err != nil { + return nil, err + } + + reply := kexECDHReplyMsg{ + EphemeralPubKey: serializedEphKey, + HostKey: hostKeyBytes, + Signature: sig, + } + + serialized := Marshal(&reply) + if err := c.writePacket(serialized); err != nil { + return nil, err + } + + return &kexResult{ + H: H, + K: K, + HostKey: reply.HostKey, + Signature: sig, + Hash: ecHash(kex.curve), + }, nil +} + +var kexAlgoMap = map[string]kexAlgorithm{} + +func init() { + // This is the group called diffie-hellman-group1-sha1 in RFC + // 4253 and Oakley Group 2 in RFC 2409. + p, _ := new(big.Int).SetString("FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD129024E088A67CC74020BBEA63B139B22514A08798E3404DDEF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7EDEE386BFB5A899FA5AE9F24117C4B1FE649286651ECE65381FFFFFFFFFFFFFFFF", 16) + kexAlgoMap[kexAlgoDH1SHA1] = &dhGroup{ + g: new(big.Int).SetInt64(2), + p: p, + pMinus1: new(big.Int).Sub(p, bigOne), + } + + // This is the group called diffie-hellman-group14-sha1 in RFC + // 4253 and Oakley Group 14 in RFC 3526. + p, _ = new(big.Int).SetString("FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD129024E088A67CC74020BBEA63B139B22514A08798E3404DDEF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7EDEE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3DC2007CB8A163BF0598DA48361C55D39A69163FA8FD24CF5F83655D23DCA3AD961C62F356208552BB9ED529077096966D670C354E4ABC9804F1746C08CA18217C32905E462E36CE3BE39E772C180E86039B2783A2EC07A28FB5C55DF06F4C52C9DE2BCBF6955817183995497CEA956AE515D2261898FA051015728E5A8AACAA68FFFFFFFFFFFFFFFF", 16) + + kexAlgoMap[kexAlgoDH14SHA1] = &dhGroup{ + g: new(big.Int).SetInt64(2), + p: p, + pMinus1: new(big.Int).Sub(p, bigOne), + } + + kexAlgoMap[kexAlgoECDH521] = &ecdh{elliptic.P521()} + kexAlgoMap[kexAlgoECDH384] = &ecdh{elliptic.P384()} + kexAlgoMap[kexAlgoECDH256] = &ecdh{elliptic.P256()} + kexAlgoMap[kexAlgoCurve25519SHA256] = &curve25519sha256{} +} + +// curve25519sha256 implements the curve25519-sha256@libssh.org key +// agreement protocol, as described in +// https://git.libssh.org/projects/libssh.git/tree/doc/curve25519-sha256@libssh.org.txt +type curve25519sha256 struct{} + +type curve25519KeyPair struct { + priv [32]byte + pub [32]byte +} + +func (kp *curve25519KeyPair) generate(rand io.Reader) error { + if _, err := io.ReadFull(rand, kp.priv[:]); err != nil { + return err + } + curve25519.ScalarBaseMult(&kp.pub, &kp.priv) + return nil +} + +// curve25519Zeros is just an array of 32 zero bytes so that we have something +// convenient to compare against in order to reject curve25519 points with the +// wrong order. +var curve25519Zeros [32]byte + +func (kex *curve25519sha256) Client(c packetConn, rand io.Reader, magics *handshakeMagics) (*kexResult, error) { + var kp curve25519KeyPair + if err := kp.generate(rand); err != nil { + return nil, err + } + if err := c.writePacket(Marshal(&kexECDHInitMsg{kp.pub[:]})); err != nil { + return nil, err + } + + packet, err := c.readPacket() + if err != nil { + return nil, err + } + + var reply kexECDHReplyMsg + if err = Unmarshal(packet, &reply); err != nil { + return nil, err + } + if len(reply.EphemeralPubKey) != 32 { + return nil, errors.New("ssh: peer's curve25519 public value has wrong length") + } + + var servPub, secret [32]byte + copy(servPub[:], reply.EphemeralPubKey) + curve25519.ScalarMult(&secret, &kp.priv, &servPub) + if subtle.ConstantTimeCompare(secret[:], curve25519Zeros[:]) == 1 { + return nil, errors.New("ssh: peer's curve25519 public value has wrong order") + } + + h := crypto.SHA256.New() + magics.write(h) + writeString(h, reply.HostKey) + writeString(h, kp.pub[:]) + writeString(h, reply.EphemeralPubKey) + + ki := new(big.Int).SetBytes(secret[:]) + K := make([]byte, intLength(ki)) + marshalInt(K, ki) + h.Write(K) + + return &kexResult{ + H: h.Sum(nil), + K: K, + HostKey: reply.HostKey, + Signature: reply.Signature, + Hash: crypto.SHA256, + }, nil +} + +func (kex *curve25519sha256) Server(c packetConn, rand io.Reader, magics *handshakeMagics, priv Signer) (result *kexResult, err error) { + packet, err := c.readPacket() + if err != nil { + return + } + var kexInit kexECDHInitMsg + if err = Unmarshal(packet, &kexInit); err != nil { + return + } + + if len(kexInit.ClientPubKey) != 32 { + return nil, errors.New("ssh: peer's curve25519 public value has wrong length") + } + + var kp curve25519KeyPair + if err := kp.generate(rand); err != nil { + return nil, err + } + + var clientPub, secret [32]byte + copy(clientPub[:], kexInit.ClientPubKey) + curve25519.ScalarMult(&secret, &kp.priv, &clientPub) + if subtle.ConstantTimeCompare(secret[:], curve25519Zeros[:]) == 1 { + return nil, errors.New("ssh: peer's curve25519 public value has wrong order") + } + + hostKeyBytes := priv.PublicKey().Marshal() + + h := crypto.SHA256.New() + magics.write(h) + writeString(h, hostKeyBytes) + writeString(h, kexInit.ClientPubKey) + writeString(h, kp.pub[:]) + + ki := new(big.Int).SetBytes(secret[:]) + K := make([]byte, intLength(ki)) + marshalInt(K, ki) + h.Write(K) + + H := h.Sum(nil) + + sig, err := signAndMarshal(priv, rand, H) + if err != nil { + return nil, err + } + + reply := kexECDHReplyMsg{ + EphemeralPubKey: kp.pub[:], + HostKey: hostKeyBytes, + Signature: sig, + } + if err := c.writePacket(Marshal(&reply)); err != nil { + return nil, err + } + return &kexResult{ + H: H, + K: K, + HostKey: hostKeyBytes, + Signature: sig, + Hash: crypto.SHA256, + }, nil +} diff --git a/vendor/golang.org/x/crypto/ssh/keys.go b/vendor/golang.org/x/crypto/ssh/keys.go new file mode 100644 index 0000000..9698047 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/keys.go @@ -0,0 +1,1100 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "bytes" + "crypto" + "crypto/dsa" + "crypto/ecdsa" + "crypto/elliptic" + "crypto/md5" + "crypto/rsa" + "crypto/sha256" + "crypto/x509" + "encoding/asn1" + "encoding/base64" + "encoding/hex" + "encoding/pem" + "errors" + "fmt" + "io" + "math/big" + "strings" + + "golang.org/x/crypto/ed25519" +) + +// These constants represent the algorithm names for key types supported by this +// package. +const ( + KeyAlgoRSA = "ssh-rsa" + KeyAlgoDSA = "ssh-dss" + KeyAlgoECDSA256 = "ecdsa-sha2-nistp256" + KeyAlgoECDSA384 = "ecdsa-sha2-nistp384" + KeyAlgoECDSA521 = "ecdsa-sha2-nistp521" + KeyAlgoED25519 = "ssh-ed25519" +) + +// These constants represent non-default signature algorithms that are supported +// as algorithm parameters to AlgorithmSigner.SignWithAlgorithm methods. See +// [PROTOCOL.agent] section 4.5.1 and +// https://tools.ietf.org/html/draft-ietf-curdle-rsa-sha2-10 +const ( + SigAlgoRSA = "ssh-rsa" + SigAlgoRSASHA2256 = "rsa-sha2-256" + SigAlgoRSASHA2512 = "rsa-sha2-512" +) + +// parsePubKey parses a public key of the given algorithm. +// Use ParsePublicKey for keys with prepended algorithm. +func parsePubKey(in []byte, algo string) (pubKey PublicKey, rest []byte, err error) { + switch algo { + case KeyAlgoRSA: + return parseRSA(in) + case KeyAlgoDSA: + return parseDSA(in) + case KeyAlgoECDSA256, KeyAlgoECDSA384, KeyAlgoECDSA521: + return parseECDSA(in) + case KeyAlgoED25519: + return parseED25519(in) + case CertAlgoRSAv01, CertAlgoDSAv01, CertAlgoECDSA256v01, CertAlgoECDSA384v01, CertAlgoECDSA521v01, CertAlgoED25519v01: + cert, err := parseCert(in, certToPrivAlgo(algo)) + if err != nil { + return nil, nil, err + } + return cert, nil, nil + } + return nil, nil, fmt.Errorf("ssh: unknown key algorithm: %v", algo) +} + +// parseAuthorizedKey parses a public key in OpenSSH authorized_keys format +// (see sshd(8) manual page) once the options and key type fields have been +// removed. +func parseAuthorizedKey(in []byte) (out PublicKey, comment string, err error) { + in = bytes.TrimSpace(in) + + i := bytes.IndexAny(in, " \t") + if i == -1 { + i = len(in) + } + base64Key := in[:i] + + key := make([]byte, base64.StdEncoding.DecodedLen(len(base64Key))) + n, err := base64.StdEncoding.Decode(key, base64Key) + if err != nil { + return nil, "", err + } + key = key[:n] + out, err = ParsePublicKey(key) + if err != nil { + return nil, "", err + } + comment = string(bytes.TrimSpace(in[i:])) + return out, comment, nil +} + +// ParseKnownHosts parses an entry in the format of the known_hosts file. +// +// The known_hosts format is documented in the sshd(8) manual page. This +// function will parse a single entry from in. On successful return, marker +// will contain the optional marker value (i.e. "cert-authority" or "revoked") +// or else be empty, hosts will contain the hosts that this entry matches, +// pubKey will contain the public key and comment will contain any trailing +// comment at the end of the line. See the sshd(8) manual page for the various +// forms that a host string can take. +// +// The unparsed remainder of the input will be returned in rest. This function +// can be called repeatedly to parse multiple entries. +// +// If no entries were found in the input then err will be io.EOF. Otherwise a +// non-nil err value indicates a parse error. +func ParseKnownHosts(in []byte) (marker string, hosts []string, pubKey PublicKey, comment string, rest []byte, err error) { + for len(in) > 0 { + end := bytes.IndexByte(in, '\n') + if end != -1 { + rest = in[end+1:] + in = in[:end] + } else { + rest = nil + } + + end = bytes.IndexByte(in, '\r') + if end != -1 { + in = in[:end] + } + + in = bytes.TrimSpace(in) + if len(in) == 0 || in[0] == '#' { + in = rest + continue + } + + i := bytes.IndexAny(in, " \t") + if i == -1 { + in = rest + continue + } + + // Strip out the beginning of the known_host key. + // This is either an optional marker or a (set of) hostname(s). + keyFields := bytes.Fields(in) + if len(keyFields) < 3 || len(keyFields) > 5 { + return "", nil, nil, "", nil, errors.New("ssh: invalid entry in known_hosts data") + } + + // keyFields[0] is either "@cert-authority", "@revoked" or a comma separated + // list of hosts + marker := "" + if keyFields[0][0] == '@' { + marker = string(keyFields[0][1:]) + keyFields = keyFields[1:] + } + + hosts := string(keyFields[0]) + // keyFields[1] contains the key type (e.g. “ssh-rsa”). + // However, that information is duplicated inside the + // base64-encoded key and so is ignored here. + + key := bytes.Join(keyFields[2:], []byte(" ")) + if pubKey, comment, err = parseAuthorizedKey(key); err != nil { + return "", nil, nil, "", nil, err + } + + return marker, strings.Split(hosts, ","), pubKey, comment, rest, nil + } + + return "", nil, nil, "", nil, io.EOF +} + +// ParseAuthorizedKeys parses a public key from an authorized_keys +// file used in OpenSSH according to the sshd(8) manual page. +func ParseAuthorizedKey(in []byte) (out PublicKey, comment string, options []string, rest []byte, err error) { + for len(in) > 0 { + end := bytes.IndexByte(in, '\n') + if end != -1 { + rest = in[end+1:] + in = in[:end] + } else { + rest = nil + } + + end = bytes.IndexByte(in, '\r') + if end != -1 { + in = in[:end] + } + + in = bytes.TrimSpace(in) + if len(in) == 0 || in[0] == '#' { + in = rest + continue + } + + i := bytes.IndexAny(in, " \t") + if i == -1 { + in = rest + continue + } + + if out, comment, err = parseAuthorizedKey(in[i:]); err == nil { + return out, comment, options, rest, nil + } + + // No key type recognised. Maybe there's an options field at + // the beginning. + var b byte + inQuote := false + var candidateOptions []string + optionStart := 0 + for i, b = range in { + isEnd := !inQuote && (b == ' ' || b == '\t') + if (b == ',' && !inQuote) || isEnd { + if i-optionStart > 0 { + candidateOptions = append(candidateOptions, string(in[optionStart:i])) + } + optionStart = i + 1 + } + if isEnd { + break + } + if b == '"' && (i == 0 || (i > 0 && in[i-1] != '\\')) { + inQuote = !inQuote + } + } + for i < len(in) && (in[i] == ' ' || in[i] == '\t') { + i++ + } + if i == len(in) { + // Invalid line: unmatched quote + in = rest + continue + } + + in = in[i:] + i = bytes.IndexAny(in, " \t") + if i == -1 { + in = rest + continue + } + + if out, comment, err = parseAuthorizedKey(in[i:]); err == nil { + options = candidateOptions + return out, comment, options, rest, nil + } + + in = rest + continue + } + + return nil, "", nil, nil, errors.New("ssh: no key found") +} + +// ParsePublicKey parses an SSH public key formatted for use in +// the SSH wire protocol according to RFC 4253, section 6.6. +func ParsePublicKey(in []byte) (out PublicKey, err error) { + algo, in, ok := parseString(in) + if !ok { + return nil, errShortRead + } + var rest []byte + out, rest, err = parsePubKey(in, string(algo)) + if len(rest) > 0 { + return nil, errors.New("ssh: trailing junk in public key") + } + + return out, err +} + +// MarshalAuthorizedKey serializes key for inclusion in an OpenSSH +// authorized_keys file. The return value ends with newline. +func MarshalAuthorizedKey(key PublicKey) []byte { + b := &bytes.Buffer{} + b.WriteString(key.Type()) + b.WriteByte(' ') + e := base64.NewEncoder(base64.StdEncoding, b) + e.Write(key.Marshal()) + e.Close() + b.WriteByte('\n') + return b.Bytes() +} + +// PublicKey is an abstraction of different types of public keys. +type PublicKey interface { + // Type returns the key's type, e.g. "ssh-rsa". + Type() string + + // Marshal returns the serialized key data in SSH wire format, + // with the name prefix. To unmarshal the returned data, use + // the ParsePublicKey function. + Marshal() []byte + + // Verify that sig is a signature on the given data using this + // key. This function will hash the data appropriately first. + Verify(data []byte, sig *Signature) error +} + +// CryptoPublicKey, if implemented by a PublicKey, +// returns the underlying crypto.PublicKey form of the key. +type CryptoPublicKey interface { + CryptoPublicKey() crypto.PublicKey +} + +// A Signer can create signatures that verify against a public key. +type Signer interface { + // PublicKey returns an associated PublicKey instance. + PublicKey() PublicKey + + // Sign returns raw signature for the given data. This method + // will apply the hash specified for the keytype to the data. + Sign(rand io.Reader, data []byte) (*Signature, error) +} + +// A AlgorithmSigner is a Signer that also supports specifying a specific +// algorithm to use for signing. +type AlgorithmSigner interface { + Signer + + // SignWithAlgorithm is like Signer.Sign, but allows specification of a + // non-default signing algorithm. See the SigAlgo* constants in this + // package for signature algorithms supported by this package. Callers may + // pass an empty string for the algorithm in which case the AlgorithmSigner + // will use its default algorithm. + SignWithAlgorithm(rand io.Reader, data []byte, algorithm string) (*Signature, error) +} + +type rsaPublicKey rsa.PublicKey + +func (r *rsaPublicKey) Type() string { + return "ssh-rsa" +} + +// parseRSA parses an RSA key according to RFC 4253, section 6.6. +func parseRSA(in []byte) (out PublicKey, rest []byte, err error) { + var w struct { + E *big.Int + N *big.Int + Rest []byte `ssh:"rest"` + } + if err := Unmarshal(in, &w); err != nil { + return nil, nil, err + } + + if w.E.BitLen() > 24 { + return nil, nil, errors.New("ssh: exponent too large") + } + e := w.E.Int64() + if e < 3 || e&1 == 0 { + return nil, nil, errors.New("ssh: incorrect exponent") + } + + var key rsa.PublicKey + key.E = int(e) + key.N = w.N + return (*rsaPublicKey)(&key), w.Rest, nil +} + +func (r *rsaPublicKey) Marshal() []byte { + e := new(big.Int).SetInt64(int64(r.E)) + // RSA publickey struct layout should match the struct used by + // parseRSACert in the x/crypto/ssh/agent package. + wirekey := struct { + Name string + E *big.Int + N *big.Int + }{ + KeyAlgoRSA, + e, + r.N, + } + return Marshal(&wirekey) +} + +func (r *rsaPublicKey) Verify(data []byte, sig *Signature) error { + var hash crypto.Hash + switch sig.Format { + case SigAlgoRSA: + hash = crypto.SHA1 + case SigAlgoRSASHA2256: + hash = crypto.SHA256 + case SigAlgoRSASHA2512: + hash = crypto.SHA512 + default: + return fmt.Errorf("ssh: signature type %s for key type %s", sig.Format, r.Type()) + } + h := hash.New() + h.Write(data) + digest := h.Sum(nil) + return rsa.VerifyPKCS1v15((*rsa.PublicKey)(r), hash, digest, sig.Blob) +} + +func (r *rsaPublicKey) CryptoPublicKey() crypto.PublicKey { + return (*rsa.PublicKey)(r) +} + +type dsaPublicKey dsa.PublicKey + +func (k *dsaPublicKey) Type() string { + return "ssh-dss" +} + +func checkDSAParams(param *dsa.Parameters) error { + // SSH specifies FIPS 186-2, which only provided a single size + // (1024 bits) DSA key. FIPS 186-3 allows for larger key + // sizes, which would confuse SSH. + if l := param.P.BitLen(); l != 1024 { + return fmt.Errorf("ssh: unsupported DSA key size %d", l) + } + + return nil +} + +// parseDSA parses an DSA key according to RFC 4253, section 6.6. +func parseDSA(in []byte) (out PublicKey, rest []byte, err error) { + var w struct { + P, Q, G, Y *big.Int + Rest []byte `ssh:"rest"` + } + if err := Unmarshal(in, &w); err != nil { + return nil, nil, err + } + + param := dsa.Parameters{ + P: w.P, + Q: w.Q, + G: w.G, + } + if err := checkDSAParams(¶m); err != nil { + return nil, nil, err + } + + key := &dsaPublicKey{ + Parameters: param, + Y: w.Y, + } + return key, w.Rest, nil +} + +func (k *dsaPublicKey) Marshal() []byte { + // DSA publickey struct layout should match the struct used by + // parseDSACert in the x/crypto/ssh/agent package. + w := struct { + Name string + P, Q, G, Y *big.Int + }{ + k.Type(), + k.P, + k.Q, + k.G, + k.Y, + } + + return Marshal(&w) +} + +func (k *dsaPublicKey) Verify(data []byte, sig *Signature) error { + if sig.Format != k.Type() { + return fmt.Errorf("ssh: signature type %s for key type %s", sig.Format, k.Type()) + } + h := crypto.SHA1.New() + h.Write(data) + digest := h.Sum(nil) + + // Per RFC 4253, section 6.6, + // The value for 'dss_signature_blob' is encoded as a string containing + // r, followed by s (which are 160-bit integers, without lengths or + // padding, unsigned, and in network byte order). + // For DSS purposes, sig.Blob should be exactly 40 bytes in length. + if len(sig.Blob) != 40 { + return errors.New("ssh: DSA signature parse error") + } + r := new(big.Int).SetBytes(sig.Blob[:20]) + s := new(big.Int).SetBytes(sig.Blob[20:]) + if dsa.Verify((*dsa.PublicKey)(k), digest, r, s) { + return nil + } + return errors.New("ssh: signature did not verify") +} + +func (k *dsaPublicKey) CryptoPublicKey() crypto.PublicKey { + return (*dsa.PublicKey)(k) +} + +type dsaPrivateKey struct { + *dsa.PrivateKey +} + +func (k *dsaPrivateKey) PublicKey() PublicKey { + return (*dsaPublicKey)(&k.PrivateKey.PublicKey) +} + +func (k *dsaPrivateKey) Sign(rand io.Reader, data []byte) (*Signature, error) { + return k.SignWithAlgorithm(rand, data, "") +} + +func (k *dsaPrivateKey) SignWithAlgorithm(rand io.Reader, data []byte, algorithm string) (*Signature, error) { + if algorithm != "" && algorithm != k.PublicKey().Type() { + return nil, fmt.Errorf("ssh: unsupported signature algorithm %s", algorithm) + } + + h := crypto.SHA1.New() + h.Write(data) + digest := h.Sum(nil) + r, s, err := dsa.Sign(rand, k.PrivateKey, digest) + if err != nil { + return nil, err + } + + sig := make([]byte, 40) + rb := r.Bytes() + sb := s.Bytes() + + copy(sig[20-len(rb):20], rb) + copy(sig[40-len(sb):], sb) + + return &Signature{ + Format: k.PublicKey().Type(), + Blob: sig, + }, nil +} + +type ecdsaPublicKey ecdsa.PublicKey + +func (k *ecdsaPublicKey) Type() string { + return "ecdsa-sha2-" + k.nistID() +} + +func (k *ecdsaPublicKey) nistID() string { + switch k.Params().BitSize { + case 256: + return "nistp256" + case 384: + return "nistp384" + case 521: + return "nistp521" + } + panic("ssh: unsupported ecdsa key size") +} + +type ed25519PublicKey ed25519.PublicKey + +func (k ed25519PublicKey) Type() string { + return KeyAlgoED25519 +} + +func parseED25519(in []byte) (out PublicKey, rest []byte, err error) { + var w struct { + KeyBytes []byte + Rest []byte `ssh:"rest"` + } + + if err := Unmarshal(in, &w); err != nil { + return nil, nil, err + } + + key := ed25519.PublicKey(w.KeyBytes) + + return (ed25519PublicKey)(key), w.Rest, nil +} + +func (k ed25519PublicKey) Marshal() []byte { + w := struct { + Name string + KeyBytes []byte + }{ + KeyAlgoED25519, + []byte(k), + } + return Marshal(&w) +} + +func (k ed25519PublicKey) Verify(b []byte, sig *Signature) error { + if sig.Format != k.Type() { + return fmt.Errorf("ssh: signature type %s for key type %s", sig.Format, k.Type()) + } + + edKey := (ed25519.PublicKey)(k) + if ok := ed25519.Verify(edKey, b, sig.Blob); !ok { + return errors.New("ssh: signature did not verify") + } + + return nil +} + +func (k ed25519PublicKey) CryptoPublicKey() crypto.PublicKey { + return ed25519.PublicKey(k) +} + +func supportedEllipticCurve(curve elliptic.Curve) bool { + return curve == elliptic.P256() || curve == elliptic.P384() || curve == elliptic.P521() +} + +// ecHash returns the hash to match the given elliptic curve, see RFC +// 5656, section 6.2.1 +func ecHash(curve elliptic.Curve) crypto.Hash { + bitSize := curve.Params().BitSize + switch { + case bitSize <= 256: + return crypto.SHA256 + case bitSize <= 384: + return crypto.SHA384 + } + return crypto.SHA512 +} + +// parseECDSA parses an ECDSA key according to RFC 5656, section 3.1. +func parseECDSA(in []byte) (out PublicKey, rest []byte, err error) { + var w struct { + Curve string + KeyBytes []byte + Rest []byte `ssh:"rest"` + } + + if err := Unmarshal(in, &w); err != nil { + return nil, nil, err + } + + key := new(ecdsa.PublicKey) + + switch w.Curve { + case "nistp256": + key.Curve = elliptic.P256() + case "nistp384": + key.Curve = elliptic.P384() + case "nistp521": + key.Curve = elliptic.P521() + default: + return nil, nil, errors.New("ssh: unsupported curve") + } + + key.X, key.Y = elliptic.Unmarshal(key.Curve, w.KeyBytes) + if key.X == nil || key.Y == nil { + return nil, nil, errors.New("ssh: invalid curve point") + } + return (*ecdsaPublicKey)(key), w.Rest, nil +} + +func (k *ecdsaPublicKey) Marshal() []byte { + // See RFC 5656, section 3.1. + keyBytes := elliptic.Marshal(k.Curve, k.X, k.Y) + // ECDSA publickey struct layout should match the struct used by + // parseECDSACert in the x/crypto/ssh/agent package. + w := struct { + Name string + ID string + Key []byte + }{ + k.Type(), + k.nistID(), + keyBytes, + } + + return Marshal(&w) +} + +func (k *ecdsaPublicKey) Verify(data []byte, sig *Signature) error { + if sig.Format != k.Type() { + return fmt.Errorf("ssh: signature type %s for key type %s", sig.Format, k.Type()) + } + + h := ecHash(k.Curve).New() + h.Write(data) + digest := h.Sum(nil) + + // Per RFC 5656, section 3.1.2, + // The ecdsa_signature_blob value has the following specific encoding: + // mpint r + // mpint s + var ecSig struct { + R *big.Int + S *big.Int + } + + if err := Unmarshal(sig.Blob, &ecSig); err != nil { + return err + } + + if ecdsa.Verify((*ecdsa.PublicKey)(k), digest, ecSig.R, ecSig.S) { + return nil + } + return errors.New("ssh: signature did not verify") +} + +func (k *ecdsaPublicKey) CryptoPublicKey() crypto.PublicKey { + return (*ecdsa.PublicKey)(k) +} + +// NewSignerFromKey takes an *rsa.PrivateKey, *dsa.PrivateKey, +// *ecdsa.PrivateKey or any other crypto.Signer and returns a +// corresponding Signer instance. ECDSA keys must use P-256, P-384 or +// P-521. DSA keys must use parameter size L1024N160. +func NewSignerFromKey(key interface{}) (Signer, error) { + switch key := key.(type) { + case crypto.Signer: + return NewSignerFromSigner(key) + case *dsa.PrivateKey: + return newDSAPrivateKey(key) + default: + return nil, fmt.Errorf("ssh: unsupported key type %T", key) + } +} + +func newDSAPrivateKey(key *dsa.PrivateKey) (Signer, error) { + if err := checkDSAParams(&key.PublicKey.Parameters); err != nil { + return nil, err + } + + return &dsaPrivateKey{key}, nil +} + +type wrappedSigner struct { + signer crypto.Signer + pubKey PublicKey +} + +// NewSignerFromSigner takes any crypto.Signer implementation and +// returns a corresponding Signer interface. This can be used, for +// example, with keys kept in hardware modules. +func NewSignerFromSigner(signer crypto.Signer) (Signer, error) { + pubKey, err := NewPublicKey(signer.Public()) + if err != nil { + return nil, err + } + + return &wrappedSigner{signer, pubKey}, nil +} + +func (s *wrappedSigner) PublicKey() PublicKey { + return s.pubKey +} + +func (s *wrappedSigner) Sign(rand io.Reader, data []byte) (*Signature, error) { + return s.SignWithAlgorithm(rand, data, "") +} + +func (s *wrappedSigner) SignWithAlgorithm(rand io.Reader, data []byte, algorithm string) (*Signature, error) { + var hashFunc crypto.Hash + + if _, ok := s.pubKey.(*rsaPublicKey); ok { + // RSA keys support a few hash functions determined by the requested signature algorithm + switch algorithm { + case "", SigAlgoRSA: + algorithm = SigAlgoRSA + hashFunc = crypto.SHA1 + case SigAlgoRSASHA2256: + hashFunc = crypto.SHA256 + case SigAlgoRSASHA2512: + hashFunc = crypto.SHA512 + default: + return nil, fmt.Errorf("ssh: unsupported signature algorithm %s", algorithm) + } + } else { + // The only supported algorithm for all other key types is the same as the type of the key + if algorithm == "" { + algorithm = s.pubKey.Type() + } else if algorithm != s.pubKey.Type() { + return nil, fmt.Errorf("ssh: unsupported signature algorithm %s", algorithm) + } + + switch key := s.pubKey.(type) { + case *dsaPublicKey: + hashFunc = crypto.SHA1 + case *ecdsaPublicKey: + hashFunc = ecHash(key.Curve) + case ed25519PublicKey: + default: + return nil, fmt.Errorf("ssh: unsupported key type %T", key) + } + } + + var digest []byte + if hashFunc != 0 { + h := hashFunc.New() + h.Write(data) + digest = h.Sum(nil) + } else { + digest = data + } + + signature, err := s.signer.Sign(rand, digest, hashFunc) + if err != nil { + return nil, err + } + + // crypto.Signer.Sign is expected to return an ASN.1-encoded signature + // for ECDSA and DSA, but that's not the encoding expected by SSH, so + // re-encode. + switch s.pubKey.(type) { + case *ecdsaPublicKey, *dsaPublicKey: + type asn1Signature struct { + R, S *big.Int + } + asn1Sig := new(asn1Signature) + _, err := asn1.Unmarshal(signature, asn1Sig) + if err != nil { + return nil, err + } + + switch s.pubKey.(type) { + case *ecdsaPublicKey: + signature = Marshal(asn1Sig) + + case *dsaPublicKey: + signature = make([]byte, 40) + r := asn1Sig.R.Bytes() + s := asn1Sig.S.Bytes() + copy(signature[20-len(r):20], r) + copy(signature[40-len(s):40], s) + } + } + + return &Signature{ + Format: algorithm, + Blob: signature, + }, nil +} + +// NewPublicKey takes an *rsa.PublicKey, *dsa.PublicKey, *ecdsa.PublicKey, +// or ed25519.PublicKey returns a corresponding PublicKey instance. +// ECDSA keys must use P-256, P-384 or P-521. +func NewPublicKey(key interface{}) (PublicKey, error) { + switch key := key.(type) { + case *rsa.PublicKey: + return (*rsaPublicKey)(key), nil + case *ecdsa.PublicKey: + if !supportedEllipticCurve(key.Curve) { + return nil, errors.New("ssh: only P-256, P-384 and P-521 EC keys are supported") + } + return (*ecdsaPublicKey)(key), nil + case *dsa.PublicKey: + return (*dsaPublicKey)(key), nil + case ed25519.PublicKey: + return (ed25519PublicKey)(key), nil + default: + return nil, fmt.Errorf("ssh: unsupported key type %T", key) + } +} + +// ParsePrivateKey returns a Signer from a PEM encoded private key. It supports +// the same keys as ParseRawPrivateKey. +func ParsePrivateKey(pemBytes []byte) (Signer, error) { + key, err := ParseRawPrivateKey(pemBytes) + if err != nil { + return nil, err + } + + return NewSignerFromKey(key) +} + +// ParsePrivateKeyWithPassphrase returns a Signer from a PEM encoded private +// key and passphrase. It supports the same keys as +// ParseRawPrivateKeyWithPassphrase. +func ParsePrivateKeyWithPassphrase(pemBytes, passPhrase []byte) (Signer, error) { + key, err := ParseRawPrivateKeyWithPassphrase(pemBytes, passPhrase) + if err != nil { + return nil, err + } + + return NewSignerFromKey(key) +} + +// encryptedBlock tells whether a private key is +// encrypted by examining its Proc-Type header +// for a mention of ENCRYPTED +// according to RFC 1421 Section 4.6.1.1. +func encryptedBlock(block *pem.Block) bool { + return strings.Contains(block.Headers["Proc-Type"], "ENCRYPTED") +} + +// ParseRawPrivateKey returns a private key from a PEM encoded private key. It +// supports RSA (PKCS#1), PKCS#8, DSA (OpenSSL), and ECDSA private keys. +func ParseRawPrivateKey(pemBytes []byte) (interface{}, error) { + block, _ := pem.Decode(pemBytes) + if block == nil { + return nil, errors.New("ssh: no key found") + } + + if encryptedBlock(block) { + return nil, errors.New("ssh: cannot decode encrypted private keys") + } + + switch block.Type { + case "RSA PRIVATE KEY": + return x509.ParsePKCS1PrivateKey(block.Bytes) + // RFC5208 - https://tools.ietf.org/html/rfc5208 + case "PRIVATE KEY": + return x509.ParsePKCS8PrivateKey(block.Bytes) + case "EC PRIVATE KEY": + return x509.ParseECPrivateKey(block.Bytes) + case "DSA PRIVATE KEY": + return ParseDSAPrivateKey(block.Bytes) + case "OPENSSH PRIVATE KEY": + return parseOpenSSHPrivateKey(block.Bytes) + default: + return nil, fmt.Errorf("ssh: unsupported key type %q", block.Type) + } +} + +// ParseRawPrivateKeyWithPassphrase returns a private key decrypted with +// passphrase from a PEM encoded private key. If wrong passphrase, return +// x509.IncorrectPasswordError. +func ParseRawPrivateKeyWithPassphrase(pemBytes, passPhrase []byte) (interface{}, error) { + block, _ := pem.Decode(pemBytes) + if block == nil { + return nil, errors.New("ssh: no key found") + } + buf := block.Bytes + + if encryptedBlock(block) { + if x509.IsEncryptedPEMBlock(block) { + var err error + buf, err = x509.DecryptPEMBlock(block, passPhrase) + if err != nil { + if err == x509.IncorrectPasswordError { + return nil, err + } + return nil, fmt.Errorf("ssh: cannot decode encrypted private keys: %v", err) + } + } + } + + switch block.Type { + case "RSA PRIVATE KEY": + return x509.ParsePKCS1PrivateKey(buf) + case "EC PRIVATE KEY": + return x509.ParseECPrivateKey(buf) + case "DSA PRIVATE KEY": + return ParseDSAPrivateKey(buf) + case "OPENSSH PRIVATE KEY": + return parseOpenSSHPrivateKey(buf) + default: + return nil, fmt.Errorf("ssh: unsupported key type %q", block.Type) + } +} + +// ParseDSAPrivateKey returns a DSA private key from its ASN.1 DER encoding, as +// specified by the OpenSSL DSA man page. +func ParseDSAPrivateKey(der []byte) (*dsa.PrivateKey, error) { + var k struct { + Version int + P *big.Int + Q *big.Int + G *big.Int + Pub *big.Int + Priv *big.Int + } + rest, err := asn1.Unmarshal(der, &k) + if err != nil { + return nil, errors.New("ssh: failed to parse DSA key: " + err.Error()) + } + if len(rest) > 0 { + return nil, errors.New("ssh: garbage after DSA key") + } + + return &dsa.PrivateKey{ + PublicKey: dsa.PublicKey{ + Parameters: dsa.Parameters{ + P: k.P, + Q: k.Q, + G: k.G, + }, + Y: k.Pub, + }, + X: k.Priv, + }, nil +} + +// Implemented based on the documentation at +// https://github.com/openssh/openssh-portable/blob/master/PROTOCOL.key +func parseOpenSSHPrivateKey(key []byte) (crypto.PrivateKey, error) { + const magic = "openssh-key-v1\x00" + if len(key) < len(magic) || string(key[:len(magic)]) != magic { + return nil, errors.New("ssh: invalid openssh private key format") + } + remaining := key[len(magic):] + + var w struct { + CipherName string + KdfName string + KdfOpts string + NumKeys uint32 + PubKey []byte + PrivKeyBlock []byte + } + + if err := Unmarshal(remaining, &w); err != nil { + return nil, err + } + + if w.KdfName != "none" || w.CipherName != "none" { + return nil, errors.New("ssh: cannot decode encrypted private keys") + } + + pk1 := struct { + Check1 uint32 + Check2 uint32 + Keytype string + Rest []byte `ssh:"rest"` + }{} + + if err := Unmarshal(w.PrivKeyBlock, &pk1); err != nil { + return nil, err + } + + if pk1.Check1 != pk1.Check2 { + return nil, errors.New("ssh: checkint mismatch") + } + + // we only handle ed25519 and rsa keys currently + switch pk1.Keytype { + case KeyAlgoRSA: + // https://github.com/openssh/openssh-portable/blob/master/sshkey.c#L2760-L2773 + key := struct { + N *big.Int + E *big.Int + D *big.Int + Iqmp *big.Int + P *big.Int + Q *big.Int + Comment string + Pad []byte `ssh:"rest"` + }{} + + if err := Unmarshal(pk1.Rest, &key); err != nil { + return nil, err + } + + for i, b := range key.Pad { + if int(b) != i+1 { + return nil, errors.New("ssh: padding not as expected") + } + } + + pk := &rsa.PrivateKey{ + PublicKey: rsa.PublicKey{ + N: key.N, + E: int(key.E.Int64()), + }, + D: key.D, + Primes: []*big.Int{key.P, key.Q}, + } + + if err := pk.Validate(); err != nil { + return nil, err + } + + pk.Precompute() + + return pk, nil + case KeyAlgoED25519: + key := struct { + Pub []byte + Priv []byte + Comment string + Pad []byte `ssh:"rest"` + }{} + + if err := Unmarshal(pk1.Rest, &key); err != nil { + return nil, err + } + + if len(key.Priv) != ed25519.PrivateKeySize { + return nil, errors.New("ssh: private key unexpected length") + } + + for i, b := range key.Pad { + if int(b) != i+1 { + return nil, errors.New("ssh: padding not as expected") + } + } + + pk := ed25519.PrivateKey(make([]byte, ed25519.PrivateKeySize)) + copy(pk, key.Priv) + return &pk, nil + default: + return nil, errors.New("ssh: unhandled key type") + } +} + +// FingerprintLegacyMD5 returns the user presentation of the key's +// fingerprint as described by RFC 4716 section 4. +func FingerprintLegacyMD5(pubKey PublicKey) string { + md5sum := md5.Sum(pubKey.Marshal()) + hexarray := make([]string, len(md5sum)) + for i, c := range md5sum { + hexarray[i] = hex.EncodeToString([]byte{c}) + } + return strings.Join(hexarray, ":") +} + +// FingerprintSHA256 returns the user presentation of the key's +// fingerprint as unpadded base64 encoded sha256 hash. +// This format was introduced from OpenSSH 6.8. +// https://www.openssh.com/txt/release-6.8 +// https://tools.ietf.org/html/rfc4648#section-3.2 (unpadded base64 encoding) +func FingerprintSHA256(pubKey PublicKey) string { + sha256sum := sha256.Sum256(pubKey.Marshal()) + hash := base64.RawStdEncoding.EncodeToString(sha256sum[:]) + return "SHA256:" + hash +} diff --git a/vendor/golang.org/x/crypto/ssh/mac.go b/vendor/golang.org/x/crypto/ssh/mac.go new file mode 100644 index 0000000..c07a062 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/mac.go @@ -0,0 +1,61 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +// Message authentication support + +import ( + "crypto/hmac" + "crypto/sha1" + "crypto/sha256" + "hash" +) + +type macMode struct { + keySize int + etm bool + new func(key []byte) hash.Hash +} + +// truncatingMAC wraps around a hash.Hash and truncates the output digest to +// a given size. +type truncatingMAC struct { + length int + hmac hash.Hash +} + +func (t truncatingMAC) Write(data []byte) (int, error) { + return t.hmac.Write(data) +} + +func (t truncatingMAC) Sum(in []byte) []byte { + out := t.hmac.Sum(in) + return out[:len(in)+t.length] +} + +func (t truncatingMAC) Reset() { + t.hmac.Reset() +} + +func (t truncatingMAC) Size() int { + return t.length +} + +func (t truncatingMAC) BlockSize() int { return t.hmac.BlockSize() } + +var macModes = map[string]*macMode{ + "hmac-sha2-256-etm@openssh.com": {32, true, func(key []byte) hash.Hash { + return hmac.New(sha256.New, key) + }}, + "hmac-sha2-256": {32, false, func(key []byte) hash.Hash { + return hmac.New(sha256.New, key) + }}, + "hmac-sha1": {20, false, func(key []byte) hash.Hash { + return hmac.New(sha1.New, key) + }}, + "hmac-sha1-96": {20, false, func(key []byte) hash.Hash { + return truncatingMAC{12, hmac.New(sha1.New, key)} + }}, +} diff --git a/vendor/golang.org/x/crypto/ssh/messages.go b/vendor/golang.org/x/crypto/ssh/messages.go new file mode 100644 index 0000000..08d2811 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/messages.go @@ -0,0 +1,766 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "bytes" + "encoding/binary" + "errors" + "fmt" + "io" + "math/big" + "reflect" + "strconv" + "strings" +) + +// These are SSH message type numbers. They are scattered around several +// documents but many were taken from [SSH-PARAMETERS]. +const ( + msgIgnore = 2 + msgUnimplemented = 3 + msgDebug = 4 + msgNewKeys = 21 +) + +// SSH messages: +// +// These structures mirror the wire format of the corresponding SSH messages. +// They are marshaled using reflection with the marshal and unmarshal functions +// in this file. The only wrinkle is that a final member of type []byte with a +// ssh tag of "rest" receives the remainder of a packet when unmarshaling. + +// See RFC 4253, section 11.1. +const msgDisconnect = 1 + +// disconnectMsg is the message that signals a disconnect. It is also +// the error type returned from mux.Wait() +type disconnectMsg struct { + Reason uint32 `sshtype:"1"` + Message string + Language string +} + +func (d *disconnectMsg) Error() string { + return fmt.Sprintf("ssh: disconnect, reason %d: %s", d.Reason, d.Message) +} + +// See RFC 4253, section 7.1. +const msgKexInit = 20 + +type kexInitMsg struct { + Cookie [16]byte `sshtype:"20"` + KexAlgos []string + ServerHostKeyAlgos []string + CiphersClientServer []string + CiphersServerClient []string + MACsClientServer []string + MACsServerClient []string + CompressionClientServer []string + CompressionServerClient []string + LanguagesClientServer []string + LanguagesServerClient []string + FirstKexFollows bool + Reserved uint32 +} + +// See RFC 4253, section 8. + +// Diffie-Helman +const msgKexDHInit = 30 + +type kexDHInitMsg struct { + X *big.Int `sshtype:"30"` +} + +const msgKexECDHInit = 30 + +type kexECDHInitMsg struct { + ClientPubKey []byte `sshtype:"30"` +} + +const msgKexECDHReply = 31 + +type kexECDHReplyMsg struct { + HostKey []byte `sshtype:"31"` + EphemeralPubKey []byte + Signature []byte +} + +const msgKexDHReply = 31 + +type kexDHReplyMsg struct { + HostKey []byte `sshtype:"31"` + Y *big.Int + Signature []byte +} + +// See RFC 4253, section 10. +const msgServiceRequest = 5 + +type serviceRequestMsg struct { + Service string `sshtype:"5"` +} + +// See RFC 4253, section 10. +const msgServiceAccept = 6 + +type serviceAcceptMsg struct { + Service string `sshtype:"6"` +} + +// See RFC 4252, section 5. +const msgUserAuthRequest = 50 + +type userAuthRequestMsg struct { + User string `sshtype:"50"` + Service string + Method string + Payload []byte `ssh:"rest"` +} + +// Used for debug printouts of packets. +type userAuthSuccessMsg struct { +} + +// See RFC 4252, section 5.1 +const msgUserAuthFailure = 51 + +type userAuthFailureMsg struct { + Methods []string `sshtype:"51"` + PartialSuccess bool +} + +// See RFC 4252, section 5.1 +const msgUserAuthSuccess = 52 + +// See RFC 4252, section 5.4 +const msgUserAuthBanner = 53 + +type userAuthBannerMsg struct { + Message string `sshtype:"53"` + // unused, but required to allow message parsing + Language string +} + +// See RFC 4256, section 3.2 +const msgUserAuthInfoRequest = 60 +const msgUserAuthInfoResponse = 61 + +type userAuthInfoRequestMsg struct { + User string `sshtype:"60"` + Instruction string + DeprecatedLanguage string + NumPrompts uint32 + Prompts []byte `ssh:"rest"` +} + +// See RFC 4254, section 5.1. +const msgChannelOpen = 90 + +type channelOpenMsg struct { + ChanType string `sshtype:"90"` + PeersID uint32 + PeersWindow uint32 + MaxPacketSize uint32 + TypeSpecificData []byte `ssh:"rest"` +} + +const msgChannelExtendedData = 95 +const msgChannelData = 94 + +// Used for debug print outs of packets. +type channelDataMsg struct { + PeersID uint32 `sshtype:"94"` + Length uint32 + Rest []byte `ssh:"rest"` +} + +// See RFC 4254, section 5.1. +const msgChannelOpenConfirm = 91 + +type channelOpenConfirmMsg struct { + PeersID uint32 `sshtype:"91"` + MyID uint32 + MyWindow uint32 + MaxPacketSize uint32 + TypeSpecificData []byte `ssh:"rest"` +} + +// See RFC 4254, section 5.1. +const msgChannelOpenFailure = 92 + +type channelOpenFailureMsg struct { + PeersID uint32 `sshtype:"92"` + Reason RejectionReason + Message string + Language string +} + +const msgChannelRequest = 98 + +type channelRequestMsg struct { + PeersID uint32 `sshtype:"98"` + Request string + WantReply bool + RequestSpecificData []byte `ssh:"rest"` +} + +// See RFC 4254, section 5.4. +const msgChannelSuccess = 99 + +type channelRequestSuccessMsg struct { + PeersID uint32 `sshtype:"99"` +} + +// See RFC 4254, section 5.4. +const msgChannelFailure = 100 + +type channelRequestFailureMsg struct { + PeersID uint32 `sshtype:"100"` +} + +// See RFC 4254, section 5.3 +const msgChannelClose = 97 + +type channelCloseMsg struct { + PeersID uint32 `sshtype:"97"` +} + +// See RFC 4254, section 5.3 +const msgChannelEOF = 96 + +type channelEOFMsg struct { + PeersID uint32 `sshtype:"96"` +} + +// See RFC 4254, section 4 +const msgGlobalRequest = 80 + +type globalRequestMsg struct { + Type string `sshtype:"80"` + WantReply bool + Data []byte `ssh:"rest"` +} + +// See RFC 4254, section 4 +const msgRequestSuccess = 81 + +type globalRequestSuccessMsg struct { + Data []byte `ssh:"rest" sshtype:"81"` +} + +// See RFC 4254, section 4 +const msgRequestFailure = 82 + +type globalRequestFailureMsg struct { + Data []byte `ssh:"rest" sshtype:"82"` +} + +// See RFC 4254, section 5.2 +const msgChannelWindowAdjust = 93 + +type windowAdjustMsg struct { + PeersID uint32 `sshtype:"93"` + AdditionalBytes uint32 +} + +// See RFC 4252, section 7 +const msgUserAuthPubKeyOk = 60 + +type userAuthPubKeyOkMsg struct { + Algo string `sshtype:"60"` + PubKey []byte +} + +// typeTags returns the possible type bytes for the given reflect.Type, which +// should be a struct. The possible values are separated by a '|' character. +func typeTags(structType reflect.Type) (tags []byte) { + tagStr := structType.Field(0).Tag.Get("sshtype") + + for _, tag := range strings.Split(tagStr, "|") { + i, err := strconv.Atoi(tag) + if err == nil { + tags = append(tags, byte(i)) + } + } + + return tags +} + +func fieldError(t reflect.Type, field int, problem string) error { + if problem != "" { + problem = ": " + problem + } + return fmt.Errorf("ssh: unmarshal error for field %s of type %s%s", t.Field(field).Name, t.Name(), problem) +} + +var errShortRead = errors.New("ssh: short read") + +// Unmarshal parses data in SSH wire format into a structure. The out +// argument should be a pointer to struct. If the first member of the +// struct has the "sshtype" tag set to a '|'-separated set of numbers +// in decimal, the packet must start with one of those numbers. In +// case of error, Unmarshal returns a ParseError or +// UnexpectedMessageError. +func Unmarshal(data []byte, out interface{}) error { + v := reflect.ValueOf(out).Elem() + structType := v.Type() + expectedTypes := typeTags(structType) + + var expectedType byte + if len(expectedTypes) > 0 { + expectedType = expectedTypes[0] + } + + if len(data) == 0 { + return parseError(expectedType) + } + + if len(expectedTypes) > 0 { + goodType := false + for _, e := range expectedTypes { + if e > 0 && data[0] == e { + goodType = true + break + } + } + if !goodType { + return fmt.Errorf("ssh: unexpected message type %d (expected one of %v)", data[0], expectedTypes) + } + data = data[1:] + } + + var ok bool + for i := 0; i < v.NumField(); i++ { + field := v.Field(i) + t := field.Type() + switch t.Kind() { + case reflect.Bool: + if len(data) < 1 { + return errShortRead + } + field.SetBool(data[0] != 0) + data = data[1:] + case reflect.Array: + if t.Elem().Kind() != reflect.Uint8 { + return fieldError(structType, i, "array of unsupported type") + } + if len(data) < t.Len() { + return errShortRead + } + for j, n := 0, t.Len(); j < n; j++ { + field.Index(j).Set(reflect.ValueOf(data[j])) + } + data = data[t.Len():] + case reflect.Uint64: + var u64 uint64 + if u64, data, ok = parseUint64(data); !ok { + return errShortRead + } + field.SetUint(u64) + case reflect.Uint32: + var u32 uint32 + if u32, data, ok = parseUint32(data); !ok { + return errShortRead + } + field.SetUint(uint64(u32)) + case reflect.Uint8: + if len(data) < 1 { + return errShortRead + } + field.SetUint(uint64(data[0])) + data = data[1:] + case reflect.String: + var s []byte + if s, data, ok = parseString(data); !ok { + return fieldError(structType, i, "") + } + field.SetString(string(s)) + case reflect.Slice: + switch t.Elem().Kind() { + case reflect.Uint8: + if structType.Field(i).Tag.Get("ssh") == "rest" { + field.Set(reflect.ValueOf(data)) + data = nil + } else { + var s []byte + if s, data, ok = parseString(data); !ok { + return errShortRead + } + field.Set(reflect.ValueOf(s)) + } + case reflect.String: + var nl []string + if nl, data, ok = parseNameList(data); !ok { + return errShortRead + } + field.Set(reflect.ValueOf(nl)) + default: + return fieldError(structType, i, "slice of unsupported type") + } + case reflect.Ptr: + if t == bigIntType { + var n *big.Int + if n, data, ok = parseInt(data); !ok { + return errShortRead + } + field.Set(reflect.ValueOf(n)) + } else { + return fieldError(structType, i, "pointer to unsupported type") + } + default: + return fieldError(structType, i, fmt.Sprintf("unsupported type: %v", t)) + } + } + + if len(data) != 0 { + return parseError(expectedType) + } + + return nil +} + +// Marshal serializes the message in msg to SSH wire format. The msg +// argument should be a struct or pointer to struct. If the first +// member has the "sshtype" tag set to a number in decimal, that +// number is prepended to the result. If the last of member has the +// "ssh" tag set to "rest", its contents are appended to the output. +func Marshal(msg interface{}) []byte { + out := make([]byte, 0, 64) + return marshalStruct(out, msg) +} + +func marshalStruct(out []byte, msg interface{}) []byte { + v := reflect.Indirect(reflect.ValueOf(msg)) + msgTypes := typeTags(v.Type()) + if len(msgTypes) > 0 { + out = append(out, msgTypes[0]) + } + + for i, n := 0, v.NumField(); i < n; i++ { + field := v.Field(i) + switch t := field.Type(); t.Kind() { + case reflect.Bool: + var v uint8 + if field.Bool() { + v = 1 + } + out = append(out, v) + case reflect.Array: + if t.Elem().Kind() != reflect.Uint8 { + panic(fmt.Sprintf("array of non-uint8 in field %d: %T", i, field.Interface())) + } + for j, l := 0, t.Len(); j < l; j++ { + out = append(out, uint8(field.Index(j).Uint())) + } + case reflect.Uint32: + out = appendU32(out, uint32(field.Uint())) + case reflect.Uint64: + out = appendU64(out, uint64(field.Uint())) + case reflect.Uint8: + out = append(out, uint8(field.Uint())) + case reflect.String: + s := field.String() + out = appendInt(out, len(s)) + out = append(out, s...) + case reflect.Slice: + switch t.Elem().Kind() { + case reflect.Uint8: + if v.Type().Field(i).Tag.Get("ssh") != "rest" { + out = appendInt(out, field.Len()) + } + out = append(out, field.Bytes()...) + case reflect.String: + offset := len(out) + out = appendU32(out, 0) + if n := field.Len(); n > 0 { + for j := 0; j < n; j++ { + f := field.Index(j) + if j != 0 { + out = append(out, ',') + } + out = append(out, f.String()...) + } + // overwrite length value + binary.BigEndian.PutUint32(out[offset:], uint32(len(out)-offset-4)) + } + default: + panic(fmt.Sprintf("slice of unknown type in field %d: %T", i, field.Interface())) + } + case reflect.Ptr: + if t == bigIntType { + var n *big.Int + nValue := reflect.ValueOf(&n) + nValue.Elem().Set(field) + needed := intLength(n) + oldLength := len(out) + + if cap(out)-len(out) < needed { + newOut := make([]byte, len(out), 2*(len(out)+needed)) + copy(newOut, out) + out = newOut + } + out = out[:oldLength+needed] + marshalInt(out[oldLength:], n) + } else { + panic(fmt.Sprintf("pointer to unknown type in field %d: %T", i, field.Interface())) + } + } + } + + return out +} + +var bigOne = big.NewInt(1) + +func parseString(in []byte) (out, rest []byte, ok bool) { + if len(in) < 4 { + return + } + length := binary.BigEndian.Uint32(in) + in = in[4:] + if uint32(len(in)) < length { + return + } + out = in[:length] + rest = in[length:] + ok = true + return +} + +var ( + comma = []byte{','} + emptyNameList = []string{} +) + +func parseNameList(in []byte) (out []string, rest []byte, ok bool) { + contents, rest, ok := parseString(in) + if !ok { + return + } + if len(contents) == 0 { + out = emptyNameList + return + } + parts := bytes.Split(contents, comma) + out = make([]string, len(parts)) + for i, part := range parts { + out[i] = string(part) + } + return +} + +func parseInt(in []byte) (out *big.Int, rest []byte, ok bool) { + contents, rest, ok := parseString(in) + if !ok { + return + } + out = new(big.Int) + + if len(contents) > 0 && contents[0]&0x80 == 0x80 { + // This is a negative number + notBytes := make([]byte, len(contents)) + for i := range notBytes { + notBytes[i] = ^contents[i] + } + out.SetBytes(notBytes) + out.Add(out, bigOne) + out.Neg(out) + } else { + // Positive number + out.SetBytes(contents) + } + ok = true + return +} + +func parseUint32(in []byte) (uint32, []byte, bool) { + if len(in) < 4 { + return 0, nil, false + } + return binary.BigEndian.Uint32(in), in[4:], true +} + +func parseUint64(in []byte) (uint64, []byte, bool) { + if len(in) < 8 { + return 0, nil, false + } + return binary.BigEndian.Uint64(in), in[8:], true +} + +func intLength(n *big.Int) int { + length := 4 /* length bytes */ + if n.Sign() < 0 { + nMinus1 := new(big.Int).Neg(n) + nMinus1.Sub(nMinus1, bigOne) + bitLen := nMinus1.BitLen() + if bitLen%8 == 0 { + // The number will need 0xff padding + length++ + } + length += (bitLen + 7) / 8 + } else if n.Sign() == 0 { + // A zero is the zero length string + } else { + bitLen := n.BitLen() + if bitLen%8 == 0 { + // The number will need 0x00 padding + length++ + } + length += (bitLen + 7) / 8 + } + + return length +} + +func marshalUint32(to []byte, n uint32) []byte { + binary.BigEndian.PutUint32(to, n) + return to[4:] +} + +func marshalUint64(to []byte, n uint64) []byte { + binary.BigEndian.PutUint64(to, n) + return to[8:] +} + +func marshalInt(to []byte, n *big.Int) []byte { + lengthBytes := to + to = to[4:] + length := 0 + + if n.Sign() < 0 { + // A negative number has to be converted to two's-complement + // form. So we'll subtract 1 and invert. If the + // most-significant-bit isn't set then we'll need to pad the + // beginning with 0xff in order to keep the number negative. + nMinus1 := new(big.Int).Neg(n) + nMinus1.Sub(nMinus1, bigOne) + bytes := nMinus1.Bytes() + for i := range bytes { + bytes[i] ^= 0xff + } + if len(bytes) == 0 || bytes[0]&0x80 == 0 { + to[0] = 0xff + to = to[1:] + length++ + } + nBytes := copy(to, bytes) + to = to[nBytes:] + length += nBytes + } else if n.Sign() == 0 { + // A zero is the zero length string + } else { + bytes := n.Bytes() + if len(bytes) > 0 && bytes[0]&0x80 != 0 { + // We'll have to pad this with a 0x00 in order to + // stop it looking like a negative number. + to[0] = 0 + to = to[1:] + length++ + } + nBytes := copy(to, bytes) + to = to[nBytes:] + length += nBytes + } + + lengthBytes[0] = byte(length >> 24) + lengthBytes[1] = byte(length >> 16) + lengthBytes[2] = byte(length >> 8) + lengthBytes[3] = byte(length) + return to +} + +func writeInt(w io.Writer, n *big.Int) { + length := intLength(n) + buf := make([]byte, length) + marshalInt(buf, n) + w.Write(buf) +} + +func writeString(w io.Writer, s []byte) { + var lengthBytes [4]byte + lengthBytes[0] = byte(len(s) >> 24) + lengthBytes[1] = byte(len(s) >> 16) + lengthBytes[2] = byte(len(s) >> 8) + lengthBytes[3] = byte(len(s)) + w.Write(lengthBytes[:]) + w.Write(s) +} + +func stringLength(n int) int { + return 4 + n +} + +func marshalString(to []byte, s []byte) []byte { + to[0] = byte(len(s) >> 24) + to[1] = byte(len(s) >> 16) + to[2] = byte(len(s) >> 8) + to[3] = byte(len(s)) + to = to[4:] + copy(to, s) + return to[len(s):] +} + +var bigIntType = reflect.TypeOf((*big.Int)(nil)) + +// Decode a packet into its corresponding message. +func decode(packet []byte) (interface{}, error) { + var msg interface{} + switch packet[0] { + case msgDisconnect: + msg = new(disconnectMsg) + case msgServiceRequest: + msg = new(serviceRequestMsg) + case msgServiceAccept: + msg = new(serviceAcceptMsg) + case msgKexInit: + msg = new(kexInitMsg) + case msgKexDHInit: + msg = new(kexDHInitMsg) + case msgKexDHReply: + msg = new(kexDHReplyMsg) + case msgUserAuthRequest: + msg = new(userAuthRequestMsg) + case msgUserAuthSuccess: + return new(userAuthSuccessMsg), nil + case msgUserAuthFailure: + msg = new(userAuthFailureMsg) + case msgUserAuthPubKeyOk: + msg = new(userAuthPubKeyOkMsg) + case msgGlobalRequest: + msg = new(globalRequestMsg) + case msgRequestSuccess: + msg = new(globalRequestSuccessMsg) + case msgRequestFailure: + msg = new(globalRequestFailureMsg) + case msgChannelOpen: + msg = new(channelOpenMsg) + case msgChannelData: + msg = new(channelDataMsg) + case msgChannelOpenConfirm: + msg = new(channelOpenConfirmMsg) + case msgChannelOpenFailure: + msg = new(channelOpenFailureMsg) + case msgChannelWindowAdjust: + msg = new(windowAdjustMsg) + case msgChannelEOF: + msg = new(channelEOFMsg) + case msgChannelClose: + msg = new(channelCloseMsg) + case msgChannelRequest: + msg = new(channelRequestMsg) + case msgChannelSuccess: + msg = new(channelRequestSuccessMsg) + case msgChannelFailure: + msg = new(channelRequestFailureMsg) + default: + return nil, unexpectedMessageError(0, packet[0]) + } + if err := Unmarshal(packet, msg); err != nil { + return nil, err + } + return msg, nil +} diff --git a/vendor/golang.org/x/crypto/ssh/mux.go b/vendor/golang.org/x/crypto/ssh/mux.go new file mode 100644 index 0000000..f190162 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/mux.go @@ -0,0 +1,330 @@ +// Copyright 2013 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "encoding/binary" + "fmt" + "io" + "log" + "sync" + "sync/atomic" +) + +// debugMux, if set, causes messages in the connection protocol to be +// logged. +const debugMux = false + +// chanList is a thread safe channel list. +type chanList struct { + // protects concurrent access to chans + sync.Mutex + + // chans are indexed by the local id of the channel, which the + // other side should send in the PeersId field. + chans []*channel + + // This is a debugging aid: it offsets all IDs by this + // amount. This helps distinguish otherwise identical + // server/client muxes + offset uint32 +} + +// Assigns a channel ID to the given channel. +func (c *chanList) add(ch *channel) uint32 { + c.Lock() + defer c.Unlock() + for i := range c.chans { + if c.chans[i] == nil { + c.chans[i] = ch + return uint32(i) + c.offset + } + } + c.chans = append(c.chans, ch) + return uint32(len(c.chans)-1) + c.offset +} + +// getChan returns the channel for the given ID. +func (c *chanList) getChan(id uint32) *channel { + id -= c.offset + + c.Lock() + defer c.Unlock() + if id < uint32(len(c.chans)) { + return c.chans[id] + } + return nil +} + +func (c *chanList) remove(id uint32) { + id -= c.offset + c.Lock() + if id < uint32(len(c.chans)) { + c.chans[id] = nil + } + c.Unlock() +} + +// dropAll forgets all channels it knows, returning them in a slice. +func (c *chanList) dropAll() []*channel { + c.Lock() + defer c.Unlock() + var r []*channel + + for _, ch := range c.chans { + if ch == nil { + continue + } + r = append(r, ch) + } + c.chans = nil + return r +} + +// mux represents the state for the SSH connection protocol, which +// multiplexes many channels onto a single packet transport. +type mux struct { + conn packetConn + chanList chanList + + incomingChannels chan NewChannel + + globalSentMu sync.Mutex + globalResponses chan interface{} + incomingRequests chan *Request + + errCond *sync.Cond + err error +} + +// When debugging, each new chanList instantiation has a different +// offset. +var globalOff uint32 + +func (m *mux) Wait() error { + m.errCond.L.Lock() + defer m.errCond.L.Unlock() + for m.err == nil { + m.errCond.Wait() + } + return m.err +} + +// newMux returns a mux that runs over the given connection. +func newMux(p packetConn) *mux { + m := &mux{ + conn: p, + incomingChannels: make(chan NewChannel, chanSize), + globalResponses: make(chan interface{}, 1), + incomingRequests: make(chan *Request, chanSize), + errCond: newCond(), + } + if debugMux { + m.chanList.offset = atomic.AddUint32(&globalOff, 1) + } + + go m.loop() + return m +} + +func (m *mux) sendMessage(msg interface{}) error { + p := Marshal(msg) + if debugMux { + log.Printf("send global(%d): %#v", m.chanList.offset, msg) + } + return m.conn.writePacket(p) +} + +func (m *mux) SendRequest(name string, wantReply bool, payload []byte) (bool, []byte, error) { + if wantReply { + m.globalSentMu.Lock() + defer m.globalSentMu.Unlock() + } + + if err := m.sendMessage(globalRequestMsg{ + Type: name, + WantReply: wantReply, + Data: payload, + }); err != nil { + return false, nil, err + } + + if !wantReply { + return false, nil, nil + } + + msg, ok := <-m.globalResponses + if !ok { + return false, nil, io.EOF + } + switch msg := msg.(type) { + case *globalRequestFailureMsg: + return false, msg.Data, nil + case *globalRequestSuccessMsg: + return true, msg.Data, nil + default: + return false, nil, fmt.Errorf("ssh: unexpected response to request: %#v", msg) + } +} + +// ackRequest must be called after processing a global request that +// has WantReply set. +func (m *mux) ackRequest(ok bool, data []byte) error { + if ok { + return m.sendMessage(globalRequestSuccessMsg{Data: data}) + } + return m.sendMessage(globalRequestFailureMsg{Data: data}) +} + +func (m *mux) Close() error { + return m.conn.Close() +} + +// loop runs the connection machine. It will process packets until an +// error is encountered. To synchronize on loop exit, use mux.Wait. +func (m *mux) loop() { + var err error + for err == nil { + err = m.onePacket() + } + + for _, ch := range m.chanList.dropAll() { + ch.close() + } + + close(m.incomingChannels) + close(m.incomingRequests) + close(m.globalResponses) + + m.conn.Close() + + m.errCond.L.Lock() + m.err = err + m.errCond.Broadcast() + m.errCond.L.Unlock() + + if debugMux { + log.Println("loop exit", err) + } +} + +// onePacket reads and processes one packet. +func (m *mux) onePacket() error { + packet, err := m.conn.readPacket() + if err != nil { + return err + } + + if debugMux { + if packet[0] == msgChannelData || packet[0] == msgChannelExtendedData { + log.Printf("decoding(%d): data packet - %d bytes", m.chanList.offset, len(packet)) + } else { + p, _ := decode(packet) + log.Printf("decoding(%d): %d %#v - %d bytes", m.chanList.offset, packet[0], p, len(packet)) + } + } + + switch packet[0] { + case msgChannelOpen: + return m.handleChannelOpen(packet) + case msgGlobalRequest, msgRequestSuccess, msgRequestFailure: + return m.handleGlobalPacket(packet) + } + + // assume a channel packet. + if len(packet) < 5 { + return parseError(packet[0]) + } + id := binary.BigEndian.Uint32(packet[1:]) + ch := m.chanList.getChan(id) + if ch == nil { + return fmt.Errorf("ssh: invalid channel %d", id) + } + + return ch.handlePacket(packet) +} + +func (m *mux) handleGlobalPacket(packet []byte) error { + msg, err := decode(packet) + if err != nil { + return err + } + + switch msg := msg.(type) { + case *globalRequestMsg: + m.incomingRequests <- &Request{ + Type: msg.Type, + WantReply: msg.WantReply, + Payload: msg.Data, + mux: m, + } + case *globalRequestSuccessMsg, *globalRequestFailureMsg: + m.globalResponses <- msg + default: + panic(fmt.Sprintf("not a global message %#v", msg)) + } + + return nil +} + +// handleChannelOpen schedules a channel to be Accept()ed. +func (m *mux) handleChannelOpen(packet []byte) error { + var msg channelOpenMsg + if err := Unmarshal(packet, &msg); err != nil { + return err + } + + if msg.MaxPacketSize < minPacketLength || msg.MaxPacketSize > 1<<31 { + failMsg := channelOpenFailureMsg{ + PeersID: msg.PeersID, + Reason: ConnectionFailed, + Message: "invalid request", + Language: "en_US.UTF-8", + } + return m.sendMessage(failMsg) + } + + c := m.newChannel(msg.ChanType, channelInbound, msg.TypeSpecificData) + c.remoteId = msg.PeersID + c.maxRemotePayload = msg.MaxPacketSize + c.remoteWin.add(msg.PeersWindow) + m.incomingChannels <- c + return nil +} + +func (m *mux) OpenChannel(chanType string, extra []byte) (Channel, <-chan *Request, error) { + ch, err := m.openChannel(chanType, extra) + if err != nil { + return nil, nil, err + } + + return ch, ch.incomingRequests, nil +} + +func (m *mux) openChannel(chanType string, extra []byte) (*channel, error) { + ch := m.newChannel(chanType, channelOutbound, extra) + + ch.maxIncomingPayload = channelMaxPacket + + open := channelOpenMsg{ + ChanType: chanType, + PeersWindow: ch.myWindow, + MaxPacketSize: ch.maxIncomingPayload, + TypeSpecificData: extra, + PeersID: ch.localId, + } + if err := m.sendMessage(open); err != nil { + return nil, err + } + + switch msg := (<-ch.msg).(type) { + case *channelOpenConfirmMsg: + return ch, nil + case *channelOpenFailureMsg: + return nil, &OpenChannelError{msg.Reason, msg.Message} + default: + return nil, fmt.Errorf("ssh: unexpected packet in response to channel open: %T", msg) + } +} diff --git a/vendor/golang.org/x/crypto/ssh/server.go b/vendor/golang.org/x/crypto/ssh/server.go new file mode 100644 index 0000000..e86e896 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/server.go @@ -0,0 +1,594 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "bytes" + "errors" + "fmt" + "io" + "net" + "strings" +) + +// The Permissions type holds fine-grained permissions that are +// specific to a user or a specific authentication method for a user. +// The Permissions value for a successful authentication attempt is +// available in ServerConn, so it can be used to pass information from +// the user-authentication phase to the application layer. +type Permissions struct { + // CriticalOptions indicate restrictions to the default + // permissions, and are typically used in conjunction with + // user certificates. The standard for SSH certificates + // defines "force-command" (only allow the given command to + // execute) and "source-address" (only allow connections from + // the given address). The SSH package currently only enforces + // the "source-address" critical option. It is up to server + // implementations to enforce other critical options, such as + // "force-command", by checking them after the SSH handshake + // is successful. In general, SSH servers should reject + // connections that specify critical options that are unknown + // or not supported. + CriticalOptions map[string]string + + // Extensions are extra functionality that the server may + // offer on authenticated connections. Lack of support for an + // extension does not preclude authenticating a user. Common + // extensions are "permit-agent-forwarding", + // "permit-X11-forwarding". The Go SSH library currently does + // not act on any extension, and it is up to server + // implementations to honor them. Extensions can be used to + // pass data from the authentication callbacks to the server + // application layer. + Extensions map[string]string +} + +// ServerConfig holds server specific configuration data. +type ServerConfig struct { + // Config contains configuration shared between client and server. + Config + + hostKeys []Signer + + // NoClientAuth is true if clients are allowed to connect without + // authenticating. + NoClientAuth bool + + // MaxAuthTries specifies the maximum number of authentication attempts + // permitted per connection. If set to a negative number, the number of + // attempts are unlimited. If set to zero, the number of attempts are limited + // to 6. + MaxAuthTries int + + // PasswordCallback, if non-nil, is called when a user + // attempts to authenticate using a password. + PasswordCallback func(conn ConnMetadata, password []byte) (*Permissions, error) + + // PublicKeyCallback, if non-nil, is called when a client + // offers a public key for authentication. It must return a nil error + // if the given public key can be used to authenticate the + // given user. For example, see CertChecker.Authenticate. A + // call to this function does not guarantee that the key + // offered is in fact used to authenticate. To record any data + // depending on the public key, store it inside a + // Permissions.Extensions entry. + PublicKeyCallback func(conn ConnMetadata, key PublicKey) (*Permissions, error) + + // KeyboardInteractiveCallback, if non-nil, is called when + // keyboard-interactive authentication is selected (RFC + // 4256). The client object's Challenge function should be + // used to query the user. The callback may offer multiple + // Challenge rounds. To avoid information leaks, the client + // should be presented a challenge even if the user is + // unknown. + KeyboardInteractiveCallback func(conn ConnMetadata, client KeyboardInteractiveChallenge) (*Permissions, error) + + // AuthLogCallback, if non-nil, is called to log all authentication + // attempts. + AuthLogCallback func(conn ConnMetadata, method string, err error) + + // ServerVersion is the version identification string to announce in + // the public handshake. + // If empty, a reasonable default is used. + // Note that RFC 4253 section 4.2 requires that this string start with + // "SSH-2.0-". + ServerVersion string + + // BannerCallback, if present, is called and the return string is sent to + // the client after key exchange completed but before authentication. + BannerCallback func(conn ConnMetadata) string +} + +// AddHostKey adds a private key as a host key. If an existing host +// key exists with the same algorithm, it is overwritten. Each server +// config must have at least one host key. +func (s *ServerConfig) AddHostKey(key Signer) { + for i, k := range s.hostKeys { + if k.PublicKey().Type() == key.PublicKey().Type() { + s.hostKeys[i] = key + return + } + } + + s.hostKeys = append(s.hostKeys, key) +} + +// cachedPubKey contains the results of querying whether a public key is +// acceptable for a user. +type cachedPubKey struct { + user string + pubKeyData []byte + result error + perms *Permissions +} + +const maxCachedPubKeys = 16 + +// pubKeyCache caches tests for public keys. Since SSH clients +// will query whether a public key is acceptable before attempting to +// authenticate with it, we end up with duplicate queries for public +// key validity. The cache only applies to a single ServerConn. +type pubKeyCache struct { + keys []cachedPubKey +} + +// get returns the result for a given user/algo/key tuple. +func (c *pubKeyCache) get(user string, pubKeyData []byte) (cachedPubKey, bool) { + for _, k := range c.keys { + if k.user == user && bytes.Equal(k.pubKeyData, pubKeyData) { + return k, true + } + } + return cachedPubKey{}, false +} + +// add adds the given tuple to the cache. +func (c *pubKeyCache) add(candidate cachedPubKey) { + if len(c.keys) < maxCachedPubKeys { + c.keys = append(c.keys, candidate) + } +} + +// ServerConn is an authenticated SSH connection, as seen from the +// server +type ServerConn struct { + Conn + + // If the succeeding authentication callback returned a + // non-nil Permissions pointer, it is stored here. + Permissions *Permissions +} + +// NewServerConn starts a new SSH server with c as the underlying +// transport. It starts with a handshake and, if the handshake is +// unsuccessful, it closes the connection and returns an error. The +// Request and NewChannel channels must be serviced, or the connection +// will hang. +// +// The returned error may be of type *ServerAuthError for +// authentication errors. +func NewServerConn(c net.Conn, config *ServerConfig) (*ServerConn, <-chan NewChannel, <-chan *Request, error) { + fullConf := *config + fullConf.SetDefaults() + if fullConf.MaxAuthTries == 0 { + fullConf.MaxAuthTries = 6 + } + + s := &connection{ + sshConn: sshConn{conn: c}, + } + perms, err := s.serverHandshake(&fullConf) + if err != nil { + c.Close() + return nil, nil, nil, err + } + return &ServerConn{s, perms}, s.mux.incomingChannels, s.mux.incomingRequests, nil +} + +// signAndMarshal signs the data with the appropriate algorithm, +// and serializes the result in SSH wire format. +func signAndMarshal(k Signer, rand io.Reader, data []byte) ([]byte, error) { + sig, err := k.Sign(rand, data) + if err != nil { + return nil, err + } + + return Marshal(sig), nil +} + +// handshake performs key exchange and user authentication. +func (s *connection) serverHandshake(config *ServerConfig) (*Permissions, error) { + if len(config.hostKeys) == 0 { + return nil, errors.New("ssh: server has no host keys") + } + + if !config.NoClientAuth && config.PasswordCallback == nil && config.PublicKeyCallback == nil && config.KeyboardInteractiveCallback == nil { + return nil, errors.New("ssh: no authentication methods configured but NoClientAuth is also false") + } + + if config.ServerVersion != "" { + s.serverVersion = []byte(config.ServerVersion) + } else { + s.serverVersion = []byte(packageVersion) + } + var err error + s.clientVersion, err = exchangeVersions(s.sshConn.conn, s.serverVersion) + if err != nil { + return nil, err + } + + tr := newTransport(s.sshConn.conn, config.Rand, false /* not client */) + s.transport = newServerTransport(tr, s.clientVersion, s.serverVersion, config) + + if err := s.transport.waitSession(); err != nil { + return nil, err + } + + // We just did the key change, so the session ID is established. + s.sessionID = s.transport.getSessionID() + + var packet []byte + if packet, err = s.transport.readPacket(); err != nil { + return nil, err + } + + var serviceRequest serviceRequestMsg + if err = Unmarshal(packet, &serviceRequest); err != nil { + return nil, err + } + if serviceRequest.Service != serviceUserAuth { + return nil, errors.New("ssh: requested service '" + serviceRequest.Service + "' before authenticating") + } + serviceAccept := serviceAcceptMsg{ + Service: serviceUserAuth, + } + if err := s.transport.writePacket(Marshal(&serviceAccept)); err != nil { + return nil, err + } + + perms, err := s.serverAuthenticate(config) + if err != nil { + return nil, err + } + s.mux = newMux(s.transport) + return perms, err +} + +func isAcceptableAlgo(algo string) bool { + switch algo { + case KeyAlgoRSA, KeyAlgoDSA, KeyAlgoECDSA256, KeyAlgoECDSA384, KeyAlgoECDSA521, KeyAlgoED25519, + CertAlgoRSAv01, CertAlgoDSAv01, CertAlgoECDSA256v01, CertAlgoECDSA384v01, CertAlgoECDSA521v01, CertAlgoED25519v01: + return true + } + return false +} + +func checkSourceAddress(addr net.Addr, sourceAddrs string) error { + if addr == nil { + return errors.New("ssh: no address known for client, but source-address match required") + } + + tcpAddr, ok := addr.(*net.TCPAddr) + if !ok { + return fmt.Errorf("ssh: remote address %v is not an TCP address when checking source-address match", addr) + } + + for _, sourceAddr := range strings.Split(sourceAddrs, ",") { + if allowedIP := net.ParseIP(sourceAddr); allowedIP != nil { + if allowedIP.Equal(tcpAddr.IP) { + return nil + } + } else { + _, ipNet, err := net.ParseCIDR(sourceAddr) + if err != nil { + return fmt.Errorf("ssh: error parsing source-address restriction %q: %v", sourceAddr, err) + } + + if ipNet.Contains(tcpAddr.IP) { + return nil + } + } + } + + return fmt.Errorf("ssh: remote address %v is not allowed because of source-address restriction", addr) +} + +// ServerAuthError represents server authentication errors and is +// sometimes returned by NewServerConn. It appends any authentication +// errors that may occur, and is returned if all of the authentication +// methods provided by the user failed to authenticate. +type ServerAuthError struct { + // Errors contains authentication errors returned by the authentication + // callback methods. The first entry is typically ErrNoAuth. + Errors []error +} + +func (l ServerAuthError) Error() string { + var errs []string + for _, err := range l.Errors { + errs = append(errs, err.Error()) + } + return "[" + strings.Join(errs, ", ") + "]" +} + +// ErrNoAuth is the error value returned if no +// authentication method has been passed yet. This happens as a normal +// part of the authentication loop, since the client first tries +// 'none' authentication to discover available methods. +// It is returned in ServerAuthError.Errors from NewServerConn. +var ErrNoAuth = errors.New("ssh: no auth passed yet") + +func (s *connection) serverAuthenticate(config *ServerConfig) (*Permissions, error) { + sessionID := s.transport.getSessionID() + var cache pubKeyCache + var perms *Permissions + + authFailures := 0 + var authErrs []error + var displayedBanner bool + +userAuthLoop: + for { + if authFailures >= config.MaxAuthTries && config.MaxAuthTries > 0 { + discMsg := &disconnectMsg{ + Reason: 2, + Message: "too many authentication failures", + } + + if err := s.transport.writePacket(Marshal(discMsg)); err != nil { + return nil, err + } + + return nil, discMsg + } + + var userAuthReq userAuthRequestMsg + if packet, err := s.transport.readPacket(); err != nil { + if err == io.EOF { + return nil, &ServerAuthError{Errors: authErrs} + } + return nil, err + } else if err = Unmarshal(packet, &userAuthReq); err != nil { + return nil, err + } + + if userAuthReq.Service != serviceSSH { + return nil, errors.New("ssh: client attempted to negotiate for unknown service: " + userAuthReq.Service) + } + + s.user = userAuthReq.User + + if !displayedBanner && config.BannerCallback != nil { + displayedBanner = true + msg := config.BannerCallback(s) + if msg != "" { + bannerMsg := &userAuthBannerMsg{ + Message: msg, + } + if err := s.transport.writePacket(Marshal(bannerMsg)); err != nil { + return nil, err + } + } + } + + perms = nil + authErr := ErrNoAuth + + switch userAuthReq.Method { + case "none": + if config.NoClientAuth { + authErr = nil + } + + // allow initial attempt of 'none' without penalty + if authFailures == 0 { + authFailures-- + } + case "password": + if config.PasswordCallback == nil { + authErr = errors.New("ssh: password auth not configured") + break + } + payload := userAuthReq.Payload + if len(payload) < 1 || payload[0] != 0 { + return nil, parseError(msgUserAuthRequest) + } + payload = payload[1:] + password, payload, ok := parseString(payload) + if !ok || len(payload) > 0 { + return nil, parseError(msgUserAuthRequest) + } + + perms, authErr = config.PasswordCallback(s, password) + case "keyboard-interactive": + if config.KeyboardInteractiveCallback == nil { + authErr = errors.New("ssh: keyboard-interactive auth not configured") + break + } + + prompter := &sshClientKeyboardInteractive{s} + perms, authErr = config.KeyboardInteractiveCallback(s, prompter.Challenge) + case "publickey": + if config.PublicKeyCallback == nil { + authErr = errors.New("ssh: publickey auth not configured") + break + } + payload := userAuthReq.Payload + if len(payload) < 1 { + return nil, parseError(msgUserAuthRequest) + } + isQuery := payload[0] == 0 + payload = payload[1:] + algoBytes, payload, ok := parseString(payload) + if !ok { + return nil, parseError(msgUserAuthRequest) + } + algo := string(algoBytes) + if !isAcceptableAlgo(algo) { + authErr = fmt.Errorf("ssh: algorithm %q not accepted", algo) + break + } + + pubKeyData, payload, ok := parseString(payload) + if !ok { + return nil, parseError(msgUserAuthRequest) + } + + pubKey, err := ParsePublicKey(pubKeyData) + if err != nil { + return nil, err + } + + candidate, ok := cache.get(s.user, pubKeyData) + if !ok { + candidate.user = s.user + candidate.pubKeyData = pubKeyData + candidate.perms, candidate.result = config.PublicKeyCallback(s, pubKey) + if candidate.result == nil && candidate.perms != nil && candidate.perms.CriticalOptions != nil && candidate.perms.CriticalOptions[sourceAddressCriticalOption] != "" { + candidate.result = checkSourceAddress( + s.RemoteAddr(), + candidate.perms.CriticalOptions[sourceAddressCriticalOption]) + } + cache.add(candidate) + } + + if isQuery { + // The client can query if the given public key + // would be okay. + + if len(payload) > 0 { + return nil, parseError(msgUserAuthRequest) + } + + if candidate.result == nil { + okMsg := userAuthPubKeyOkMsg{ + Algo: algo, + PubKey: pubKeyData, + } + if err = s.transport.writePacket(Marshal(&okMsg)); err != nil { + return nil, err + } + continue userAuthLoop + } + authErr = candidate.result + } else { + sig, payload, ok := parseSignature(payload) + if !ok || len(payload) > 0 { + return nil, parseError(msgUserAuthRequest) + } + // Ensure the public key algo and signature algo + // are supported. Compare the private key + // algorithm name that corresponds to algo with + // sig.Format. This is usually the same, but + // for certs, the names differ. + if !isAcceptableAlgo(sig.Format) { + authErr = fmt.Errorf("ssh: algorithm %q not accepted", sig.Format) + break + } + signedData := buildDataSignedForAuth(sessionID, userAuthReq, algoBytes, pubKeyData) + + if err := pubKey.Verify(signedData, sig); err != nil { + return nil, err + } + + authErr = candidate.result + perms = candidate.perms + } + default: + authErr = fmt.Errorf("ssh: unknown method %q", userAuthReq.Method) + } + + authErrs = append(authErrs, authErr) + + if config.AuthLogCallback != nil { + config.AuthLogCallback(s, userAuthReq.Method, authErr) + } + + if authErr == nil { + break userAuthLoop + } + + authFailures++ + + var failureMsg userAuthFailureMsg + if config.PasswordCallback != nil { + failureMsg.Methods = append(failureMsg.Methods, "password") + } + if config.PublicKeyCallback != nil { + failureMsg.Methods = append(failureMsg.Methods, "publickey") + } + if config.KeyboardInteractiveCallback != nil { + failureMsg.Methods = append(failureMsg.Methods, "keyboard-interactive") + } + + if len(failureMsg.Methods) == 0 { + return nil, errors.New("ssh: no authentication methods configured but NoClientAuth is also false") + } + + if err := s.transport.writePacket(Marshal(&failureMsg)); err != nil { + return nil, err + } + } + + if err := s.transport.writePacket([]byte{msgUserAuthSuccess}); err != nil { + return nil, err + } + return perms, nil +} + +// sshClientKeyboardInteractive implements a ClientKeyboardInteractive by +// asking the client on the other side of a ServerConn. +type sshClientKeyboardInteractive struct { + *connection +} + +func (c *sshClientKeyboardInteractive) Challenge(user, instruction string, questions []string, echos []bool) (answers []string, err error) { + if len(questions) != len(echos) { + return nil, errors.New("ssh: echos and questions must have equal length") + } + + var prompts []byte + for i := range questions { + prompts = appendString(prompts, questions[i]) + prompts = appendBool(prompts, echos[i]) + } + + if err := c.transport.writePacket(Marshal(&userAuthInfoRequestMsg{ + Instruction: instruction, + NumPrompts: uint32(len(questions)), + Prompts: prompts, + })); err != nil { + return nil, err + } + + packet, err := c.transport.readPacket() + if err != nil { + return nil, err + } + if packet[0] != msgUserAuthInfoResponse { + return nil, unexpectedMessageError(msgUserAuthInfoResponse, packet[0]) + } + packet = packet[1:] + + n, packet, ok := parseUint32(packet) + if !ok || int(n) != len(questions) { + return nil, parseError(msgUserAuthInfoResponse) + } + + for i := uint32(0); i < n; i++ { + ans, rest, ok := parseString(packet) + if !ok { + return nil, parseError(msgUserAuthInfoResponse) + } + + answers = append(answers, string(ans)) + packet = rest + } + if len(packet) != 0 { + return nil, errors.New("ssh: junk at end of message") + } + + return answers, nil +} diff --git a/vendor/golang.org/x/crypto/ssh/session.go b/vendor/golang.org/x/crypto/ssh/session.go new file mode 100644 index 0000000..d3321f6 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/session.go @@ -0,0 +1,647 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +// Session implements an interactive session described in +// "RFC 4254, section 6". + +import ( + "bytes" + "encoding/binary" + "errors" + "fmt" + "io" + "io/ioutil" + "sync" +) + +type Signal string + +// POSIX signals as listed in RFC 4254 Section 6.10. +const ( + SIGABRT Signal = "ABRT" + SIGALRM Signal = "ALRM" + SIGFPE Signal = "FPE" + SIGHUP Signal = "HUP" + SIGILL Signal = "ILL" + SIGINT Signal = "INT" + SIGKILL Signal = "KILL" + SIGPIPE Signal = "PIPE" + SIGQUIT Signal = "QUIT" + SIGSEGV Signal = "SEGV" + SIGTERM Signal = "TERM" + SIGUSR1 Signal = "USR1" + SIGUSR2 Signal = "USR2" +) + +var signals = map[Signal]int{ + SIGABRT: 6, + SIGALRM: 14, + SIGFPE: 8, + SIGHUP: 1, + SIGILL: 4, + SIGINT: 2, + SIGKILL: 9, + SIGPIPE: 13, + SIGQUIT: 3, + SIGSEGV: 11, + SIGTERM: 15, +} + +type TerminalModes map[uint8]uint32 + +// POSIX terminal mode flags as listed in RFC 4254 Section 8. +const ( + tty_OP_END = 0 + VINTR = 1 + VQUIT = 2 + VERASE = 3 + VKILL = 4 + VEOF = 5 + VEOL = 6 + VEOL2 = 7 + VSTART = 8 + VSTOP = 9 + VSUSP = 10 + VDSUSP = 11 + VREPRINT = 12 + VWERASE = 13 + VLNEXT = 14 + VFLUSH = 15 + VSWTCH = 16 + VSTATUS = 17 + VDISCARD = 18 + IGNPAR = 30 + PARMRK = 31 + INPCK = 32 + ISTRIP = 33 + INLCR = 34 + IGNCR = 35 + ICRNL = 36 + IUCLC = 37 + IXON = 38 + IXANY = 39 + IXOFF = 40 + IMAXBEL = 41 + ISIG = 50 + ICANON = 51 + XCASE = 52 + ECHO = 53 + ECHOE = 54 + ECHOK = 55 + ECHONL = 56 + NOFLSH = 57 + TOSTOP = 58 + IEXTEN = 59 + ECHOCTL = 60 + ECHOKE = 61 + PENDIN = 62 + OPOST = 70 + OLCUC = 71 + ONLCR = 72 + OCRNL = 73 + ONOCR = 74 + ONLRET = 75 + CS7 = 90 + CS8 = 91 + PARENB = 92 + PARODD = 93 + TTY_OP_ISPEED = 128 + TTY_OP_OSPEED = 129 +) + +// A Session represents a connection to a remote command or shell. +type Session struct { + // Stdin specifies the remote process's standard input. + // If Stdin is nil, the remote process reads from an empty + // bytes.Buffer. + Stdin io.Reader + + // Stdout and Stderr specify the remote process's standard + // output and error. + // + // If either is nil, Run connects the corresponding file + // descriptor to an instance of ioutil.Discard. There is a + // fixed amount of buffering that is shared for the two streams. + // If either blocks it may eventually cause the remote + // command to block. + Stdout io.Writer + Stderr io.Writer + + ch Channel // the channel backing this session + started bool // true once Start, Run or Shell is invoked. + copyFuncs []func() error + errors chan error // one send per copyFunc + + // true if pipe method is active + stdinpipe, stdoutpipe, stderrpipe bool + + // stdinPipeWriter is non-nil if StdinPipe has not been called + // and Stdin was specified by the user; it is the write end of + // a pipe connecting Session.Stdin to the stdin channel. + stdinPipeWriter io.WriteCloser + + exitStatus chan error +} + +// SendRequest sends an out-of-band channel request on the SSH channel +// underlying the session. +func (s *Session) SendRequest(name string, wantReply bool, payload []byte) (bool, error) { + return s.ch.SendRequest(name, wantReply, payload) +} + +func (s *Session) Close() error { + return s.ch.Close() +} + +// RFC 4254 Section 6.4. +type setenvRequest struct { + Name string + Value string +} + +// Setenv sets an environment variable that will be applied to any +// command executed by Shell or Run. +func (s *Session) Setenv(name, value string) error { + msg := setenvRequest{ + Name: name, + Value: value, + } + ok, err := s.ch.SendRequest("env", true, Marshal(&msg)) + if err == nil && !ok { + err = errors.New("ssh: setenv failed") + } + return err +} + +// RFC 4254 Section 6.2. +type ptyRequestMsg struct { + Term string + Columns uint32 + Rows uint32 + Width uint32 + Height uint32 + Modelist string +} + +// RequestPty requests the association of a pty with the session on the remote host. +func (s *Session) RequestPty(term string, h, w int, termmodes TerminalModes) error { + var tm []byte + for k, v := range termmodes { + kv := struct { + Key byte + Val uint32 + }{k, v} + + tm = append(tm, Marshal(&kv)...) + } + tm = append(tm, tty_OP_END) + req := ptyRequestMsg{ + Term: term, + Columns: uint32(w), + Rows: uint32(h), + Width: uint32(w * 8), + Height: uint32(h * 8), + Modelist: string(tm), + } + ok, err := s.ch.SendRequest("pty-req", true, Marshal(&req)) + if err == nil && !ok { + err = errors.New("ssh: pty-req failed") + } + return err +} + +// RFC 4254 Section 6.5. +type subsystemRequestMsg struct { + Subsystem string +} + +// RequestSubsystem requests the association of a subsystem with the session on the remote host. +// A subsystem is a predefined command that runs in the background when the ssh session is initiated +func (s *Session) RequestSubsystem(subsystem string) error { + msg := subsystemRequestMsg{ + Subsystem: subsystem, + } + ok, err := s.ch.SendRequest("subsystem", true, Marshal(&msg)) + if err == nil && !ok { + err = errors.New("ssh: subsystem request failed") + } + return err +} + +// RFC 4254 Section 6.7. +type ptyWindowChangeMsg struct { + Columns uint32 + Rows uint32 + Width uint32 + Height uint32 +} + +// WindowChange informs the remote host about a terminal window dimension change to h rows and w columns. +func (s *Session) WindowChange(h, w int) error { + req := ptyWindowChangeMsg{ + Columns: uint32(w), + Rows: uint32(h), + Width: uint32(w * 8), + Height: uint32(h * 8), + } + _, err := s.ch.SendRequest("window-change", false, Marshal(&req)) + return err +} + +// RFC 4254 Section 6.9. +type signalMsg struct { + Signal string +} + +// Signal sends the given signal to the remote process. +// sig is one of the SIG* constants. +func (s *Session) Signal(sig Signal) error { + msg := signalMsg{ + Signal: string(sig), + } + + _, err := s.ch.SendRequest("signal", false, Marshal(&msg)) + return err +} + +// RFC 4254 Section 6.5. +type execMsg struct { + Command string +} + +// Start runs cmd on the remote host. Typically, the remote +// server passes cmd to the shell for interpretation. +// A Session only accepts one call to Run, Start or Shell. +func (s *Session) Start(cmd string) error { + if s.started { + return errors.New("ssh: session already started") + } + req := execMsg{ + Command: cmd, + } + + ok, err := s.ch.SendRequest("exec", true, Marshal(&req)) + if err == nil && !ok { + err = fmt.Errorf("ssh: command %v failed", cmd) + } + if err != nil { + return err + } + return s.start() +} + +// Run runs cmd on the remote host. Typically, the remote +// server passes cmd to the shell for interpretation. +// A Session only accepts one call to Run, Start, Shell, Output, +// or CombinedOutput. +// +// The returned error is nil if the command runs, has no problems +// copying stdin, stdout, and stderr, and exits with a zero exit +// status. +// +// If the remote server does not send an exit status, an error of type +// *ExitMissingError is returned. If the command completes +// unsuccessfully or is interrupted by a signal, the error is of type +// *ExitError. Other error types may be returned for I/O problems. +func (s *Session) Run(cmd string) error { + err := s.Start(cmd) + if err != nil { + return err + } + return s.Wait() +} + +// Output runs cmd on the remote host and returns its standard output. +func (s *Session) Output(cmd string) ([]byte, error) { + if s.Stdout != nil { + return nil, errors.New("ssh: Stdout already set") + } + var b bytes.Buffer + s.Stdout = &b + err := s.Run(cmd) + return b.Bytes(), err +} + +type singleWriter struct { + b bytes.Buffer + mu sync.Mutex +} + +func (w *singleWriter) Write(p []byte) (int, error) { + w.mu.Lock() + defer w.mu.Unlock() + return w.b.Write(p) +} + +// CombinedOutput runs cmd on the remote host and returns its combined +// standard output and standard error. +func (s *Session) CombinedOutput(cmd string) ([]byte, error) { + if s.Stdout != nil { + return nil, errors.New("ssh: Stdout already set") + } + if s.Stderr != nil { + return nil, errors.New("ssh: Stderr already set") + } + var b singleWriter + s.Stdout = &b + s.Stderr = &b + err := s.Run(cmd) + return b.b.Bytes(), err +} + +// Shell starts a login shell on the remote host. A Session only +// accepts one call to Run, Start, Shell, Output, or CombinedOutput. +func (s *Session) Shell() error { + if s.started { + return errors.New("ssh: session already started") + } + + ok, err := s.ch.SendRequest("shell", true, nil) + if err == nil && !ok { + return errors.New("ssh: could not start shell") + } + if err != nil { + return err + } + return s.start() +} + +func (s *Session) start() error { + s.started = true + + type F func(*Session) + for _, setupFd := range []F{(*Session).stdin, (*Session).stdout, (*Session).stderr} { + setupFd(s) + } + + s.errors = make(chan error, len(s.copyFuncs)) + for _, fn := range s.copyFuncs { + go func(fn func() error) { + s.errors <- fn() + }(fn) + } + return nil +} + +// Wait waits for the remote command to exit. +// +// The returned error is nil if the command runs, has no problems +// copying stdin, stdout, and stderr, and exits with a zero exit +// status. +// +// If the remote server does not send an exit status, an error of type +// *ExitMissingError is returned. If the command completes +// unsuccessfully or is interrupted by a signal, the error is of type +// *ExitError. Other error types may be returned for I/O problems. +func (s *Session) Wait() error { + if !s.started { + return errors.New("ssh: session not started") + } + waitErr := <-s.exitStatus + + if s.stdinPipeWriter != nil { + s.stdinPipeWriter.Close() + } + var copyError error + for range s.copyFuncs { + if err := <-s.errors; err != nil && copyError == nil { + copyError = err + } + } + if waitErr != nil { + return waitErr + } + return copyError +} + +func (s *Session) wait(reqs <-chan *Request) error { + wm := Waitmsg{status: -1} + // Wait for msg channel to be closed before returning. + for msg := range reqs { + switch msg.Type { + case "exit-status": + wm.status = int(binary.BigEndian.Uint32(msg.Payload)) + case "exit-signal": + var sigval struct { + Signal string + CoreDumped bool + Error string + Lang string + } + if err := Unmarshal(msg.Payload, &sigval); err != nil { + return err + } + + // Must sanitize strings? + wm.signal = sigval.Signal + wm.msg = sigval.Error + wm.lang = sigval.Lang + default: + // This handles keepalives and matches + // OpenSSH's behaviour. + if msg.WantReply { + msg.Reply(false, nil) + } + } + } + if wm.status == 0 { + return nil + } + if wm.status == -1 { + // exit-status was never sent from server + if wm.signal == "" { + // signal was not sent either. RFC 4254 + // section 6.10 recommends against this + // behavior, but it is allowed, so we let + // clients handle it. + return &ExitMissingError{} + } + wm.status = 128 + if _, ok := signals[Signal(wm.signal)]; ok { + wm.status += signals[Signal(wm.signal)] + } + } + + return &ExitError{wm} +} + +// ExitMissingError is returned if a session is torn down cleanly, but +// the server sends no confirmation of the exit status. +type ExitMissingError struct{} + +func (e *ExitMissingError) Error() string { + return "wait: remote command exited without exit status or exit signal" +} + +func (s *Session) stdin() { + if s.stdinpipe { + return + } + var stdin io.Reader + if s.Stdin == nil { + stdin = new(bytes.Buffer) + } else { + r, w := io.Pipe() + go func() { + _, err := io.Copy(w, s.Stdin) + w.CloseWithError(err) + }() + stdin, s.stdinPipeWriter = r, w + } + s.copyFuncs = append(s.copyFuncs, func() error { + _, err := io.Copy(s.ch, stdin) + if err1 := s.ch.CloseWrite(); err == nil && err1 != io.EOF { + err = err1 + } + return err + }) +} + +func (s *Session) stdout() { + if s.stdoutpipe { + return + } + if s.Stdout == nil { + s.Stdout = ioutil.Discard + } + s.copyFuncs = append(s.copyFuncs, func() error { + _, err := io.Copy(s.Stdout, s.ch) + return err + }) +} + +func (s *Session) stderr() { + if s.stderrpipe { + return + } + if s.Stderr == nil { + s.Stderr = ioutil.Discard + } + s.copyFuncs = append(s.copyFuncs, func() error { + _, err := io.Copy(s.Stderr, s.ch.Stderr()) + return err + }) +} + +// sessionStdin reroutes Close to CloseWrite. +type sessionStdin struct { + io.Writer + ch Channel +} + +func (s *sessionStdin) Close() error { + return s.ch.CloseWrite() +} + +// StdinPipe returns a pipe that will be connected to the +// remote command's standard input when the command starts. +func (s *Session) StdinPipe() (io.WriteCloser, error) { + if s.Stdin != nil { + return nil, errors.New("ssh: Stdin already set") + } + if s.started { + return nil, errors.New("ssh: StdinPipe after process started") + } + s.stdinpipe = true + return &sessionStdin{s.ch, s.ch}, nil +} + +// StdoutPipe returns a pipe that will be connected to the +// remote command's standard output when the command starts. +// There is a fixed amount of buffering that is shared between +// stdout and stderr streams. If the StdoutPipe reader is +// not serviced fast enough it may eventually cause the +// remote command to block. +func (s *Session) StdoutPipe() (io.Reader, error) { + if s.Stdout != nil { + return nil, errors.New("ssh: Stdout already set") + } + if s.started { + return nil, errors.New("ssh: StdoutPipe after process started") + } + s.stdoutpipe = true + return s.ch, nil +} + +// StderrPipe returns a pipe that will be connected to the +// remote command's standard error when the command starts. +// There is a fixed amount of buffering that is shared between +// stdout and stderr streams. If the StderrPipe reader is +// not serviced fast enough it may eventually cause the +// remote command to block. +func (s *Session) StderrPipe() (io.Reader, error) { + if s.Stderr != nil { + return nil, errors.New("ssh: Stderr already set") + } + if s.started { + return nil, errors.New("ssh: StderrPipe after process started") + } + s.stderrpipe = true + return s.ch.Stderr(), nil +} + +// newSession returns a new interactive session on the remote host. +func newSession(ch Channel, reqs <-chan *Request) (*Session, error) { + s := &Session{ + ch: ch, + } + s.exitStatus = make(chan error, 1) + go func() { + s.exitStatus <- s.wait(reqs) + }() + + return s, nil +} + +// An ExitError reports unsuccessful completion of a remote command. +type ExitError struct { + Waitmsg +} + +func (e *ExitError) Error() string { + return e.Waitmsg.String() +} + +// Waitmsg stores the information about an exited remote command +// as reported by Wait. +type Waitmsg struct { + status int + signal string + msg string + lang string +} + +// ExitStatus returns the exit status of the remote command. +func (w Waitmsg) ExitStatus() int { + return w.status +} + +// Signal returns the exit signal of the remote command if +// it was terminated violently. +func (w Waitmsg) Signal() string { + return w.signal +} + +// Msg returns the exit message given by the remote command +func (w Waitmsg) Msg() string { + return w.msg +} + +// Lang returns the language tag. See RFC 3066 +func (w Waitmsg) Lang() string { + return w.lang +} + +func (w Waitmsg) String() string { + str := fmt.Sprintf("Process exited with status %v", w.status) + if w.signal != "" { + str += fmt.Sprintf(" from signal %v", w.signal) + } + if w.msg != "" { + str += fmt.Sprintf(". Reason was: %v", w.msg) + } + return str +} diff --git a/vendor/golang.org/x/crypto/ssh/streamlocal.go b/vendor/golang.org/x/crypto/ssh/streamlocal.go new file mode 100644 index 0000000..b171b33 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/streamlocal.go @@ -0,0 +1,116 @@ +package ssh + +import ( + "errors" + "io" + "net" +) + +// streamLocalChannelOpenDirectMsg is a struct used for SSH_MSG_CHANNEL_OPEN message +// with "direct-streamlocal@openssh.com" string. +// +// See openssh-portable/PROTOCOL, section 2.4. connection: Unix domain socket forwarding +// https://github.com/openssh/openssh-portable/blob/master/PROTOCOL#L235 +type streamLocalChannelOpenDirectMsg struct { + socketPath string + reserved0 string + reserved1 uint32 +} + +// forwardedStreamLocalPayload is a struct used for SSH_MSG_CHANNEL_OPEN message +// with "forwarded-streamlocal@openssh.com" string. +type forwardedStreamLocalPayload struct { + SocketPath string + Reserved0 string +} + +// streamLocalChannelForwardMsg is a struct used for SSH2_MSG_GLOBAL_REQUEST message +// with "streamlocal-forward@openssh.com"/"cancel-streamlocal-forward@openssh.com" string. +type streamLocalChannelForwardMsg struct { + socketPath string +} + +// ListenUnix is similar to ListenTCP but uses a Unix domain socket. +func (c *Client) ListenUnix(socketPath string) (net.Listener, error) { + c.handleForwardsOnce.Do(c.handleForwards) + m := streamLocalChannelForwardMsg{ + socketPath, + } + // send message + ok, _, err := c.SendRequest("streamlocal-forward@openssh.com", true, Marshal(&m)) + if err != nil { + return nil, err + } + if !ok { + return nil, errors.New("ssh: streamlocal-forward@openssh.com request denied by peer") + } + ch := c.forwards.add(&net.UnixAddr{Name: socketPath, Net: "unix"}) + + return &unixListener{socketPath, c, ch}, nil +} + +func (c *Client) dialStreamLocal(socketPath string) (Channel, error) { + msg := streamLocalChannelOpenDirectMsg{ + socketPath: socketPath, + } + ch, in, err := c.OpenChannel("direct-streamlocal@openssh.com", Marshal(&msg)) + if err != nil { + return nil, err + } + go DiscardRequests(in) + return ch, err +} + +type unixListener struct { + socketPath string + + conn *Client + in <-chan forward +} + +// Accept waits for and returns the next connection to the listener. +func (l *unixListener) Accept() (net.Conn, error) { + s, ok := <-l.in + if !ok { + return nil, io.EOF + } + ch, incoming, err := s.newCh.Accept() + if err != nil { + return nil, err + } + go DiscardRequests(incoming) + + return &chanConn{ + Channel: ch, + laddr: &net.UnixAddr{ + Name: l.socketPath, + Net: "unix", + }, + raddr: &net.UnixAddr{ + Name: "@", + Net: "unix", + }, + }, nil +} + +// Close closes the listener. +func (l *unixListener) Close() error { + // this also closes the listener. + l.conn.forwards.remove(&net.UnixAddr{Name: l.socketPath, Net: "unix"}) + m := streamLocalChannelForwardMsg{ + l.socketPath, + } + ok, _, err := l.conn.SendRequest("cancel-streamlocal-forward@openssh.com", true, Marshal(&m)) + if err == nil && !ok { + err = errors.New("ssh: cancel-streamlocal-forward@openssh.com failed") + } + return err +} + +// Addr returns the listener's network address. +func (l *unixListener) Addr() net.Addr { + return &net.UnixAddr{ + Name: l.socketPath, + Net: "unix", + } +} diff --git a/vendor/golang.org/x/crypto/ssh/tcpip.go b/vendor/golang.org/x/crypto/ssh/tcpip.go new file mode 100644 index 0000000..80d35f5 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/tcpip.go @@ -0,0 +1,474 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "errors" + "fmt" + "io" + "math/rand" + "net" + "strconv" + "strings" + "sync" + "time" +) + +// Listen requests the remote peer open a listening socket on +// addr. Incoming connections will be available by calling Accept on +// the returned net.Listener. The listener must be serviced, or the +// SSH connection may hang. +// N must be "tcp", "tcp4", "tcp6", or "unix". +func (c *Client) Listen(n, addr string) (net.Listener, error) { + switch n { + case "tcp", "tcp4", "tcp6": + laddr, err := net.ResolveTCPAddr(n, addr) + if err != nil { + return nil, err + } + return c.ListenTCP(laddr) + case "unix": + return c.ListenUnix(addr) + default: + return nil, fmt.Errorf("ssh: unsupported protocol: %s", n) + } +} + +// Automatic port allocation is broken with OpenSSH before 6.0. See +// also https://bugzilla.mindrot.org/show_bug.cgi?id=2017. In +// particular, OpenSSH 5.9 sends a channelOpenMsg with port number 0, +// rather than the actual port number. This means you can never open +// two different listeners with auto allocated ports. We work around +// this by trying explicit ports until we succeed. + +const openSSHPrefix = "OpenSSH_" + +var portRandomizer = rand.New(rand.NewSource(time.Now().UnixNano())) + +// isBrokenOpenSSHVersion returns true if the given version string +// specifies a version of OpenSSH that is known to have a bug in port +// forwarding. +func isBrokenOpenSSHVersion(versionStr string) bool { + i := strings.Index(versionStr, openSSHPrefix) + if i < 0 { + return false + } + i += len(openSSHPrefix) + j := i + for ; j < len(versionStr); j++ { + if versionStr[j] < '0' || versionStr[j] > '9' { + break + } + } + version, _ := strconv.Atoi(versionStr[i:j]) + return version < 6 +} + +// autoPortListenWorkaround simulates automatic port allocation by +// trying random ports repeatedly. +func (c *Client) autoPortListenWorkaround(laddr *net.TCPAddr) (net.Listener, error) { + var sshListener net.Listener + var err error + const tries = 10 + for i := 0; i < tries; i++ { + addr := *laddr + addr.Port = 1024 + portRandomizer.Intn(60000) + sshListener, err = c.ListenTCP(&addr) + if err == nil { + laddr.Port = addr.Port + return sshListener, err + } + } + return nil, fmt.Errorf("ssh: listen on random port failed after %d tries: %v", tries, err) +} + +// RFC 4254 7.1 +type channelForwardMsg struct { + addr string + rport uint32 +} + +// handleForwards starts goroutines handling forwarded connections. +// It's called on first use by (*Client).ListenTCP to not launch +// goroutines until needed. +func (c *Client) handleForwards() { + go c.forwards.handleChannels(c.HandleChannelOpen("forwarded-tcpip")) + go c.forwards.handleChannels(c.HandleChannelOpen("forwarded-streamlocal@openssh.com")) +} + +// ListenTCP requests the remote peer open a listening socket +// on laddr. Incoming connections will be available by calling +// Accept on the returned net.Listener. +func (c *Client) ListenTCP(laddr *net.TCPAddr) (net.Listener, error) { + c.handleForwardsOnce.Do(c.handleForwards) + if laddr.Port == 0 && isBrokenOpenSSHVersion(string(c.ServerVersion())) { + return c.autoPortListenWorkaround(laddr) + } + + m := channelForwardMsg{ + laddr.IP.String(), + uint32(laddr.Port), + } + // send message + ok, resp, err := c.SendRequest("tcpip-forward", true, Marshal(&m)) + if err != nil { + return nil, err + } + if !ok { + return nil, errors.New("ssh: tcpip-forward request denied by peer") + } + + // If the original port was 0, then the remote side will + // supply a real port number in the response. + if laddr.Port == 0 { + var p struct { + Port uint32 + } + if err := Unmarshal(resp, &p); err != nil { + return nil, err + } + laddr.Port = int(p.Port) + } + + // Register this forward, using the port number we obtained. + ch := c.forwards.add(laddr) + + return &tcpListener{laddr, c, ch}, nil +} + +// forwardList stores a mapping between remote +// forward requests and the tcpListeners. +type forwardList struct { + sync.Mutex + entries []forwardEntry +} + +// forwardEntry represents an established mapping of a laddr on a +// remote ssh server to a channel connected to a tcpListener. +type forwardEntry struct { + laddr net.Addr + c chan forward +} + +// forward represents an incoming forwarded tcpip connection. The +// arguments to add/remove/lookup should be address as specified in +// the original forward-request. +type forward struct { + newCh NewChannel // the ssh client channel underlying this forward + raddr net.Addr // the raddr of the incoming connection +} + +func (l *forwardList) add(addr net.Addr) chan forward { + l.Lock() + defer l.Unlock() + f := forwardEntry{ + laddr: addr, + c: make(chan forward, 1), + } + l.entries = append(l.entries, f) + return f.c +} + +// See RFC 4254, section 7.2 +type forwardedTCPPayload struct { + Addr string + Port uint32 + OriginAddr string + OriginPort uint32 +} + +// parseTCPAddr parses the originating address from the remote into a *net.TCPAddr. +func parseTCPAddr(addr string, port uint32) (*net.TCPAddr, error) { + if port == 0 || port > 65535 { + return nil, fmt.Errorf("ssh: port number out of range: %d", port) + } + ip := net.ParseIP(string(addr)) + if ip == nil { + return nil, fmt.Errorf("ssh: cannot parse IP address %q", addr) + } + return &net.TCPAddr{IP: ip, Port: int(port)}, nil +} + +func (l *forwardList) handleChannels(in <-chan NewChannel) { + for ch := range in { + var ( + laddr net.Addr + raddr net.Addr + err error + ) + switch channelType := ch.ChannelType(); channelType { + case "forwarded-tcpip": + var payload forwardedTCPPayload + if err = Unmarshal(ch.ExtraData(), &payload); err != nil { + ch.Reject(ConnectionFailed, "could not parse forwarded-tcpip payload: "+err.Error()) + continue + } + + // RFC 4254 section 7.2 specifies that incoming + // addresses should list the address, in string + // format. It is implied that this should be an IP + // address, as it would be impossible to connect to it + // otherwise. + laddr, err = parseTCPAddr(payload.Addr, payload.Port) + if err != nil { + ch.Reject(ConnectionFailed, err.Error()) + continue + } + raddr, err = parseTCPAddr(payload.OriginAddr, payload.OriginPort) + if err != nil { + ch.Reject(ConnectionFailed, err.Error()) + continue + } + + case "forwarded-streamlocal@openssh.com": + var payload forwardedStreamLocalPayload + if err = Unmarshal(ch.ExtraData(), &payload); err != nil { + ch.Reject(ConnectionFailed, "could not parse forwarded-streamlocal@openssh.com payload: "+err.Error()) + continue + } + laddr = &net.UnixAddr{ + Name: payload.SocketPath, + Net: "unix", + } + raddr = &net.UnixAddr{ + Name: "@", + Net: "unix", + } + default: + panic(fmt.Errorf("ssh: unknown channel type %s", channelType)) + } + if ok := l.forward(laddr, raddr, ch); !ok { + // Section 7.2, implementations MUST reject spurious incoming + // connections. + ch.Reject(Prohibited, "no forward for address") + continue + } + + } +} + +// remove removes the forward entry, and the channel feeding its +// listener. +func (l *forwardList) remove(addr net.Addr) { + l.Lock() + defer l.Unlock() + for i, f := range l.entries { + if addr.Network() == f.laddr.Network() && addr.String() == f.laddr.String() { + l.entries = append(l.entries[:i], l.entries[i+1:]...) + close(f.c) + return + } + } +} + +// closeAll closes and clears all forwards. +func (l *forwardList) closeAll() { + l.Lock() + defer l.Unlock() + for _, f := range l.entries { + close(f.c) + } + l.entries = nil +} + +func (l *forwardList) forward(laddr, raddr net.Addr, ch NewChannel) bool { + l.Lock() + defer l.Unlock() + for _, f := range l.entries { + if laddr.Network() == f.laddr.Network() && laddr.String() == f.laddr.String() { + f.c <- forward{newCh: ch, raddr: raddr} + return true + } + } + return false +} + +type tcpListener struct { + laddr *net.TCPAddr + + conn *Client + in <-chan forward +} + +// Accept waits for and returns the next connection to the listener. +func (l *tcpListener) Accept() (net.Conn, error) { + s, ok := <-l.in + if !ok { + return nil, io.EOF + } + ch, incoming, err := s.newCh.Accept() + if err != nil { + return nil, err + } + go DiscardRequests(incoming) + + return &chanConn{ + Channel: ch, + laddr: l.laddr, + raddr: s.raddr, + }, nil +} + +// Close closes the listener. +func (l *tcpListener) Close() error { + m := channelForwardMsg{ + l.laddr.IP.String(), + uint32(l.laddr.Port), + } + + // this also closes the listener. + l.conn.forwards.remove(l.laddr) + ok, _, err := l.conn.SendRequest("cancel-tcpip-forward", true, Marshal(&m)) + if err == nil && !ok { + err = errors.New("ssh: cancel-tcpip-forward failed") + } + return err +} + +// Addr returns the listener's network address. +func (l *tcpListener) Addr() net.Addr { + return l.laddr +} + +// Dial initiates a connection to the addr from the remote host. +// The resulting connection has a zero LocalAddr() and RemoteAddr(). +func (c *Client) Dial(n, addr string) (net.Conn, error) { + var ch Channel + switch n { + case "tcp", "tcp4", "tcp6": + // Parse the address into host and numeric port. + host, portString, err := net.SplitHostPort(addr) + if err != nil { + return nil, err + } + port, err := strconv.ParseUint(portString, 10, 16) + if err != nil { + return nil, err + } + ch, err = c.dial(net.IPv4zero.String(), 0, host, int(port)) + if err != nil { + return nil, err + } + // Use a zero address for local and remote address. + zeroAddr := &net.TCPAddr{ + IP: net.IPv4zero, + Port: 0, + } + return &chanConn{ + Channel: ch, + laddr: zeroAddr, + raddr: zeroAddr, + }, nil + case "unix": + var err error + ch, err = c.dialStreamLocal(addr) + if err != nil { + return nil, err + } + return &chanConn{ + Channel: ch, + laddr: &net.UnixAddr{ + Name: "@", + Net: "unix", + }, + raddr: &net.UnixAddr{ + Name: addr, + Net: "unix", + }, + }, nil + default: + return nil, fmt.Errorf("ssh: unsupported protocol: %s", n) + } +} + +// DialTCP connects to the remote address raddr on the network net, +// which must be "tcp", "tcp4", or "tcp6". If laddr is not nil, it is used +// as the local address for the connection. +func (c *Client) DialTCP(n string, laddr, raddr *net.TCPAddr) (net.Conn, error) { + if laddr == nil { + laddr = &net.TCPAddr{ + IP: net.IPv4zero, + Port: 0, + } + } + ch, err := c.dial(laddr.IP.String(), laddr.Port, raddr.IP.String(), raddr.Port) + if err != nil { + return nil, err + } + return &chanConn{ + Channel: ch, + laddr: laddr, + raddr: raddr, + }, nil +} + +// RFC 4254 7.2 +type channelOpenDirectMsg struct { + raddr string + rport uint32 + laddr string + lport uint32 +} + +func (c *Client) dial(laddr string, lport int, raddr string, rport int) (Channel, error) { + msg := channelOpenDirectMsg{ + raddr: raddr, + rport: uint32(rport), + laddr: laddr, + lport: uint32(lport), + } + ch, in, err := c.OpenChannel("direct-tcpip", Marshal(&msg)) + if err != nil { + return nil, err + } + go DiscardRequests(in) + return ch, err +} + +type tcpChan struct { + Channel // the backing channel +} + +// chanConn fulfills the net.Conn interface without +// the tcpChan having to hold laddr or raddr directly. +type chanConn struct { + Channel + laddr, raddr net.Addr +} + +// LocalAddr returns the local network address. +func (t *chanConn) LocalAddr() net.Addr { + return t.laddr +} + +// RemoteAddr returns the remote network address. +func (t *chanConn) RemoteAddr() net.Addr { + return t.raddr +} + +// SetDeadline sets the read and write deadlines associated +// with the connection. +func (t *chanConn) SetDeadline(deadline time.Time) error { + if err := t.SetReadDeadline(deadline); err != nil { + return err + } + return t.SetWriteDeadline(deadline) +} + +// SetReadDeadline sets the read deadline. +// A zero value for t means Read will not time out. +// After the deadline, the error from Read will implement net.Error +// with Timeout() == true. +func (t *chanConn) SetReadDeadline(deadline time.Time) error { + // for compatibility with previous version, + // the error message contains "tcpChan" + return errors.New("ssh: tcpChan: deadline not supported") +} + +// SetWriteDeadline exists to satisfy the net.Conn interface +// but is not implemented by this type. It always returns an error. +func (t *chanConn) SetWriteDeadline(deadline time.Time) error { + return errors.New("ssh: tcpChan: deadline not supported") +} diff --git a/vendor/golang.org/x/crypto/ssh/transport.go b/vendor/golang.org/x/crypto/ssh/transport.go new file mode 100644 index 0000000..f6fae1d --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/transport.go @@ -0,0 +1,353 @@ +// Copyright 2011 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package ssh + +import ( + "bufio" + "bytes" + "errors" + "io" + "log" +) + +// debugTransport if set, will print packet types as they go over the +// wire. No message decoding is done, to minimize the impact on timing. +const debugTransport = false + +const ( + gcmCipherID = "aes128-gcm@openssh.com" + aes128cbcID = "aes128-cbc" + tripledescbcID = "3des-cbc" +) + +// packetConn represents a transport that implements packet based +// operations. +type packetConn interface { + // Encrypt and send a packet of data to the remote peer. + writePacket(packet []byte) error + + // Read a packet from the connection. The read is blocking, + // i.e. if error is nil, then the returned byte slice is + // always non-empty. + readPacket() ([]byte, error) + + // Close closes the write-side of the connection. + Close() error +} + +// transport is the keyingTransport that implements the SSH packet +// protocol. +type transport struct { + reader connectionState + writer connectionState + + bufReader *bufio.Reader + bufWriter *bufio.Writer + rand io.Reader + isClient bool + io.Closer +} + +// packetCipher represents a combination of SSH encryption/MAC +// protocol. A single instance should be used for one direction only. +type packetCipher interface { + // writePacket encrypts the packet and writes it to w. The + // contents of the packet are generally scrambled. + writePacket(seqnum uint32, w io.Writer, rand io.Reader, packet []byte) error + + // readPacket reads and decrypts a packet of data. The + // returned packet may be overwritten by future calls of + // readPacket. + readPacket(seqnum uint32, r io.Reader) ([]byte, error) +} + +// connectionState represents one side (read or write) of the +// connection. This is necessary because each direction has its own +// keys, and can even have its own algorithms +type connectionState struct { + packetCipher + seqNum uint32 + dir direction + pendingKeyChange chan packetCipher +} + +// prepareKeyChange sets up key material for a keychange. The key changes in +// both directions are triggered by reading and writing a msgNewKey packet +// respectively. +func (t *transport) prepareKeyChange(algs *algorithms, kexResult *kexResult) error { + ciph, err := newPacketCipher(t.reader.dir, algs.r, kexResult) + if err != nil { + return err + } + t.reader.pendingKeyChange <- ciph + + ciph, err = newPacketCipher(t.writer.dir, algs.w, kexResult) + if err != nil { + return err + } + t.writer.pendingKeyChange <- ciph + + return nil +} + +func (t *transport) printPacket(p []byte, write bool) { + if len(p) == 0 { + return + } + who := "server" + if t.isClient { + who = "client" + } + what := "read" + if write { + what = "write" + } + + log.Println(what, who, p[0]) +} + +// Read and decrypt next packet. +func (t *transport) readPacket() (p []byte, err error) { + for { + p, err = t.reader.readPacket(t.bufReader) + if err != nil { + break + } + if len(p) == 0 || (p[0] != msgIgnore && p[0] != msgDebug) { + break + } + } + if debugTransport { + t.printPacket(p, false) + } + + return p, err +} + +func (s *connectionState) readPacket(r *bufio.Reader) ([]byte, error) { + packet, err := s.packetCipher.readPacket(s.seqNum, r) + s.seqNum++ + if err == nil && len(packet) == 0 { + err = errors.New("ssh: zero length packet") + } + + if len(packet) > 0 { + switch packet[0] { + case msgNewKeys: + select { + case cipher := <-s.pendingKeyChange: + s.packetCipher = cipher + default: + return nil, errors.New("ssh: got bogus newkeys message") + } + + case msgDisconnect: + // Transform a disconnect message into an + // error. Since this is lowest level at which + // we interpret message types, doing it here + // ensures that we don't have to handle it + // elsewhere. + var msg disconnectMsg + if err := Unmarshal(packet, &msg); err != nil { + return nil, err + } + return nil, &msg + } + } + + // The packet may point to an internal buffer, so copy the + // packet out here. + fresh := make([]byte, len(packet)) + copy(fresh, packet) + + return fresh, err +} + +func (t *transport) writePacket(packet []byte) error { + if debugTransport { + t.printPacket(packet, true) + } + return t.writer.writePacket(t.bufWriter, t.rand, packet) +} + +func (s *connectionState) writePacket(w *bufio.Writer, rand io.Reader, packet []byte) error { + changeKeys := len(packet) > 0 && packet[0] == msgNewKeys + + err := s.packetCipher.writePacket(s.seqNum, w, rand, packet) + if err != nil { + return err + } + if err = w.Flush(); err != nil { + return err + } + s.seqNum++ + if changeKeys { + select { + case cipher := <-s.pendingKeyChange: + s.packetCipher = cipher + default: + panic("ssh: no key material for msgNewKeys") + } + } + return err +} + +func newTransport(rwc io.ReadWriteCloser, rand io.Reader, isClient bool) *transport { + t := &transport{ + bufReader: bufio.NewReader(rwc), + bufWriter: bufio.NewWriter(rwc), + rand: rand, + reader: connectionState{ + packetCipher: &streamPacketCipher{cipher: noneCipher{}}, + pendingKeyChange: make(chan packetCipher, 1), + }, + writer: connectionState{ + packetCipher: &streamPacketCipher{cipher: noneCipher{}}, + pendingKeyChange: make(chan packetCipher, 1), + }, + Closer: rwc, + } + t.isClient = isClient + + if isClient { + t.reader.dir = serverKeys + t.writer.dir = clientKeys + } else { + t.reader.dir = clientKeys + t.writer.dir = serverKeys + } + + return t +} + +type direction struct { + ivTag []byte + keyTag []byte + macKeyTag []byte +} + +var ( + serverKeys = direction{[]byte{'B'}, []byte{'D'}, []byte{'F'}} + clientKeys = direction{[]byte{'A'}, []byte{'C'}, []byte{'E'}} +) + +// setupKeys sets the cipher and MAC keys from kex.K, kex.H and sessionId, as +// described in RFC 4253, section 6.4. direction should either be serverKeys +// (to setup server->client keys) or clientKeys (for client->server keys). +func newPacketCipher(d direction, algs directionAlgorithms, kex *kexResult) (packetCipher, error) { + cipherMode := cipherModes[algs.Cipher] + macMode := macModes[algs.MAC] + + iv := make([]byte, cipherMode.ivSize) + key := make([]byte, cipherMode.keySize) + macKey := make([]byte, macMode.keySize) + + generateKeyMaterial(iv, d.ivTag, kex) + generateKeyMaterial(key, d.keyTag, kex) + generateKeyMaterial(macKey, d.macKeyTag, kex) + + return cipherModes[algs.Cipher].create(key, iv, macKey, algs) +} + +// generateKeyMaterial fills out with key material generated from tag, K, H +// and sessionId, as specified in RFC 4253, section 7.2. +func generateKeyMaterial(out, tag []byte, r *kexResult) { + var digestsSoFar []byte + + h := r.Hash.New() + for len(out) > 0 { + h.Reset() + h.Write(r.K) + h.Write(r.H) + + if len(digestsSoFar) == 0 { + h.Write(tag) + h.Write(r.SessionID) + } else { + h.Write(digestsSoFar) + } + + digest := h.Sum(nil) + n := copy(out, digest) + out = out[n:] + if len(out) > 0 { + digestsSoFar = append(digestsSoFar, digest...) + } + } +} + +const packageVersion = "SSH-2.0-Go" + +// Sends and receives a version line. The versionLine string should +// be US ASCII, start with "SSH-2.0-", and should not include a +// newline. exchangeVersions returns the other side's version line. +func exchangeVersions(rw io.ReadWriter, versionLine []byte) (them []byte, err error) { + // Contrary to the RFC, we do not ignore lines that don't + // start with "SSH-2.0-" to make the library usable with + // nonconforming servers. + for _, c := range versionLine { + // The spec disallows non US-ASCII chars, and + // specifically forbids null chars. + if c < 32 { + return nil, errors.New("ssh: junk character in version line") + } + } + if _, err = rw.Write(append(versionLine, '\r', '\n')); err != nil { + return + } + + them, err = readVersion(rw) + return them, err +} + +// maxVersionStringBytes is the maximum number of bytes that we'll +// accept as a version string. RFC 4253 section 4.2 limits this at 255 +// chars +const maxVersionStringBytes = 255 + +// Read version string as specified by RFC 4253, section 4.2. +func readVersion(r io.Reader) ([]byte, error) { + versionString := make([]byte, 0, 64) + var ok bool + var buf [1]byte + + for length := 0; length < maxVersionStringBytes; length++ { + _, err := io.ReadFull(r, buf[:]) + if err != nil { + return nil, err + } + // The RFC says that the version should be terminated with \r\n + // but several SSH servers actually only send a \n. + if buf[0] == '\n' { + if !bytes.HasPrefix(versionString, []byte("SSH-")) { + // RFC 4253 says we need to ignore all version string lines + // except the one containing the SSH version (provided that + // all the lines do not exceed 255 bytes in total). + versionString = versionString[:0] + continue + } + ok = true + break + } + + // non ASCII chars are disallowed, but we are lenient, + // since Go doesn't use null-terminated strings. + + // The RFC allows a comment after a space, however, + // all of it (version and comments) goes into the + // session hash. + versionString = append(versionString, buf[0]) + } + + if !ok { + return nil, errors.New("ssh: overflow reading version string") + } + + // There might be a '\r' on the end which we should remove. + if len(versionString) > 0 && versionString[len(versionString)-1] == '\r' { + versionString = versionString[:len(versionString)-1] + } + return versionString, nil +} diff --git a/vendor/golang.org/x/net/AUTHORS b/vendor/golang.org/x/net/AUTHORS new file mode 100644 index 0000000..15167cd --- /dev/null +++ b/vendor/golang.org/x/net/AUTHORS @@ -0,0 +1,3 @@ +# This source code refers to The Go Authors for copyright purposes. +# The master list of authors is in the main Go distribution, +# visible at http://tip.golang.org/AUTHORS. diff --git a/vendor/golang.org/x/net/CONTRIBUTORS b/vendor/golang.org/x/net/CONTRIBUTORS new file mode 100644 index 0000000..1c4577e --- /dev/null +++ b/vendor/golang.org/x/net/CONTRIBUTORS @@ -0,0 +1,3 @@ +# This source code was written by the Go contributors. +# The master list of contributors is in the main Go distribution, +# visible at http://tip.golang.org/CONTRIBUTORS. diff --git a/vendor/golang.org/x/net/LICENSE b/vendor/golang.org/x/net/LICENSE new file mode 100644 index 0000000..6a66aea --- /dev/null +++ b/vendor/golang.org/x/net/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/net/PATENTS b/vendor/golang.org/x/net/PATENTS new file mode 100644 index 0000000..7330990 --- /dev/null +++ b/vendor/golang.org/x/net/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/net/context/context.go b/vendor/golang.org/x/net/context/context.go new file mode 100644 index 0000000..a3c021d --- /dev/null +++ b/vendor/golang.org/x/net/context/context.go @@ -0,0 +1,56 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package context defines the Context type, which carries deadlines, +// cancelation signals, and other request-scoped values across API boundaries +// and between processes. +// As of Go 1.7 this package is available in the standard library under the +// name context. https://golang.org/pkg/context. +// +// Incoming requests to a server should create a Context, and outgoing calls to +// servers should accept a Context. The chain of function calls between must +// propagate the Context, optionally replacing it with a modified copy created +// using WithDeadline, WithTimeout, WithCancel, or WithValue. +// +// Programs that use Contexts should follow these rules to keep interfaces +// consistent across packages and enable static analysis tools to check context +// propagation: +// +// Do not store Contexts inside a struct type; instead, pass a Context +// explicitly to each function that needs it. The Context should be the first +// parameter, typically named ctx: +// +// func DoSomething(ctx context.Context, arg Arg) error { +// // ... use ctx ... +// } +// +// Do not pass a nil Context, even if a function permits it. Pass context.TODO +// if you are unsure about which Context to use. +// +// Use context Values only for request-scoped data that transits processes and +// APIs, not for passing optional parameters to functions. +// +// The same Context may be passed to functions running in different goroutines; +// Contexts are safe for simultaneous use by multiple goroutines. +// +// See http://blog.golang.org/context for example code for a server that uses +// Contexts. +package context // import "golang.org/x/net/context" + +// Background returns a non-nil, empty Context. It is never canceled, has no +// values, and has no deadline. It is typically used by the main function, +// initialization, and tests, and as the top-level Context for incoming +// requests. +func Background() Context { + return background +} + +// TODO returns a non-nil, empty Context. Code should use context.TODO when +// it's unclear which Context to use or it is not yet available (because the +// surrounding function has not yet been extended to accept a Context +// parameter). TODO is recognized by static analysis tools that determine +// whether Contexts are propagated correctly in a program. +func TODO() Context { + return todo +} diff --git a/vendor/golang.org/x/net/context/go17.go b/vendor/golang.org/x/net/context/go17.go new file mode 100644 index 0000000..d20f52b --- /dev/null +++ b/vendor/golang.org/x/net/context/go17.go @@ -0,0 +1,72 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build go1.7 + +package context + +import ( + "context" // standard library's context, as of Go 1.7 + "time" +) + +var ( + todo = context.TODO() + background = context.Background() +) + +// Canceled is the error returned by Context.Err when the context is canceled. +var Canceled = context.Canceled + +// DeadlineExceeded is the error returned by Context.Err when the context's +// deadline passes. +var DeadlineExceeded = context.DeadlineExceeded + +// WithCancel returns a copy of parent with a new Done channel. The returned +// context's Done channel is closed when the returned cancel function is called +// or when the parent context's Done channel is closed, whichever happens first. +// +// Canceling this context releases resources associated with it, so code should +// call cancel as soon as the operations running in this Context complete. +func WithCancel(parent Context) (ctx Context, cancel CancelFunc) { + ctx, f := context.WithCancel(parent) + return ctx, CancelFunc(f) +} + +// WithDeadline returns a copy of the parent context with the deadline adjusted +// to be no later than d. If the parent's deadline is already earlier than d, +// WithDeadline(parent, d) is semantically equivalent to parent. The returned +// context's Done channel is closed when the deadline expires, when the returned +// cancel function is called, or when the parent context's Done channel is +// closed, whichever happens first. +// +// Canceling this context releases resources associated with it, so code should +// call cancel as soon as the operations running in this Context complete. +func WithDeadline(parent Context, deadline time.Time) (Context, CancelFunc) { + ctx, f := context.WithDeadline(parent, deadline) + return ctx, CancelFunc(f) +} + +// WithTimeout returns WithDeadline(parent, time.Now().Add(timeout)). +// +// Canceling this context releases resources associated with it, so code should +// call cancel as soon as the operations running in this Context complete: +// +// func slowOperationWithTimeout(ctx context.Context) (Result, error) { +// ctx, cancel := context.WithTimeout(ctx, 100*time.Millisecond) +// defer cancel() // releases resources if slowOperation completes before timeout elapses +// return slowOperation(ctx) +// } +func WithTimeout(parent Context, timeout time.Duration) (Context, CancelFunc) { + return WithDeadline(parent, time.Now().Add(timeout)) +} + +// WithValue returns a copy of parent in which the value associated with key is +// val. +// +// Use context Values only for request-scoped data that transits processes and +// APIs, not for passing optional parameters to functions. +func WithValue(parent Context, key interface{}, val interface{}) Context { + return context.WithValue(parent, key, val) +} diff --git a/vendor/golang.org/x/net/context/go19.go b/vendor/golang.org/x/net/context/go19.go new file mode 100644 index 0000000..d88bd1d --- /dev/null +++ b/vendor/golang.org/x/net/context/go19.go @@ -0,0 +1,20 @@ +// Copyright 2017 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build go1.9 + +package context + +import "context" // standard library's context, as of Go 1.7 + +// A Context carries a deadline, a cancelation signal, and other values across +// API boundaries. +// +// Context's methods may be called by multiple goroutines simultaneously. +type Context = context.Context + +// A CancelFunc tells an operation to abandon its work. +// A CancelFunc does not wait for the work to stop. +// After the first call, subsequent calls to a CancelFunc do nothing. +type CancelFunc = context.CancelFunc diff --git a/vendor/golang.org/x/net/context/pre_go17.go b/vendor/golang.org/x/net/context/pre_go17.go new file mode 100644 index 0000000..0f35592 --- /dev/null +++ b/vendor/golang.org/x/net/context/pre_go17.go @@ -0,0 +1,300 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build !go1.7 + +package context + +import ( + "errors" + "fmt" + "sync" + "time" +) + +// An emptyCtx is never canceled, has no values, and has no deadline. It is not +// struct{}, since vars of this type must have distinct addresses. +type emptyCtx int + +func (*emptyCtx) Deadline() (deadline time.Time, ok bool) { + return +} + +func (*emptyCtx) Done() <-chan struct{} { + return nil +} + +func (*emptyCtx) Err() error { + return nil +} + +func (*emptyCtx) Value(key interface{}) interface{} { + return nil +} + +func (e *emptyCtx) String() string { + switch e { + case background: + return "context.Background" + case todo: + return "context.TODO" + } + return "unknown empty Context" +} + +var ( + background = new(emptyCtx) + todo = new(emptyCtx) +) + +// Canceled is the error returned by Context.Err when the context is canceled. +var Canceled = errors.New("context canceled") + +// DeadlineExceeded is the error returned by Context.Err when the context's +// deadline passes. +var DeadlineExceeded = errors.New("context deadline exceeded") + +// WithCancel returns a copy of parent with a new Done channel. The returned +// context's Done channel is closed when the returned cancel function is called +// or when the parent context's Done channel is closed, whichever happens first. +// +// Canceling this context releases resources associated with it, so code should +// call cancel as soon as the operations running in this Context complete. +func WithCancel(parent Context) (ctx Context, cancel CancelFunc) { + c := newCancelCtx(parent) + propagateCancel(parent, c) + return c, func() { c.cancel(true, Canceled) } +} + +// newCancelCtx returns an initialized cancelCtx. +func newCancelCtx(parent Context) *cancelCtx { + return &cancelCtx{ + Context: parent, + done: make(chan struct{}), + } +} + +// propagateCancel arranges for child to be canceled when parent is. +func propagateCancel(parent Context, child canceler) { + if parent.Done() == nil { + return // parent is never canceled + } + if p, ok := parentCancelCtx(parent); ok { + p.mu.Lock() + if p.err != nil { + // parent has already been canceled + child.cancel(false, p.err) + } else { + if p.children == nil { + p.children = make(map[canceler]bool) + } + p.children[child] = true + } + p.mu.Unlock() + } else { + go func() { + select { + case <-parent.Done(): + child.cancel(false, parent.Err()) + case <-child.Done(): + } + }() + } +} + +// parentCancelCtx follows a chain of parent references until it finds a +// *cancelCtx. This function understands how each of the concrete types in this +// package represents its parent. +func parentCancelCtx(parent Context) (*cancelCtx, bool) { + for { + switch c := parent.(type) { + case *cancelCtx: + return c, true + case *timerCtx: + return c.cancelCtx, true + case *valueCtx: + parent = c.Context + default: + return nil, false + } + } +} + +// removeChild removes a context from its parent. +func removeChild(parent Context, child canceler) { + p, ok := parentCancelCtx(parent) + if !ok { + return + } + p.mu.Lock() + if p.children != nil { + delete(p.children, child) + } + p.mu.Unlock() +} + +// A canceler is a context type that can be canceled directly. The +// implementations are *cancelCtx and *timerCtx. +type canceler interface { + cancel(removeFromParent bool, err error) + Done() <-chan struct{} +} + +// A cancelCtx can be canceled. When canceled, it also cancels any children +// that implement canceler. +type cancelCtx struct { + Context + + done chan struct{} // closed by the first cancel call. + + mu sync.Mutex + children map[canceler]bool // set to nil by the first cancel call + err error // set to non-nil by the first cancel call +} + +func (c *cancelCtx) Done() <-chan struct{} { + return c.done +} + +func (c *cancelCtx) Err() error { + c.mu.Lock() + defer c.mu.Unlock() + return c.err +} + +func (c *cancelCtx) String() string { + return fmt.Sprintf("%v.WithCancel", c.Context) +} + +// cancel closes c.done, cancels each of c's children, and, if +// removeFromParent is true, removes c from its parent's children. +func (c *cancelCtx) cancel(removeFromParent bool, err error) { + if err == nil { + panic("context: internal error: missing cancel error") + } + c.mu.Lock() + if c.err != nil { + c.mu.Unlock() + return // already canceled + } + c.err = err + close(c.done) + for child := range c.children { + // NOTE: acquiring the child's lock while holding parent's lock. + child.cancel(false, err) + } + c.children = nil + c.mu.Unlock() + + if removeFromParent { + removeChild(c.Context, c) + } +} + +// WithDeadline returns a copy of the parent context with the deadline adjusted +// to be no later than d. If the parent's deadline is already earlier than d, +// WithDeadline(parent, d) is semantically equivalent to parent. The returned +// context's Done channel is closed when the deadline expires, when the returned +// cancel function is called, or when the parent context's Done channel is +// closed, whichever happens first. +// +// Canceling this context releases resources associated with it, so code should +// call cancel as soon as the operations running in this Context complete. +func WithDeadline(parent Context, deadline time.Time) (Context, CancelFunc) { + if cur, ok := parent.Deadline(); ok && cur.Before(deadline) { + // The current deadline is already sooner than the new one. + return WithCancel(parent) + } + c := &timerCtx{ + cancelCtx: newCancelCtx(parent), + deadline: deadline, + } + propagateCancel(parent, c) + d := deadline.Sub(time.Now()) + if d <= 0 { + c.cancel(true, DeadlineExceeded) // deadline has already passed + return c, func() { c.cancel(true, Canceled) } + } + c.mu.Lock() + defer c.mu.Unlock() + if c.err == nil { + c.timer = time.AfterFunc(d, func() { + c.cancel(true, DeadlineExceeded) + }) + } + return c, func() { c.cancel(true, Canceled) } +} + +// A timerCtx carries a timer and a deadline. It embeds a cancelCtx to +// implement Done and Err. It implements cancel by stopping its timer then +// delegating to cancelCtx.cancel. +type timerCtx struct { + *cancelCtx + timer *time.Timer // Under cancelCtx.mu. + + deadline time.Time +} + +func (c *timerCtx) Deadline() (deadline time.Time, ok bool) { + return c.deadline, true +} + +func (c *timerCtx) String() string { + return fmt.Sprintf("%v.WithDeadline(%s [%s])", c.cancelCtx.Context, c.deadline, c.deadline.Sub(time.Now())) +} + +func (c *timerCtx) cancel(removeFromParent bool, err error) { + c.cancelCtx.cancel(false, err) + if removeFromParent { + // Remove this timerCtx from its parent cancelCtx's children. + removeChild(c.cancelCtx.Context, c) + } + c.mu.Lock() + if c.timer != nil { + c.timer.Stop() + c.timer = nil + } + c.mu.Unlock() +} + +// WithTimeout returns WithDeadline(parent, time.Now().Add(timeout)). +// +// Canceling this context releases resources associated with it, so code should +// call cancel as soon as the operations running in this Context complete: +// +// func slowOperationWithTimeout(ctx context.Context) (Result, error) { +// ctx, cancel := context.WithTimeout(ctx, 100*time.Millisecond) +// defer cancel() // releases resources if slowOperation completes before timeout elapses +// return slowOperation(ctx) +// } +func WithTimeout(parent Context, timeout time.Duration) (Context, CancelFunc) { + return WithDeadline(parent, time.Now().Add(timeout)) +} + +// WithValue returns a copy of parent in which the value associated with key is +// val. +// +// Use context Values only for request-scoped data that transits processes and +// APIs, not for passing optional parameters to functions. +func WithValue(parent Context, key interface{}, val interface{}) Context { + return &valueCtx{parent, key, val} +} + +// A valueCtx carries a key-value pair. It implements Value for that key and +// delegates all other calls to the embedded Context. +type valueCtx struct { + Context + key, val interface{} +} + +func (c *valueCtx) String() string { + return fmt.Sprintf("%v.WithValue(%#v, %#v)", c.Context, c.key, c.val) +} + +func (c *valueCtx) Value(key interface{}) interface{} { + if c.key == key { + return c.val + } + return c.Context.Value(key) +} diff --git a/vendor/golang.org/x/net/context/pre_go19.go b/vendor/golang.org/x/net/context/pre_go19.go new file mode 100644 index 0000000..b105f80 --- /dev/null +++ b/vendor/golang.org/x/net/context/pre_go19.go @@ -0,0 +1,109 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build !go1.9 + +package context + +import "time" + +// A Context carries a deadline, a cancelation signal, and other values across +// API boundaries. +// +// Context's methods may be called by multiple goroutines simultaneously. +type Context interface { + // Deadline returns the time when work done on behalf of this context + // should be canceled. Deadline returns ok==false when no deadline is + // set. Successive calls to Deadline return the same results. + Deadline() (deadline time.Time, ok bool) + + // Done returns a channel that's closed when work done on behalf of this + // context should be canceled. Done may return nil if this context can + // never be canceled. Successive calls to Done return the same value. + // + // WithCancel arranges for Done to be closed when cancel is called; + // WithDeadline arranges for Done to be closed when the deadline + // expires; WithTimeout arranges for Done to be closed when the timeout + // elapses. + // + // Done is provided for use in select statements: + // + // // Stream generates values with DoSomething and sends them to out + // // until DoSomething returns an error or ctx.Done is closed. + // func Stream(ctx context.Context, out chan<- Value) error { + // for { + // v, err := DoSomething(ctx) + // if err != nil { + // return err + // } + // select { + // case <-ctx.Done(): + // return ctx.Err() + // case out <- v: + // } + // } + // } + // + // See http://blog.golang.org/pipelines for more examples of how to use + // a Done channel for cancelation. + Done() <-chan struct{} + + // Err returns a non-nil error value after Done is closed. Err returns + // Canceled if the context was canceled or DeadlineExceeded if the + // context's deadline passed. No other values for Err are defined. + // After Done is closed, successive calls to Err return the same value. + Err() error + + // Value returns the value associated with this context for key, or nil + // if no value is associated with key. Successive calls to Value with + // the same key returns the same result. + // + // Use context values only for request-scoped data that transits + // processes and API boundaries, not for passing optional parameters to + // functions. + // + // A key identifies a specific value in a Context. Functions that wish + // to store values in Context typically allocate a key in a global + // variable then use that key as the argument to context.WithValue and + // Context.Value. A key can be any type that supports equality; + // packages should define keys as an unexported type to avoid + // collisions. + // + // Packages that define a Context key should provide type-safe accessors + // for the values stores using that key: + // + // // Package user defines a User type that's stored in Contexts. + // package user + // + // import "golang.org/x/net/context" + // + // // User is the type of value stored in the Contexts. + // type User struct {...} + // + // // key is an unexported type for keys defined in this package. + // // This prevents collisions with keys defined in other packages. + // type key int + // + // // userKey is the key for user.User values in Contexts. It is + // // unexported; clients use user.NewContext and user.FromContext + // // instead of using this key directly. + // var userKey key = 0 + // + // // NewContext returns a new Context that carries value u. + // func NewContext(ctx context.Context, u *User) context.Context { + // return context.WithValue(ctx, userKey, u) + // } + // + // // FromContext returns the User value stored in ctx, if any. + // func FromContext(ctx context.Context) (*User, bool) { + // u, ok := ctx.Value(userKey).(*User) + // return u, ok + // } + Value(key interface{}) interface{} +} + +// A CancelFunc tells an operation to abandon its work. +// A CancelFunc does not wait for the work to stop. +// After the first call, subsequent calls to a CancelFunc do nothing. +type CancelFunc func() diff --git a/vendor/golang.org/x/sys/AUTHORS b/vendor/golang.org/x/sys/AUTHORS new file mode 100644 index 0000000..15167cd --- /dev/null +++ b/vendor/golang.org/x/sys/AUTHORS @@ -0,0 +1,3 @@ +# This source code refers to The Go Authors for copyright purposes. +# The master list of authors is in the main Go distribution, +# visible at http://tip.golang.org/AUTHORS. diff --git a/vendor/golang.org/x/sys/CONTRIBUTORS b/vendor/golang.org/x/sys/CONTRIBUTORS new file mode 100644 index 0000000..1c4577e --- /dev/null +++ b/vendor/golang.org/x/sys/CONTRIBUTORS @@ -0,0 +1,3 @@ +# This source code was written by the Go contributors. +# The master list of contributors is in the main Go distribution, +# visible at http://tip.golang.org/CONTRIBUTORS. diff --git a/vendor/golang.org/x/sys/LICENSE b/vendor/golang.org/x/sys/LICENSE new file mode 100644 index 0000000..6a66aea --- /dev/null +++ b/vendor/golang.org/x/sys/LICENSE @@ -0,0 +1,27 @@ +Copyright (c) 2009 The Go Authors. All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/vendor/golang.org/x/sys/PATENTS b/vendor/golang.org/x/sys/PATENTS new file mode 100644 index 0000000..7330990 --- /dev/null +++ b/vendor/golang.org/x/sys/PATENTS @@ -0,0 +1,22 @@ +Additional IP Rights Grant (Patents) + +"This implementation" means the copyrightable works distributed by +Google as part of the Go project. + +Google hereby grants to You a perpetual, worldwide, non-exclusive, +no-charge, royalty-free, irrevocable (except as stated in this section) +patent license to make, have made, use, offer to sell, sell, import, +transfer and otherwise run, modify and propagate the contents of this +implementation of Go, where such license applies only to those patent +claims, both currently owned or controlled by Google and acquired in +the future, licensable by Google that are necessarily infringed by this +implementation of Go. This grant does not include claims that would be +infringed only as a consequence of further modification of this +implementation. If you or your agent or exclusive licensee institute or +order or agree to the institution of patent litigation against any +entity (including a cross-claim or counterclaim in a lawsuit) alleging +that this implementation of Go or any code incorporated within this +implementation of Go constitutes direct or contributory patent +infringement, or inducement of patent infringement, then any patent +rights granted to you under this License for this implementation of Go +shall terminate as of the date such litigation is filed. diff --git a/vendor/golang.org/x/sys/cpu/byteorder.go b/vendor/golang.org/x/sys/cpu/byteorder.go new file mode 100644 index 0000000..da6b9e4 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/byteorder.go @@ -0,0 +1,30 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package cpu + +import ( + "encoding/binary" + "runtime" +) + +// hostByteOrder returns binary.LittleEndian on little-endian machines and +// binary.BigEndian on big-endian machines. +func hostByteOrder() binary.ByteOrder { + switch runtime.GOARCH { + case "386", "amd64", "amd64p32", + "arm", "arm64", + "mipsle", "mips64le", "mips64p32le", + "ppc64le", + "riscv", "riscv64": + return binary.LittleEndian + case "armbe", "arm64be", + "mips", "mips64", "mips64p32", + "ppc", "ppc64", + "s390", "s390x", + "sparc", "sparc64": + return binary.BigEndian + } + panic("unknown architecture") +} diff --git a/vendor/golang.org/x/sys/cpu/cpu.go b/vendor/golang.org/x/sys/cpu/cpu.go new file mode 100644 index 0000000..679e78c --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu.go @@ -0,0 +1,126 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package cpu implements processor feature detection for +// various CPU architectures. +package cpu + +// Initialized reports whether the CPU features were initialized. +// +// For some GOOS/GOARCH combinations initialization of the CPU features depends +// on reading an operating specific file, e.g. /proc/self/auxv on linux/arm +// Initialized will report false if reading the file fails. +var Initialized bool + +// CacheLinePad is used to pad structs to avoid false sharing. +type CacheLinePad struct{ _ [cacheLineSize]byte } + +// X86 contains the supported CPU features of the +// current X86/AMD64 platform. If the current platform +// is not X86/AMD64 then all feature flags are false. +// +// X86 is padded to avoid false sharing. Further the HasAVX +// and HasAVX2 are only set if the OS supports XMM and YMM +// registers in addition to the CPUID feature bit being set. +var X86 struct { + _ CacheLinePad + HasAES bool // AES hardware implementation (AES NI) + HasADX bool // Multi-precision add-carry instruction extensions + HasAVX bool // Advanced vector extension + HasAVX2 bool // Advanced vector extension 2 + HasBMI1 bool // Bit manipulation instruction set 1 + HasBMI2 bool // Bit manipulation instruction set 2 + HasERMS bool // Enhanced REP for MOVSB and STOSB + HasFMA bool // Fused-multiply-add instructions + HasOSXSAVE bool // OS supports XSAVE/XRESTOR for saving/restoring XMM registers. + HasPCLMULQDQ bool // PCLMULQDQ instruction - most often used for AES-GCM + HasPOPCNT bool // Hamming weight instruction POPCNT. + HasRDRAND bool // RDRAND instruction (on-chip random number generator) + HasRDSEED bool // RDSEED instruction (on-chip random number generator) + HasSSE2 bool // Streaming SIMD extension 2 (always available on amd64) + HasSSE3 bool // Streaming SIMD extension 3 + HasSSSE3 bool // Supplemental streaming SIMD extension 3 + HasSSE41 bool // Streaming SIMD extension 4 and 4.1 + HasSSE42 bool // Streaming SIMD extension 4 and 4.2 + _ CacheLinePad +} + +// ARM64 contains the supported CPU features of the +// current ARMv8(aarch64) platform. If the current platform +// is not arm64 then all feature flags are false. +var ARM64 struct { + _ CacheLinePad + HasFP bool // Floating-point instruction set (always available) + HasASIMD bool // Advanced SIMD (always available) + HasEVTSTRM bool // Event stream support + HasAES bool // AES hardware implementation + HasPMULL bool // Polynomial multiplication instruction set + HasSHA1 bool // SHA1 hardware implementation + HasSHA2 bool // SHA2 hardware implementation + HasCRC32 bool // CRC32 hardware implementation + HasATOMICS bool // Atomic memory operation instruction set + HasFPHP bool // Half precision floating-point instruction set + HasASIMDHP bool // Advanced SIMD half precision instruction set + HasCPUID bool // CPUID identification scheme registers + HasASIMDRDM bool // Rounding double multiply add/subtract instruction set + HasJSCVT bool // Javascript conversion from floating-point to integer + HasFCMA bool // Floating-point multiplication and addition of complex numbers + HasLRCPC bool // Release Consistent processor consistent support + HasDCPOP bool // Persistent memory support + HasSHA3 bool // SHA3 hardware implementation + HasSM3 bool // SM3 hardware implementation + HasSM4 bool // SM4 hardware implementation + HasASIMDDP bool // Advanced SIMD double precision instruction set + HasSHA512 bool // SHA512 hardware implementation + HasSVE bool // Scalable Vector Extensions + HasASIMDFHM bool // Advanced SIMD multiplication FP16 to FP32 + _ CacheLinePad +} + +// PPC64 contains the supported CPU features of the current ppc64/ppc64le platforms. +// If the current platform is not ppc64/ppc64le then all feature flags are false. +// +// For ppc64/ppc64le, it is safe to check only for ISA level starting on ISA v3.00, +// since there are no optional categories. There are some exceptions that also +// require kernel support to work (DARN, SCV), so there are feature bits for +// those as well. The minimum processor requirement is POWER8 (ISA 2.07). +// The struct is padded to avoid false sharing. +var PPC64 struct { + _ CacheLinePad + HasDARN bool // Hardware random number generator (requires kernel enablement) + HasSCV bool // Syscall vectored (requires kernel enablement) + IsPOWER8 bool // ISA v2.07 (POWER8) + IsPOWER9 bool // ISA v3.00 (POWER9) + _ CacheLinePad +} + +// S390X contains the supported CPU features of the current IBM Z +// (s390x) platform. If the current platform is not IBM Z then all +// feature flags are false. +// +// S390X is padded to avoid false sharing. Further HasVX is only set +// if the OS supports vector registers in addition to the STFLE +// feature bit being set. +var S390X struct { + _ CacheLinePad + HasZARCH bool // z/Architecture mode is active [mandatory] + HasSTFLE bool // store facility list extended + HasLDISP bool // long (20-bit) displacements + HasEIMM bool // 32-bit immediates + HasDFP bool // decimal floating point + HasETF3EH bool // ETF-3 enhanced + HasMSA bool // message security assist (CPACF) + HasAES bool // KM-AES{128,192,256} functions + HasAESCBC bool // KMC-AES{128,192,256} functions + HasAESCTR bool // KMCTR-AES{128,192,256} functions + HasAESGCM bool // KMA-GCM-AES{128,192,256} functions + HasGHASH bool // KIMD-GHASH function + HasSHA1 bool // K{I,L}MD-SHA-1 functions + HasSHA256 bool // K{I,L}MD-SHA-256 functions + HasSHA512 bool // K{I,L}MD-SHA-512 functions + HasSHA3 bool // K{I,L}MD-SHA3-{224,256,384,512} and K{I,L}MD-SHAKE-{128,256} functions + HasVX bool // vector facility + HasVXE bool // vector-enhancements facility 1 + _ CacheLinePad +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_arm.go b/vendor/golang.org/x/sys/cpu/cpu_arm.go new file mode 100644 index 0000000..7f2348b --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_arm.go @@ -0,0 +1,9 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package cpu + +const cacheLineSize = 32 + +func doinit() {} diff --git a/vendor/golang.org/x/sys/cpu/cpu_gc_s390x.go b/vendor/golang.org/x/sys/cpu/cpu_gc_s390x.go new file mode 100644 index 0000000..568bcd0 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_gc_s390x.go @@ -0,0 +1,21 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build !gccgo + +package cpu + +// haveAsmFunctions reports whether the other functions in this file can +// be safely called. +func haveAsmFunctions() bool { return true } + +// The following feature detection functions are defined in cpu_s390x.s. +// They are likely to be expensive to call so the results should be cached. +func stfle() facilityList +func kmQuery() queryResult +func kmcQuery() queryResult +func kmctrQuery() queryResult +func kmaQuery() queryResult +func kimdQuery() queryResult +func klmdQuery() queryResult diff --git a/vendor/golang.org/x/sys/cpu/cpu_gc_x86.go b/vendor/golang.org/x/sys/cpu/cpu_gc_x86.go new file mode 100644 index 0000000..f7cb469 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_gc_x86.go @@ -0,0 +1,16 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build 386 amd64 amd64p32 +// +build !gccgo + +package cpu + +// cpuid is implemented in cpu_x86.s for gc compiler +// and in cpu_gccgo.c for gccgo. +func cpuid(eaxArg, ecxArg uint32) (eax, ebx, ecx, edx uint32) + +// xgetbv with ecx = 0 is implemented in cpu_x86.s for gc compiler +// and in cpu_gccgo.c for gccgo. +func xgetbv() (eax, edx uint32) diff --git a/vendor/golang.org/x/sys/cpu/cpu_gccgo.c b/vendor/golang.org/x/sys/cpu/cpu_gccgo.c new file mode 100644 index 0000000..e363c7d --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_gccgo.c @@ -0,0 +1,43 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build 386 amd64 amd64p32 +// +build gccgo + +#include +#include + +// Need to wrap __get_cpuid_count because it's declared as static. +int +gccgoGetCpuidCount(uint32_t leaf, uint32_t subleaf, + uint32_t *eax, uint32_t *ebx, + uint32_t *ecx, uint32_t *edx) +{ + return __get_cpuid_count(leaf, subleaf, eax, ebx, ecx, edx); +} + +// xgetbv reads the contents of an XCR (Extended Control Register) +// specified in the ECX register into registers EDX:EAX. +// Currently, the only supported value for XCR is 0. +// +// TODO: Replace with a better alternative: +// +// #include +// +// #pragma GCC target("xsave") +// +// void gccgoXgetbv(uint32_t *eax, uint32_t *edx) { +// unsigned long long x = _xgetbv(0); +// *eax = x & 0xffffffff; +// *edx = (x >> 32) & 0xffffffff; +// } +// +// Note that _xgetbv is defined starting with GCC 8. +void +gccgoXgetbv(uint32_t *eax, uint32_t *edx) +{ + __asm(" xorl %%ecx, %%ecx\n" + " xgetbv" + : "=a"(*eax), "=d"(*edx)); +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_gccgo.go b/vendor/golang.org/x/sys/cpu/cpu_gccgo.go new file mode 100644 index 0000000..ba49b91 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_gccgo.go @@ -0,0 +1,26 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build 386 amd64 amd64p32 +// +build gccgo + +package cpu + +//extern gccgoGetCpuidCount +func gccgoGetCpuidCount(eaxArg, ecxArg uint32, eax, ebx, ecx, edx *uint32) + +func cpuid(eaxArg, ecxArg uint32) (eax, ebx, ecx, edx uint32) { + var a, b, c, d uint32 + gccgoGetCpuidCount(eaxArg, ecxArg, &a, &b, &c, &d) + return a, b, c, d +} + +//extern gccgoXgetbv +func gccgoXgetbv(eax, edx *uint32) + +func xgetbv() (eax, edx uint32) { + var a, d uint32 + gccgoXgetbv(&a, &d) + return a, d +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_gccgo_s390x.go b/vendor/golang.org/x/sys/cpu/cpu_gccgo_s390x.go new file mode 100644 index 0000000..aa986f7 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_gccgo_s390x.go @@ -0,0 +1,22 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build gccgo + +package cpu + +// haveAsmFunctions reports whether the other functions in this file can +// be safely called. +func haveAsmFunctions() bool { return false } + +// TODO(mundaym): the following feature detection functions are currently +// stubs. See https://golang.org/cl/162887 for how to fix this. +// They are likely to be expensive to call so the results should be cached. +func stfle() facilityList { panic("not implemented for gccgo") } +func kmQuery() queryResult { panic("not implemented for gccgo") } +func kmcQuery() queryResult { panic("not implemented for gccgo") } +func kmctrQuery() queryResult { panic("not implemented for gccgo") } +func kmaQuery() queryResult { panic("not implemented for gccgo") } +func kimdQuery() queryResult { panic("not implemented for gccgo") } +func klmdQuery() queryResult { panic("not implemented for gccgo") } diff --git a/vendor/golang.org/x/sys/cpu/cpu_linux.go b/vendor/golang.org/x/sys/cpu/cpu_linux.go new file mode 100644 index 0000000..76b5f50 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_linux.go @@ -0,0 +1,59 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +//+build !amd64,!amd64p32,!386 + +package cpu + +import ( + "io/ioutil" +) + +const ( + _AT_HWCAP = 16 + _AT_HWCAP2 = 26 + + procAuxv = "/proc/self/auxv" + + uintSize = int(32 << (^uint(0) >> 63)) +) + +// For those platforms don't have a 'cpuid' equivalent we use HWCAP/HWCAP2 +// These are initialized in cpu_$GOARCH.go +// and should not be changed after they are initialized. +var hwCap uint +var hwCap2 uint + +func init() { + buf, err := ioutil.ReadFile(procAuxv) + if err != nil { + // e.g. on android /proc/self/auxv is not accessible, so silently + // ignore the error and leave Initialized = false + return + } + + bo := hostByteOrder() + for len(buf) >= 2*(uintSize/8) { + var tag, val uint + switch uintSize { + case 32: + tag = uint(bo.Uint32(buf[0:])) + val = uint(bo.Uint32(buf[4:])) + buf = buf[8:] + case 64: + tag = uint(bo.Uint64(buf[0:])) + val = uint(bo.Uint64(buf[8:])) + buf = buf[16:] + } + switch tag { + case _AT_HWCAP: + hwCap = val + case _AT_HWCAP2: + hwCap2 = val + } + } + doinit() + + Initialized = true +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_linux_arm64.go b/vendor/golang.org/x/sys/cpu/cpu_linux_arm64.go new file mode 100644 index 0000000..fa7fb1b --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_linux_arm64.go @@ -0,0 +1,67 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package cpu + +const cacheLineSize = 64 + +// HWCAP/HWCAP2 bits. These are exposed by Linux. +const ( + hwcap_FP = 1 << 0 + hwcap_ASIMD = 1 << 1 + hwcap_EVTSTRM = 1 << 2 + hwcap_AES = 1 << 3 + hwcap_PMULL = 1 << 4 + hwcap_SHA1 = 1 << 5 + hwcap_SHA2 = 1 << 6 + hwcap_CRC32 = 1 << 7 + hwcap_ATOMICS = 1 << 8 + hwcap_FPHP = 1 << 9 + hwcap_ASIMDHP = 1 << 10 + hwcap_CPUID = 1 << 11 + hwcap_ASIMDRDM = 1 << 12 + hwcap_JSCVT = 1 << 13 + hwcap_FCMA = 1 << 14 + hwcap_LRCPC = 1 << 15 + hwcap_DCPOP = 1 << 16 + hwcap_SHA3 = 1 << 17 + hwcap_SM3 = 1 << 18 + hwcap_SM4 = 1 << 19 + hwcap_ASIMDDP = 1 << 20 + hwcap_SHA512 = 1 << 21 + hwcap_SVE = 1 << 22 + hwcap_ASIMDFHM = 1 << 23 +) + +func doinit() { + // HWCAP feature bits + ARM64.HasFP = isSet(hwCap, hwcap_FP) + ARM64.HasASIMD = isSet(hwCap, hwcap_ASIMD) + ARM64.HasEVTSTRM = isSet(hwCap, hwcap_EVTSTRM) + ARM64.HasAES = isSet(hwCap, hwcap_AES) + ARM64.HasPMULL = isSet(hwCap, hwcap_PMULL) + ARM64.HasSHA1 = isSet(hwCap, hwcap_SHA1) + ARM64.HasSHA2 = isSet(hwCap, hwcap_SHA2) + ARM64.HasCRC32 = isSet(hwCap, hwcap_CRC32) + ARM64.HasATOMICS = isSet(hwCap, hwcap_ATOMICS) + ARM64.HasFPHP = isSet(hwCap, hwcap_FPHP) + ARM64.HasASIMDHP = isSet(hwCap, hwcap_ASIMDHP) + ARM64.HasCPUID = isSet(hwCap, hwcap_CPUID) + ARM64.HasASIMDRDM = isSet(hwCap, hwcap_ASIMDRDM) + ARM64.HasJSCVT = isSet(hwCap, hwcap_JSCVT) + ARM64.HasFCMA = isSet(hwCap, hwcap_FCMA) + ARM64.HasLRCPC = isSet(hwCap, hwcap_LRCPC) + ARM64.HasDCPOP = isSet(hwCap, hwcap_DCPOP) + ARM64.HasSHA3 = isSet(hwCap, hwcap_SHA3) + ARM64.HasSM3 = isSet(hwCap, hwcap_SM3) + ARM64.HasSM4 = isSet(hwCap, hwcap_SM4) + ARM64.HasASIMDDP = isSet(hwCap, hwcap_ASIMDDP) + ARM64.HasSHA512 = isSet(hwCap, hwcap_SHA512) + ARM64.HasSVE = isSet(hwCap, hwcap_SVE) + ARM64.HasASIMDFHM = isSet(hwCap, hwcap_ASIMDFHM) +} + +func isSet(hwc uint, value uint) bool { + return hwc&value != 0 +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_linux_ppc64x.go b/vendor/golang.org/x/sys/cpu/cpu_linux_ppc64x.go new file mode 100644 index 0000000..6c8d975 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_linux_ppc64x.go @@ -0,0 +1,33 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build linux +// +build ppc64 ppc64le + +package cpu + +const cacheLineSize = 128 + +// HWCAP/HWCAP2 bits. These are exposed by the kernel. +const ( + // ISA Level + _PPC_FEATURE2_ARCH_2_07 = 0x80000000 + _PPC_FEATURE2_ARCH_3_00 = 0x00800000 + + // CPU features + _PPC_FEATURE2_DARN = 0x00200000 + _PPC_FEATURE2_SCV = 0x00100000 +) + +func doinit() { + // HWCAP2 feature bits + PPC64.IsPOWER8 = isSet(hwCap2, _PPC_FEATURE2_ARCH_2_07) + PPC64.IsPOWER9 = isSet(hwCap2, _PPC_FEATURE2_ARCH_3_00) + PPC64.HasDARN = isSet(hwCap2, _PPC_FEATURE2_DARN) + PPC64.HasSCV = isSet(hwCap2, _PPC_FEATURE2_SCV) +} + +func isSet(hwc uint, value uint) bool { + return hwc&value != 0 +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_linux_s390x.go b/vendor/golang.org/x/sys/cpu/cpu_linux_s390x.go new file mode 100644 index 0000000..d579eae --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_linux_s390x.go @@ -0,0 +1,161 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package cpu + +const cacheLineSize = 256 + +const ( + // bit mask values from /usr/include/bits/hwcap.h + hwcap_ZARCH = 2 + hwcap_STFLE = 4 + hwcap_MSA = 8 + hwcap_LDISP = 16 + hwcap_EIMM = 32 + hwcap_DFP = 64 + hwcap_ETF3EH = 256 + hwcap_VX = 2048 + hwcap_VXE = 8192 +) + +// bitIsSet reports whether the bit at index is set. The bit index +// is in big endian order, so bit index 0 is the leftmost bit. +func bitIsSet(bits []uint64, index uint) bool { + return bits[index/64]&((1<<63)>>(index%64)) != 0 +} + +// function is the code for the named cryptographic function. +type function uint8 + +const ( + // KM{,A,C,CTR} function codes + aes128 function = 18 // AES-128 + aes192 function = 19 // AES-192 + aes256 function = 20 // AES-256 + + // K{I,L}MD function codes + sha1 function = 1 // SHA-1 + sha256 function = 2 // SHA-256 + sha512 function = 3 // SHA-512 + sha3_224 function = 32 // SHA3-224 + sha3_256 function = 33 // SHA3-256 + sha3_384 function = 34 // SHA3-384 + sha3_512 function = 35 // SHA3-512 + shake128 function = 36 // SHAKE-128 + shake256 function = 37 // SHAKE-256 + + // KLMD function codes + ghash function = 65 // GHASH +) + +// queryResult contains the result of a Query function +// call. Bits are numbered in big endian order so the +// leftmost bit (the MSB) is at index 0. +type queryResult struct { + bits [2]uint64 +} + +// Has reports whether the given functions are present. +func (q *queryResult) Has(fns ...function) bool { + if len(fns) == 0 { + panic("no function codes provided") + } + for _, f := range fns { + if !bitIsSet(q.bits[:], uint(f)) { + return false + } + } + return true +} + +// facility is a bit index for the named facility. +type facility uint8 + +const ( + // cryptography facilities + msa4 facility = 77 // message-security-assist extension 4 + msa8 facility = 146 // message-security-assist extension 8 +) + +// facilityList contains the result of an STFLE call. +// Bits are numbered in big endian order so the +// leftmost bit (the MSB) is at index 0. +type facilityList struct { + bits [4]uint64 +} + +// Has reports whether the given facilities are present. +func (s *facilityList) Has(fs ...facility) bool { + if len(fs) == 0 { + panic("no facility bits provided") + } + for _, f := range fs { + if !bitIsSet(s.bits[:], uint(f)) { + return false + } + } + return true +} + +func doinit() { + // test HWCAP bit vector + has := func(featureMask uint) bool { + return hwCap&featureMask == featureMask + } + + // mandatory + S390X.HasZARCH = has(hwcap_ZARCH) + + // optional + S390X.HasSTFLE = has(hwcap_STFLE) + S390X.HasLDISP = has(hwcap_LDISP) + S390X.HasEIMM = has(hwcap_EIMM) + S390X.HasETF3EH = has(hwcap_ETF3EH) + S390X.HasDFP = has(hwcap_DFP) + S390X.HasMSA = has(hwcap_MSA) + S390X.HasVX = has(hwcap_VX) + if S390X.HasVX { + S390X.HasVXE = has(hwcap_VXE) + } + + // We need implementations of stfle, km and so on + // to detect cryptographic features. + if !haveAsmFunctions() { + return + } + + // optional cryptographic functions + if S390X.HasMSA { + aes := []function{aes128, aes192, aes256} + + // cipher message + km, kmc := kmQuery(), kmcQuery() + S390X.HasAES = km.Has(aes...) + S390X.HasAESCBC = kmc.Has(aes...) + if S390X.HasSTFLE { + facilities := stfle() + if facilities.Has(msa4) { + kmctr := kmctrQuery() + S390X.HasAESCTR = kmctr.Has(aes...) + } + if facilities.Has(msa8) { + kma := kmaQuery() + S390X.HasAESGCM = kma.Has(aes...) + } + } + + // compute message digest + kimd := kimdQuery() // intermediate (no padding) + klmd := klmdQuery() // last (padding) + S390X.HasSHA1 = kimd.Has(sha1) && klmd.Has(sha1) + S390X.HasSHA256 = kimd.Has(sha256) && klmd.Has(sha256) + S390X.HasSHA512 = kimd.Has(sha512) && klmd.Has(sha512) + S390X.HasGHASH = kimd.Has(ghash) // KLMD-GHASH does not exist + sha3 := []function{ + sha3_224, sha3_256, sha3_384, sha3_512, + shake128, shake256, + } + S390X.HasSHA3 = kimd.Has(sha3...) && klmd.Has(sha3...) + } +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_mips64x.go b/vendor/golang.org/x/sys/cpu/cpu_mips64x.go new file mode 100644 index 0000000..f55e0c8 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_mips64x.go @@ -0,0 +1,11 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build mips64 mips64le + +package cpu + +const cacheLineSize = 32 + +func doinit() {} diff --git a/vendor/golang.org/x/sys/cpu/cpu_mipsx.go b/vendor/golang.org/x/sys/cpu/cpu_mipsx.go new file mode 100644 index 0000000..cda87b1 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_mipsx.go @@ -0,0 +1,11 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build mips mipsle + +package cpu + +const cacheLineSize = 32 + +func doinit() {} diff --git a/vendor/golang.org/x/sys/cpu/cpu_other_arm64.go b/vendor/golang.org/x/sys/cpu/cpu_other_arm64.go new file mode 100644 index 0000000..dd1e76d --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_other_arm64.go @@ -0,0 +1,11 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build !linux,arm64 + +package cpu + +const cacheLineSize = 64 + +func doinit() {} diff --git a/vendor/golang.org/x/sys/cpu/cpu_other_ppc64x.go b/vendor/golang.org/x/sys/cpu/cpu_other_ppc64x.go new file mode 100644 index 0000000..3053b4b --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_other_ppc64x.go @@ -0,0 +1,12 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build !linux +// +build ppc64 ppc64le + +package cpu + +const cacheLineSize = 128 + +func doinit() {} diff --git a/vendor/golang.org/x/sys/cpu/cpu_s390x.s b/vendor/golang.org/x/sys/cpu/cpu_s390x.s new file mode 100644 index 0000000..e5037d9 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_s390x.s @@ -0,0 +1,57 @@ +// Copyright 2019 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build !gccgo + +#include "textflag.h" + +// func stfle() facilityList +TEXT ·stfle(SB), NOSPLIT|NOFRAME, $0-32 + MOVD $ret+0(FP), R1 + MOVD $3, R0 // last doubleword index to store + XC $32, (R1), (R1) // clear 4 doublewords (32 bytes) + WORD $0xb2b01000 // store facility list extended (STFLE) + RET + +// func kmQuery() queryResult +TEXT ·kmQuery(SB), NOSPLIT|NOFRAME, $0-16 + MOVD $0, R0 // set function code to 0 (KM-Query) + MOVD $ret+0(FP), R1 // address of 16-byte return value + WORD $0xB92E0024 // cipher message (KM) + RET + +// func kmcQuery() queryResult +TEXT ·kmcQuery(SB), NOSPLIT|NOFRAME, $0-16 + MOVD $0, R0 // set function code to 0 (KMC-Query) + MOVD $ret+0(FP), R1 // address of 16-byte return value + WORD $0xB92F0024 // cipher message with chaining (KMC) + RET + +// func kmctrQuery() queryResult +TEXT ·kmctrQuery(SB), NOSPLIT|NOFRAME, $0-16 + MOVD $0, R0 // set function code to 0 (KMCTR-Query) + MOVD $ret+0(FP), R1 // address of 16-byte return value + WORD $0xB92D4024 // cipher message with counter (KMCTR) + RET + +// func kmaQuery() queryResult +TEXT ·kmaQuery(SB), NOSPLIT|NOFRAME, $0-16 + MOVD $0, R0 // set function code to 0 (KMA-Query) + MOVD $ret+0(FP), R1 // address of 16-byte return value + WORD $0xb9296024 // cipher message with authentication (KMA) + RET + +// func kimdQuery() queryResult +TEXT ·kimdQuery(SB), NOSPLIT|NOFRAME, $0-16 + MOVD $0, R0 // set function code to 0 (KIMD-Query) + MOVD $ret+0(FP), R1 // address of 16-byte return value + WORD $0xB93E0024 // compute intermediate message digest (KIMD) + RET + +// func klmdQuery() queryResult +TEXT ·klmdQuery(SB), NOSPLIT|NOFRAME, $0-16 + MOVD $0, R0 // set function code to 0 (KLMD-Query) + MOVD $ret+0(FP), R1 // address of 16-byte return value + WORD $0xB93F0024 // compute last message digest (KLMD) + RET diff --git a/vendor/golang.org/x/sys/cpu/cpu_x86.go b/vendor/golang.org/x/sys/cpu/cpu_x86.go new file mode 100644 index 0000000..d70d317 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_x86.go @@ -0,0 +1,59 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build 386 amd64 amd64p32 + +package cpu + +const cacheLineSize = 64 + +func init() { + Initialized = true + + maxID, _, _, _ := cpuid(0, 0) + + if maxID < 1 { + return + } + + _, _, ecx1, edx1 := cpuid(1, 0) + X86.HasSSE2 = isSet(26, edx1) + + X86.HasSSE3 = isSet(0, ecx1) + X86.HasPCLMULQDQ = isSet(1, ecx1) + X86.HasSSSE3 = isSet(9, ecx1) + X86.HasFMA = isSet(12, ecx1) + X86.HasSSE41 = isSet(19, ecx1) + X86.HasSSE42 = isSet(20, ecx1) + X86.HasPOPCNT = isSet(23, ecx1) + X86.HasAES = isSet(25, ecx1) + X86.HasOSXSAVE = isSet(27, ecx1) + X86.HasRDRAND = isSet(30, ecx1) + + osSupportsAVX := false + // For XGETBV, OSXSAVE bit is required and sufficient. + if X86.HasOSXSAVE { + eax, _ := xgetbv() + // Check if XMM and YMM registers have OS support. + osSupportsAVX = isSet(1, eax) && isSet(2, eax) + } + + X86.HasAVX = isSet(28, ecx1) && osSupportsAVX + + if maxID < 7 { + return + } + + _, ebx7, _, _ := cpuid(7, 0) + X86.HasBMI1 = isSet(3, ebx7) + X86.HasAVX2 = isSet(5, ebx7) && osSupportsAVX + X86.HasBMI2 = isSet(8, ebx7) + X86.HasERMS = isSet(9, ebx7) + X86.HasRDSEED = isSet(18, ebx7) + X86.HasADX = isSet(19, ebx7) +} + +func isSet(bitpos uint, value uint32) bool { + return value&(1<